Compare commits
	
		
			263 Commits
		
	
	
		
			0caeb94e64
			...
			v123010261
		
	
	| Author | SHA1 | Date | |
|---|---|---|---|
|  | 40e1d1478b | ||
|  | 2154ff3c33 | ||
| 2245565f95 | |||
| 014858f06b | |||
| 3f1f86a78e | |||
| a549169a7c | |||
| be7cae365a | |||
| cef3b2e593 | |||
| ae927ebc57 | |||
|  | 90532cf501 | ||
|  | ab0678d61e | ||
|  | a1b7d22d26 | ||
|  | 29eae4b1f6 | ||
|  | f5bbc63481 | ||
| ddc72d85b0 | |||
| 68bbf5b2d3 | |||
|  | 95e76a55da | ||
| 2b6659f4ec | |||
|  | e0c118a73e | ||
|  | 4e61b2aed6 | ||
|  | ba2758c0a3 | ||
|  | c718b966a1 | ||
|  | 99438e142f | ||
|  | 4d8076c3cf | ||
|  | db75c5b74a | ||
|  | 966a082147 | ||
|  | cd20a5ec29 | ||
|  | cc4c1c9201 | ||
|  | ff021d572c | ||
|  | 89992967be | ||
|  | 3c68bde62b | ||
|  | c38251f5b3 | ||
|  | a01f6d2322 | ||
|  | 417a33eb25 | ||
|  | 2e7f7f23b3 | ||
|  | e5e182761e | ||
|  | a094d88799 | ||
| e51915d1cd | |||
| 3a654f6ede | |||
| 5227751dca | |||
|  | 27eafe4ff4 | ||
|  | 8c83a9408b | ||
|  | fe2410f719 | ||
|  | a5e86bfb77 | ||
|  | 23be633798 | ||
|  | 813e0707d8 | ||
|  | 9ed9bf07fc | ||
|  | 47265c10d0 | ||
|  | 5cc633246a | ||
|  | 1f40385786 | ||
|  | eb2876324a | ||
|  | 633b817d76 | ||
|  | 2cfaa9b285 | ||
|  | f42ae97326 | ||
|  | 3b0028164b | ||
|  | 7420adeb5c | ||
|  | 316027ca3b | ||
|  | 9d58fba5c9 | ||
|  | 284c19ef89 | ||
|  | 7cfd17231a | ||
|  | 527830a5ae | ||
|  | c4ed30f594 | ||
|  | 156c1681cf | ||
|  | 3593fbca78 | ||
|  | 430fc8e8cb | ||
|  | 4fce19bad4 | ||
|  | 49f5848e7b | ||
|  | 90452100a4 | ||
|  | bf1196dd0f | ||
|  | 4316dc6516 | ||
|  | 9833a66a64 | ||
|  | 797bf06a9c | ||
|  | d98b00533d | ||
|  | bf8f7d8667 | ||
|  | 89c570f34f | ||
|  | d6a562863a | ||
|  | a02f06fe2e | ||
|  | 7b088d7bb4 | ||
|  | 477883ed39 | ||
|  | 748ed41096 | ||
|  | 86c50d4881 | ||
|  | c4c92e6dd9 | ||
|  | 7f0ba193ec | ||
|  | 87ed5b0fa8 | ||
|  | 6947743ac0 | ||
|  | 07e3710d44 | ||
|  | e68da7764f | ||
|  | c3ff894027 | ||
|  | f09f731d30 | ||
|  | 956c4341c7 | ||
|  | 7b68264dd7 | ||
|  | cfcf030bf8 | ||
|  | 0e7d7a5835 | ||
|  | 0856ebb889 | ||
|  | 25bf68cf0c | ||
|  | afc6f392c6 | ||
|  | a0b5e2052b | ||
|  | 87d1ef2bce | ||
|  | 537a6d3a0b | ||
| dbe97f564e | |||
|  | 3a3bf03114 | ||
| c09a32e9ad | |||
| b02a588dff | |||
|  | a4527940b8 | ||
|  | 9e8a25ed3e | ||
|  | 8ea46e146b | ||
|  | 5ecf3c3f87 | ||
|  | 325f103417 | ||
|  | ab4b1ae644 | ||
|  | 87ea44754e | ||
|  | 04dec50808 | ||
|  | e36189e2e7 | ||
|  | d6bdf510a4 | ||
|  | a464e93370 | ||
| 4b63afe62a | |||
| ac4c4b9441 | |||
|  | 16b10dc1b7 | ||
| 02d734eee8 | |||
| c5cdfc0d53 | |||
| 6d610ed61a | |||
| 792950be7c | |||
|  | af8969ce4a | ||
|  | 27c55e59a1 | ||
|  | 94a0747947 | ||
|  | d862bfba4f | ||
|  | b0d1d9c29a | ||
|  | 7b40a31979 | ||
|  | 823a8c3692 | ||
|  | 5494978db8 | ||
|  | 6076eb1cee | ||
|  | 131101d2ee | ||
|  | 62ad1f45ba | ||
|  | 402d18b889 | ||
|  | e32699c93f | ||
|  | 059a237b99 | ||
|  | d2bdbae6c8 | ||
|  | 510fcbe47e | ||
| 667e9c1a5d | |||
| 53b1d1f8b2 | |||
| c25e8889a4 | |||
|  | 8b0bbe71c9 | ||
| 8bfe14c019 | |||
| 208babbce3 | |||
| 02098a7aa9 | |||
| d0a982f385 | |||
| 1d1c121aab | |||
| fe12819163 | |||
|  | 023a30c008 | ||
|  | a2862a2587 | ||
|  | 054e936657 | ||
| 1d2e5069b8 | |||
| a147646743 | |||
| 32e7fc0038 | |||
| c15bf44032 | |||
| 0bcd55bd4e | |||
| ebef0b3511 | |||
| 713ceb05bf | |||
| dc8381b661 | |||
| b5b820c64b | |||
| f7055626d9 | |||
|  | 6ec3e96909 | ||
| 22da30eaa8 | |||
| 79fd115f5e | |||
| 8dc3d319cd | |||
| 27bb056397 | |||
| f9ba13dc32 | |||
| 6f60ef4346 | |||
| 28b950f467 | |||
| a9c7ec3dc1 | |||
| 920d4ac1ef | |||
| 0e96d313ec | |||
| 7211fdb1a3 | |||
|  | 381d6acc82 | ||
| d311c2cdeb | |||
| 219cae5d74 | |||
| 2968aee309 | |||
| 6cb4b35c93 | |||
| 15ec0f2d26 | |||
| 4781e30da2 | |||
| c8759cc035 | |||
| cb4f2f02ef | |||
| 7517626ab7 | |||
| 41c951b659 | |||
|  | ad279c6683 | ||
|  | 5f0817ddb7 | ||
|  | 7124cbcacd | ||
|  | 2a710a1a08 | ||
|  | 82ec2445a1 | ||
|  | cabb6d494d | ||
|  | 5c12481813 | ||
|  | b16f86dda1 | ||
|  | 2bc28db2cc | ||
|  | bf1b680b4a | ||
| e2afff0b8e | |||
| a382fc89ea | |||
| 3f0a3903ae | |||
| f46f98cef0 | |||
| bf6f1a917e | |||
| 71c0a4d340 | |||
| 63c550ead3 | |||
|  | d81fb79b4f | ||
|  | 144067d5b6 | ||
|  | 8106faa45c | ||
|  | d9ef301e0f | ||
|  | 90b52232ab | ||
|  | 0f000ea359 | ||
|  | fb8f81a4c8 | ||
|  | a76b3dd2a9 | ||
|  | 91aed5a777 | ||
| 366b2e10f1 | |||
|  | 8823cc6c6c | ||
| d2436bb976 | |||
|  | 74ef4da15b | ||
|  | bd96c67788 | ||
|  | da71de6806 | ||
|  | 0264da8ccc | ||
|  | 270d959ee0 | ||
|  | 6d11dfb80c | ||
|  | 4184bbb900 | ||
| ef994460c1 | |||
| 758708e18d | |||
| c0381144d1 | |||
| cda3ba6cb4 | |||
| a4636cc0c8 | |||
|  | 4c12c9d570 | ||
|  | f4db02521d | ||
|  | 01763556b1 | ||
| 60c24fc75a | |||
| 5853a19937 | |||
| 99f2c04bf6 | |||
|  | e2411c00d8 | ||
|  | 0473a5f7bc | ||
|  | d0d6a4378c | ||
|  | 1dfa3c9f07 | ||
|  | 815f00e764 | ||
| bdc77ab8ef | |||
| 6bd06cb458 | |||
|  | e9e8bee6c9 | ||
|  | ff6038dbd4 | ||
|  | 8146cff011 | ||
|  | fc4c48dd12 | ||
|  | 94f1ec943c | ||
|  | 0278540fb2 | ||
|  | 109050d0cf | ||
|  | 0392e1b406 | ||
|  | 8b2be5c55c | ||
|  | e6afb4702d | ||
|  | 8cf462a755 | ||
|  | 17293e5574 | ||
|  | a99286a9b7 | ||
|  | 5531034086 | ||
|  | fbcb428e96 | ||
| e281751bb0 | |||
|  | 0eed9a8d07 | ||
|  | 9603860bae | ||
|  | 75b566a38d | ||
|  | fb572dbb27 | ||
|  | 34028949d7 | ||
|  | 44a0469b17 | ||
|  | c87473e8f1 | ||
|  | de43abf019 | ||
|  | e60f3a9d91 | ||
|  | 255fbcb12f | 
							
								
								
									
										131
									
								
								.drone.yml
									
									
									
									
									
								
							
							
						
						
									
										131
									
								
								.drone.yml
									
									
									
									
									
								
							| @@ -1,21 +1,140 @@ | |||||||
| kind: pipeline | kind: pipeline | ||||||
| type: docker | type: docker | ||||||
| name: android | name: test | ||||||
|  |  | ||||||
| steps: | steps: | ||||||
|   - name: code-analysis |   - name: BuildAndTest | ||||||
|     image: mingc/android-build-box:latest |     image: mingc/android-build-box:latest | ||||||
|     failure: ignore |  | ||||||
|     commands: |     commands: | ||||||
|       - ls -la |       - echo "---------------------------------------------------------" | ||||||
|       - ./gradlew sonarqube -Dsonar.projectKey=RFS2 -Dsonar.host.url=$SONAR_HOST_URL -Dsonar.login=$SONAR_LOGIN -PignoreGitVersion=true -P appLoginUrl="\"URL\"" -P appLoginUsername="\"LOGIN\"" -P appLoginPassword="\"PASS\"" |       - echo "Configure gradle..." | ||||||
|  |       - mkdir -p ~/.gradle && echo "org.gradle.daemon=false\nignoreGitVersion=true\npushCache=false\nsystemProp.org.gradle.internal.http.connectionTimeout=180000\nsystemProp.org.gradle.internal.http.socketTimeout=180000" >> ~/.gradle/gradle.properties | ||||||
|  |       - echo "---------------------------------------------------------" | ||||||
|  |       - echo "Building..." | ||||||
|  |       - ./gradlew build -x test | ||||||
|  |       - echo "---------------------------------------------------------" | ||||||
|  |       - echo "Testing..." | ||||||
|  |       - echo "---------------------------------------------------------" | ||||||
|  |       - ./gradlew koverMergedXmlReport | ||||||
|     environment: |     environment: | ||||||
|  |       TZ: Europe/Paris | ||||||
|       SONAR_HOST_URL: |       SONAR_HOST_URL: | ||||||
|         from_secret: sonarScannerHostUrl |         from_secret: sonarScannerHostUrl | ||||||
|       SONAR_LOGIN: |       SONAR_LOGIN: | ||||||
|         from_secret: sonarScannerLogin |         from_secret: sonarScannerLogin | ||||||
|  |   - name: Analyse | ||||||
|  |     image: kytay/sonar-node-plugin | ||||||
|  |     settings: | ||||||
|  |       sonar_host: | ||||||
|  |         from_secret: sonarScannerHostUrl | ||||||
|  |       sonar_token: | ||||||
|  |         from_secret: sonarScannerLogin | ||||||
|  |       use_node_version: 16.18.1 | ||||||
|  |       sonar_debug: true | ||||||
|  |       sonar_project_settings: ./sonar-project.properties | ||||||
|  | trigger: | ||||||
|  |   event: | ||||||
|  |     - push | ||||||
|  |  | ||||||
|  | --- | ||||||
|  | kind: pipeline | ||||||
|  | type: docker | ||||||
|  | name: Publish | ||||||
|  |  | ||||||
|  | steps: | ||||||
|  |   - name: createTagAndChangelog | ||||||
|  |     image: ubuntu:latest | ||||||
|  |     commands: | ||||||
|  |       - apt-get update && apt-get install -y git | ||||||
|  |       - git fetch --tags -p | ||||||
|  |       - VER=$(git describe --tags --abbrev=0) | ||||||
|  |       - CHANGELOG=$(git log $VER..HEAD --pretty="- %s") | ||||||
|  |       - echo "**$VER**\n\n$CHANGELOG\n\n--------------------------------------------------------------------\n\n$(cat CHANGELOG.md)" > CHANGELOG.md | ||||||
|  |       - git add CHANGELOG.md | ||||||
|  |       - git commit -m "Changelog for $VER [CI SKIP]" | ||||||
|  |       - ./build.sh --publish --from-ci | ||||||
|  |       - git remote add pushing https://$GITEA_USR:$GITEA_PASS@gitea.amine-louveau.fr/Louvorg/ReaderForSelfoss-multiplatform.git | ||||||
|  |       - git push pushing master | ||||||
|  |       - git push pushing --tags | ||||||
|  |     environment: | ||||||
|  |       TZ: Europe/Paris | ||||||
|  |       GITEA_USR: | ||||||
|  |         from_secret: giteaUsr | ||||||
|  |       GITEA_PASS: | ||||||
|  |         from_secret: giteaPass | ||||||
|  |  | ||||||
|  |   - name: scpFiles | ||||||
|  |     image: appleboy/drone-scp | ||||||
|  |     settings: | ||||||
|  |       host: amine-louveau.fr | ||||||
|  |       username: ubuntu | ||||||
|  |       key: | ||||||
|  |         from_secret: privateKey | ||||||
|  |       port: 22 | ||||||
|  |       target: /home/ubuntu/ | ||||||
|  |       source: version.txt | ||||||
|  |  | ||||||
|  |   - name: deploy | ||||||
|  |     image: appleboy/drone-ssh | ||||||
|  |     settings: | ||||||
|  |       host: amine-louveau.fr | ||||||
|  |       user: ubuntu | ||||||
|  |       key: | ||||||
|  |         from_secret: privateKey | ||||||
|  |       command_timeout: 2m | ||||||
|  |       script: | ||||||
|  |         - cd /home/ubuntu && sudo rm -rf /var/www/amine/version.txt && sudo chown www-data:www-data ./version.txt && sudo mv version.txt /var/www/amine/ | ||||||
|  |  | ||||||
|  | trigger: | ||||||
|  |   event: | ||||||
|  |     - promote | ||||||
|  |   target: | ||||||
|  |     - production | ||||||
|  |  | ||||||
|  | --- | ||||||
|  | kind: pipeline | ||||||
|  | type: docker | ||||||
|  | name: Release | ||||||
|  |  | ||||||
|  | steps: | ||||||
|   - name: build |   - name: build | ||||||
|     image: mingc/android-build-box:latest |     image: mingc/android-build-box:latest | ||||||
|     commands: |     commands: | ||||||
|       - ./gradlew  :androidApp:build -PignoreGitVersion=true -P appLoginUrl="\"URL\"" -P appLoginUsername="\"LOGIN\"" -P appLoginPassword="\"PASS\"" |       - echo "---------------------------------------------------------" | ||||||
|  |       - echo "Fetch tags..." | ||||||
|  |       - git fetch --tags | ||||||
|  |       - echo "---------------------------------------------------------" | ||||||
|  |       - echo "Configure gradle..." | ||||||
|  |       - mkdir -p ~/.gradle && echo "org.gradle.daemon=false\nignoreGitVersion=false\npushCache=false\nsystemProp.org.gradle.internal.http.connectionTimeout=180000\nsystemProp.org.gradle.internal.http.socketTimeout=180000" >> ~/.gradle/gradle.properties | ||||||
|  |       - echo "---------------------------------------------------------" | ||||||
|  |       - echo "Generate APK" | ||||||
|  |       - ./gradlew :androidApp:assembleGithubConfigRelease  -P pushCache=false | ||||||
|  |       - echo "---------------------------------------------------------" | ||||||
|  |       - echo "Get Key" | ||||||
|  |       - wget https://amine-louveau.fr/key | ||||||
|  |       - echo "---------------------------------------------------------" | ||||||
|  |       - echo "Zipalign" | ||||||
|  |       - $ANDROID_HOME/build-tools/31.0.0/zipalign -f -v 4 androidApp/build/outputs/apk/githubConfig/release/androidApp-githubConfig-release-unsigned.apk androidApp/build/outputs/apk/githubConfig/release/android-prod-released-ziped.apk | ||||||
|  |       - echo "---------------------------------------------------------" | ||||||
|  |       - echo "Sign" | ||||||
|  |       - $ANDROID_HOME/build-tools/31.0.0/apksigner sign -v --out signed.apk --ks ./key --ks-key-alias $YOUR_KEY_ALIAS --ks-pass pass:$YOUR_KEYSTORE_PASSWORD --v1-signing-enabled true --v2-signing-enabled true androidApp/build/outputs/apk/githubConfig/release/android-prod-released-ziped.apk | ||||||
|  |       - echo "---------------------------------------------------------" | ||||||
|  |       - echo "Verify" | ||||||
|  |       - $ANDROID_HOME/build-tools/31.0.0/apksigner verify signed.apk | ||||||
|  |     environment: | ||||||
|  |       TZ: Europe/Paris | ||||||
|  |       YOUR_KEYSTORE_PASSWORD: | ||||||
|  |         from_secret: keyPass | ||||||
|  |       YOUR_KEY_ALIAS: | ||||||
|  |         from_secret: keyAlias | ||||||
|  |  | ||||||
|  |   - name: gitea_release | ||||||
|  |     image: plugins/gitea-release | ||||||
|  |     settings: | ||||||
|  |       api_key: | ||||||
|  |         from_secret: giteaAPI | ||||||
|  |       base_url: https://gitea.amine-louveau.fr | ||||||
|  |       files: signed.apk | ||||||
|  | trigger: | ||||||
|  |   event: | ||||||
|  |     - tag | ||||||
							
								
								
									
										25
									
								
								.github/CONTRIBUTING.md
									
									
									
									
										vendored
									
									
								
							
							
						
						
									
										25
									
								
								.github/CONTRIBUTING.md
									
									
									
									
										vendored
									
									
								
							| @@ -46,28 +46,3 @@ Always check if the web version of your instance is working. | |||||||
| I won't provide any selfoss instance url. If you want to help, but to not have one, you'll have to install one, and use it. | I won't provide any selfoss instance url. If you want to help, but to not have one, you'll have to install one, and use it. | ||||||
|  |  | ||||||
| All the details to need are [here](https://selfoss.aditu.de/). | All the details to need are [here](https://selfoss.aditu.de/). | ||||||
|  |  | ||||||
| # Build the project |  | ||||||
|  |  | ||||||
| You can directly import this project into IntellIJ/Android Studio. |  | ||||||
|  |  | ||||||
| You'll have to: |  | ||||||
|  |  | ||||||
| - Define some parameters either in `~/.gradle/gradle.properties` or as gradle parameters (see the examples) |  | ||||||
|  |  | ||||||
|     - appLoginUrl, appLoginUsername and appLoginPassword: url, username and password of a selfoss instance. **These are only used for tests. They can be empty if you don't test API calls.** |  | ||||||
|  |  | ||||||
| ### Examples: |  | ||||||
| #### Inside ~/.gradle/gradle.properties |  | ||||||
|  |  | ||||||
| ``` |  | ||||||
| appLoginUrl="URL" # It can be empty. |  | ||||||
| appLoginUsername="LOGIN" # It can be empty. |  | ||||||
| appLoginPassword="PASS" # It can be empty. |  | ||||||
| ``` |  | ||||||
|  |  | ||||||
| #### As gradle parameters |  | ||||||
|  |  | ||||||
| ``` |  | ||||||
| ./gradlew .... -P appLoginUrl="URL" -P appLoginUsername="LOGIN" -P appLoginPassword="PASS" |  | ||||||
| ``` |  | ||||||
|   | |||||||
							
								
								
									
										64
									
								
								CHANGELOG.md
									
									
									
									
									
								
							
							
						
						
									
										64
									
								
								CHANGELOG.md
									
									
									
									
									
								
							| @@ -1,3 +1,67 @@ | |||||||
|  | **v123010241** | ||||||
|  |  | ||||||
|  | - Merge pull request 'feat: swipe down to close images' (#122) from davidoskky/ReaderForSelfoss-multiplatform:swipe_down into master | ||||||
|  | - Remove unnecessary definition | ||||||
|  | - Remove unused import | ||||||
|  | - Adjust the image closing animation | ||||||
|  | - Add a dark hue to the underlying article when swiping to close images | ||||||
|  | - Rename activity style to avoid interferences | ||||||
|  | - Adapt the style of the image activity to the rest of the application | ||||||
|  | - Resolve issues when swiping down to close images | ||||||
|  | - Close the image fragment only if the image has been dragged down | ||||||
|  | - Animate swipe down to close images | ||||||
|  | - Swipe down to close images | ||||||
|  |  | ||||||
|  | -------------------------------------------------------------------- | ||||||
|  |  | ||||||
|  | **v123010041** | ||||||
|  |  | ||||||
|  | - Merge pull request 'scroll-tag-filters' (#124) from scroll-tag-filters into master | ||||||
|  | - fix: added POST_NOTIFICATIONS to fix notifications issues. | ||||||
|  | - fix: scrollable filter sheet. | ||||||
|  | - enhancement: Ellipsize chips text. | ||||||
|  | - Cleaning. | ||||||
|  |  | ||||||
|  | -------------------------------------------------------------------- | ||||||
|  |  | ||||||
|  | **v122123641** | ||||||
|  |  | ||||||
|  | - feat: Disable the failing source in the filter sheet. | ||||||
|  | - feat: Display the source error in the sources list. | ||||||
|  |  | ||||||
|  | -------------------------------------------------------------------- | ||||||
|  |  | ||||||
|  | **v122123631** | ||||||
|  |  | ||||||
|  | - build: Added back maven repos (see https://gitlab.com/fdroid/fdroiddata/-/commit/1fb9d60dc58511abc2bb4eb321977922a0682c8b#note_1223925153) | ||||||
|  | - build: Added back maven repos (see https://gitlab.com/fdroid/fdroiddata/-/commit/1fb9d60dc58511abc2bb4eb321977922a0682c8b#note_1223925153) | ||||||
|  | - debug: trying to resolve `Canvas: trying to use a recycled bitmap`. | ||||||
|  | - fix: NPE may be caused by the binding or the title that was null. | ||||||
|  | - chore: Skip drone pipeline on changelog push. | ||||||
|  |  | ||||||
|  | -------------------------------------------------------------------- | ||||||
|  |  | ||||||
|  | **v122123621** | ||||||
|  |  | ||||||
|  | - fix: Automatic CHANGELOG generation. | ||||||
|  | - Merge pull request 'Sources Upsert' (#119) from sources-edit into master | ||||||
|  | - Source update screen. | ||||||
|  | - Sources menu. | ||||||
|  | - chore: Automatic CHANGELOG generation. | ||||||
|  |  | ||||||
|  | -------------------------------------------------------------------- | ||||||
|  |  | ||||||
|  | # V2/Multiplatform rewrite | ||||||
|  |  | ||||||
|  | **v1** | ||||||
|  |  | ||||||
|  | - The app has the same functionalities as before. | ||||||
|  |  | ||||||
|  |  | ||||||
|  | -------------------------------------------------------------------- | ||||||
|  |                                                                        | ||||||
|  | # Old version changes | ||||||
|  |  | ||||||
| **1.7.x** | **1.7.x** | ||||||
|  |  | ||||||
| - Hiding tags with 0 articles | - Hiding tags with 0 articles | ||||||
|   | |||||||
| @@ -1,4 +1,4 @@ | |||||||
| # ReaderForSelfoss-multiplatform | # ReaderForSelfoss-multiplatform [](https://build.amine-louveau.fr/Louvorg/ReaderForSelfoss-multiplatform) | ||||||
|  |  | ||||||
| [](https://crowdin.com/project/readerforselfoss) | [](https://crowdin.com/project/readerforselfoss) | ||||||
|  |  | ||||||
|   | |||||||
| @@ -1,11 +1,14 @@ | |||||||
| import java.io.ByteArrayOutputStream | import java.io.ByteArrayOutputStream | ||||||
|  |  | ||||||
| val ignoreGitVersion: String by project | val ignoreGitVersion: String by project | ||||||
|  | val acraVersion = "5.9.7" | ||||||
|  |  | ||||||
| plugins { | plugins { | ||||||
|     id("com.android.application") |     id("com.android.application") | ||||||
|     kotlin("android") |     kotlin("android") | ||||||
|     kotlin("kapt") |     kotlin("kapt") | ||||||
|  |     id("com.mikepenz.aboutlibraries.plugin") | ||||||
|  |     id("org.jetbrains.kotlinx.kover") version "0.6.1" | ||||||
| } | } | ||||||
|  |  | ||||||
| fun Project.execWithOutput(cmd: String, ignore: Boolean = false): String { | fun Project.execWithOutput(cmd: String, ignore: Boolean = false): String { | ||||||
| @@ -30,7 +33,7 @@ fun gitVersion(): String { | |||||||
|         println("Tag found on current commit") |         println("Tag found on current commit") | ||||||
|         execWithOutput("git -C ../ describe --contains HEAD") |         execWithOutput("git -C ../ describe --contains HEAD") | ||||||
|     } |     } | ||||||
|     return process.replace("'", "").substring(1).replace("\\.", "").trim() |     return process.replace("^0", "").replace("'", "").substring(1).replace("\\.", "").trim() | ||||||
| } | } | ||||||
|  |  | ||||||
| fun versionCodeFromGit(): Int { | fun versionCodeFromGit(): Int { | ||||||
| @@ -54,19 +57,23 @@ fun versionNameFromGit(): String { | |||||||
| android { | android { | ||||||
|     compileOptions { |     compileOptions { | ||||||
|         // Flag to enable support for the new language APIs |         // Flag to enable support for the new language APIs | ||||||
|         isCoreLibraryDesugaringEnabled = true |         sourceCompatibility = JavaVersion.VERSION_11 | ||||||
|         sourceCompatibility = JavaVersion.VERSION_1_8 |         targetCompatibility = JavaVersion.VERSION_11 | ||||||
|         targetCompatibility = JavaVersion.VERSION_1_8 |  | ||||||
|     } |     } | ||||||
|     compileSdk = 31 |  | ||||||
|     buildToolsVersion = "31.0.0" |     // For Kotlin projects | ||||||
|  |     kotlinOptions { | ||||||
|  |         jvmTarget = "11" | ||||||
|  |     } | ||||||
|  |     compileSdk = 33 | ||||||
|  |     buildToolsVersion = "33.0.0" | ||||||
|     buildFeatures { |     buildFeatures { | ||||||
|         viewBinding = true |         viewBinding = true | ||||||
|     } |     } | ||||||
|     defaultConfig { |     defaultConfig { | ||||||
|         applicationId = "bou.amine.apps.readerforselfossv2.android" |         applicationId = "bou.amine.apps.readerforselfossv2.android" | ||||||
|         minSdk = 21 |         minSdk = 21 | ||||||
|         targetSdk = 31 |         targetSdk = 33 | ||||||
|         versionCode = versionCodeFromGit() |         versionCode = versionCodeFromGit() | ||||||
|         versionName = versionNameFromGit() |         versionName = versionNameFromGit() | ||||||
|  |  | ||||||
| @@ -79,6 +86,11 @@ android { | |||||||
|         // tests |         // tests | ||||||
|         testInstrumentationRunner = "androidx.test.runner.AndroidJUnitRunner" |         testInstrumentationRunner = "androidx.test.runner.AndroidJUnitRunner" | ||||||
|     } |     } | ||||||
|  |     packagingOptions { | ||||||
|  |         resources { | ||||||
|  |             excludes += "/META-INF/{AL2.0,LGPL2.1}" | ||||||
|  |         } | ||||||
|  |     } | ||||||
|     buildTypes { |     buildTypes { | ||||||
|         getByName("release") { |         getByName("release") { | ||||||
|             isMinifyEnabled = true |             isMinifyEnabled = true | ||||||
| @@ -86,21 +98,16 @@ android { | |||||||
|             proguardFiles(getDefaultProguardFile("proguard-android.txt"), "proguard-rules.pro") |             proguardFiles(getDefaultProguardFile("proguard-android.txt"), "proguard-rules.pro") | ||||||
|         } |         } | ||||||
|         getByName("debug") { |         getByName("debug") { | ||||||
|             buildConfigField("String", "LOGIN_URL", properties["appLoginUrl"] as String) |  | ||||||
|             buildConfigField("String", "LOGIN_PASSWORD", properties["appLoginPassword"] as String) |  | ||||||
|             buildConfigField("String", "LOGIN_USERNAME", properties["appLoginUsername"] as String) |  | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|     flavorDimensions.add("build") |     flavorDimensions.add("build") | ||||||
|     productFlavors { |     productFlavors { | ||||||
|         create("github") { |         create("githubConfig") { | ||||||
|             versionNameSuffix = "-github" |             versionNameSuffix = "-github" | ||||||
|             dimension = "build" |             dimension = "build" | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|     kotlinOptions { |     namespace = "bou.amine.apps.readerforselfossv2.android" | ||||||
|         jvmTarget = "1.8" |  | ||||||
|     } |  | ||||||
|  |  | ||||||
| } | } | ||||||
|  |  | ||||||
| @@ -108,18 +115,10 @@ dependencies { | |||||||
|     implementation(project(":shared")) |     implementation(project(":shared")) | ||||||
|     implementation("com.google.android.material:material:1.5.0") |     implementation("com.google.android.material:material:1.5.0") | ||||||
|     implementation("androidx.appcompat:appcompat:1.4.1") |     implementation("androidx.appcompat:appcompat:1.4.1") | ||||||
|     implementation("androidx.constraintlayout:constraintlayout:2.1.3") |  | ||||||
|     implementation("org.jetbrains.kotlinx:kotlinx-coroutines-android:1.6.0") |     implementation("org.jetbrains.kotlinx:kotlinx-coroutines-android:1.6.0") | ||||||
|  |  | ||||||
|     implementation("androidx.preference:preference-ktx:1.1.1") |     implementation("androidx.preference:preference-ktx:1.1.1") | ||||||
|  |  | ||||||
|     // Testing |  | ||||||
|     androidTestImplementation("androidx.test.espresso:espresso-core:3.4.0-alpha02") |  | ||||||
|     androidTestImplementation("androidx.test:runner:1.3.1-alpha02") |  | ||||||
|     // Espresso-contrib for DatePicker, RecyclerView, Drawer actions, Accessibility checks, CountingIdlingResource |  | ||||||
|     androidTestImplementation("androidx.test.espresso:espresso-contrib:3.4.0-alpha02") |  | ||||||
|     // Espresso-intents for validation and stubbing of Intents |  | ||||||
|     androidTestImplementation("androidx.test.espresso:espresso-intents:3.4.0-alpha02") |  | ||||||
|     implementation(fileTree(mapOf("include" to listOf("*.jar"), "dir" to "libs"))) |     implementation(fileTree(mapOf("include" to listOf("*.jar"), "dir" to "libs"))) | ||||||
|  |  | ||||||
|     // Android Support |     // Android Support | ||||||
| @@ -128,46 +127,28 @@ dependencies { | |||||||
|     implementation("androidx.recyclerview:recyclerview:1.3.0-alpha01") |     implementation("androidx.recyclerview:recyclerview:1.3.0-alpha01") | ||||||
|     implementation("androidx.legacy:legacy-support-v4:1.0.0") |     implementation("androidx.legacy:legacy-support-v4:1.0.0") | ||||||
|     implementation("androidx.vectordrawable:vectordrawable:1.2.0-alpha02") |     implementation("androidx.vectordrawable:vectordrawable:1.2.0-alpha02") | ||||||
|     implementation("androidx.browser:browser:1.4.0") |  | ||||||
|     implementation("androidx.cardview:cardview:1.0.0") |     implementation("androidx.cardview:cardview:1.0.0") | ||||||
|     implementation("androidx.annotation:annotation:1.3.0") |     implementation("androidx.annotation:annotation:1.3.0") | ||||||
|     implementation("androidx.work:work-runtime-ktx:2.7.1") |     implementation("androidx.work:work-runtime-ktx:2.7.1") | ||||||
|     implementation("androidx.constraintlayout:constraintlayout:2.1.3") |     implementation("androidx.constraintlayout:constraintlayout:2.1.4") | ||||||
|     implementation("org.jsoup:jsoup:1.14.3") |     implementation("org.jsoup:jsoup:1.14.3") | ||||||
|  |  | ||||||
|     coreLibraryDesugaring("com.android.tools:desugar_jdk_libs:1.1.5") |  | ||||||
|  |  | ||||||
|     //multidex |     //multidex | ||||||
|     implementation("androidx.multidex:multidex:2.0.1") |     implementation("androidx.multidex:multidex:2.0.1") | ||||||
|  |  | ||||||
|     // About |     // About | ||||||
|     implementation("com.mikepenz:aboutlibraries-core:8.9.4") |     implementation("com.mikepenz:aboutlibraries-core:10.5.1") | ||||||
|     implementation("com.mikepenz:aboutlibraries:8.9.4") |     implementation("com.mikepenz:aboutlibraries:10.5.1") | ||||||
|     implementation("com.mikepenz:aboutlibraries-definitions:8.9.4") |  | ||||||
|  |  | ||||||
|     // Async |  | ||||||
|     implementation("org.jetbrains.kotlinx:kotlinx-coroutines-android:1.6.0") |  | ||||||
|  |  | ||||||
|     // Retrofit + http logging + okhttp |  | ||||||
|     implementation("com.squareup.retrofit2:retrofit:2.9.0") |  | ||||||
|     implementation("com.squareup.okhttp3:logging-interceptor:5.0.0-alpha.3") |  | ||||||
|     implementation("com.squareup.retrofit2:converter-gson:2.9.0") |  | ||||||
|     implementation("com.burgstaller:okhttp-digest:2.5") |  | ||||||
|  |  | ||||||
|     // Material-ish things |     // Material-ish things | ||||||
|     implementation("com.ashokvarma.android:bottom-navigation-bar:2.2.0") |     implementation("com.ashokvarma.android:bottom-navigation-bar:2.2.0") | ||||||
|     implementation("com.amulyakhare:com.amulyakhare.textdrawable:1.0.1") |     implementation("com.amulyakhare:com.amulyakhare.textdrawable:1.0.1") | ||||||
|  |  | ||||||
|     // glide |     // glide | ||||||
|     kapt("com.github.bumptech.glide:compiler:4.11.0") |     kapt("com.github.bumptech.glide:compiler:4.14.2") | ||||||
|     implementation("com.github.bumptech.glide:okhttp3-integration:4.1.1") |     implementation("com.github.bumptech.glide:okhttp3-integration:4.14.2") | ||||||
|  |  | ||||||
|     // Drawer |  | ||||||
|     implementation("com.mikepenz:materialdrawer:8.4.5") |  | ||||||
|  |  | ||||||
|     // Themes |     // Themes | ||||||
|     implementation("com.52inc:scoops:1.0.0") |  | ||||||
|     implementation("com.jaredrummler:colorpicker:1.1.0") |  | ||||||
|     implementation("com.github.rubensousa:floatingtoolbar:1.5.1") |     implementation("com.github.rubensousa:floatingtoolbar:1.5.1") | ||||||
|  |  | ||||||
|     // Pager |     // Pager | ||||||
| @@ -190,14 +171,44 @@ dependencies { | |||||||
|  |  | ||||||
|     implementation("androidx.core:core-ktx:1.8.0") |     implementation("androidx.core:core-ktx:1.8.0") | ||||||
|  |  | ||||||
|     // implementation("androidx.lifecycle:lifecycle-livedata-ktx:2.5.1") |  | ||||||
|     // implementation("androidx.lifecycle:lifecycle-common-java8:2.5.1") |  | ||||||
|     // implementation("androidx.lifecycle:lifecycle-runtime:2.5.1") |  | ||||||
|     implementation("androidx.lifecycle:lifecycle-extensions:2.2.0") |     implementation("androidx.lifecycle:lifecycle-extensions:2.2.0") | ||||||
|  |  | ||||||
|     // Network information |     // Network information | ||||||
|      implementation("com.github.ln-12:multiplatform-connectivity-status:1.3.0") |      implementation("com.github.ln-12:multiplatform-connectivity-status:1.3.0") | ||||||
|  |  | ||||||
|     // SQLDELIGHT |     // SQLDELIGHT | ||||||
|     implementation("com.squareup.sqldelight:android-driver:1.5.3") |     implementation("com.squareup.sqldelight:android-driver:1.5.4") | ||||||
|  |  | ||||||
|  |     //test | ||||||
|  |     testImplementation("junit:junit:4.13.2") | ||||||
|  |     testImplementation("io.mockk:mockk:1.12.0") | ||||||
|  |     testImplementation("org.jetbrains.kotlinx:kotlinx-coroutines-core:1.6.0") | ||||||
|  |     implementation("org.jetbrains.kotlinx:kotlinx-datetime:0.4.0") | ||||||
|  |  | ||||||
|  |     implementation("ch.acra:acra-http:$acraVersion") | ||||||
|  |     implementation("ch.acra:acra-toast:$acraVersion") | ||||||
|  | } | ||||||
|  |  | ||||||
|  | tasks.withType<Test> { | ||||||
|  |     outputs.upToDateWhen { false } | ||||||
|  |     useJUnit() | ||||||
|  |     testLogging { | ||||||
|  |         exceptionFormat = org.gradle.api.tasks.testing.logging.TestExceptionFormat.FULL | ||||||
|  |         events = setOf( | ||||||
|  |             org.gradle.api.tasks.testing.logging.TestLogEvent.PASSED, | ||||||
|  |             org.gradle.api.tasks.testing.logging.TestLogEvent.FAILED, | ||||||
|  |             org.gradle.api.tasks.testing.logging.TestLogEvent.STANDARD_ERROR | ||||||
|  |         ) | ||||||
|  |         showStandardStreams = true | ||||||
|  |     } | ||||||
|  | } | ||||||
|  |  | ||||||
|  | aboutLibraries { | ||||||
|  |     offlineMode = true | ||||||
|  |     fetchRemoteLicense = false | ||||||
|  |     fetchRemoteFunding = false | ||||||
|  |     includePlatform = false | ||||||
|  |     strictMode = com.mikepenz.aboutlibraries.plugin.StrictMode.FAIL | ||||||
|  |     duplicationMode = com.mikepenz.aboutlibraries.plugin.DuplicateMode.MERGE | ||||||
|  |     duplicationRule = com.mikepenz.aboutlibraries.plugin.DuplicateRule.GROUP | ||||||
| } | } | ||||||
							
								
								
									
										40
									
								
								androidApp/proguard-rules.pro
									
									
									
									
										vendored
									
									
								
							
							
						
						
									
										40
									
								
								androidApp/proguard-rules.pro
									
									
									
									
										vendored
									
									
								
							| @@ -30,15 +30,8 @@ | |||||||
|     <fields>; |     <fields>; | ||||||
| } | } | ||||||
|  |  | ||||||
| -dontwarn okio.** |  | ||||||
| -dontwarn retrofit2.Platform$Java8 |  | ||||||
| -keep class retrofit.** { *; } |  | ||||||
| -keepclasseswithmembers class * { |  | ||||||
|     @retrofit.http.* <methods>; |  | ||||||
| } |  | ||||||
| -keepattributes *Annotation*,Signature | -keepattributes *Annotation*,Signature | ||||||
| -keepattributes Exceptions | -keepattributes Exceptions | ||||||
| -dontwarn okio.** |  | ||||||
| -dontwarn javax.annotation.Nullable | -dontwarn javax.annotation.Nullable | ||||||
| -dontwarn javax.annotation.ParametersAreNonnullByDefault | -dontwarn javax.annotation.ParametersAreNonnullByDefault | ||||||
|  |  | ||||||
| @@ -55,11 +48,40 @@ | |||||||
|   public *; |   public *; | ||||||
| } | } | ||||||
|  |  | ||||||
| -dontwarn com.anupcowkur.reservoir.** |  | ||||||
|  |  | ||||||
| -dontwarn javax.annotation.** | -dontwarn javax.annotation.** | ||||||
|  |  | ||||||
| -keep class android.support.v7.widget.SearchView { *; } | -keep class android.support.v7.widget.SearchView { *; } | ||||||
|  |  | ||||||
| # maybe remove later ? | # maybe remove later ? | ||||||
| -keep class * extends androidx.fragment.app.Fragment | -keep class * extends androidx.fragment.app.Fragment | ||||||
|  |  | ||||||
|  |  | ||||||
|  | # Keep `Companion` object fields of serializable classes. | ||||||
|  | # This avoids serializer lookup through `getDeclaredClasses` as done for named companion objects. | ||||||
|  | -if @kotlinx.serialization.Serializable class ** | ||||||
|  | -keepclassmembers class <1> { | ||||||
|  |    static <1>$Companion Companion; | ||||||
|  | } | ||||||
|  |  | ||||||
|  | # Keep `serializer()` on companion objects (both default and named) of serializable classes. | ||||||
|  | -if @kotlinx.serialization.Serializable class ** { | ||||||
|  |    static **$* *; | ||||||
|  | } | ||||||
|  | -keepclassmembers class <2>$<3> { | ||||||
|  |    kotlinx.serialization.KSerializer serializer(...); | ||||||
|  | } | ||||||
|  |  | ||||||
|  | # Keep `INSTANCE.serializer()` of serializable objects. | ||||||
|  | -if @kotlinx.serialization.Serializable class ** { | ||||||
|  |    public static ** INSTANCE; | ||||||
|  | } | ||||||
|  | -keepclassmembers class <1> { | ||||||
|  |    public static <1> INSTANCE; | ||||||
|  |    kotlinx.serialization.KSerializer serializer(...); | ||||||
|  | } | ||||||
|  |  | ||||||
|  | # @Serializable and @Polymorphic are used at runtime for polymorphic serialization. | ||||||
|  | -keepattributes RuntimeVisibleAnnotations,AnnotationDefault | ||||||
|  |  | ||||||
|  | -dontwarn io.mockk.** | ||||||
|  | -keep class io.mockk.** { *; } | ||||||
|   | |||||||
| @@ -1,11 +0,0 @@ | |||||||
| #!/bin/bash |  | ||||||
|  |  | ||||||
| # NOTE: This is copy/pasted in jenkins |  | ||||||
|  |  | ||||||
| rm -f version.txt |  | ||||||
| printf "versionName=$1-github\nversionCode=$1" >> version.txt |  | ||||||
|  |  | ||||||
| # You'll need to change server as your server and define a VERSION_PATH. |  | ||||||
| scp version.txt server:$VERSION_PATH |  | ||||||
|  |  | ||||||
| rm version.txt |  | ||||||
| @@ -1,3 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android |  | ||||||
|  |  | ||||||
| // TODO: test source adding |  | ||||||
| @@ -1,102 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android |  | ||||||
|  |  | ||||||
| import android.content.Context |  | ||||||
| import android.content.Intent |  | ||||||
| import androidx.test.InstrumentationRegistry |  | ||||||
| import androidx.test.espresso.Espresso.onView |  | ||||||
| import androidx.test.espresso.Espresso.openActionBarOverflowOrOptionsMenu |  | ||||||
| import androidx.test.espresso.action.ViewActions.click |  | ||||||
| import androidx.test.espresso.action.ViewActions.closeSoftKeyboard |  | ||||||
| import androidx.test.espresso.action.ViewActions.pressKey |  | ||||||
| import androidx.test.espresso.action.ViewActions.typeText |  | ||||||
| import androidx.test.espresso.assertion.ViewAssertions.matches |  | ||||||
| import androidx.test.espresso.intent.Intents |  | ||||||
| import androidx.test.espresso.intent.Intents.intended |  | ||||||
| import androidx.test.espresso.intent.matcher.IntentMatchers.hasComponent |  | ||||||
| import androidx.test.espresso.matcher.ViewMatchers.isDisplayed |  | ||||||
| import androidx.test.espresso.matcher.ViewMatchers.withContentDescription |  | ||||||
| import androidx.test.espresso.matcher.ViewMatchers.withId |  | ||||||
| import androidx.test.espresso.matcher.ViewMatchers.withText |  | ||||||
| import androidx.test.rule.ActivityTestRule |  | ||||||
| import androidx.test.runner.AndroidJUnit4 |  | ||||||
| import android.view.KeyEvent |  | ||||||
| import androidx.test.espresso.matcher.RootMatchers.isDialog |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.HomeActivity |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.LoginActivity |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.Config |  | ||||||
| import org.junit.After |  | ||||||
| import org.junit.Before |  | ||||||
| import org.junit.Rule |  | ||||||
| import org.junit.Test |  | ||||||
| import org.junit.runner.RunWith |  | ||||||
|  |  | ||||||
| @RunWith(AndroidJUnit4::class) |  | ||||||
| class HomeActivityEspressoTest { |  | ||||||
|     lateinit var context: Context |  | ||||||
|  |  | ||||||
|     @Rule @JvmField |  | ||||||
|     val rule = ActivityTestRule(HomeActivity::class.java, true, false) |  | ||||||
|  |  | ||||||
|     @Before |  | ||||||
|     fun clearData() { |  | ||||||
|         context = InstrumentationRegistry.getInstrumentation().targetContext |  | ||||||
|  |  | ||||||
|         val editor = |  | ||||||
|                 context |  | ||||||
|                         .getSharedPreferences(Config.settingsName, Context.MODE_PRIVATE) |  | ||||||
|                         .edit() |  | ||||||
|         editor.clear() |  | ||||||
|  |  | ||||||
|         editor.putString("url", BuildConfig.LOGIN_URL) |  | ||||||
|         editor.putString("login", BuildConfig.LOGIN_USERNAME) |  | ||||||
|         editor.putString("password", BuildConfig.LOGIN_PASSWORD) |  | ||||||
|  |  | ||||||
|         editor.commit() |  | ||||||
|  |  | ||||||
|         Intents.init() |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @Test |  | ||||||
|     fun menuItems() { |  | ||||||
|  |  | ||||||
|         rule.launchActivity(Intent()) |  | ||||||
|  |  | ||||||
|         onView( |  | ||||||
|                 withMenu( |  | ||||||
|                         id = R.id.action_search, |  | ||||||
|                         titleId = R.string.menu_home_search |  | ||||||
|                 ) |  | ||||||
|         ).perform(click()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.search_bar)).check(matches(isDisplayed())) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.search_src_text)).perform( |  | ||||||
|                 typeText("android"), |  | ||||||
|                 pressKey(KeyEvent.KEYCODE_SEARCH), |  | ||||||
|                 closeSoftKeyboard() |  | ||||||
|         ) |  | ||||||
|  |  | ||||||
|         onView(withContentDescription(R.string.abc_toolbar_collapse_description)).perform(click()) |  | ||||||
|  |  | ||||||
|         openActionBarOverflowOrOptionsMenu(context) |  | ||||||
|  |  | ||||||
|         onView(withMenu(id = R.id.refresh, titleId = R.string.menu_home_refresh)) |  | ||||||
|                 .perform(click()) |  | ||||||
|  |  | ||||||
|         onView(withText(android.R.string.ok)) |  | ||||||
|             .inRoot(isDialog()).check(matches(isDisplayed())).perform(click()) |  | ||||||
|  |  | ||||||
|         openActionBarOverflowOrOptionsMenu(context) |  | ||||||
|  |  | ||||||
|         onView(withText(R.string.action_disconnect)).perform(click()) |  | ||||||
|  |  | ||||||
|         intended(hasComponent(LoginActivity::class.java.name)) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     // TODO: test articles opening and actions for cards and lists |  | ||||||
|  |  | ||||||
|     @After |  | ||||||
|     fun releaseIntents() { |  | ||||||
|         Intents.release() |  | ||||||
|     } |  | ||||||
| } |  | ||||||
| @@ -1,180 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android |  | ||||||
|  |  | ||||||
| import android.content.Context |  | ||||||
| import android.content.Intent |  | ||||||
| import androidx.test.InstrumentationRegistry |  | ||||||
| import androidx.test.espresso.Espresso.onView |  | ||||||
| import androidx.test.espresso.Espresso.openActionBarOverflowOrOptionsMenu |  | ||||||
| import androidx.test.espresso.action.ViewActions.click |  | ||||||
| import androidx.test.espresso.action.ViewActions.closeSoftKeyboard |  | ||||||
| import androidx.test.espresso.action.ViewActions.pressBack |  | ||||||
| import androidx.test.espresso.action.ViewActions.typeText |  | ||||||
| import androidx.test.espresso.assertion.ViewAssertions.matches |  | ||||||
| import androidx.test.espresso.intent.Intents |  | ||||||
| import androidx.test.espresso.intent.Intents.intended |  | ||||||
| import androidx.test.espresso.intent.Intents.times |  | ||||||
| import androidx.test.espresso.intent.matcher.IntentMatchers.hasComponent |  | ||||||
| import androidx.test.espresso.matcher.ViewMatchers |  | ||||||
| import androidx.test.espresso.matcher.ViewMatchers.isRoot |  | ||||||
| import androidx.test.espresso.matcher.ViewMatchers.withEffectiveVisibility |  | ||||||
| import androidx.test.espresso.matcher.ViewMatchers.withId |  | ||||||
| import androidx.test.espresso.matcher.ViewMatchers.withText |  | ||||||
| import androidx.test.rule.ActivityTestRule |  | ||||||
| import androidx.test.runner.AndroidJUnit4 |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.HomeActivity |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.LoginActivity |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.Config |  | ||||||
| import com.mikepenz.aboutlibraries.ui.LibsActivity |  | ||||||
| import org.junit.After |  | ||||||
| import org.junit.Before |  | ||||||
| import org.junit.Rule |  | ||||||
| import org.junit.Test |  | ||||||
| import org.junit.runner.RunWith |  | ||||||
|  |  | ||||||
| @RunWith(AndroidJUnit4::class) |  | ||||||
| class LoginActivityEspressoTest { |  | ||||||
|  |  | ||||||
|     @Rule @JvmField |  | ||||||
|     val rule = ActivityTestRule(LoginActivity::class.java, true, false) |  | ||||||
|  |  | ||||||
|     private lateinit var context: Context |  | ||||||
|     private lateinit var url: String |  | ||||||
|     private lateinit var username: String |  | ||||||
|     private lateinit var password: String |  | ||||||
|  |  | ||||||
|     @Before |  | ||||||
|     fun setUp() { |  | ||||||
|         context = InstrumentationRegistry.getInstrumentation().targetContext |  | ||||||
|         val editor = |  | ||||||
|                 context |  | ||||||
|                         .getSharedPreferences(Config.settingsName, Context.MODE_PRIVATE) |  | ||||||
|                         .edit() |  | ||||||
|         editor.clear() |  | ||||||
|         editor.commit() |  | ||||||
|  |  | ||||||
|  |  | ||||||
|         url = BuildConfig.LOGIN_URL |  | ||||||
|         username = BuildConfig.LOGIN_USERNAME |  | ||||||
|         password = BuildConfig.LOGIN_PASSWORD |  | ||||||
|  |  | ||||||
|         Intents.init() |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @Test |  | ||||||
|     fun menuItems() { |  | ||||||
|  |  | ||||||
|         rule.launchActivity(Intent()) |  | ||||||
|  |  | ||||||
|         openActionBarOverflowOrOptionsMenu(context) |  | ||||||
|  |  | ||||||
|         onView(withText(R.string.action_about)).perform(click()) |  | ||||||
|  |  | ||||||
|         intended(hasComponent(LibsActivity::class.java.name), times(1)) |  | ||||||
|  |  | ||||||
|         onView(isRoot()).perform(pressBack()) |  | ||||||
|  |  | ||||||
|         intended(hasComponent(LoginActivity::class.java.name)) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @Test |  | ||||||
|     fun wrongLoginUrl() { |  | ||||||
|         rule.launchActivity(Intent()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.loginProgress)) |  | ||||||
|                 .check(matches(withEffectiveVisibility(ViewMatchers.Visibility.GONE))) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.urlView)).perform(click()).perform(typeText("WRONGURL")) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.signInButton)).perform(click()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.urlView)).check(matches(isHintOrErrorEnabled())) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     // TODO: Add tests for multiple false urls with dialog |  | ||||||
|  |  | ||||||
|     @Test |  | ||||||
|     fun emptyAuthData() { |  | ||||||
|  |  | ||||||
|         rule.launchActivity(Intent()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.urlView)).perform(click()).perform(typeText(url), closeSoftKeyboard()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.withLogin)).perform(click()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.signInButton)).perform(click()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.loginView)).check(matches(isHintOrErrorEnabled())) |  | ||||||
|         onView(withId(R.id.passwordView)).check(matches(isHintOrErrorEnabled())) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.loginView)).perform(click()).perform( |  | ||||||
|                 typeText(username), |  | ||||||
|                 closeSoftKeyboard() |  | ||||||
|         ) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.passwordView)).check(matches(isHintOrErrorEnabled())) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.signInButton)).perform(click()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.passwordView)).check( |  | ||||||
|                 matches( |  | ||||||
|                         isHintOrErrorEnabled() |  | ||||||
|                 ) |  | ||||||
|         ) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @Test |  | ||||||
|     fun wrongAuthData() { |  | ||||||
|  |  | ||||||
|         rule.launchActivity(Intent()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.urlView)).perform(click()).perform(typeText(url), closeSoftKeyboard()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.withLogin)).perform(click()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.loginView)).perform(click()).perform( |  | ||||||
|                 typeText(username), |  | ||||||
|                 closeSoftKeyboard() |  | ||||||
|         ) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.passwordView)).perform(click()).perform( |  | ||||||
|                 typeText("WRONGPASS"), |  | ||||||
|                 closeSoftKeyboard() |  | ||||||
|         ) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.signInButton)).perform(click()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.urlView)).check(matches(isHintOrErrorEnabled())) |  | ||||||
|         onView(withId(R.id.loginView)).check(matches(isHintOrErrorEnabled())) |  | ||||||
|         onView(withId(R.id.passwordView)).check(matches(isHintOrErrorEnabled())) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @Test |  | ||||||
|     fun workingAuth() { |  | ||||||
|  |  | ||||||
|         rule.launchActivity(Intent()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.urlView)).perform(click()).perform(typeText(url), closeSoftKeyboard()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.withLogin)).perform(click()) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.loginView)).perform(click()).perform( |  | ||||||
|                 typeText(username), |  | ||||||
|                 closeSoftKeyboard() |  | ||||||
|         ) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.passwordView)).perform(click()).perform( |  | ||||||
|                 typeText(password), |  | ||||||
|                 closeSoftKeyboard() |  | ||||||
|         ) |  | ||||||
|  |  | ||||||
|         onView(withId(R.id.signInButton)).perform(click()) |  | ||||||
|  |  | ||||||
|         Thread.sleep(2000) |  | ||||||
|         intended(hasComponent(HomeActivity::class.java.name)) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @After |  | ||||||
|     fun releaseIntents() { |  | ||||||
|         Intents.release() |  | ||||||
|     } |  | ||||||
| } |  | ||||||
| @@ -1,81 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android |  | ||||||
|  |  | ||||||
| import android.content.Context |  | ||||||
| import android.content.Intent |  | ||||||
| import android.content.SharedPreferences |  | ||||||
| import androidx.test.InstrumentationRegistry.getInstrumentation |  | ||||||
| import androidx.test.espresso.intent.Intents |  | ||||||
| import androidx.test.espresso.intent.Intents.intended |  | ||||||
| import androidx.test.espresso.intent.Intents.times |  | ||||||
| import androidx.test.espresso.intent.matcher.IntentMatchers.hasComponent |  | ||||||
| import androidx.test.rule.ActivityTestRule |  | ||||||
| import androidx.test.runner.AndroidJUnit4 |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.HomeActivity |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.LoginActivity |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.MainActivity |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.Config |  | ||||||
| import org.junit.After |  | ||||||
|  |  | ||||||
| import org.junit.Before |  | ||||||
| import org.junit.Rule |  | ||||||
| import org.junit.Test |  | ||||||
| import org.junit.runner.RunWith |  | ||||||
|  |  | ||||||
| @RunWith(AndroidJUnit4::class) |  | ||||||
| class MainActivityEspressoTest { |  | ||||||
|  |  | ||||||
|     lateinit var intent: Intent |  | ||||||
|     lateinit var preferencesEditor: SharedPreferences.Editor |  | ||||||
|     private lateinit var url: String |  | ||||||
|     private lateinit var username: String |  | ||||||
|     private lateinit var password: String |  | ||||||
|  |  | ||||||
|     @Rule @JvmField |  | ||||||
|     val rule = ActivityTestRule(MainActivity::class.java, true, false) |  | ||||||
|  |  | ||||||
|     @Before |  | ||||||
|     fun setUp() { |  | ||||||
|         intent = Intent() |  | ||||||
|         val context = getInstrumentation().targetContext |  | ||||||
|  |  | ||||||
|         // create a SharedPreferences editor |  | ||||||
|         preferencesEditor = context.getSharedPreferences(Config.settingsName, Context.MODE_PRIVATE).edit() |  | ||||||
|  |  | ||||||
|         url = BuildConfig.LOGIN_URL |  | ||||||
|         username = BuildConfig.LOGIN_USERNAME |  | ||||||
|         password = BuildConfig.LOGIN_PASSWORD |  | ||||||
|  |  | ||||||
|         Intents.init() |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @Test |  | ||||||
|     fun checkFirstOpenLaunchesIntro() { |  | ||||||
|         preferencesEditor.putString("url", "") |  | ||||||
|         preferencesEditor.putString("password", "") |  | ||||||
|         preferencesEditor.putString("login", "") |  | ||||||
|         preferencesEditor.commit() |  | ||||||
|  |  | ||||||
|         rule.launchActivity(intent) |  | ||||||
|  |  | ||||||
|         intended(hasComponent(LoginActivity::class.java.name)) |  | ||||||
|         intended(hasComponent(HomeActivity::class.java.name), times(0)) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @Test |  | ||||||
|     fun checkNotFirstOpenLaunchesLogin() { |  | ||||||
|         preferencesEditor.putString("url", url) |  | ||||||
|         preferencesEditor.putString("password", password) |  | ||||||
|         preferencesEditor.putString("login", username) |  | ||||||
|         preferencesEditor.commit() |  | ||||||
|  |  | ||||||
|         rule.launchActivity(intent) |  | ||||||
|  |  | ||||||
|         intended(hasComponent(MainActivity::class.java.name)) |  | ||||||
|         intended(hasComponent(HomeActivity::class.java.name)) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @After |  | ||||||
|     fun releaseIntents() { |  | ||||||
|         Intents.release() |  | ||||||
|     } |  | ||||||
| } |  | ||||||
| @@ -1,29 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android |  | ||||||
|  |  | ||||||
| import androidx.test.espresso.matcher.ViewMatchers |  | ||||||
| import android.view.View |  | ||||||
| import android.widget.EditText |  | ||||||
| import org.hamcrest.Description |  | ||||||
| import org.hamcrest.Matcher |  | ||||||
| import org.hamcrest.Matchers |  | ||||||
| import org.hamcrest.TypeSafeMatcher |  | ||||||
|  |  | ||||||
| fun isHintOrErrorEnabled(): Matcher<View> = |  | ||||||
|         object : TypeSafeMatcher<View>() { |  | ||||||
|             override fun describeTo(description: Description?) { |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             override fun matchesSafely(item: View?): Boolean { |  | ||||||
|                 if (item !is EditText) { |  | ||||||
|                     return false |  | ||||||
|                 } |  | ||||||
|  |  | ||||||
|                 return item.error.isNotEmpty() |  | ||||||
|             } |  | ||||||
|         } |  | ||||||
|  |  | ||||||
| fun withMenu(id: Int, titleId: Int): Matcher<View> = |  | ||||||
|         Matchers.anyOf( |  | ||||||
|                 ViewMatchers.withId(id), |  | ||||||
|                 ViewMatchers.withText(titleId) |  | ||||||
|         ) |  | ||||||
| @@ -1,18 +1,23 @@ | |||||||
| <?xml version="1.0" encoding="utf-8"?> | <?xml version="1.0" encoding="utf-8"?> | ||||||
| <manifest xmlns:android="http://schemas.android.com/apk/res/android" | <manifest xmlns:android="http://schemas.android.com/apk/res/android" | ||||||
|     package="bou.amine.apps.readerforselfossv2.android"> |     xmlns:tools="http://schemas.android.com/tools"> | ||||||
|  |  | ||||||
|  |     <uses-permission android:name="android.permission.POST_NOTIFICATIONS"/> | ||||||
|     <uses-permission android:name="android.permission.INTERNET" /> |     <uses-permission android:name="android.permission.INTERNET" /> | ||||||
|     <uses-permission android:name="android.permission.ACCESS_NETWORK_STATE" /> |     <uses-permission android:name="android.permission.ACCESS_NETWORK_STATE" /> | ||||||
|  |  | ||||||
|     <application |     <application | ||||||
|  |         android:allowBackup="false" | ||||||
|  |         android:fullBackupContent="false" | ||||||
|  |         tools:replace="android:allowBackup" | ||||||
|         android:name=".MyApp" |         android:name=".MyApp" | ||||||
|         android:allowBackup="true" |  | ||||||
|         android:icon="@mipmap/ic_launcher" |         android:icon="@mipmap/ic_launcher" | ||||||
|         android:label="@string/app_name" |         android:label="@string/app_name" | ||||||
|         android:supportsRtl="true" |         android:supportsRtl="true" | ||||||
|         android:networkSecurityConfig="@xml/network_security_config" |         android:networkSecurityConfig="@xml/network_security_config" | ||||||
|         android:theme="@style/NoBar"> |         android:theme="@style/NoBar" | ||||||
|  |         android:dataExtractionRules="@xml/data_extraction_rules" | ||||||
|  |         android:configChanges="uiMode"> | ||||||
|         <activity |         <activity | ||||||
|             android:name=".MainActivity" |             android:name=".MainActivity" | ||||||
|             android:theme="@style/SplashTheme" |             android:theme="@style/SplashTheme" | ||||||
| @@ -48,7 +53,7 @@ | |||||||
|                 android:value=".HomeActivity" /> |                 android:value=".HomeActivity" /> | ||||||
|         </activity> |         </activity> | ||||||
|         <activity |         <activity | ||||||
|             android:name=".AddSourceActivity" |             android:name=".UpsertSourceActivity" | ||||||
|             android:parentActivityName=".SourcesActivity" |             android:parentActivityName=".SourcesActivity" | ||||||
|             android:exported="true"> |             android:exported="true"> | ||||||
|             <meta-data |             <meta-data | ||||||
| @@ -65,13 +70,10 @@ | |||||||
|             android:name=".ReaderActivity"> |             android:name=".ReaderActivity"> | ||||||
|         </activity> |         </activity> | ||||||
|         <activity |         <activity | ||||||
|             android:name=".ImageActivity"> |             android:name=".ImageActivity" | ||||||
|  |             android:theme="@style/Theme.AppCompat.ImageActivity"> | ||||||
|         </activity> |         </activity> | ||||||
|  |  | ||||||
|         <meta-data |  | ||||||
|             android:name="bou.amine.apps.readerforselfossv2.android.utils.glide.SelfSignedGlideModule" |  | ||||||
|             android:value="GlideModule" /> |  | ||||||
|  |  | ||||||
|         <meta-data android:name="android.webkit.WebView.MetricsOptOut" |         <meta-data android:name="android.webkit.WebView.MetricsOptOut" | ||||||
|             android:value="true" /> |             android:value="true" /> | ||||||
|  |  | ||||||
| @@ -79,8 +81,5 @@ | |||||||
|             android:value="true" /> |             android:value="true" /> | ||||||
|  |  | ||||||
|         <meta-data android:name="android.max_aspect" android:value="2.1" /> |         <meta-data android:name="android.max_aspect" android:value="2.1" /> | ||||||
|         <meta-data |  | ||||||
|             android:name="preloaded_fonts" |  | ||||||
|             android:resource="@array/preloaded_fonts" /> |  | ||||||
|     </application> |     </application> | ||||||
| </manifest> | </manifest> | ||||||
| @@ -0,0 +1,9 @@ | |||||||
|  | package bou.amine.apps.readerforselfossv2.android | ||||||
|  |  | ||||||
|  | import org.acra.ACRA | ||||||
|  | import org.acra.ktx.sendSilentlyWithAcra | ||||||
|  |  | ||||||
|  | fun Throwable.sendSilentlyWithAcraWithName(name: String) { | ||||||
|  |     ACRA.errorReporter.putCustomData("error_source", name) | ||||||
|  |     this.sendSilentlyWithAcra() | ||||||
|  | } | ||||||
| @@ -1,22 +1,17 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android | package bou.amine.apps.readerforselfossv2.android | ||||||
|  |  | ||||||
| import android.content.Intent | import android.content.Intent | ||||||
| import android.graphics.Color |  | ||||||
| import android.graphics.drawable.Drawable |  | ||||||
| import android.graphics.drawable.GradientDrawable |  | ||||||
| import android.net.Uri |  | ||||||
| import android.os.Bundle | import android.os.Bundle | ||||||
| import android.view.Menu | import android.view.Menu | ||||||
| import android.view.MenuItem | import android.view.MenuItem | ||||||
| import android.view.View | import android.view.View | ||||||
| import android.widget.ImageView |  | ||||||
| import android.widget.Toast | import android.widget.Toast | ||||||
| import androidx.appcompat.app.ActionBarDrawerToggle | import androidx.activity.result.contract.ActivityResultContracts | ||||||
| import androidx.appcompat.app.AlertDialog | import androidx.appcompat.app.AlertDialog | ||||||
| import androidx.appcompat.app.AppCompatActivity | import androidx.appcompat.app.AppCompatActivity | ||||||
| import androidx.appcompat.widget.SearchView | import androidx.appcompat.widget.SearchView | ||||||
| import androidx.core.view.doOnNextLayout | import androidx.core.view.doOnNextLayout | ||||||
| import androidx.drawerlayout.widget.DrawerLayout | import androidx.lifecycle.lifecycleScope | ||||||
| import androidx.recyclerview.widget.* | import androidx.recyclerview.widget.* | ||||||
| import androidx.work.Constraints | import androidx.work.Constraints | ||||||
| import androidx.work.ExistingPeriodicWorkPolicy | import androidx.work.ExistingPeriodicWorkPolicy | ||||||
| @@ -27,109 +22,56 @@ import bou.amine.apps.readerforselfossv2.android.adapters.ItemListAdapter | |||||||
| import bou.amine.apps.readerforselfossv2.android.adapters.ItemsAdapter | import bou.amine.apps.readerforselfossv2.android.adapters.ItemsAdapter | ||||||
| import bou.amine.apps.readerforselfossv2.android.background.LoadingWorker | import bou.amine.apps.readerforselfossv2.android.background.LoadingWorker | ||||||
| import bou.amine.apps.readerforselfossv2.android.databinding.ActivityHomeBinding | import bou.amine.apps.readerforselfossv2.android.databinding.ActivityHomeBinding | ||||||
|  | import bou.amine.apps.readerforselfossv2.android.fragments.FilterSheetFragment | ||||||
| import bou.amine.apps.readerforselfossv2.android.settings.SettingsActivity | import bou.amine.apps.readerforselfossv2.android.settings.SettingsActivity | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.AppColors |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.Toppings |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.Config |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.bottombar.maybeShow | import bou.amine.apps.readerforselfossv2.android.utils.bottombar.maybeShow | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.bottombar.removeBadge | import bou.amine.apps.readerforselfossv2.android.utils.bottombar.removeBadge | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.customtabs.CustomTabActivityHelper |  | ||||||
| import bou.amine.apps.readerforselfossv2.dao.ACTION |  | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository |  | ||||||
| import bou.amine.apps.readerforselfossv2.model.SelfossModel | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
| import bou.amine.apps.readerforselfossv2.utils.* | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
|  | import bou.amine.apps.readerforselfossv2.service.AppSettingsService | ||||||
|  | import bou.amine.apps.readerforselfossv2.utils.ItemType | ||||||
| import com.ashokvarma.bottomnavigation.BottomNavigationBar | import com.ashokvarma.bottomnavigation.BottomNavigationBar | ||||||
| import com.ashokvarma.bottomnavigation.BottomNavigationItem | import com.ashokvarma.bottomnavigation.BottomNavigationItem | ||||||
| import com.ashokvarma.bottomnavigation.TextBadgeItem | import com.ashokvarma.bottomnavigation.TextBadgeItem | ||||||
| import com.bumptech.glide.Glide |  | ||||||
| import com.bumptech.glide.request.RequestOptions |  | ||||||
| import com.ftinc.scoop.Scoop |  | ||||||
| import com.mikepenz.aboutlibraries.LibsBuilder |  | ||||||
| import com.mikepenz.materialdrawer.holder.BadgeStyle |  | ||||||
| import com.mikepenz.materialdrawer.holder.ColorHolder |  | ||||||
| import com.mikepenz.materialdrawer.holder.StringHolder |  | ||||||
| import com.mikepenz.materialdrawer.model.DividerDrawerItem |  | ||||||
| import com.mikepenz.materialdrawer.model.PrimaryDrawerItem |  | ||||||
| import com.mikepenz.materialdrawer.model.ProfileDrawerItem |  | ||||||
| import com.mikepenz.materialdrawer.model.SecondaryDrawerItem |  | ||||||
| import com.mikepenz.materialdrawer.model.interfaces.* |  | ||||||
| import com.mikepenz.materialdrawer.util.AbstractDrawerImageLoader |  | ||||||
| import com.mikepenz.materialdrawer.util.DrawerImageLoader |  | ||||||
| import com.mikepenz.materialdrawer.util.addStickyFooterItem |  | ||||||
| import com.mikepenz.materialdrawer.util.updateBadge |  | ||||||
| import com.mikepenz.materialdrawer.widget.AccountHeaderView |  | ||||||
| import com.russhwolf.settings.Settings |  | ||||||
| import kotlinx.coroutines.CoroutineScope | import kotlinx.coroutines.CoroutineScope | ||||||
| import kotlinx.coroutines.Dispatchers | import kotlinx.coroutines.Dispatchers | ||||||
| import kotlinx.coroutines.launch | import kotlinx.coroutines.launch | ||||||
| import org.kodein.di.DIAware | import org.kodein.di.DIAware | ||||||
| import org.kodein.di.android.closestDI | import org.kodein.di.android.closestDI | ||||||
| import org.kodein.di.instance | import org.kodein.di.instance | ||||||
|  | import java.security.MessageDigest | ||||||
| import java.util.concurrent.TimeUnit | import java.util.concurrent.TimeUnit | ||||||
| import kotlin.concurrent.thread |  | ||||||
|  |  | ||||||
| class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAware { | class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAware { | ||||||
|  |  | ||||||
|     private val MENU_PREFERENCES = 12302 |  | ||||||
|     private val DRAWER_ID_TAGS = 100101L |  | ||||||
|     private val DRAWER_ID_HIDDEN_TAGS = 101100L |  | ||||||
|     private val DRAWER_ID_SOURCES = 100110L |  | ||||||
|     private val DRAWER_ID_FILTERS = 100111L |  | ||||||
|  |  | ||||||
|     private var items: ArrayList<SelfossModel.Item> = ArrayList() |     private var items: ArrayList<SelfossModel.Item> = ArrayList() | ||||||
|  |  | ||||||
|     private var internalBrowser = false |  | ||||||
|     private var articleViewer = false |  | ||||||
|     private var shouldBeCardView = false |  | ||||||
|     private var displayUnreadCount = false |  | ||||||
|     private var displayAllCount = false |  | ||||||
|     private var fullHeightCards: Boolean = false |  | ||||||
|     private var itemsNumber: Int = 200 |  | ||||||
|     private var elementsShown: ItemType = ItemType.UNREAD |     private var elementsShown: ItemType = ItemType.UNREAD | ||||||
|     private var displayAccountHeader: Boolean = false |  | ||||||
|     private var infiniteScroll: Boolean = false |  | ||||||
|     private var lastFetchDone: Boolean = false |     private var lastFetchDone: Boolean = false | ||||||
|     private var updateSources: Boolean = true |  | ||||||
|     private var markOnScroll: Boolean = false |  | ||||||
|     private var hiddenTags: List<String> = emptyList() |  | ||||||
|  |  | ||||||
|     private var periodicRefresh = false |  | ||||||
|     private var refreshMinutes: Long = 360L |  | ||||||
|     private var refreshWhenChargingOnly = false |  | ||||||
|  |  | ||||||
|     private lateinit var tabNewBadge: TextBadgeItem |     private lateinit var tabNewBadge: TextBadgeItem | ||||||
|     private lateinit var tabArchiveBadge: TextBadgeItem |     private lateinit var tabArchiveBadge: TextBadgeItem | ||||||
|     private lateinit var tabStarredBadge: TextBadgeItem |     private lateinit var tabStarredBadge: TextBadgeItem | ||||||
|     private lateinit var customTabActivityHelper: CustomTabActivityHelper |  | ||||||
|     private lateinit var appColors: AppColors |  | ||||||
|     private var offset: Int = 0 |     private var offset: Int = 0 | ||||||
|     private var firstVisible: Int = 0 |     private var firstVisible: Int = 0 | ||||||
|     private lateinit var recyclerViewScrollListener: RecyclerView.OnScrollListener |     private lateinit var recyclerViewScrollListener: RecyclerView.OnScrollListener | ||||||
|     private var settings = Settings() |  | ||||||
|     private lateinit var binding: ActivityHomeBinding |     private lateinit var binding: ActivityHomeBinding | ||||||
|  |  | ||||||
|     private var recyclerAdapter: RecyclerView.Adapter<*>? = null |     private var recyclerAdapter: RecyclerView.Adapter<*>? = null | ||||||
|  |  | ||||||
|     private var fromTabShortcut: Boolean = false |     private var fromTabShortcut: Boolean = false | ||||||
|  |  | ||||||
|     private lateinit var tagsBadge: Map<Long, Int> |     private val settingsLauncher = registerForActivityResult(ActivityResultContracts.StartActivityForResult()) { | ||||||
|  |         appSettingsService.refreshUserSettings() | ||||||
|     private lateinit var config: Config |     } | ||||||
|  |  | ||||||
|     override val di by closestDI() |     override val di by closestDI() | ||||||
|     private val repository : Repository by instance() |     private val repository : Repository by instance() | ||||||
|  |     private val appSettingsService : AppSettingsService by instance() | ||||||
|  |  | ||||||
|     data class DrawerData(val tags: List<SelfossModel.Tag>?, val sources: List<SelfossModel.Source>?) |  | ||||||
|  |  | ||||||
|     override fun onStart() { |  | ||||||
|         super.onStart() |  | ||||||
|         customTabActivityHelper.bindCustomTabsService(this) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     override fun onCreate(savedInstanceState: Bundle?) { |     override fun onCreate(savedInstanceState: Bundle?) { | ||||||
|         appColors = AppColors(this@HomeActivity) |  | ||||||
|         config = Config() |  | ||||||
|  |  | ||||||
|         super.onCreate(savedInstanceState) |         super.onCreate(savedInstanceState) | ||||||
|         binding = ActivityHomeBinding.inflate(layoutInflater) |         binding = ActivityHomeBinding.inflate(layoutInflater) | ||||||
|         val view = binding.root |         val view = binding.root | ||||||
| @@ -143,31 +85,18 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|  |  | ||||||
|         setContentView(view) |         setContentView(view) | ||||||
|  |  | ||||||
|         handleThemeBinding() |  | ||||||
|  |  | ||||||
|         setSupportActionBar(binding.toolBar) |         setSupportActionBar(binding.toolBar) | ||||||
|         supportActionBar?.setDisplayHomeAsUpEnabled(true) |  | ||||||
|         supportActionBar?.setHomeButtonEnabled(true) |  | ||||||
|         val mDrawerToggle = ActionBarDrawerToggle(this, binding.drawerContainer, binding.toolBar, R.string.material_drawer_open, R.string.material_drawer_close) |  | ||||||
|         binding.drawerContainer.addDrawerListener(mDrawerToggle) |  | ||||||
|         mDrawerToggle.syncState() |  | ||||||
|  |  | ||||||
|         customTabActivityHelper = CustomTabActivityHelper() |  | ||||||
|  |  | ||||||
|         handleBottomBar() |         handleBottomBar() | ||||||
|         handleDrawer() |  | ||||||
|  |  | ||||||
|         handleSwipeRefreshLayout() |         handleSwipeRefreshLayout() | ||||||
|  |  | ||||||
|         handleSettings() |  | ||||||
|  |  | ||||||
|         getElementsAccordingToTab() |         if (appSettingsService.isItemCachingEnabled()) { | ||||||
|  |             CoroutineScope(Dispatchers.Main).launch { | ||||||
|  |                 repository.tryToCacheItemsAndGetNewOnes() | ||||||
|         CoroutineScope(Dispatchers.Main).launch { |             } | ||||||
|             repository.tryToCacheItemsAndGetNewOnes() |  | ||||||
|         } |         } | ||||||
|  |  | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun handleSwipeRefreshLayout() { |     private fun handleSwipeRefreshLayout() { | ||||||
| @@ -179,7 +108,6 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|         binding.swipeRefreshLayout.setOnRefreshListener { |         binding.swipeRefreshLayout.setOnRefreshListener { | ||||||
|             repository.offlineOverride = false |             repository.offlineOverride = false | ||||||
|             lastFetchDone = false |             lastFetchDone = false | ||||||
|             handleDrawerItems() |  | ||||||
|             CoroutineScope(Dispatchers.Main).launch { |             CoroutineScope(Dispatchers.Main).launch { | ||||||
|                 getElementsAccordingToTab() |                 getElementsAccordingToTab() | ||||||
|                 binding.swipeRefreshLayout.isRefreshing = false |                 binding.swipeRefreshLayout.isRefreshing = false | ||||||
| @@ -219,18 +147,6 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|  |  | ||||||
|                         adapter.handleItemAtIndex(position) |                         adapter.handleItemAtIndex(position) | ||||||
|  |  | ||||||
|                         reloadBadgeContent() |  | ||||||
|  |  | ||||||
|                         val tagHashes = i.tags.map { it.longHash() } |  | ||||||
|                         tagsBadge = tagsBadge.map { |  | ||||||
|                             if (tagHashes.contains(it.key)) { |  | ||||||
|                                 (it.key to (it.value - 1)) |  | ||||||
|                             } else { |  | ||||||
|                                 (it.key to it.value) |  | ||||||
|                             } |  | ||||||
|                         }.toMap() |  | ||||||
|                         reloadTagsBadges() |  | ||||||
|  |  | ||||||
|                         // Just load everythin |                         // Just load everythin | ||||||
|                         if (items.size <= 0) { |                         if (items.size <= 0) { | ||||||
|                             getElementsAccordingToTab() |                             getElementsAccordingToTab() | ||||||
| @@ -248,32 +164,61 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|         ItemTouchHelper(simpleItemTouchCallback).attachToRecyclerView(binding.recyclerView) |         ItemTouchHelper(simpleItemTouchCallback).attachToRecyclerView(binding.recyclerView) | ||||||
|     } |     } | ||||||
|  |  | ||||||
|  |     private fun updateBottomBarBadgeCount(badge: TextBadgeItem, count: Int) { | ||||||
|  |         if (count > 0) { | ||||||
|  |             badge | ||||||
|  |                 .setText(count.toString()) | ||||||
|  |                 .maybeShow() | ||||||
|  |         } else { | ||||||
|  |             badge.removeBadge() | ||||||
|  |         } | ||||||
|  |     } | ||||||
|  |  | ||||||
|     private fun handleBottomBar() { |     private fun handleBottomBar() { | ||||||
|  |  | ||||||
|         tabNewBadge = TextBadgeItem() |         tabNewBadge = TextBadgeItem() | ||||||
|             .setText("") |             .setText("") | ||||||
|             .setHideOnSelect(false).hide(false) |             .setHideOnSelect(false).hide(false) | ||||||
|             .setBackgroundColor(appColors.colorPrimary) |  | ||||||
|         tabArchiveBadge = TextBadgeItem() |         tabArchiveBadge = TextBadgeItem() | ||||||
|             .setText("") |             .setText("") | ||||||
|             .setHideOnSelect(false).hide(false) |             .setHideOnSelect(false).hide(false) | ||||||
|             .setBackgroundColor(appColors.colorPrimary) |  | ||||||
|         tabStarredBadge = TextBadgeItem() |         tabStarredBadge = TextBadgeItem() | ||||||
|             .setText("") |             .setText("") | ||||||
|             .setHideOnSelect(false).hide(false) |             .setHideOnSelect(false).hide(false) | ||||||
|             .setBackgroundColor(appColors.colorPrimary) |  | ||||||
|  |         if (appSettingsService.isDisplayUnreadCountEnabled()) { | ||||||
|  |             lifecycleScope.launch { | ||||||
|  |                 repository.badgeUnread.collect { | ||||||
|  |                     updateBottomBarBadgeCount(tabNewBadge, it) | ||||||
|  |                 } | ||||||
|  |             } | ||||||
|  |         } | ||||||
|  |  | ||||||
|  |         if (appSettingsService.isDisplayAllCountEnabled()) { | ||||||
|  |             lifecycleScope.launch { | ||||||
|  |                 repository.badgeAll.collect { | ||||||
|  |                     updateBottomBarBadgeCount(tabArchiveBadge, it) | ||||||
|  |                 } | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             lifecycleScope.launch { | ||||||
|  |                 repository.badgeStarred.collect { | ||||||
|  |                     updateBottomBarBadgeCount(tabStarredBadge, it) | ||||||
|  |                 } | ||||||
|  |             } | ||||||
|  |         } | ||||||
|  |  | ||||||
|         val tabNew = |         val tabNew = | ||||||
|             BottomNavigationItem( |             BottomNavigationItem( | ||||||
|                 R.drawable.ic_tab_fiber_new_black_24dp, |                 R.drawable.ic_tab_fiber_new_black_24dp, | ||||||
|                 getString(R.string.tab_new) |                 getString(R.string.tab_new) | ||||||
|             ).setActiveColor(appColors.colorAccent) |             ) | ||||||
|                 .setBadgeItem(tabNewBadge) |                 .setBadgeItem(tabNewBadge) | ||||||
|         val tabArchive = |         val tabArchive = | ||||||
|             BottomNavigationItem( |             BottomNavigationItem( | ||||||
|                 R.drawable.ic_tab_archive_black_24dp, |                 R.drawable.ic_tab_archive_black_24dp, | ||||||
|                 getString(R.string.tab_read) |                 getString(R.string.tab_read) | ||||||
|             ).setActiveColor(appColors.colorAccentDark) |             ) | ||||||
|                 .setBadgeItem(tabArchiveBadge) |                 .setBadgeItem(tabArchiveBadge) | ||||||
|         val tabStarred = |         val tabStarred = | ||||||
|             BottomNavigationItem( |             BottomNavigationItem( | ||||||
| @@ -289,7 +234,6 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|             .setFirstSelectedPosition(0) |             .setFirstSelectedPosition(0) | ||||||
|             .initialise() |             .initialise() | ||||||
|         binding.bottomBar.setMode(BottomNavigationBar.MODE_SHIFTING) |         binding.bottomBar.setMode(BottomNavigationBar.MODE_SHIFTING) | ||||||
|         binding.bottomBar.setBackgroundStyle(BottomNavigationBar.BACKGROUND_STYLE_STATIC) |  | ||||||
|  |  | ||||||
|         if (fromTabShortcut) { |         if (fromTabShortcut) { | ||||||
|             binding.bottomBar.selectTab(elementsShown.position - 1) |             binding.bottomBar.selectTab(elementsShown.position - 1) | ||||||
| @@ -299,409 +243,43 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|     override fun onResume() { |     override fun onResume() { | ||||||
|         super.onResume() |         super.onResume() | ||||||
|  |  | ||||||
|         // TODO: Make this the only appcolors init |  | ||||||
|         appColors = AppColors(this@HomeActivity) |  | ||||||
|  |  | ||||||
|         handleDrawerItems() |  | ||||||
|  |  | ||||||
|         handleThemeUpdate() |  | ||||||
|  |  | ||||||
|         reloadLayoutManager() |         reloadLayoutManager() | ||||||
|  |  | ||||||
|         if (!infiniteScroll) { |         if (appSettingsService.isInfiniteLoadingEnabled()) { | ||||||
|             binding.recyclerView.setHasFixedSize(true) |  | ||||||
|         } else { |  | ||||||
|             handleInfiniteScroll() |             handleInfiniteScroll() | ||||||
|  |         } else { | ||||||
|  |             binding.recyclerView.setHasFixedSize(true) | ||||||
|         } |         } | ||||||
|  |  | ||||||
|         handleBottomBarActions() |         handleBottomBarActions() | ||||||
|  |  | ||||||
|  |         handleGDPRDialog(appSettingsService.settings.getBoolean("GDPR_shown", false)) | ||||||
|  |  | ||||||
|         handleRecurringTask() |         handleRecurringTask() | ||||||
|  |  | ||||||
|         handleOfflineActions() |         CoroutineScope(Dispatchers.Main).launch { | ||||||
|  |             repository.handleDBActions() | ||||||
|  |         } | ||||||
|  |  | ||||||
|         getElementsAccordingToTab() |         getElementsAccordingToTab() | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     override fun onStop() { |  | ||||||
|         super.onStop() |  | ||||||
|         customTabActivityHelper.unbindCustomTabsService(this) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     private fun handleSettings() { |     private fun handleGDPRDialog(GDPRShown: Boolean) { | ||||||
|         internalBrowser = settings.getBoolean("prefer_internal_browser", true) |         val messageDigest: MessageDigest = MessageDigest.getInstance("SHA-256") | ||||||
|         articleViewer = settings.getBoolean("prefer_article_viewer", true) |         messageDigest.update(appSettingsService.getBaseUrl().toByteArray()) | ||||||
|         shouldBeCardView = settings.getBoolean("card_view_active", false) |         if (!GDPRShown) { | ||||||
|         displayUnreadCount = settings.getBoolean("display_unread_count", true) |             val alertDialog = AlertDialog.Builder(this).create() | ||||||
|         displayAllCount = settings.getBoolean("display_other_count", false) |             alertDialog.setTitle(getString(R.string.gdpr_dialog_title)) | ||||||
|         fullHeightCards = settings.getBoolean("full_height_cards", false) |             alertDialog.setMessage(getString(R.string.gdpr_dialog_message)) | ||||||
|         itemsNumber = settings.getString("prefer_api_items_number", "200").toInt() |             alertDialog.setButton( | ||||||
|         displayAccountHeader = settings.getBoolean("account_header_displaying", false) |                 AlertDialog.BUTTON_NEUTRAL, | ||||||
|         infiniteScroll = settings.getBoolean("infinite_loading", false) |                 "OK" | ||||||
|         updateSources = settings.getBoolean("update_sources", true) |             ) { dialog, _ -> | ||||||
|         markOnScroll = settings.getBoolean("mark_on_scroll", false) |                 appSettingsService.settings.putBoolean("GDPR_shown", true) | ||||||
|         hiddenTags = if (settings.getString("hidden_tags", "").isNotEmpty()) { |                 dialog.dismiss() | ||||||
|             settings.getString("hidden_tags", "").replace("\\s".toRegex(), "").split(",") |  | ||||||
|         } else { |  | ||||||
|             emptyList() |  | ||||||
|         } |  | ||||||
|         periodicRefresh = settings.getBoolean("periodic_refresh", false) |  | ||||||
|         refreshWhenChargingOnly = settings.getBoolean("refresh_when_charging", false) |  | ||||||
|         refreshMinutes = settings.getString("periodic_refresh_minutes", "360").toLong() |  | ||||||
|  |  | ||||||
|         if (refreshMinutes <= 15) { |  | ||||||
|             refreshMinutes = 15 |  | ||||||
|         } |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     private fun handleThemeBinding() { |  | ||||||
|         val scoop = Scoop.getInstance() |  | ||||||
|         scoop.bind(this, Toppings.PRIMARY.value, binding.toolBar) |  | ||||||
|         scoop.bindStatusBar(this, Toppings.PRIMARY_DARK.value) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     private fun handleThemeUpdate() { |  | ||||||
|  |  | ||||||
|         val scoop = Scoop.getInstance() |  | ||||||
|         scoop.update(Toppings.PRIMARY.value, appColors.colorPrimary) |  | ||||||
|  |  | ||||||
|         scoop.update(Toppings.PRIMARY_DARK.value, appColors.colorPrimaryDark) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     private fun handleDrawer() { |  | ||||||
|         DrawerImageLoader.init(object : AbstractDrawerImageLoader() { |  | ||||||
|             override fun set(imageView: ImageView, uri: Uri, placeholder: Drawable, tag: String?) { |  | ||||||
|                 Glide.with(this@HomeActivity) |  | ||||||
|                         .asBitmap() |  | ||||||
|                         .load(uri) |  | ||||||
|                         .apply(RequestOptions() |  | ||||||
|                                 .placeholder(R.mipmap.ic_launcher) |  | ||||||
|                                 .fallback(R.mipmap.ic_launcher) |  | ||||||
|                                 .fitCenter()) |  | ||||||
|                         .into(imageView) |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             override fun cancel(imageView: ImageView) { |  | ||||||
|                 Glide.with(this@HomeActivity).clear(imageView) |  | ||||||
|             } |  | ||||||
|         }) |  | ||||||
|  |  | ||||||
|         val drawerListener = object : DrawerLayout.DrawerListener { |  | ||||||
|             override fun onDrawerSlide(drawerView: View, slideOffset: Float) { |  | ||||||
|                 // We do nothing |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             override fun onDrawerOpened(drawerView: View) { |  | ||||||
|                 binding.bottomBar.hide() |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             override fun onDrawerClosed(drawerView: View) { |  | ||||||
|                 binding.bottomBar.show() |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             override fun onDrawerStateChanged(newState: Int) { |  | ||||||
|                 // We do nothing |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|         } |  | ||||||
|  |  | ||||||
|         binding.drawerContainer.addDrawerListener(drawerListener) |  | ||||||
|  |  | ||||||
|         displayAccountHeader = |  | ||||||
|                 settings.getBoolean("account_header_displaying", false) |  | ||||||
|  |  | ||||||
|         binding.mainDrawer.addStickyFooterItem( |  | ||||||
|             PrimaryDrawerItem().apply { |  | ||||||
|                 nameRes = R.string.drawer_report_bug |  | ||||||
|                 iconRes = R.drawable.ic_bug_report_black_24dp |  | ||||||
|                 isIconTinted = true |  | ||||||
|                 onDrawerItemClickListener = { _, _, _ -> |  | ||||||
|                     val browserIntent = Intent(Intent.ACTION_VIEW, Uri.parse(Config.trackerUrl)) |  | ||||||
|                     startActivity(browserIntent) |  | ||||||
|                     false |  | ||||||
|                 } |  | ||||||
|             }) |  | ||||||
|  |  | ||||||
|         binding.mainDrawer.addStickyFooterItem( |  | ||||||
|             PrimaryDrawerItem().apply { |  | ||||||
|                 nameRes = R.string.title_activity_settings |  | ||||||
|                 iconRes = R.drawable.ic_settings_black_24dp |  | ||||||
|                 isIconTinted = true |  | ||||||
|                 onDrawerItemClickListener = { _, _, _ -> |  | ||||||
|                     startActivity(Intent(this@HomeActivity, SettingsActivity::class.java)) |  | ||||||
|                     false |  | ||||||
|                 } |  | ||||||
|             }) |  | ||||||
|  |  | ||||||
|         if (displayAccountHeader) { |  | ||||||
|             AccountHeaderView(this).apply { |  | ||||||
|                 attachToSliderView(binding.mainDrawer) |  | ||||||
|                 addProfiles( |  | ||||||
|                     ProfileDrawerItem().apply { |  | ||||||
|                         nameText = settings.getString("url", "") |  | ||||||
|                         setBackgroundResource(R.drawable.bg) |  | ||||||
|                         iconRes = R.mipmap.ic_launcher |  | ||||||
|                         selectionListEnabledForSingleProfile = false |  | ||||||
|                     } |  | ||||||
|                 ) |  | ||||||
|             } |  | ||||||
|         } |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     // TODO: refactor this. |  | ||||||
|     private fun handleDrawerItems() { |  | ||||||
|         tagsBadge = emptyMap() |  | ||||||
|         fun handleDrawerData(maybeDrawerData: DrawerData?, loadedFromCache: Boolean = false) { |  | ||||||
|             fun createDrawerItem( |  | ||||||
|                 it: SelfossModel.Tag |  | ||||||
|             ) { |  | ||||||
|                 val gd = GradientDrawable() |  | ||||||
|                 val gdColor = try { |  | ||||||
|                     Color.parseColor(it.color) |  | ||||||
|                 } catch (e: IllegalArgumentException) { |  | ||||||
|                     appColors.colorPrimary |  | ||||||
|                 } |  | ||||||
|  |  | ||||||
|                 gd.setColor(gdColor) |  | ||||||
|                 gd.shape = GradientDrawable.RECTANGLE |  | ||||||
|                 gd.setSize(30, 30) |  | ||||||
|                 gd.cornerRadius = 30F |  | ||||||
|  |  | ||||||
|                 val drawerItem = PrimaryDrawerItem() |  | ||||||
|                     .apply { |  | ||||||
|                         nameText = it.tag.getHtmlDecoded() |  | ||||||
|                         identifier = it.tag.longHash() |  | ||||||
|                         iconDrawable = gd |  | ||||||
|                         badgeStyle = BadgeStyle().apply { |  | ||||||
|                             textColor = ColorHolder.fromColor(Color.WHITE) |  | ||||||
|                             color = ColorHolder.fromColor(appColors.colorAccent) |  | ||||||
|                         } |  | ||||||
|                         onDrawerItemClickListener = { _, _, _ -> |  | ||||||
|                             repository.tagFilter = it |  | ||||||
|                             repository.sourceFilter = null |  | ||||||
|                             getElementsAccordingToTab() |  | ||||||
|                             fetchOnEmptyList() |  | ||||||
|                             false |  | ||||||
|                         } |  | ||||||
|                     } |  | ||||||
|                 if (it.unread > 0) { |  | ||||||
|                     drawerItem.badgeText = it.unread.toString() |  | ||||||
|                 } |  | ||||||
|  |  | ||||||
|                 binding.mainDrawer.itemAdapter.add(drawerItem) |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             fun handleTags(maybeTags: List<SelfossModel.Tag>?) { |  | ||||||
|                 if (maybeTags == null) { |  | ||||||
|                     if (loadedFromCache) { |  | ||||||
|                         binding.mainDrawer.itemAdapter.add( |  | ||||||
|                             SecondaryDrawerItem() |  | ||||||
|                                 .apply { nameRes = R.string.drawer_error_loading_tags; isSelectable = false } |  | ||||||
|                         ) |  | ||||||
|                     } |  | ||||||
|                 } else { |  | ||||||
|                     val filteredTags = maybeTags |  | ||||||
|                         .filterNot { hiddenTags.contains(it.tag) } |  | ||||||
|                         .sortedBy { it.unread == 0 } |  | ||||||
|                     tagsBadge = filteredTags.map { |  | ||||||
|                         createDrawerItem(it) |  | ||||||
|  |  | ||||||
|                         (it.tag.longHash() to it.unread) |  | ||||||
|                     }.toMap() |  | ||||||
|                 } |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             fun handleHiddenTags(maybeTags: List<SelfossModel.Tag>?) { |  | ||||||
|                 if (maybeTags == null) { |  | ||||||
|                     if (loadedFromCache) { |  | ||||||
|                         binding.mainDrawer.itemAdapter.add( |  | ||||||
|                             SecondaryDrawerItem().apply { |  | ||||||
|                                 nameRes = R.string.drawer_error_loading_tags |  | ||||||
|                                 isSelectable = false |  | ||||||
|                             } |  | ||||||
|                         ) |  | ||||||
|                     } |  | ||||||
|                 } else { |  | ||||||
|                     val filteredHiddenTags: List<SelfossModel.Tag> = |  | ||||||
|                         maybeTags.filter { hiddenTags.contains(it.tag) } |  | ||||||
|                     tagsBadge = filteredHiddenTags.map { |  | ||||||
|                         createDrawerItem(it) |  | ||||||
|  |  | ||||||
|                         (it.tag.longHash() to it.unread) |  | ||||||
|                     }.toMap() |  | ||||||
|                 } |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             fun handleSources(maybeSources: List<SelfossModel.Source>?) { |  | ||||||
|                 if (maybeSources == null) { |  | ||||||
|                     if (loadedFromCache) { |  | ||||||
|                         binding.mainDrawer.itemAdapter.add( |  | ||||||
|                             SecondaryDrawerItem().apply { |  | ||||||
|                                 nameRes = R.string.drawer_error_loading_sources |  | ||||||
|                                 isSelectable = false |  | ||||||
|                             } |  | ||||||
|                         ) |  | ||||||
|                     } |  | ||||||
|                 } else { |  | ||||||
|                     for (source in maybeSources) { |  | ||||||
|                         val item = PrimaryDrawerItem().apply { |  | ||||||
|                             nameText = source.title.getHtmlDecoded() |  | ||||||
|                             identifier = source.id.toLong() |  | ||||||
|                             iconUrl = source.getIcon(repository.baseUrl) |  | ||||||
|                             onDrawerItemClickListener = { _,_,_ -> |  | ||||||
|                                 repository.sourceFilter = source |  | ||||||
|                                 repository.tagFilter = null |  | ||||||
|                                 getElementsAccordingToTab() |  | ||||||
|                                 fetchOnEmptyList() |  | ||||||
|                                 false |  | ||||||
|                             } |  | ||||||
|                         } |  | ||||||
|                         binding.mainDrawer.itemAdapter.add(item) |  | ||||||
|                     } |  | ||||||
|                 } |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             binding.mainDrawer.itemAdapter.clear() |  | ||||||
|             if (maybeDrawerData != null) { |  | ||||||
|                 binding.mainDrawer.itemAdapter.add( |  | ||||||
|                     SecondaryDrawerItem().apply { |  | ||||||
|                         nameRes = R.string.drawer_item_filters |  | ||||||
|                         isSelectable = false |  | ||||||
|                         identifier = DRAWER_ID_FILTERS |  | ||||||
|                         badgeRes = R.string.drawer_action_clear |  | ||||||
|                         onDrawerItemClickListener = { _,_,_ -> |  | ||||||
|                             repository.sourceFilter = null |  | ||||||
|                             repository.tagFilter = null |  | ||||||
|                             binding.mainDrawer.setSelectionAtPosition(-1) |  | ||||||
|                             getElementsAccordingToTab() |  | ||||||
|                             fetchOnEmptyList() |  | ||||||
|                             false |  | ||||||
|                         } |  | ||||||
|                     } |  | ||||||
|                 ) |  | ||||||
|                 if (hiddenTags.isNotEmpty()) { |  | ||||||
|                     binding.mainDrawer.itemAdapter.add( |  | ||||||
|                         DividerDrawerItem(), |  | ||||||
|                         SecondaryDrawerItem().apply { |  | ||||||
|                             nameRes = R.string.drawer_item_hidden_tags |  | ||||||
|                             identifier = DRAWER_ID_HIDDEN_TAGS |  | ||||||
|                             isSelectable = false |  | ||||||
|                         } |  | ||||||
|                     ) |  | ||||||
|                     handleHiddenTags(maybeDrawerData.tags) |  | ||||||
|                 } |  | ||||||
|                 binding.mainDrawer.itemAdapter.add( |  | ||||||
|                     DividerDrawerItem(), |  | ||||||
|                     SecondaryDrawerItem().apply { |  | ||||||
|                         nameRes = R.string.drawer_item_tags |  | ||||||
|                         identifier = DRAWER_ID_TAGS |  | ||||||
|                         isSelectable = false |  | ||||||
|                     } |  | ||||||
|                 ) |  | ||||||
|                 handleTags(maybeDrawerData.tags) |  | ||||||
|                 binding.mainDrawer.itemAdapter.add( |  | ||||||
|                     DividerDrawerItem(), |  | ||||||
|                     SecondaryDrawerItem().apply { |  | ||||||
|                         nameRes = R.string.drawer_item_sources |  | ||||||
|                         identifier = DRAWER_ID_SOURCES |  | ||||||
|                         isSelectable = false |  | ||||||
|                         badgeRes = R.string.drawer_action_edit |  | ||||||
|                         onDrawerItemClickListener = { v,_,_ -> |  | ||||||
|                             startActivity(Intent(v!!.context, SourcesActivity::class.java)) |  | ||||||
|                             false |  | ||||||
|                         } |  | ||||||
|                     } |  | ||||||
|                 ) |  | ||||||
|                 handleSources(maybeDrawerData.sources) |  | ||||||
|                 binding.mainDrawer.itemAdapter.add( |  | ||||||
|                     DividerDrawerItem(), |  | ||||||
|                     PrimaryDrawerItem().apply { |  | ||||||
|                         nameRes = R.string.action_about |  | ||||||
|                         isSelectable = false |  | ||||||
|                         iconRes = R.drawable.ic_info_outline_white_24dp |  | ||||||
|                         isIconTinted = true |  | ||||||
|                         onDrawerItemClickListener = { _,_,_ -> |  | ||||||
|                             LibsBuilder() |  | ||||||
|                                 .withAboutIconShown(true) |  | ||||||
|                                 .withAboutVersionShown(true) |  | ||||||
|                                 .start(this@HomeActivity) |  | ||||||
|                             false |  | ||||||
|                         } |  | ||||||
|                     } |  | ||||||
|                 ) |  | ||||||
|  |  | ||||||
|                 if (!loadedFromCache) { |  | ||||||
|                     if (maybeDrawerData.tags != null) { |  | ||||||
|                         thread { |  | ||||||
|                             repository.resetDBTagsWithData(maybeDrawerData.tags) |  | ||||||
|                         } |  | ||||||
|                     } |  | ||||||
|                     if (maybeDrawerData.sources != null) { |  | ||||||
|                         thread { |  | ||||||
|                             repository.resetDBSourcesWithData(maybeDrawerData.sources) |  | ||||||
|                         } |  | ||||||
|                     } |  | ||||||
|                 } |  | ||||||
|             } else { |  | ||||||
|                 if (!loadedFromCache) { |  | ||||||
|                     binding.mainDrawer.itemAdapter.add( |  | ||||||
|                         PrimaryDrawerItem().apply { |  | ||||||
|                             nameRes = R.string.no_tags_loaded |  | ||||||
|                             identifier = DRAWER_ID_TAGS |  | ||||||
|                             isSelectable = false |  | ||||||
|                         }, |  | ||||||
|                         PrimaryDrawerItem().apply { |  | ||||||
|                             nameRes = R.string.no_sources_loaded |  | ||||||
|                             identifier = DRAWER_ID_SOURCES |  | ||||||
|                             isSelectable = false |  | ||||||
|                         } |  | ||||||
|                     ) |  | ||||||
|                 } |  | ||||||
|             } |  | ||||||
|         } |  | ||||||
|  |  | ||||||
|         fun drawerApiCalls(maybeDrawerData: DrawerData?) { |  | ||||||
|             var tags: List<SelfossModel.Tag>? = null |  | ||||||
|             var sources: List<SelfossModel.Source>? |  | ||||||
|  |  | ||||||
|             fun sourcesApiCall() { |  | ||||||
|                 CoroutineScope(Dispatchers.Main).launch { |  | ||||||
|                     val response = repository.getSources() |  | ||||||
|                     if (response != null) { |  | ||||||
|                         sources = response |  | ||||||
|                         val apiDrawerData = DrawerData(tags, sources) |  | ||||||
|                         if ((maybeDrawerData != null && maybeDrawerData != apiDrawerData) || maybeDrawerData == null) { |  | ||||||
|                             handleDrawerData(apiDrawerData) |  | ||||||
|                         } |  | ||||||
|                     } else { |  | ||||||
|                         val apiDrawerData = DrawerData(tags, null) |  | ||||||
|                         if ((maybeDrawerData != null && maybeDrawerData != apiDrawerData) || maybeDrawerData == null) { |  | ||||||
|                             handleDrawerData(apiDrawerData) |  | ||||||
|                         } |  | ||||||
|                     } |  | ||||||
|                 } |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             CoroutineScope(Dispatchers.IO).launch { |  | ||||||
|                 tags = repository.getTags() |  | ||||||
|                 sourcesApiCall() |  | ||||||
|             } |  | ||||||
|         } |  | ||||||
|  |  | ||||||
|         binding.mainDrawer.itemAdapter.add( |  | ||||||
|             PrimaryDrawerItem().apply { |  | ||||||
|                 nameRes = R.string.drawer_loading |  | ||||||
|                 isSelectable = false |  | ||||||
|             } |  | ||||||
|         ) |  | ||||||
|  |  | ||||||
|         thread { |  | ||||||
|             val drawerData = DrawerData(repository.getDBTags().map { it.toView() }, |  | ||||||
|                                         repository.getDBSources().map { it.toView() }) |  | ||||||
|             runOnUiThread { |  | ||||||
|                 handleDrawerData(drawerData, loadedFromCache = true) |  | ||||||
|                 drawerApiCalls(drawerData) |  | ||||||
|             } |             } | ||||||
|  |             alertDialog.show() | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
| @@ -712,7 +290,7 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|         // This will only update the layout manager if settings changed |         // This will only update the layout manager if settings changed | ||||||
|         when (currentManager) { |         when (currentManager) { | ||||||
|             is StaggeredGridLayoutManager -> |             is StaggeredGridLayoutManager -> | ||||||
|                 if (!shouldBeCardView) { |                 if (!appSettingsService.isCardViewEnabled()) { | ||||||
|                     layoutManager = GridLayoutManager( |                     layoutManager = GridLayoutManager( | ||||||
|                         this, |                         this, | ||||||
|                         calculateNoOfColumns() |                         calculateNoOfColumns() | ||||||
| @@ -720,7 +298,7 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|                     binding.recyclerView.layoutManager = layoutManager |                     binding.recyclerView.layoutManager = layoutManager | ||||||
|                 } |                 } | ||||||
|             is GridLayoutManager -> |             is GridLayoutManager -> | ||||||
|                 if (shouldBeCardView) { |                 if (appSettingsService.isCardViewEnabled()) { | ||||||
|                     layoutManager = StaggeredGridLayoutManager( |                     layoutManager = StaggeredGridLayoutManager( | ||||||
|                         calculateNoOfColumns(), |                         calculateNoOfColumns(), | ||||||
|                         StaggeredGridLayoutManager.VERTICAL |                         StaggeredGridLayoutManager.VERTICAL | ||||||
| @@ -731,7 +309,7 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|                 } |                 } | ||||||
|             else -> |             else -> | ||||||
|                 if (currentManager == null) { |                 if (currentManager == null) { | ||||||
|                     if (!shouldBeCardView) { |                     if (!appSettingsService.isCardViewEnabled()) { | ||||||
|                         layoutManager = GridLayoutManager( |                         layoutManager = GridLayoutManager( | ||||||
|                             this, |                             this, | ||||||
|                             calculateNoOfColumns() |                             calculateNoOfColumns() | ||||||
| @@ -786,9 +364,8 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|         }) |         }) | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun fetchOnEmptyList() { |     fun fetchOnEmptyList() { | ||||||
|         binding.recyclerView.doOnNextLayout { |         binding.recyclerView.doOnNextLayout { | ||||||
|             // TODO: do if last element (or is empty ?) |  | ||||||
|             getElementsAccordingToTab(true) |             getElementsAccordingToTab(true) | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
| @@ -827,7 +404,7 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|             binding.emptyText.visibility = View.GONE |             binding.emptyText.visibility = View.GONE | ||||||
|         } |         } | ||||||
|  |  | ||||||
|     private fun getElementsAccordingToTab( |     fun getElementsAccordingToTab( | ||||||
|         appendResults: Boolean = false |         appendResults: Boolean = false | ||||||
|     ) { |     ) { | ||||||
|         offset = if (appendResults && items.size > 0) { |         offset = if (appendResults && items.size > 0) { | ||||||
| @@ -867,17 +444,11 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|         } |         } | ||||||
|  |  | ||||||
|         if (recyclerAdapter == null) { |         if (recyclerAdapter == null) { | ||||||
|             if (shouldBeCardView) { |             if (appSettingsService.isCardViewEnabled()) { | ||||||
|                 recyclerAdapter = |                 recyclerAdapter = | ||||||
|                         ItemCardAdapter( |                         ItemCardAdapter( | ||||||
|                             this, |                             this, | ||||||
|                             items, |                             items, | ||||||
|                             customTabActivityHelper, |  | ||||||
|                             internalBrowser, |  | ||||||
|                             articleViewer, |  | ||||||
|                             fullHeightCards, |  | ||||||
|                             appColors, |  | ||||||
|                             config |  | ||||||
|                         ) { |                         ) { | ||||||
|                             updateItems(it) |                             updateItems(it) | ||||||
|                         } |                         } | ||||||
| @@ -886,11 +457,6 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|                         ItemListAdapter( |                         ItemListAdapter( | ||||||
|                             this, |                             this, | ||||||
|                             items, |                             items, | ||||||
|                             customTabActivityHelper, |  | ||||||
|                             internalBrowser, |  | ||||||
|                             articleViewer, |  | ||||||
|                             appColors, |  | ||||||
|                             config |  | ||||||
|                         ) { |                         ) { | ||||||
|                             updateItems(it) |                             updateItems(it) | ||||||
|                         } |                         } | ||||||
| @@ -912,37 +478,13 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun reloadBadges() { |     private fun reloadBadges() { | ||||||
|         if (displayUnreadCount || displayAllCount) { |         if (appSettingsService.isDisplayUnreadCountEnabled() || appSettingsService.isDisplayAllCountEnabled()) { | ||||||
|             CoroutineScope(Dispatchers.Main).launch { |             CoroutineScope(Dispatchers.IO).launch { | ||||||
|                 repository.reloadBadges() |                 repository.reloadBadges() | ||||||
|                 reloadBadgeContent() |  | ||||||
|             } |             } | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun reloadBadgeContent() { |  | ||||||
|         if (displayUnreadCount) { |  | ||||||
|             tabNewBadge |  | ||||||
|                 .setText(repository.badgeUnread.toString()) |  | ||||||
|                 .maybeShow() |  | ||||||
|         } |  | ||||||
|         if (displayAllCount) { |  | ||||||
|             tabArchiveBadge |  | ||||||
|                 .setText(repository.badgeAll.toString()) |  | ||||||
|                 .maybeShow() |  | ||||||
|             tabStarredBadge |  | ||||||
|                 .setText(repository.badgeStarred.toString()) |  | ||||||
|                 .maybeShow() |  | ||||||
|         } |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     private fun reloadTagsBadges() { |  | ||||||
|         tagsBadge.forEach { |  | ||||||
|             binding.mainDrawer.updateBadge(it.key, StringHolder(it.value.toString())) |  | ||||||
|         } |  | ||||||
|         binding.mainDrawer.resetDrawerContent() |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     private fun calculateNoOfColumns(): Int { |     private fun calculateNoOfColumns(): Int { | ||||||
|         val displayMetrics = resources.displayMetrics |         val displayMetrics = resources.displayMetrics | ||||||
|         val dpWidth = displayMetrics.widthPixels / displayMetrics.density |         val dpWidth = displayMetrics.widthPixels / displayMetrics.density | ||||||
| @@ -988,14 +530,17 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|  |  | ||||||
|     override fun onOptionsItemSelected(item: MenuItem): Boolean { |     override fun onOptionsItemSelected(item: MenuItem): Boolean { | ||||||
|         when (item.itemId) { |         when (item.itemId) { | ||||||
|  |             R.id.action_filter -> { | ||||||
|  |                 val filterSheetFragment = FilterSheetFragment() | ||||||
|  |                 filterSheetFragment.show(supportFragmentManager, FilterSheetFragment.TAG) | ||||||
|  |                 return true | ||||||
|  |             } | ||||||
|             R.id.refresh -> { |             R.id.refresh -> { | ||||||
|                 needsConfirmation(R.string.menu_home_refresh, R.string.refresh_dialog_message) { |                 needsConfirmation(R.string.menu_home_refresh, R.string.refresh_dialog_message) { | ||||||
|                     Toast.makeText(this, R.string.refresh_in_progress, Toast.LENGTH_SHORT).show() |                     Toast.makeText(this, R.string.refresh_in_progress, Toast.LENGTH_SHORT).show() | ||||||
|                     // TODO: Use Dispatchers.IO |  | ||||||
|                     CoroutineScope(Dispatchers.Main).launch { |                     CoroutineScope(Dispatchers.Main).launch { | ||||||
|                         val updatedRemote = repository.updateRemote() |                         val updatedRemote = repository.updateRemote() | ||||||
|                         if (updatedRemote) { |                         if (updatedRemote) { | ||||||
|                             // TODO: Send toast messages from the repository |  | ||||||
|                             Toast.makeText( |                             Toast.makeText( | ||||||
|                                 this@HomeActivity, |                                 this@HomeActivity, | ||||||
|                                 R.string.refresh_success_response, Toast.LENGTH_LONG |                                 R.string.refresh_success_response, Toast.LENGTH_LONG | ||||||
| @@ -1027,8 +572,6 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|                                 ).show() |                                 ).show() | ||||||
|                                 tabNewBadge.removeBadge() |                                 tabNewBadge.removeBadge() | ||||||
|  |  | ||||||
|                                 handleDrawerItems() |  | ||||||
|  |  | ||||||
|                                 getElementsAccordingToTab() |                                 getElementsAccordingToTab() | ||||||
|                             } else { |                             } else { | ||||||
|                                 Toast.makeText( |                                 Toast.makeText( | ||||||
| @@ -1045,7 +588,21 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|                 return true |                 return true | ||||||
|             } |             } | ||||||
|             R.id.action_disconnect -> { |             R.id.action_disconnect -> { | ||||||
|                 return Config.logoutAndRedirect(this, this@HomeActivity) |                 CoroutineScope(Dispatchers.Main).launch { | ||||||
|  |                     repository.logout() | ||||||
|  |                 } | ||||||
|  |                 this@HomeActivity.finish() | ||||||
|  |                 val intent = Intent(this, LoginActivity::class.java) | ||||||
|  |                 this.startActivity(intent) | ||||||
|  |                 return true | ||||||
|  |             } | ||||||
|  |             R.id.action_settings -> { | ||||||
|  |                 settingsLauncher.launch(Intent(this, SettingsActivity::class.java)) | ||||||
|  |                 return true | ||||||
|  |             } | ||||||
|  |             R.id.action_sources -> { | ||||||
|  |                 startActivity(Intent(this, SourcesActivity::class.java)) | ||||||
|  |                 return true | ||||||
|             } |             } | ||||||
|             else -> return super.onOptionsItemSelected(item) |             else -> return super.onOptionsItemSelected(item) | ||||||
|         } |         } | ||||||
| @@ -1053,10 +610,10 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|  |  | ||||||
|     private fun maxItemNumber(): Int = |     private fun maxItemNumber(): Int = | ||||||
|         when (elementsShown) { |         when (elementsShown) { | ||||||
|             ItemType.UNREAD -> repository.badgeUnread |             ItemType.UNREAD -> repository.badgeUnread.value | ||||||
|             ItemType.ALL -> repository.badgeAll |             ItemType.ALL -> repository.badgeAll.value | ||||||
|             ItemType.STARRED -> repository.badgeStarred |             ItemType.STARRED -> repository.badgeStarred.value | ||||||
|             else -> repository.badgeUnread // if !elementsShown then unread are fetched. |             else -> repository.badgeUnread.value // if !elementsShown then unread are fetched. | ||||||
|         } |         } | ||||||
|  |  | ||||||
|     private fun updateItems(adapterItems: ArrayList<SelfossModel.Item>) { |     private fun updateItems(adapterItems: ArrayList<SelfossModel.Item>) { | ||||||
| @@ -1064,15 +621,15 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun handleRecurringTask() { |     private fun handleRecurringTask() { | ||||||
|         if (periodicRefresh) { |         if (appSettingsService.isPeriodicRefreshEnabled()) { | ||||||
|             val myConstraints = Constraints.Builder() |             val myConstraints = Constraints.Builder() | ||||||
|                 .setRequiresBatteryNotLow(true) |                 .setRequiresBatteryNotLow(true) | ||||||
|                 .setRequiresCharging(refreshWhenChargingOnly) |                 .setRequiresCharging(appSettingsService.isRefreshWhenChargingOnlyEnabled()) | ||||||
|                 .setRequiresStorageNotLow(true) |                 .setRequiresStorageNotLow(true) | ||||||
|                 .build() |                 .build() | ||||||
|  |  | ||||||
|             val backgroundWork = |             val backgroundWork = | ||||||
|                 PeriodicWorkRequestBuilder<LoadingWorker>(refreshMinutes, TimeUnit.MINUTES) |                 PeriodicWorkRequestBuilder<LoadingWorker>(appSettingsService.getRefreshMinutes(), TimeUnit.MINUTES) | ||||||
|                     .setConstraints(myConstraints) |                     .setConstraints(myConstraints) | ||||||
|                     .addTag("selfoss-loading") |                     .addTag("selfoss-loading") | ||||||
|                     .build() |                     .build() | ||||||
| @@ -1080,28 +637,5 @@ class HomeActivity : AppCompatActivity(), SearchView.OnQueryTextListener, DIAwar | |||||||
|             WorkManager.getInstance(baseContext).enqueueUniquePeriodicWork("selfoss-loading", ExistingPeriodicWorkPolicy.KEEP, backgroundWork) |             WorkManager.getInstance(baseContext).enqueueUniquePeriodicWork("selfoss-loading", ExistingPeriodicWorkPolicy.KEEP, backgroundWork) | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun handleOfflineActions() { |  | ||||||
|         fun doAndReportOnFail(success: Boolean, action: ACTION) { |  | ||||||
|             if (success) { |  | ||||||
|                 thread { |  | ||||||
|                     repository.deleteDBAction(action) |  | ||||||
|                 } |  | ||||||
|             } |  | ||||||
|         } |  | ||||||
|  |  | ||||||
|         CoroutineScope(Dispatchers.Main).launch { |  | ||||||
|             val actions = repository.getDBActions() |  | ||||||
|  |  | ||||||
|             actions.forEach { action -> |  | ||||||
|                 when { |  | ||||||
|                     action.read -> doAndReportOnFail(repository.markAsReadById(action.articleid.toInt()), action) |  | ||||||
|                     action.unread -> doAndReportOnFail(repository.unmarkAsReadById(action.articleid.toInt()), action) |  | ||||||
|                     action.starred -> doAndReportOnFail(repository.starrById(action.articleid.toInt()), action) |  | ||||||
|                     action.unstarred -> doAndReportOnFail(repository.unstarrById(action.articleid.toInt()), action) |  | ||||||
|                 } |  | ||||||
|             } |  | ||||||
|         } |  | ||||||
|     } |  | ||||||
| } | } | ||||||
|  |  | ||||||
|   | |||||||
| @@ -3,6 +3,7 @@ package bou.amine.apps.readerforselfossv2.android | |||||||
| import android.os.Bundle | import android.os.Bundle | ||||||
| import android.view.MenuItem | import android.view.MenuItem | ||||||
| import androidx.appcompat.app.AppCompatActivity | import androidx.appcompat.app.AppCompatActivity | ||||||
|  | import androidx.constraintlayout.motion.widget.MotionLayout | ||||||
| import androidx.fragment.app.Fragment | import androidx.fragment.app.Fragment | ||||||
| import androidx.fragment.app.FragmentActivity | import androidx.fragment.app.FragmentActivity | ||||||
| import androidx.viewpager2.adapter.FragmentStateAdapter | import androidx.viewpager2.adapter.FragmentStateAdapter | ||||||
| @@ -23,7 +24,6 @@ class ImageActivity : AppCompatActivity() { | |||||||
|         setContentView(view) |         setContentView(view) | ||||||
|  |  | ||||||
|         setSupportActionBar(binding.toolBar) |         setSupportActionBar(binding.toolBar) | ||||||
|         supportActionBar?.setDisplayShowTitleEnabled(false) |  | ||||||
|         supportActionBar?.setDisplayHomeAsUpEnabled(true) |         supportActionBar?.setDisplayHomeAsUpEnabled(true) | ||||||
|  |  | ||||||
|         allImages = intent.getStringArrayListExtra("allImages") as ArrayList<String> |         allImages = intent.getStringArrayListExtra("allImages") as ArrayList<String> | ||||||
| @@ -31,12 +31,35 @@ class ImageActivity : AppCompatActivity() { | |||||||
|  |  | ||||||
|         binding.pager.adapter = ScreenSlidePagerAdapter(this) |         binding.pager.adapter = ScreenSlidePagerAdapter(this) | ||||||
|         binding.pager.setCurrentItem(position, false) |         binding.pager.setCurrentItem(position, false) | ||||||
|  |  | ||||||
|  |         val transitionListener = object : MotionLayout.TransitionListener { | ||||||
|  |             override fun onTransitionStarted(motionLayout: MotionLayout?, startId: Int, endId: Int) { | ||||||
|  |                 // Nothing | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             override fun onTransitionChange(motionLayout: MotionLayout?, startId: Int, endId: Int, progress: Float | ||||||
|  |             ) { | ||||||
|  |                 // Nothing | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             override fun onTransitionCompleted(motionLayout: MotionLayout?, currentId: Int) { | ||||||
|  |                 if (motionLayout?.currentState == binding.root.endState) { | ||||||
|  |                     onBackPressedDispatcher.onBackPressed() | ||||||
|  |                     overridePendingTransition(0, 0) | ||||||
|  |                 } | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             override fun onTransitionTrigger(motionLayout: MotionLayout?, triggerId: Int, positive: Boolean, progress: Float) { | ||||||
|  |                 // Nothing | ||||||
|  |             } | ||||||
|  |         } | ||||||
|  |         binding.root.setTransitionListener(transitionListener) | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     override fun onOptionsItemSelected(item: MenuItem): Boolean { |     override fun onOptionsItemSelected(item: MenuItem): Boolean { | ||||||
|         when (item.itemId) { |         when (item.itemId) { | ||||||
|             android.R.id.home -> { |             android.R.id.home -> { | ||||||
|                 onBackPressed() |                 onBackPressedDispatcher.onBackPressed() | ||||||
|                 return true |                 return true | ||||||
|             } |             } | ||||||
|         } |         } | ||||||
|   | |||||||
| @@ -2,6 +2,7 @@ package bou.amine.apps.readerforselfossv2.android | |||||||
|  |  | ||||||
| import android.animation.Animator | import android.animation.Animator | ||||||
| import android.animation.AnimatorListenerAdapter | import android.animation.AnimatorListenerAdapter | ||||||
|  | import android.annotation.SuppressLint | ||||||
| import android.content.Intent | import android.content.Intent | ||||||
| import android.os.Bundle | import android.os.Bundle | ||||||
| import android.text.TextUtils | import android.text.TextUtils | ||||||
| @@ -10,39 +11,41 @@ import android.view.MenuItem | |||||||
| import android.view.View | import android.view.View | ||||||
| import android.view.inputmethod.EditorInfo | import android.view.inputmethod.EditorInfo | ||||||
| import android.widget.TextView | import android.widget.TextView | ||||||
|  | import android.widget.Toast | ||||||
| import androidx.appcompat.app.AlertDialog | import androidx.appcompat.app.AlertDialog | ||||||
| import androidx.appcompat.app.AppCompatActivity | import androidx.appcompat.app.AppCompatActivity | ||||||
|  | import androidx.appcompat.app.AppCompatDelegate | ||||||
| import bou.amine.apps.readerforselfossv2.android.databinding.ActivityLoginBinding | import bou.amine.apps.readerforselfossv2.android.databinding.ActivityLoginBinding | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.AppColors | import bou.amine.apps.readerforselfossv2.android.utils.isBaseUrlInvalid | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.isBaseUrlValid |  | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
|  | import bou.amine.apps.readerforselfossv2.service.AppSettingsService | ||||||
| import com.mikepenz.aboutlibraries.LibsBuilder | import com.mikepenz.aboutlibraries.LibsBuilder | ||||||
| import com.russhwolf.settings.Settings |  | ||||||
| import kotlinx.coroutines.CoroutineScope | import kotlinx.coroutines.CoroutineScope | ||||||
| import kotlinx.coroutines.Dispatchers | import kotlinx.coroutines.Dispatchers | ||||||
| import kotlinx.coroutines.launch | import kotlinx.coroutines.launch | ||||||
|  | import org.acra.ACRA | ||||||
| import org.kodein.di.DIAware | import org.kodein.di.DIAware | ||||||
| import org.kodein.di.android.closestDI | import org.kodein.di.android.closestDI | ||||||
| import org.kodein.di.instance | import org.kodein.di.instance | ||||||
|  |  | ||||||
| class LoginActivity() : AppCompatActivity(), DIAware { |  | ||||||
|  | class LoginActivity : AppCompatActivity(), DIAware { | ||||||
|  |  | ||||||
|     private var inValidCount: Int = 0 |     private var inValidCount: Int = 0 | ||||||
|     private var isWithSelfSignedCert = false |  | ||||||
|     private var isWithLogin = false |     private var isWithLogin = false | ||||||
|     private var isWithHTTPLogin = false |  | ||||||
|  |  | ||||||
|     private val settings = Settings() |  | ||||||
|     private lateinit var appColors: AppColors |  | ||||||
|     private lateinit var binding: ActivityLoginBinding |     private lateinit var binding: ActivityLoginBinding | ||||||
|  |  | ||||||
|     override val di by closestDI() |     override val di by closestDI() | ||||||
|     private val repository : Repository by instance() |     private val repository: Repository by instance() | ||||||
|  |     private val appSettingsService: AppSettingsService by instance() | ||||||
|  |  | ||||||
|  |  | ||||||
|     override fun onCreate(savedInstanceState: Bundle?) { |     override fun onCreate(savedInstanceState: Bundle?) { | ||||||
|         appColors = AppColors(this@LoginActivity) |  | ||||||
|  |  | ||||||
|         super.onCreate(savedInstanceState) |         super.onCreate(savedInstanceState) | ||||||
|  |  | ||||||
|  |         handleTheme() | ||||||
|  |  | ||||||
|         binding = ActivityLoginBinding.inflate(layoutInflater) |         binding = ActivityLoginBinding.inflate(layoutInflater) | ||||||
|         val view = binding.root |         val view = binding.root | ||||||
|  |  | ||||||
| @@ -52,22 +55,43 @@ class LoginActivity() : AppCompatActivity(), DIAware { | |||||||
|  |  | ||||||
|         handleBaseUrlFail() |         handleBaseUrlFail() | ||||||
|  |  | ||||||
|         if (settings.getString("url", "").isNotEmpty()) { |         if (appSettingsService.getBaseUrl().isNotEmpty()) { | ||||||
|             goToMain() |             showProgress(true) | ||||||
|  |             // This should be reverted when "old" users connected with a non-selfoss rss | ||||||
|  |             // are handled. Revert to "simple" way. | ||||||
|  |             CoroutineScope(Dispatchers.Main).launch { | ||||||
|  |                 try { | ||||||
|  |                     val (errorFetching, displaySelfossOnly) = repository.shouldBeSelfossInstance() | ||||||
|  |                     if (!errorFetching && !displaySelfossOnly) { | ||||||
|  |                         goToMain() | ||||||
|  |                     } else { | ||||||
|  |                         showProgress(false) | ||||||
|  |                         if (displaySelfossOnly) { | ||||||
|  |                             Toast.makeText( | ||||||
|  |                                 applicationContext, | ||||||
|  |                                 R.string.application_selfoss_only, | ||||||
|  |                                 Toast.LENGTH_LONG | ||||||
|  |                             ).show() | ||||||
|  |                         } | ||||||
|  |                         repository.logout() | ||||||
|  |                     } | ||||||
|  |                 } catch (e: Throwable) { | ||||||
|  |                     repository.logout() | ||||||
|  |                     showProgress(false) | ||||||
|  |                 } | ||||||
|  |             } | ||||||
|         } |         } | ||||||
|  |  | ||||||
|         handleActions() |         handleActions() | ||||||
|     } |     } | ||||||
|  |  | ||||||
|  |     @SuppressLint("WrongConstant") // Constant is fetched from the settings | ||||||
|  |     private fun handleTheme() { | ||||||
|  |         AppCompatDelegate.setDefaultNightMode(appSettingsService.getCurrentTheme()) | ||||||
|  |     } | ||||||
|  |  | ||||||
|     private fun handleActions() { |     private fun handleActions() { | ||||||
|  |  | ||||||
|         binding.withSelfhostedCert.setOnCheckedChangeListener { _, b -> |  | ||||||
|             isWithSelfSignedCert = !isWithSelfSignedCert |  | ||||||
|             val visi: Int = if (b) View.VISIBLE else View.GONE |  | ||||||
|  |  | ||||||
|             binding.warningText.visibility = visi |  | ||||||
|         } |  | ||||||
|  |  | ||||||
|         binding.passwordView.setOnEditorActionListener( |         binding.passwordView.setOnEditorActionListener( | ||||||
|             TextView.OnEditorActionListener { _, id, _ -> |             TextView.OnEditorActionListener { _, id, _ -> | ||||||
|                 if (id == R.id.loginView || id == EditorInfo.IME_NULL) { |                 if (id == R.id.loginView || id == EditorInfo.IME_NULL) { | ||||||
| @@ -87,14 +111,6 @@ class LoginActivity() : AppCompatActivity(), DIAware { | |||||||
|             binding.loginView.visibility = visi |             binding.loginView.visibility = visi | ||||||
|             binding.passwordView.visibility = visi |             binding.passwordView.visibility = visi | ||||||
|         } |         } | ||||||
|  |  | ||||||
|         binding.withHttpLogin.setOnCheckedChangeListener { _, b -> |  | ||||||
|             isWithHTTPLogin = !isWithHTTPLogin |  | ||||||
|             val visi: Int = if (b) View.VISIBLE else View.GONE |  | ||||||
|  |  | ||||||
|             binding.httpLoginView.visibility = visi |  | ||||||
|             binding.httpPasswordView.visibility = visi |  | ||||||
|         } |  | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun handleBaseUrlFail() { |     private fun handleBaseUrlFail() { | ||||||
| @@ -111,22 +127,21 @@ class LoginActivity() : AppCompatActivity(), DIAware { | |||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun goToMain() { |     private fun goToMain() { | ||||||
|  |         CoroutineScope(Dispatchers.Main).launch { | ||||||
|  |             repository.updateApiVersion() | ||||||
|  |             ACRA.errorReporter.putCustomData("SELFOSS_API_VERSION", appSettingsService.getApiVersion().toString()) | ||||||
|  |         } | ||||||
|         val intent = Intent(this, HomeActivity::class.java) |         val intent = Intent(this, HomeActivity::class.java) | ||||||
|         startActivity(intent) |         startActivity(intent) | ||||||
|         finish() |         finish() | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun preferenceError(t: Throwable) { |     private fun preferenceError() { | ||||||
|         settings.remove("url") |         appSettingsService.resetLoginInformation() | ||||||
|         settings.remove("login") |  | ||||||
|         settings.remove("httpUserName") |  | ||||||
|         settings.remove("password") |  | ||||||
|         settings.remove("httpPassword") |  | ||||||
|         binding.urlView.error = getString(R.string.wrong_infos) |         binding.urlView.error = getString(R.string.wrong_infos) | ||||||
|         binding.loginView.error = getString(R.string.wrong_infos) |         binding.loginView.error = getString(R.string.wrong_infos) | ||||||
|         binding.passwordView.error = getString(R.string.wrong_infos) |         binding.passwordView.error = getString(R.string.wrong_infos) | ||||||
|         binding.httpLoginView.error = getString(R.string.wrong_infos) |  | ||||||
|         binding.httpPasswordView.error = getString(R.string.wrong_infos) |  | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun attemptLogin() { |     private fun attemptLogin() { | ||||||
| @@ -134,24 +149,71 @@ class LoginActivity() : AppCompatActivity(), DIAware { | |||||||
|         // Reset errors. |         // Reset errors. | ||||||
|         binding.urlView.error = null |         binding.urlView.error = null | ||||||
|         binding.loginView.error = null |         binding.loginView.error = null | ||||||
|         binding.httpLoginView.error = null |  | ||||||
|         binding.passwordView.error = null |         binding.passwordView.error = null | ||||||
|         binding.httpPasswordView.error = null |  | ||||||
|  |  | ||||||
|         // Store values at the time of the login attempt. |         // Store values at the time of the login attempt. | ||||||
|         val url = binding.urlView.text.toString() |         val url = binding.urlView.text.toString().trim() | ||||||
|         val login = binding.loginView.text.toString() |         val login = binding.loginView.text.toString().trim() | ||||||
|         val httpLogin = binding.httpLoginView.text.toString() |         val password = binding.passwordView.text.toString().trim() | ||||||
|         val password = binding.passwordView.text.toString() |  | ||||||
|         val httpPassword = binding.httpPasswordView.text.toString() |  | ||||||
|  |  | ||||||
|  |         failInvalidUrl(url) | ||||||
|  |         failLoginDetails(password, login) | ||||||
|  |  | ||||||
|  |         showProgress(true) | ||||||
|  |  | ||||||
|  |         repository.refreshLoginInformation(url, login, password) | ||||||
|  |  | ||||||
|  |         CoroutineScope(Dispatchers.Main).launch { | ||||||
|  |             val result = repository.login() | ||||||
|  |             if (result) { | ||||||
|  |                 val (errorFetching, displaySelfossOnly) = repository.shouldBeSelfossInstance() | ||||||
|  |                 if (!errorFetching && !displaySelfossOnly) { | ||||||
|  |                     goToMain() | ||||||
|  |                 } else { | ||||||
|  |                     if (displaySelfossOnly) { | ||||||
|  |                         Toast.makeText( | ||||||
|  |                             applicationContext, | ||||||
|  |                             R.string.application_selfoss_only, | ||||||
|  |                             Toast.LENGTH_LONG | ||||||
|  |                         ).show() | ||||||
|  |                     } | ||||||
|  |                     preferenceError() | ||||||
|  |                 } | ||||||
|  |             } else { | ||||||
|  |                 preferenceError() | ||||||
|  |             } | ||||||
|  |             showProgress(false) | ||||||
|  |         } | ||||||
|  |     } | ||||||
|  |  | ||||||
|  |     private fun failLoginDetails( | ||||||
|  |         password: String, | ||||||
|  |         login: String | ||||||
|  |     ) { | ||||||
|  |         var lastFocusedView: View? = null | ||||||
|         var cancel = false |         var cancel = false | ||||||
|         var focusView: View? = null |         if (isWithLogin) { | ||||||
|  |             if (TextUtils.isEmpty(password)) { | ||||||
|  |                 binding.passwordView.error = getString(R.string.error_invalid_password) | ||||||
|  |                 lastFocusedView = binding.passwordView | ||||||
|  |                 cancel = true | ||||||
|  |             } | ||||||
|  |  | ||||||
|         if (!url.isBaseUrlValid(this@LoginActivity)) { |             if (TextUtils.isEmpty(login)) { | ||||||
|             binding.urlView.error = getString(R.string.login_url_problem) |                 binding.loginView.error = getString(R.string.error_field_required) | ||||||
|             focusView = binding.urlView |                 lastFocusedView = binding.loginView | ||||||
|  |                 cancel = true | ||||||
|  |             } | ||||||
|  |         } | ||||||
|  |         maybeCancelAndFocusView(cancel, lastFocusedView) | ||||||
|  |     } | ||||||
|  |  | ||||||
|  |     private fun failInvalidUrl(url: String) { | ||||||
|  |         val focusView = binding.urlView | ||||||
|  |         var cancel = false | ||||||
|  |         if (url.isBaseUrlInvalid()) { | ||||||
|             cancel = true |             cancel = true | ||||||
|  |             binding.urlView.error = getString(R.string.login_url_problem) | ||||||
|             inValidCount++ |             inValidCount++ | ||||||
|             if (inValidCount == 3) { |             if (inValidCount == 3) { | ||||||
|                 val alertDialog = AlertDialog.Builder(this).create() |                 val alertDialog = AlertDialog.Builder(this).create() | ||||||
| @@ -165,53 +227,12 @@ class LoginActivity() : AppCompatActivity(), DIAware { | |||||||
|                 inValidCount = 0 |                 inValidCount = 0 | ||||||
|             } |             } | ||||||
|         } |         } | ||||||
|  |         maybeCancelAndFocusView(cancel, focusView) | ||||||
|  |     } | ||||||
|  |  | ||||||
|         if (isWithLogin) { |     private fun maybeCancelAndFocusView(cancel: Boolean, focusView: View?) { | ||||||
|             if (TextUtils.isEmpty(password)) { |  | ||||||
|                 binding.passwordView.error = getString(R.string.error_invalid_password) |  | ||||||
|                 focusView = binding.passwordView |  | ||||||
|                 cancel = true |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             if (TextUtils.isEmpty(login)) { |  | ||||||
|                 binding.loginView.error = getString(R.string.error_field_required) |  | ||||||
|                 focusView = binding.loginView |  | ||||||
|                 cancel = true |  | ||||||
|             } |  | ||||||
|         } |  | ||||||
|  |  | ||||||
|         if (isWithHTTPLogin) { |  | ||||||
|             if (TextUtils.isEmpty(httpPassword)) { |  | ||||||
|                 binding.httpPasswordView.error = getString(R.string.error_invalid_password) |  | ||||||
|                 focusView = binding.httpPasswordView |  | ||||||
|                 cancel = true |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             if (TextUtils.isEmpty(httpLogin)) { |  | ||||||
|                 binding.httpLoginView.error = getString(R.string.error_field_required) |  | ||||||
|                 focusView = binding.httpLoginView |  | ||||||
|                 cancel = true |  | ||||||
|             } |  | ||||||
|         } |  | ||||||
|  |  | ||||||
|         if (cancel) { |         if (cancel) { | ||||||
|             focusView?.requestFocus() |             focusView?.requestFocus() | ||||||
|         } else { |  | ||||||
|             showProgress(true) |  | ||||||
|  |  | ||||||
|             repository.refreshLoginInformation(url, login, password, httpLogin, httpPassword, isWithSelfSignedCert) |  | ||||||
|  |  | ||||||
|             CoroutineScope(Dispatchers.IO).launch { |  | ||||||
|                 val result = repository.login() |  | ||||||
|                 if (result) { |  | ||||||
|                     goToMain() |  | ||||||
|                 } else { |  | ||||||
|                     CoroutineScope(Dispatchers.Main).launch { |  | ||||||
|                         preferenceError(Exception("Not success")) |  | ||||||
|                     } |  | ||||||
|                 } |  | ||||||
|             } |  | ||||||
|             showProgress(false) |  | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
| @@ -225,11 +246,11 @@ class LoginActivity() : AppCompatActivity(), DIAware { | |||||||
|             .alpha( |             .alpha( | ||||||
|                 if (show) 0F else 1F |                 if (show) 0F else 1F | ||||||
|             ).setListener(object : AnimatorListenerAdapter() { |             ).setListener(object : AnimatorListenerAdapter() { | ||||||
|             override fun onAnimationEnd(animation: Animator) { |                 override fun onAnimationEnd(animation: Animator) { | ||||||
|                 binding.loginForm.visibility = if (show) View.GONE else View.VISIBLE |                     binding.loginForm.visibility = if (show) View.GONE else View.VISIBLE | ||||||
|  |                 } | ||||||
|             } |             } | ||||||
|         } |             ) | ||||||
|         ) |  | ||||||
|  |  | ||||||
|         binding.loginProgress.visibility = if (show) View.VISIBLE else View.GONE |         binding.loginProgress.visibility = if (show) View.VISIBLE else View.GONE | ||||||
|         binding.loginProgress |         binding.loginProgress | ||||||
| @@ -238,11 +259,11 @@ class LoginActivity() : AppCompatActivity(), DIAware { | |||||||
|             .alpha( |             .alpha( | ||||||
|                 if (show) 1F else 0F |                 if (show) 1F else 0F | ||||||
|             ).setListener(object : AnimatorListenerAdapter() { |             ).setListener(object : AnimatorListenerAdapter() { | ||||||
|             override fun onAnimationEnd(animation: Animator) { |                 override fun onAnimationEnd(animation: Animator) { | ||||||
|                 binding.loginProgress.visibility = if (show) View.VISIBLE else View.GONE |                     binding.loginProgress.visibility = if (show) View.VISIBLE else View.GONE | ||||||
|  |                 } | ||||||
|             } |             } | ||||||
|         } |             ) | ||||||
|         ) |  | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     override fun onCreateOptionsMenu(menu: Menu): Boolean { |     override fun onCreateOptionsMenu(menu: Menu): Boolean { | ||||||
|   | |||||||
| @@ -3,35 +3,32 @@ package bou.amine.apps.readerforselfossv2.android | |||||||
| import android.app.NotificationChannel | import android.app.NotificationChannel | ||||||
| import android.app.NotificationManager | import android.app.NotificationManager | ||||||
| import android.content.Context | import android.content.Context | ||||||
| import android.graphics.drawable.Drawable |  | ||||||
| import android.net.Uri |  | ||||||
| import android.os.Build | import android.os.Build | ||||||
| import android.widget.ImageView |  | ||||||
| import android.widget.Toast | import android.widget.Toast | ||||||
| import androidx.lifecycle.DefaultLifecycleObserver | import androidx.lifecycle.DefaultLifecycleObserver | ||||||
| import androidx.lifecycle.LifecycleOwner | import androidx.lifecycle.LifecycleOwner | ||||||
| import androidx.lifecycle.ProcessLifecycleOwner | import androidx.lifecycle.ProcessLifecycleOwner | ||||||
| import androidx.multidex.MultiDexApplication | import androidx.multidex.MultiDexApplication | ||||||
| import androidx.preference.PreferenceManager |  | ||||||
| import bou.amine.apps.readerforselfossv2.DI.networkModule | import bou.amine.apps.readerforselfossv2.DI.networkModule | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.Config |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.glide.loadMaybeBasicAuth |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.viewmodel.AppViewModel | import bou.amine.apps.readerforselfossv2.android.viewmodel.AppViewModel | ||||||
| import bou.amine.apps.readerforselfossv2.dao.DriverFactory | import bou.amine.apps.readerforselfossv2.dao.DriverFactory | ||||||
| import bou.amine.apps.readerforselfossv2.dao.ReaderForSelfossDB | import bou.amine.apps.readerforselfossv2.dao.ReaderForSelfossDB | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
| import com.bumptech.glide.Glide | import bou.amine.apps.readerforselfossv2.service.AppSettingsService | ||||||
| import com.bumptech.glide.request.RequestOptions |  | ||||||
| import com.ftinc.scoop.Scoop |  | ||||||
| import com.github.ln_12.library.ConnectivityStatus | import com.github.ln_12.library.ConnectivityStatus | ||||||
| import com.mikepenz.materialdrawer.util.AbstractDrawerImageLoader |  | ||||||
| import com.mikepenz.materialdrawer.util.DrawerImageLoader |  | ||||||
| import com.russhwolf.settings.Settings |  | ||||||
| import io.github.aakira.napier.DebugAntilog | import io.github.aakira.napier.DebugAntilog | ||||||
| import io.github.aakira.napier.Napier | import io.github.aakira.napier.Napier | ||||||
| import kotlinx.coroutines.CoroutineScope | import kotlinx.coroutines.CoroutineScope | ||||||
| import kotlinx.coroutines.Dispatchers | import kotlinx.coroutines.Dispatchers | ||||||
|  | import kotlinx.coroutines.flow.MutableStateFlow | ||||||
| import kotlinx.coroutines.launch | import kotlinx.coroutines.launch | ||||||
|  | import org.acra.ACRA | ||||||
|  | import org.acra.ReportField | ||||||
|  | import org.acra.config.httpSender | ||||||
|  | import org.acra.config.toast | ||||||
|  | import org.acra.data.StringFormat | ||||||
|  | import org.acra.ktx.initAcra | ||||||
|  | import org.acra.sender.HttpSender | ||||||
| import org.kodein.di.* | import org.kodein.di.* | ||||||
|  |  | ||||||
| class MyApp : MultiDexApplication(), DIAware { | class MyApp : MultiDexApplication(), DIAware { | ||||||
| @@ -40,7 +37,14 @@ class MyApp : MultiDexApplication(), DIAware { | |||||||
|         import(networkModule) |         import(networkModule) | ||||||
|         bind<DriverFactory>() with singleton { DriverFactory(applicationContext) } |         bind<DriverFactory>() with singleton { DriverFactory(applicationContext) } | ||||||
|         bind<ReaderForSelfossDB>() with singleton { ReaderForSelfossDB(driverFactory.createDriver()) } |         bind<ReaderForSelfossDB>() with singleton { ReaderForSelfossDB(driverFactory.createDriver()) } | ||||||
|         bind<Repository>() with singleton { Repository(instance(), instance(), connectivityStatus, instance()) } |         bind<Repository>() with singleton { | ||||||
|  |             Repository( | ||||||
|  |                 instance(), | ||||||
|  |                 instance(), | ||||||
|  |                 isConnectionAvailable, | ||||||
|  |                 instance() | ||||||
|  |             ) | ||||||
|  |         } | ||||||
|         bind<ConnectivityStatus>() with singleton { ConnectivityStatus(applicationContext) } |         bind<ConnectivityStatus>() with singleton { ConnectivityStatus(applicationContext) } | ||||||
|         bind<AppViewModel>() with singleton { AppViewModel(repository = instance()) } |         bind<AppViewModel>() with singleton { AppViewModel(repository = instance()) } | ||||||
|     } |     } | ||||||
| @@ -49,35 +53,88 @@ class MyApp : MultiDexApplication(), DIAware { | |||||||
|     private val viewModel: AppViewModel by instance() |     private val viewModel: AppViewModel by instance() | ||||||
|     private val connectivityStatus: ConnectivityStatus by instance() |     private val connectivityStatus: ConnectivityStatus by instance() | ||||||
|     private val driverFactory: DriverFactory by instance() |     private val driverFactory: DriverFactory by instance() | ||||||
|     private lateinit var config: Config |  | ||||||
|     private lateinit var settings : Settings |     // TODO: handle with the "previous" way | ||||||
|  |     private val isConnectionAvailable: MutableStateFlow<Boolean> = MutableStateFlow(true) | ||||||
|  |  | ||||||
|     override fun onCreate() { |     override fun onCreate() { | ||||||
|         super.onCreate() |         super.onCreate() | ||||||
|         Napier.base(DebugAntilog()) |         Napier.base(DebugAntilog()) | ||||||
|         config = Config() |  | ||||||
|         settings = Settings() |  | ||||||
|  |  | ||||||
|         initDrawerImageLoader() |         if (!ACRA.isACRASenderServiceProcess()) { | ||||||
|  |             tryToHandleBug() | ||||||
|  |  | ||||||
|         initTheme() |             handleNotificationChannels() | ||||||
|  |  | ||||||
|         tryToHandleBug() |             ProcessLifecycleOwner.get().lifecycle.addObserver( | ||||||
|  |                 AppLifeCycleObserver( | ||||||
|  |                     connectivityStatus, | ||||||
|  |                     repository | ||||||
|  |                 ) | ||||||
|  |             ) | ||||||
|  |  | ||||||
|         handleNotificationChannels() |             CoroutineScope(Dispatchers.Main).launch { | ||||||
|  |                 viewModel.networkAvailableProvider.collect { networkAvailable -> | ||||||
|  |                     val toastMessage = if (networkAvailable) { | ||||||
|  |                         repository.handleDBActions() | ||||||
|  |                         R.string.network_connectivity_retrieved | ||||||
|  |                     } else { | ||||||
|  |                         R.string.network_connectivity_lost | ||||||
|  |                     } | ||||||
|  |  | ||||||
|         ProcessLifecycleOwner.get().lifecycle.addObserver(AppLifeCycleObserver(connectivityStatus, repository)) |                     Toast.makeText( | ||||||
|  |                         applicationContext, | ||||||
|         CoroutineScope(Dispatchers.Main).launch { |                         toastMessage, | ||||||
|             viewModel.toastMessageProvider.collect { toastMessage -> |                         Toast.LENGTH_SHORT | ||||||
|                 Toast.makeText( |                     ).show() | ||||||
|                     applicationContext, |                 } | ||||||
|                     toastMessage, |  | ||||||
|                     Toast.LENGTH_SHORT |  | ||||||
|                 ).show() |  | ||||||
|             } |             } | ||||||
|         } |         } | ||||||
|  |  | ||||||
|  |         repository.migrate(driverFactory) | ||||||
|  |     } | ||||||
|  |  | ||||||
|  |     override fun attachBaseContext(base: Context?) { | ||||||
|  |         super.attachBaseContext(base) | ||||||
|  |  | ||||||
|  |         initAcra { | ||||||
|  |             reportFormat = StringFormat.JSON | ||||||
|  |             reportContent = listOf( | ||||||
|  |                 ReportField.REPORT_ID, | ||||||
|  |                 ReportField.INSTALLATION_ID, | ||||||
|  |                 ReportField.APP_VERSION_CODE, | ||||||
|  |                 ReportField.APP_VERSION_NAME, | ||||||
|  |                 ReportField.BUILD, | ||||||
|  |                 ReportField.ANDROID_VERSION, | ||||||
|  |                 ReportField.BRAND, | ||||||
|  |                 ReportField.PHONE_MODEL, | ||||||
|  |                 ReportField.AVAILABLE_MEM_SIZE, | ||||||
|  |                 ReportField.TOTAL_MEM_SIZE, | ||||||
|  |                 ReportField.STACK_TRACE, | ||||||
|  |                 ReportField.APPLICATION_LOG, | ||||||
|  |                 ReportField.LOGCAT, | ||||||
|  |                 ReportField.INITIAL_CONFIGURATION, | ||||||
|  |                 ReportField.CRASH_CONFIGURATION, | ||||||
|  |                 ReportField.IS_SILENT, | ||||||
|  |                 ReportField.USER_APP_START_DATE, | ||||||
|  |                 ReportField.USER_COMMENT, | ||||||
|  |                 ReportField.USER_CRASH_DATE, | ||||||
|  |                 ReportField.USER_EMAIL, | ||||||
|  |                 ReportField.CUSTOM_DATA | ||||||
|  |             ) | ||||||
|  |             toast { | ||||||
|  |                 //required | ||||||
|  |                 text = getString(R.string.crash_toast_text) | ||||||
|  |                 length = Toast.LENGTH_SHORT | ||||||
|  |             } | ||||||
|  |             httpSender { | ||||||
|  |                 uri = | ||||||
|  |                     "https://bugs.amine-louveau.fr/report" /*best guess, you may need to adjust this*/ | ||||||
|  |                 basicAuthLogin = "LMTlLZuazADohTCm" | ||||||
|  |                 basicAuthPassword = "he6ghHp83F0PYPfh" | ||||||
|  |                 httpMethod = HttpSender.Method.POST | ||||||
|  |             } | ||||||
|  |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun handleNotificationChannels() { |     private fun handleNotificationChannels() { | ||||||
| @@ -86,59 +143,39 @@ class MyApp : MultiDexApplication(), DIAware { | |||||||
|  |  | ||||||
|             val name = getString(R.string.notification_channel_sync) |             val name = getString(R.string.notification_channel_sync) | ||||||
|             val importance = NotificationManager.IMPORTANCE_LOW |             val importance = NotificationManager.IMPORTANCE_LOW | ||||||
|             val mChannel = NotificationChannel(Config.syncChannelId, name, importance) |             val mChannel = NotificationChannel(AppSettingsService.syncChannelId, name, importance) | ||||||
|  |  | ||||||
|             val newItemsChannelname = getString(R.string.new_items_channel_sync) |             val newItemsChannelname = getString(R.string.new_items_channel_sync) | ||||||
|             val newItemsChannelimportance = NotificationManager.IMPORTANCE_DEFAULT |             val newItemsChannelimportance = NotificationManager.IMPORTANCE_DEFAULT | ||||||
|             val newItemsChannelmChannel = NotificationChannel(Config.newItemsChannelId, newItemsChannelname, newItemsChannelimportance) |             val newItemsChannelmChannel = NotificationChannel( | ||||||
|  |                 AppSettingsService.newItemsChannelId, | ||||||
|  |                 newItemsChannelname, | ||||||
|  |                 newItemsChannelimportance | ||||||
|  |             ) | ||||||
|  |  | ||||||
|             notificationManager.createNotificationChannel(mChannel) |             notificationManager.createNotificationChannel(mChannel) | ||||||
|             notificationManager.createNotificationChannel(newItemsChannelmChannel) |             notificationManager.createNotificationChannel(newItemsChannelmChannel) | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun initDrawerImageLoader() { |  | ||||||
|         DrawerImageLoader.init(object : AbstractDrawerImageLoader() { |  | ||||||
|             override fun set(imageView: ImageView, uri: Uri, placeholder: Drawable, tag: String?) { |  | ||||||
|                 Glide.with(imageView.context) |  | ||||||
|                     .loadMaybeBasicAuth(config, uri.toString()) |  | ||||||
|                     .apply(RequestOptions.fitCenterTransform().placeholder(placeholder)) |  | ||||||
|                     .into(imageView) |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             override fun cancel(imageView: ImageView) { |  | ||||||
|                 Glide.with(imageView.context).clear(imageView) |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             override fun placeholder(ctx: Context, tag: String?): Drawable { |  | ||||||
|                 return baseContext.resources.getDrawable(R.mipmap.ic_launcher) |  | ||||||
|             } |  | ||||||
|         }) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     private fun initTheme() { |  | ||||||
|         Scoop.waffleCone() |  | ||||||
|             .addFlavor(getString(R.string.default_theme), R.style.NoBar, true) |  | ||||||
|             .addFlavor(getString(R.string.default_dark_theme), R.style.NoBarDark, false) |  | ||||||
|             .setSharedPreferences(PreferenceManager.getDefaultSharedPreferences(this)) |  | ||||||
|             .initialize() |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     private fun tryToHandleBug() { |     private fun tryToHandleBug() { | ||||||
|         val oldHandler = Thread.getDefaultUncaughtExceptionHandler() |         val oldHandler = Thread.getDefaultUncaughtExceptionHandler() | ||||||
|  |  | ||||||
|         Thread.setDefaultUncaughtExceptionHandler { thread, e -> |         Thread.setDefaultUncaughtExceptionHandler { thread, e -> | ||||||
|             if (e is java.lang.NoClassDefFoundError && e.stackTrace.asList().any { |             if (e is NoClassDefFoundError && e.stackTrace.asList().any { | ||||||
|                     it.toString().contains("android.view.ViewDebug") |                     it.toString().contains("android.view.ViewDebug") | ||||||
|                 }) { |                 }) { | ||||||
|                 Unit |                 // Nothing | ||||||
|             } else { |             } else { | ||||||
|                 oldHandler.uncaughtException(thread, e) |                 oldHandler.uncaughtException(thread, e) | ||||||
|             } |             } | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     class AppLifeCycleObserver(val connectivityStatus: ConnectivityStatus, val repository: Repository) : DefaultLifecycleObserver { |     class AppLifeCycleObserver( | ||||||
|  |         val connectivityStatus: ConnectivityStatus, | ||||||
|  |         val repository: Repository | ||||||
|  |     ) : DefaultLifecycleObserver { | ||||||
|  |  | ||||||
|         override fun onResume(owner: LifecycleOwner) { |         override fun onResume(owner: LifecycleOwner) { | ||||||
|             super.onResume(owner) |             super.onResume(owner) | ||||||
|   | |||||||
| @@ -12,12 +12,9 @@ import androidx.viewpager2.adapter.FragmentStateAdapter | |||||||
| import androidx.viewpager2.widget.ViewPager2 | import androidx.viewpager2.widget.ViewPager2 | ||||||
| import bou.amine.apps.readerforselfossv2.android.databinding.ActivityReaderBinding | import bou.amine.apps.readerforselfossv2.android.databinding.ActivityReaderBinding | ||||||
| import bou.amine.apps.readerforselfossv2.android.fragments.ArticleFragment | import bou.amine.apps.readerforselfossv2.android.fragments.ArticleFragment | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.AppColors |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.Toppings |  | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository |  | ||||||
| import bou.amine.apps.readerforselfossv2.model.SelfossModel | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
| import com.ftinc.scoop.Scoop | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
| import com.russhwolf.settings.Settings | import bou.amine.apps.readerforselfossv2.service.AppSettingsService | ||||||
| import kotlinx.coroutines.CoroutineScope | import kotlinx.coroutines.CoroutineScope | ||||||
| import kotlinx.coroutines.Dispatchers | import kotlinx.coroutines.Dispatchers | ||||||
| import kotlinx.coroutines.launch | import kotlinx.coroutines.launch | ||||||
| @@ -27,26 +24,23 @@ import org.kodein.di.instance | |||||||
|  |  | ||||||
| class ReaderActivity : AppCompatActivity(), DIAware { | class ReaderActivity : AppCompatActivity(), DIAware { | ||||||
|  |  | ||||||
|     private var markOnScroll: Boolean = false |  | ||||||
|     private var currentItem: Int = 0 |     private var currentItem: Int = 0 | ||||||
|     private lateinit var appColors: AppColors |  | ||||||
|  |  | ||||||
|     private lateinit var toolbarMenu: Menu |     private lateinit var toolbarMenu: Menu | ||||||
|  |  | ||||||
|     private lateinit var binding: ActivityReaderBinding |     private lateinit var binding: ActivityReaderBinding | ||||||
|  |  | ||||||
|     private var activeAlignment: Int = 1 |     private var allItems: ArrayList<SelfossModel.Item> = ArrayList() | ||||||
|     private val JUSTIFY = 1 |  | ||||||
|     private val ALIGN_LEFT = 2 |  | ||||||
|  |  | ||||||
|     override val di by closestDI() |     override val di by closestDI() | ||||||
|     private val repository: Repository by instance() |     private val repository: Repository by instance() | ||||||
|  |     private val appSettingsService: AppSettingsService by instance() | ||||||
|  |  | ||||||
|     private fun showMenuItem(willAddToFavorite: Boolean) { |     private fun showMenuItem(willAddToFavorite: Boolean) { | ||||||
|         if (willAddToFavorite) { |         if (willAddToFavorite) { | ||||||
|             toolbarMenu.findItem(R.id.star).icon.setTint(Color.WHITE) |             toolbarMenu.findItem(R.id.star).icon?.setTint(Color.WHITE) | ||||||
|         } else { |         } else { | ||||||
|             toolbarMenu.findItem(R.id.star).icon.setTint(Color.RED) |             toolbarMenu.findItem(R.id.star).icon?.setTint(Color.RED) | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
| @@ -58,33 +52,25 @@ class ReaderActivity : AppCompatActivity(), DIAware { | |||||||
|         showMenuItem(false) |         showMenuItem(false) | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private var settings = Settings() |  | ||||||
|  |  | ||||||
|     override fun onCreate(savedInstanceState: Bundle?) { |     override fun onCreate(savedInstanceState: Bundle?) { | ||||||
|         super.onCreate(savedInstanceState) |         super.onCreate(savedInstanceState) | ||||||
|         appColors = AppColors(this) |  | ||||||
|         binding = ActivityReaderBinding.inflate(layoutInflater) |         binding = ActivityReaderBinding.inflate(layoutInflater) | ||||||
|         val view = binding.root |         val view = binding.root | ||||||
|  |  | ||||||
|         setContentView(view) |         setContentView(view) | ||||||
|  |  | ||||||
|         val scoop = Scoop.getInstance() |  | ||||||
|         scoop.bind(this, Toppings.PRIMARY.value, binding.toolBar) |  | ||||||
|         scoop.bindStatusBar(this, Toppings.PRIMARY_DARK.value) |  | ||||||
|  |  | ||||||
|         setSupportActionBar(binding.toolBar) |         setSupportActionBar(binding.toolBar) | ||||||
|         supportActionBar?.setDisplayHomeAsUpEnabled(true) |         supportActionBar?.setDisplayHomeAsUpEnabled(true) | ||||||
|         supportActionBar?.setDisplayShowHomeEnabled(true) |         supportActionBar?.setDisplayShowHomeEnabled(true) | ||||||
|  |  | ||||||
|         markOnScroll = settings.getBoolean("mark_on_scroll", false) |         currentItem = intent.getIntExtra("currentItem", 0) | ||||||
|         activeAlignment = settings.getInt("text_align", JUSTIFY) |  | ||||||
|  |  | ||||||
|         if (allItems.isEmpty()) { |         allItems = repository.getReaderItems() | ||||||
|  |  | ||||||
|  |         if (allItems.isEmpty() || currentItem > allItems.size) { | ||||||
|             finish() |             finish() | ||||||
|         } |         } | ||||||
|  |  | ||||||
|         currentItem = intent.getIntExtra("currentItem", 0) |  | ||||||
|  |  | ||||||
|         readItem(allItems[currentItem]) |         readItem(allItems[currentItem]) | ||||||
|  |  | ||||||
|         binding.pager.adapter = ScreenSlidePagerAdapter(this) |         binding.pager.adapter = ScreenSlidePagerAdapter(this) | ||||||
| @@ -98,10 +84,9 @@ class ReaderActivity : AppCompatActivity(), DIAware { | |||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun readItem(item: SelfossModel.Item) { |     private fun readItem(item: SelfossModel.Item) { | ||||||
|         if (markOnScroll) { |         if (appSettingsService.isMarkOnScrollEnabled()) { | ||||||
|             CoroutineScope(Dispatchers.IO).launch { |             CoroutineScope(Dispatchers.IO).launch { | ||||||
|                 repository.markAsRead(item) |                 repository.markAsRead(item) | ||||||
|                 // TODO: Handle failure |  | ||||||
|             } |             } | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
| @@ -142,7 +127,7 @@ class ReaderActivity : AppCompatActivity(), DIAware { | |||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun alignmentMenu() { |     private fun alignmentMenu() { | ||||||
|         val showJustify = activeAlignment == ALIGN_LEFT |         val showJustify = appSettingsService.getActiveAllignment() == AppSettingsService.ALIGN_LEFT | ||||||
|         toolbarMenu.findItem(R.id.align_left).isVisible = !showJustify |         toolbarMenu.findItem(R.id.align_left).isVisible = !showJustify | ||||||
|         toolbarMenu.findItem(R.id.align_justify).isVisible = showJustify |         toolbarMenu.findItem(R.id.align_justify).isVisible = showJustify | ||||||
|     } |     } | ||||||
| @@ -199,33 +184,29 @@ class ReaderActivity : AppCompatActivity(), DIAware { | |||||||
|                 if (allItems[binding.pager.currentItem].starred) { |                 if (allItems[binding.pager.currentItem].starred) { | ||||||
|                     CoroutineScope(Dispatchers.IO).launch { |                     CoroutineScope(Dispatchers.IO).launch { | ||||||
|                         repository.unstarr(allItems[binding.pager.currentItem]) |                         repository.unstarr(allItems[binding.pager.currentItem]) | ||||||
|                         // TODO: Handle failure |  | ||||||
|                     } |                     } | ||||||
|                     afterUnsave() |                     afterUnsave() | ||||||
|                 } else { |                 } else { | ||||||
|                     CoroutineScope(Dispatchers.IO).launch { |                     CoroutineScope(Dispatchers.IO).launch { | ||||||
|                         repository.starr(allItems[binding.pager.currentItem]) |                         repository.starr(allItems[binding.pager.currentItem]) | ||||||
|                         // TODO: Handle failure |  | ||||||
|                     } |                     } | ||||||
|                     afterSave() |                     afterSave() | ||||||
|                 } |                 } | ||||||
|             } |             } | ||||||
|             R.id.align_left -> { |             R.id.align_left -> { | ||||||
|                 activeAlignment = ALIGN_LEFT |                 switchAlignmentSetting(AppSettingsService.ALIGN_LEFT) | ||||||
|                 switchAlignmentSetting() |  | ||||||
|                 refreshFragment() |                 refreshFragment() | ||||||
|             } |             } | ||||||
|             R.id.align_justify -> { |             R.id.align_justify -> { | ||||||
|                 activeAlignment = JUSTIFY |                 switchAlignmentSetting(AppSettingsService.JUSTIFY) | ||||||
|                 switchAlignmentSetting() |  | ||||||
|                 refreshFragment() |                 refreshFragment() | ||||||
|             } |             } | ||||||
|         } |         } | ||||||
|         return super.onOptionsItemSelected(item) |         return super.onOptionsItemSelected(item) | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun switchAlignmentSetting() { |     private fun switchAlignmentSetting(allignment: Int) { | ||||||
|         settings.putInt("text_align", activeAlignment) |         appSettingsService.changeAllignment(allignment) | ||||||
|         alignmentMenu() |         alignmentMenu() | ||||||
|     } |     } | ||||||
|  |  | ||||||
| @@ -235,8 +216,4 @@ class ReaderActivity : AppCompatActivity(), DIAware { | |||||||
|         startActivity(intent) |         startActivity(intent) | ||||||
|         overridePendingTransition(0, 0) |         overridePendingTransition(0, 0) | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     companion object { |  | ||||||
|         var allItems: ArrayList<SelfossModel.Item> = ArrayList() |  | ||||||
|     } |  | ||||||
| } | } | ||||||
|   | |||||||
| @@ -8,11 +8,8 @@ import androidx.appcompat.app.AppCompatActivity | |||||||
| import androidx.recyclerview.widget.LinearLayoutManager | import androidx.recyclerview.widget.LinearLayoutManager | ||||||
| import bou.amine.apps.readerforselfossv2.android.adapters.SourcesListAdapter | import bou.amine.apps.readerforselfossv2.android.adapters.SourcesListAdapter | ||||||
| import bou.amine.apps.readerforselfossv2.android.databinding.ActivitySourcesBinding | import bou.amine.apps.readerforselfossv2.android.databinding.ActivitySourcesBinding | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.AppColors |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.Toppings |  | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository |  | ||||||
| import bou.amine.apps.readerforselfossv2.model.SelfossModel | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
| import com.ftinc.scoop.Scoop | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
| import kotlinx.coroutines.CoroutineScope | import kotlinx.coroutines.CoroutineScope | ||||||
| import kotlinx.coroutines.Dispatchers | import kotlinx.coroutines.Dispatchers | ||||||
| import kotlinx.coroutines.launch | import kotlinx.coroutines.launch | ||||||
| @@ -22,21 +19,15 @@ import org.kodein.di.instance | |||||||
|  |  | ||||||
| class SourcesActivity : AppCompatActivity(), DIAware { | class SourcesActivity : AppCompatActivity(), DIAware { | ||||||
|  |  | ||||||
|     private lateinit var appColors: AppColors |  | ||||||
|     private lateinit var binding: ActivitySourcesBinding |     private lateinit var binding: ActivitySourcesBinding | ||||||
|  |  | ||||||
|     override val di by closestDI() |     override val di by closestDI() | ||||||
|     private val repository : Repository by instance() |     private val repository : Repository by instance() | ||||||
|  |  | ||||||
|     override fun onCreate(savedInstanceState: Bundle?) { |     override fun onCreate(savedInstanceState: Bundle?) { | ||||||
|         appColors = AppColors(this@SourcesActivity) |  | ||||||
|         binding = ActivitySourcesBinding.inflate(layoutInflater) |         binding = ActivitySourcesBinding.inflate(layoutInflater) | ||||||
|         val view = binding.root |         val view = binding.root | ||||||
|  |  | ||||||
|         val scoop = Scoop.getInstance() |  | ||||||
|         scoop.bind(this, Toppings.PRIMARY.value, binding.toolbar) |  | ||||||
|         scoop.bindStatusBar(this, Toppings.PRIMARY_DARK.value) |  | ||||||
|  |  | ||||||
|         super.onCreate(savedInstanceState) |         super.onCreate(savedInstanceState) | ||||||
|  |  | ||||||
|         setContentView(view) |         setContentView(view) | ||||||
| @@ -45,8 +36,8 @@ class SourcesActivity : AppCompatActivity(), DIAware { | |||||||
|         supportActionBar?.setDisplayHomeAsUpEnabled(true) |         supportActionBar?.setDisplayHomeAsUpEnabled(true) | ||||||
|         supportActionBar?.setDisplayShowHomeEnabled(true) |         supportActionBar?.setDisplayShowHomeEnabled(true) | ||||||
|  |  | ||||||
|         binding.fab.rippleColor = appColors.colorAccentDark |         binding.fab.rippleColor = resources.getColor(R.color.colorAccentDark) | ||||||
|         binding.fab.backgroundTintList = ColorStateList.valueOf(appColors.colorAccent) |         binding.fab.backgroundTintList = ColorStateList.valueOf(resources.getColor(R.color.colorAccent)) | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     override fun onStop() { |     override fun onStop() { | ||||||
| @@ -65,20 +56,13 @@ class SourcesActivity : AppCompatActivity(), DIAware { | |||||||
|  |  | ||||||
|         CoroutineScope(Dispatchers.Main).launch { |         CoroutineScope(Dispatchers.Main).launch { | ||||||
|             val response = repository.getSources() |             val response = repository.getSources() | ||||||
|             if (response != null) { |             if (response.isNotEmpty()) { | ||||||
|                 items = response |                 items = response | ||||||
|                 val mAdapter = SourcesListAdapter( |                 val mAdapter = SourcesListAdapter( | ||||||
|                     this@SourcesActivity, items |                     this@SourcesActivity, items | ||||||
|                 ) |                 ) | ||||||
|                 binding.recyclerView.adapter = mAdapter |                 binding.recyclerView.adapter = mAdapter | ||||||
|                 mAdapter.notifyDataSetChanged() |                 mAdapter.notifyDataSetChanged() | ||||||
|                 if (items.isEmpty()) { |  | ||||||
|                     Toast.makeText( |  | ||||||
|                         this@SourcesActivity, |  | ||||||
|                         R.string.nothing_here, |  | ||||||
|                         Toast.LENGTH_SHORT |  | ||||||
|                     ).show() |  | ||||||
|                 } |  | ||||||
|             } else { |             } else { | ||||||
|                 Toast.makeText( |                 Toast.makeText( | ||||||
|                     this@SourcesActivity, |                     this@SourcesActivity, | ||||||
| @@ -89,7 +73,7 @@ class SourcesActivity : AppCompatActivity(), DIAware { | |||||||
|         } |         } | ||||||
|  |  | ||||||
|         binding.fab.setOnClickListener { |         binding.fab.setOnClickListener { | ||||||
|             startActivity(Intent(this@SourcesActivity, AddSourceActivity::class.java)) |             startActivity(Intent(this@SourcesActivity, UpsertSourceActivity::class.java)) | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
| } | } | ||||||
|   | |||||||
| @@ -3,17 +3,17 @@ package bou.amine.apps.readerforselfossv2.android | |||||||
| import android.content.Intent | import android.content.Intent | ||||||
| import android.os.Bundle | import android.os.Bundle | ||||||
| import android.view.View | import android.view.View | ||||||
| import android.widget.* | import android.widget.AdapterView | ||||||
|  | import android.widget.ArrayAdapter | ||||||
|  | import android.widget.TextView | ||||||
|  | import android.widget.Toast | ||||||
| import androidx.appcompat.app.AppCompatActivity | import androidx.appcompat.app.AppCompatActivity | ||||||
| import androidx.constraintlayout.widget.ConstraintLayout | import bou.amine.apps.readerforselfossv2.android.databinding.ActivityUpsertSourceBinding | ||||||
| import bou.amine.apps.readerforselfossv2.android.databinding.ActivityAddSourceBinding | import bou.amine.apps.readerforselfossv2.android.utils.isBaseUrlInvalid | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.AppColors |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.Toppings |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.Config |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.isBaseUrlValid |  | ||||||
| import bou.amine.apps.readerforselfossv2.model.NetworkUnavailableException | import bou.amine.apps.readerforselfossv2.model.NetworkUnavailableException | ||||||
|  | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
| import com.ftinc.scoop.Scoop | import bou.amine.apps.readerforselfossv2.service.AppSettingsService | ||||||
| import kotlinx.coroutines.CoroutineScope | import kotlinx.coroutines.CoroutineScope | ||||||
| import kotlinx.coroutines.Dispatchers | import kotlinx.coroutines.Dispatchers | ||||||
| import kotlinx.coroutines.launch | import kotlinx.coroutines.launch | ||||||
| @@ -22,81 +22,73 @@ import org.kodein.di.android.closestDI | |||||||
| import org.kodein.di.instance | import org.kodein.di.instance | ||||||
| 
 | 
 | ||||||
| 
 | 
 | ||||||
| class AddSourceActivity : AppCompatActivity(), DIAware { | class UpsertSourceActivity : AppCompatActivity(), DIAware { | ||||||
| 
 | 
 | ||||||
|  |     private var existingSource: SelfossModel.Source? = null | ||||||
|     private var mSpoutsValue: String? = null |     private var mSpoutsValue: String? = null | ||||||
| 
 | 
 | ||||||
|     private lateinit var appColors: AppColors |     private lateinit var binding: ActivityUpsertSourceBinding | ||||||
|     private lateinit var binding: ActivityAddSourceBinding |  | ||||||
| 
 | 
 | ||||||
|     override val di by closestDI() |     override val di by closestDI() | ||||||
|     private val repository : Repository by instance() |     private val repository: Repository by instance() | ||||||
|  |     private val appSettingsService: AppSettingsService by instance() | ||||||
| 
 | 
 | ||||||
|     override fun onCreate(savedInstanceState: Bundle?) { |     override fun onCreate(savedInstanceState: Bundle?) { | ||||||
|         appColors = AppColors(this@AddSourceActivity) |  | ||||||
| 
 |  | ||||||
|         super.onCreate(savedInstanceState) |         super.onCreate(savedInstanceState) | ||||||
|         binding = ActivityAddSourceBinding.inflate(layoutInflater) |         binding = ActivityUpsertSourceBinding.inflate(layoutInflater) | ||||||
|         val view = binding.root |         val view = binding.root | ||||||
| 
 | 
 | ||||||
|  |         existingSource = repository.getSelectedSource() | ||||||
|  |         if (existingSource != null) { | ||||||
|  |             binding.formContainer.visibility = View.GONE | ||||||
|  |             binding.progress.visibility = View.VISIBLE | ||||||
|  |         } | ||||||
|  |         val title = if (existingSource == null) R.string.add_source else R.string.update_source | ||||||
|  | 
 | ||||||
|  |         supportFragmentManager.addOnBackStackChangedListener { | ||||||
|  |             if (supportFragmentManager.backStackEntryCount == 0) { | ||||||
|  |                 setTitle(title) | ||||||
|  |             } | ||||||
|  |         } | ||||||
|  | 
 | ||||||
|         setContentView(view) |         setContentView(view) | ||||||
| 
 | 
 | ||||||
|         val scoop = Scoop.getInstance() |  | ||||||
|         scoop.bind(this, Toppings.PRIMARY.value, binding.toolbar) |  | ||||||
|         scoop.bindStatusBar(this, Toppings.PRIMARY_DARK.value) |  | ||||||
| 
 |  | ||||||
|         val drawable = binding.nameInput.background |  | ||||||
|         drawable.setTint(appColors.colorAccent) |  | ||||||
| 
 |  | ||||||
| 
 |  | ||||||
|         // TODO: clean |  | ||||||
|         binding.nameInput.background = drawable |  | ||||||
| 
 |  | ||||||
|         val drawable1 = binding.sourceUri.background |  | ||||||
|         drawable1.setTint(appColors.colorAccent) |  | ||||||
| 
 |  | ||||||
|         binding.sourceUri.background = drawable1 |  | ||||||
| 
 |  | ||||||
|         val drawable2 = binding.tags.background |  | ||||||
|         drawable2.setTint(appColors.colorAccent) |  | ||||||
| 
 |  | ||||||
|         binding.tags.background = drawable2 |  | ||||||
| 
 |  | ||||||
|         setSupportActionBar(binding.toolbar) |         setSupportActionBar(binding.toolbar) | ||||||
|         supportActionBar?.setDisplayHomeAsUpEnabled(true) |         supportActionBar?.setDisplayHomeAsUpEnabled(true) | ||||||
|         supportActionBar?.setDisplayShowHomeEnabled(true) |         supportActionBar?.setDisplayShowHomeEnabled(true) | ||||||
|  |         supportActionBar?.title = resources.getString(title) | ||||||
| 
 | 
 | ||||||
|         maybeGetDetailsFromIntentSharing(intent, binding.sourceUri, binding.nameInput) |  | ||||||
| 
 | 
 | ||||||
|         binding.saveBtn.setTextColor(appColors.colorAccent) |         maybeGetDetailsFromIntentSharing(intent) | ||||||
| 
 | 
 | ||||||
|         binding.saveBtn.setOnClickListener { |         binding.saveBtn.setOnClickListener { | ||||||
|             handleSaveSource( |             handleSaveSource() | ||||||
|                 binding.tags, |  | ||||||
|                 binding.nameInput.text.toString(), |  | ||||||
|                 binding.sourceUri.text.toString() |  | ||||||
|             ) |  | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
| 
 | 
 | ||||||
|  |     private fun initFields(items: Map<String, SelfossModel.Spout>) { | ||||||
|  |         binding.nameInput.setText(existingSource!!.title) | ||||||
|  |         binding.tags.setText(existingSource!!.tags.joinToString(", ")) | ||||||
|  |         binding.sourceUri.setText(existingSource!!.params?.url) | ||||||
|  |         binding.spoutsSpinner.setSelection(items.keys.indexOf(existingSource!!.spout)) | ||||||
|  |         binding.progress.visibility = View.GONE | ||||||
|  |         binding.formContainer.visibility = View.VISIBLE | ||||||
|  |     } | ||||||
|  | 
 | ||||||
|     override fun onResume() { |     override fun onResume() { | ||||||
|         super.onResume() |         super.onResume() | ||||||
|         val config = Config() |  | ||||||
| 
 | 
 | ||||||
|         if (config.baseUrl.isEmpty() || !config.baseUrl.isBaseUrlValid(this@AddSourceActivity)) { |         val baseUrl = appSettingsService.getBaseUrl() | ||||||
|  |         if (baseUrl.isEmpty() || baseUrl.isBaseUrlInvalid()) { | ||||||
|             mustLoginToAddSource() |             mustLoginToAddSource() | ||||||
|         } else { |         } else { | ||||||
|             handleSpoutsSpinner(binding.spoutsSpinner, binding.progress, binding.formContainer) |             handleSpoutsSpinner() | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
| 
 | 
 | ||||||
|     private fun handleSpoutsSpinner( |     private fun handleSpoutsSpinner() { | ||||||
|         spoutsSpinner: Spinner, |  | ||||||
|         mProgress: ProgressBar, |  | ||||||
|         formContainer: ConstraintLayout |  | ||||||
|     ) { |  | ||||||
|         val spoutsKV = HashMap<String, String>() |         val spoutsKV = HashMap<String, String>() | ||||||
|         spoutsSpinner.onItemSelectedListener = object : AdapterView.OnItemSelectedListener { |         binding.spoutsSpinner.onItemSelectedListener = object : AdapterView.OnItemSelectedListener { | ||||||
|             override fun onItemSelected(adapterView: AdapterView<*>, view: View?, i: Int, l: Long) { |             override fun onItemSelected(adapterView: AdapterView<*>, view: View?, i: Int, l: Long) { | ||||||
|                 if (view != null) { |                 if (view != null) { | ||||||
|                     val spoutName = (view as TextView).text.toString() |                     val spoutName = (view as TextView).text.toString() | ||||||
| @@ -112,33 +104,37 @@ class AddSourceActivity : AppCompatActivity(), DIAware { | |||||||
| 
 | 
 | ||||||
|         fun handleSpoutFailure(networkIssue: Boolean = false) { |         fun handleSpoutFailure(networkIssue: Boolean = false) { | ||||||
|             Toast.makeText( |             Toast.makeText( | ||||||
|                 this@AddSourceActivity, |                 this@UpsertSourceActivity, | ||||||
|                 if (networkIssue) R.string.cant_get_spouts_no_network else R.string.cant_get_spouts, |                 if (networkIssue) R.string.cant_get_spouts_no_network else R.string.cant_get_spouts, | ||||||
|                 Toast.LENGTH_SHORT |                 Toast.LENGTH_SHORT | ||||||
|             ).show() |             ).show() | ||||||
|             mProgress.visibility = View.GONE |             binding.progress.visibility = View.GONE | ||||||
|         } |         } | ||||||
| 
 | 
 | ||||||
|         CoroutineScope(Dispatchers.Main).launch { |         CoroutineScope(Dispatchers.Main).launch { | ||||||
|             try { |             try { | ||||||
|                 val items = repository.getSpouts() |                 val items = repository.getSpouts() | ||||||
|                 if (items != null) { |                 if (items.isNotEmpty()) { | ||||||
|                     val itemsStrings = items.map { it.value.name } |                     val itemsStrings = items.map { it.value.name } | ||||||
|                     for ((key, value) in items) { |                     for ((key, value) in items) { | ||||||
|                         spoutsKV[value.name] = key |                         spoutsKV[value.name] = key | ||||||
|                     } |                     } | ||||||
| 
 | 
 | ||||||
|                     mProgress.visibility = View.GONE |                     binding.progress.visibility = View.GONE | ||||||
|                     formContainer.visibility = View.VISIBLE |                     binding.formContainer.visibility = View.VISIBLE | ||||||
| 
 | 
 | ||||||
|                     val spinnerArrayAdapter = |                     val spinnerArrayAdapter = | ||||||
|                         ArrayAdapter( |                         ArrayAdapter( | ||||||
|                             this@AddSourceActivity, |                             this@UpsertSourceActivity, | ||||||
|                             android.R.layout.simple_spinner_item, |                             android.R.layout.simple_spinner_item, | ||||||
|                             itemsStrings |                             itemsStrings | ||||||
|                         ) |                         ) | ||||||
|                     spinnerArrayAdapter.setDropDownViewResource(android.R.layout.simple_spinner_dropdown_item) |                     spinnerArrayAdapter.setDropDownViewResource(android.R.layout.simple_spinner_dropdown_item) | ||||||
|                     spoutsSpinner.adapter = spinnerArrayAdapter |                     binding.spoutsSpinner.adapter = spinnerArrayAdapter | ||||||
|  | 
 | ||||||
|  |                     if (existingSource != null) { | ||||||
|  |                         initFields(items) | ||||||
|  |                     } | ||||||
|                 } else { |                 } else { | ||||||
|                     handleSpoutFailure() |                     handleSpoutFailure() | ||||||
|                 } |                 } | ||||||
| @@ -149,13 +145,11 @@ class AddSourceActivity : AppCompatActivity(), DIAware { | |||||||
|     } |     } | ||||||
| 
 | 
 | ||||||
|     private fun maybeGetDetailsFromIntentSharing( |     private fun maybeGetDetailsFromIntentSharing( | ||||||
|         intent: Intent, |         intent: Intent | ||||||
|         sourceUri: EditText, |  | ||||||
|         nameInput: EditText |  | ||||||
|     ) { |     ) { | ||||||
|         if (Intent.ACTION_SEND == intent.action && "text/plain" == intent.type) { |         if (Intent.ACTION_SEND == intent.action && "text/plain" == intent.type) { | ||||||
|             sourceUri.setText(intent.getStringExtra(Intent.EXTRA_TEXT)) |             binding.sourceUri.setText(intent.getStringExtra(Intent.EXTRA_TEXT)) | ||||||
|             nameInput.setText(intent.getStringExtra(Intent.EXTRA_TITLE)) |             binding.nameInput.setText(intent.getStringExtra(Intent.EXTRA_TITLE)) | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
| 
 | 
 | ||||||
| @@ -166,7 +160,8 @@ class AddSourceActivity : AppCompatActivity(), DIAware { | |||||||
|         finish() |         finish() | ||||||
|     } |     } | ||||||
| 
 | 
 | ||||||
|     private fun handleSaveSource(tags: EditText, title: String, url: String) { |     private fun handleSaveSource() { | ||||||
|  |         val url = binding.sourceUri.text.toString() | ||||||
| 
 | 
 | ||||||
|         val sourceDetailsUnavailable = |         val sourceDetailsUnavailable = | ||||||
|             title.isEmpty() || url.isEmpty() || mSpoutsValue == null || mSpoutsValue!!.isEmpty() |             title.isEmpty() || url.isEmpty() || mSpoutsValue == null || mSpoutsValue!!.isEmpty() | ||||||
| @@ -177,18 +172,27 @@ class AddSourceActivity : AppCompatActivity(), DIAware { | |||||||
|             } |             } | ||||||
|             else -> { |             else -> { | ||||||
|                 CoroutineScope(Dispatchers.Main).launch { |                 CoroutineScope(Dispatchers.Main).launch { | ||||||
|                     val successfullyAddedSource = repository.createSource( |                     val successfullyAddedSource = if (existingSource != null) { | ||||||
|                         title, |                         repository.updateSource( | ||||||
|                         url, |                             existingSource!!.id, | ||||||
|                         mSpoutsValue!!, |                             binding.nameInput.text.toString(), | ||||||
|                         tags.text.toString(), |                             url, | ||||||
|                         "", |                             mSpoutsValue!!, | ||||||
|                     ) |                             binding.tags.text.toString() | ||||||
|  |                         ) | ||||||
|  |                     } else { | ||||||
|  |                         repository.createSource( | ||||||
|  |                             binding.nameInput.text.toString(), | ||||||
|  |                             url, | ||||||
|  |                             mSpoutsValue!!, | ||||||
|  |                             binding.tags.text.toString(), | ||||||
|  |                         ) | ||||||
|  |                     } | ||||||
|                     if (successfullyAddedSource) { |                     if (successfullyAddedSource) { | ||||||
|                         finish() |                         finish() | ||||||
|                     } else { |                     } else { | ||||||
|                         Toast.makeText( |                         Toast.makeText( | ||||||
|                             this@AddSourceActivity, |                             this@UpsertSourceActivity, | ||||||
|                             R.string.cant_create_source, |                             R.string.cant_create_source, | ||||||
|                             Toast.LENGTH_SHORT |                             Toast.LENGTH_SHORT | ||||||
|                         ).show() |                         ).show() | ||||||
| @@ -197,4 +201,9 @@ class AddSourceActivity : AppCompatActivity(), DIAware { | |||||||
|             } |             } | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  | 
 | ||||||
|  |     override fun onDestroy() { | ||||||
|  |         super.onDestroy() | ||||||
|  |         repository.unsetSelectedSource() | ||||||
|  |     } | ||||||
| } | } | ||||||
| @@ -9,14 +9,16 @@ import android.widget.ImageView.ScaleType | |||||||
| import androidx.recyclerview.widget.RecyclerView | import androidx.recyclerview.widget.RecyclerView | ||||||
| import bou.amine.apps.readerforselfossv2.android.R | import bou.amine.apps.readerforselfossv2.android.R | ||||||
| import bou.amine.apps.readerforselfossv2.android.databinding.CardItemBinding | import bou.amine.apps.readerforselfossv2.android.databinding.CardItemBinding | ||||||
| import bou.amine.apps.readerforselfossv2.android.model.* | import bou.amine.apps.readerforselfossv2.android.model.toTextDrawableString | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.AppColors | import bou.amine.apps.readerforselfossv2.android.utils.LinkOnTouchListener | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.* |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.customtabs.CustomTabActivityHelper |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.glide.bitmapCenterCrop | import bou.amine.apps.readerforselfossv2.android.utils.glide.bitmapCenterCrop | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.glide.circularBitmapDrawable | import bou.amine.apps.readerforselfossv2.android.utils.glide.circularBitmapDrawable | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository | import bou.amine.apps.readerforselfossv2.android.utils.openInBrowserAsNewTask | ||||||
|  | import bou.amine.apps.readerforselfossv2.android.utils.openItemUrl | ||||||
|  | import bou.amine.apps.readerforselfossv2.android.utils.shareLink | ||||||
| import bou.amine.apps.readerforselfossv2.model.SelfossModel | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
|  | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
|  | import bou.amine.apps.readerforselfossv2.service.AppSettingsService | ||||||
| import bou.amine.apps.readerforselfossv2.utils.getHtmlDecoded | import bou.amine.apps.readerforselfossv2.utils.getHtmlDecoded | ||||||
| import bou.amine.apps.readerforselfossv2.utils.getIcon | import bou.amine.apps.readerforselfossv2.utils.getIcon | ||||||
| import bou.amine.apps.readerforselfossv2.utils.getThumbnail | import bou.amine.apps.readerforselfossv2.utils.getThumbnail | ||||||
| @@ -33,12 +35,6 @@ import org.kodein.di.instance | |||||||
| class ItemCardAdapter( | class ItemCardAdapter( | ||||||
|     override val app: Activity, |     override val app: Activity, | ||||||
|     override var items: ArrayList<SelfossModel.Item>, |     override var items: ArrayList<SelfossModel.Item>, | ||||||
|     private val helper: CustomTabActivityHelper, |  | ||||||
|     private val internalBrowser: Boolean, |  | ||||||
|     private val articleViewer: Boolean, |  | ||||||
|     private val fullHeightCards: Boolean, |  | ||||||
|     override val appColors: AppColors, |  | ||||||
|     override val config: Config, |  | ||||||
|     override val updateItems: (ArrayList<SelfossModel.Item>) -> Unit |     override val updateItems: (ArrayList<SelfossModel.Item>) -> Unit | ||||||
| ) : ItemsAdapter<ItemCardAdapter.ViewHolder>() { | ) : ItemsAdapter<ItemCardAdapter.ViewHolder>() { | ||||||
|     private val c: Context = app.baseContext |     private val c: Context = app.baseContext | ||||||
| @@ -47,7 +43,8 @@ class ItemCardAdapter( | |||||||
|         c.resources.getDimension(R.dimen.card_image_max_height).toInt() |         c.resources.getDimension(R.dimen.card_image_max_height).toInt() | ||||||
|  |  | ||||||
|     override val di: DI by closestDI(app) |     override val di: DI by closestDI(app) | ||||||
|     override val repository : Repository by instance() |     override val repository: Repository by instance() | ||||||
|  |     override val appSettingsService: AppSettingsService by instance() | ||||||
|  |  | ||||||
|     override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): ViewHolder { |     override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): ViewHolder { | ||||||
|         val binding = CardItemBinding.inflate(LayoutInflater.from(parent.context), parent, false) |         val binding = CardItemBinding.inflate(LayoutInflater.from(parent.context), parent, false) | ||||||
| @@ -63,11 +60,11 @@ class ItemCardAdapter( | |||||||
|  |  | ||||||
|             binding.title.setOnTouchListener(LinkOnTouchListener()) |             binding.title.setOnTouchListener(LinkOnTouchListener()) | ||||||
|  |  | ||||||
|             binding.title.setLinkTextColor(appColors.colorAccent) |             binding.title.setLinkTextColor(c.resources.getColor(R.color.colorAccent)) | ||||||
|  |  | ||||||
|             binding.sourceTitleAndDate.text = itm.sourceAndDateText(repository.dateUtils) |             binding.sourceTitleAndDate.text = itm.sourceAuthorAndDate() | ||||||
|  |  | ||||||
|             if (!fullHeightCards) { |             if (!appSettingsService.isFullHeightCardsEnabled()) { | ||||||
|                 binding.itemImage.maxHeight = imageMaxHeight |                 binding.itemImage.maxHeight = imageMaxHeight | ||||||
|                 binding.itemImage.scaleType = ScaleType.CENTER_CROP |                 binding.itemImage.scaleType = ScaleType.CENTER_CROP | ||||||
|             } |             } | ||||||
| @@ -78,20 +75,20 @@ class ItemCardAdapter( | |||||||
|                 binding.itemImage.setImageDrawable(null) |                 binding.itemImage.setImageDrawable(null) | ||||||
|             } else { |             } else { | ||||||
|                 binding.itemImage.visibility = View.VISIBLE |                 binding.itemImage.visibility = View.VISIBLE | ||||||
|                 c.bitmapCenterCrop(config, itm.getThumbnail(repository.baseUrl), binding.itemImage) |                 c.bitmapCenterCrop(itm.getThumbnail(repository.baseUrl), binding.itemImage) | ||||||
|             } |             } | ||||||
|  |  | ||||||
|             if (itm.getIcon(repository.baseUrl).isEmpty()) { |             if (itm.getIcon(repository.baseUrl).isEmpty()) { | ||||||
|                 val color = generator.getColor(itm.title.getHtmlDecoded()) |                 val color = generator.getColor(itm.title.getHtmlDecoded()) | ||||||
|  |  | ||||||
|                 val drawable = |                 val drawable = | ||||||
|                         TextDrawable |                     TextDrawable | ||||||
|                                 .builder() |                         .builder() | ||||||
|                                 .round() |                         .round() | ||||||
|                                 .build(itm.title.getHtmlDecoded().toTextDrawableString(), color) |                         .build(itm.title.getHtmlDecoded().toTextDrawableString(), color) | ||||||
|                 binding.sourceImage.setImageDrawable(drawable) |                 binding.sourceImage.setImageDrawable(drawable) | ||||||
|             } else { |             } else { | ||||||
|                 c.circularBitmapDrawable(config, itm.getIcon(repository.baseUrl), binding.sourceImage) |                 c.circularBitmapDrawable(itm.getIcon(repository.baseUrl), binding.sourceImage) | ||||||
|             } |             } | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
| @@ -103,7 +100,7 @@ class ItemCardAdapter( | |||||||
|     inner class ViewHolder(val binding: CardItemBinding) : RecyclerView.ViewHolder(binding.root) { |     inner class ViewHolder(val binding: CardItemBinding) : RecyclerView.ViewHolder(binding.root) { | ||||||
|         init { |         init { | ||||||
|             handleClickListeners() |             handleClickListeners() | ||||||
|             handleCustomTabActions() |             handleLinkOpening() | ||||||
|         } |         } | ||||||
|  |  | ||||||
|         private fun handleClickListeners() { |         private fun handleClickListeners() { | ||||||
| @@ -113,42 +110,33 @@ class ItemCardAdapter( | |||||||
|                 if (item.starred) { |                 if (item.starred) { | ||||||
|                     CoroutineScope(Dispatchers.IO).launch { |                     CoroutineScope(Dispatchers.IO).launch { | ||||||
|                         repository.unstarr(item) |                         repository.unstarr(item) | ||||||
|                         // TODO: Handle failure |  | ||||||
|                     } |                     } | ||||||
|                     item.starred = false |  | ||||||
|                     binding.favButton.isSelected = false |                     binding.favButton.isSelected = false | ||||||
|                 } else { |                 } else { | ||||||
|                     CoroutineScope(Dispatchers.IO).launch { |                     CoroutineScope(Dispatchers.IO).launch { | ||||||
|                         repository.starr(item) |                         repository.starr(item) | ||||||
|                         // TODO: Handle failure |  | ||||||
|                     } |                     } | ||||||
|                     item.starred = true |  | ||||||
|                     binding.favButton.isSelected = true |                     binding.favButton.isSelected = true | ||||||
|                 } |                 } | ||||||
|             } |             } | ||||||
|  |  | ||||||
|                 binding.shareBtn.setOnClickListener { |             binding.shareBtn.setOnClickListener { | ||||||
|                     val item = items[bindingAdapterPosition] |                 val item = items[bindingAdapterPosition] | ||||||
|                     c.shareLink(item.getLinkDecoded(), item.title.getHtmlDecoded()) |                 c.shareLink(item.getLinkDecoded(), item.title.getHtmlDecoded()) | ||||||
|                 } |  | ||||||
|  |  | ||||||
|                 binding.browserBtn.setOnClickListener { |  | ||||||
|                     c.openInBrowserAsNewTask(items[bindingAdapterPosition]) |  | ||||||
|                 } |  | ||||||
|             } |             } | ||||||
|  |  | ||||||
|         private fun handleCustomTabActions() { |             binding.browserBtn.setOnClickListener { | ||||||
|             val customTabsIntent = c.buildCustomTabsIntent() |                 c.openInBrowserAsNewTask(items[bindingAdapterPosition]) | ||||||
|             helper.bindCustomTabsService(app) |             } | ||||||
|  |         } | ||||||
|  |  | ||||||
|  |         private fun handleLinkOpening() { | ||||||
|             binding.root.setOnClickListener { |             binding.root.setOnClickListener { | ||||||
|  |                 repository.setReaderItems(items) | ||||||
|                 c.openItemUrl( |                 c.openItemUrl( | ||||||
|                     items, |  | ||||||
|                     bindingAdapterPosition, |                     bindingAdapterPosition, | ||||||
|                     items[bindingAdapterPosition].getLinkDecoded(), |                     items[bindingAdapterPosition].getLinkDecoded(), | ||||||
|                     customTabsIntent, |                     appSettingsService.isArticleViewerEnabled(), | ||||||
|                     internalBrowser, |  | ||||||
|                     articleViewer, |  | ||||||
|                     app |                     app | ||||||
|                 ) |                 ) | ||||||
|             } |             } | ||||||
|   | |||||||
| @@ -5,15 +5,16 @@ import android.content.Context | |||||||
| import android.view.LayoutInflater | import android.view.LayoutInflater | ||||||
| import android.view.ViewGroup | import android.view.ViewGroup | ||||||
| import androidx.recyclerview.widget.RecyclerView | import androidx.recyclerview.widget.RecyclerView | ||||||
|  | import bou.amine.apps.readerforselfossv2.android.R | ||||||
| import bou.amine.apps.readerforselfossv2.android.databinding.ListItemBinding | import bou.amine.apps.readerforselfossv2.android.databinding.ListItemBinding | ||||||
| import bou.amine.apps.readerforselfossv2.android.model.* | import bou.amine.apps.readerforselfossv2.android.model.toTextDrawableString | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.AppColors | import bou.amine.apps.readerforselfossv2.android.utils.LinkOnTouchListener | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.* |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.customtabs.CustomTabActivityHelper |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.glide.bitmapCenterCrop | import bou.amine.apps.readerforselfossv2.android.utils.glide.bitmapCenterCrop | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.glide.circularBitmapDrawable | import bou.amine.apps.readerforselfossv2.android.utils.glide.circularBitmapDrawable | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository | import bou.amine.apps.readerforselfossv2.android.utils.openItemUrl | ||||||
| import bou.amine.apps.readerforselfossv2.model.SelfossModel | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
|  | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
|  | import bou.amine.apps.readerforselfossv2.service.AppSettingsService | ||||||
| import bou.amine.apps.readerforselfossv2.utils.getHtmlDecoded | import bou.amine.apps.readerforselfossv2.utils.getHtmlDecoded | ||||||
| import bou.amine.apps.readerforselfossv2.utils.getIcon | import bou.amine.apps.readerforselfossv2.utils.getIcon | ||||||
| import bou.amine.apps.readerforselfossv2.utils.getThumbnail | import bou.amine.apps.readerforselfossv2.utils.getThumbnail | ||||||
| @@ -26,11 +27,6 @@ import org.kodein.di.instance | |||||||
| class ItemListAdapter( | class ItemListAdapter( | ||||||
|     override val app: Activity, |     override val app: Activity, | ||||||
|     override var items: ArrayList<SelfossModel.Item>, |     override var items: ArrayList<SelfossModel.Item>, | ||||||
|     private val helper: CustomTabActivityHelper, |  | ||||||
|     private val internalBrowser: Boolean, |  | ||||||
|     private val articleViewer: Boolean, |  | ||||||
|     override val appColors: AppColors, |  | ||||||
|     override val config: Config, |  | ||||||
|     override val updateItems: (ArrayList<SelfossModel.Item>) -> Unit |     override val updateItems: (ArrayList<SelfossModel.Item>) -> Unit | ||||||
| ) : ItemsAdapter<ItemListAdapter.ViewHolder>() { | ) : ItemsAdapter<ItemListAdapter.ViewHolder>() { | ||||||
|     private val generator: ColorGenerator = ColorGenerator.MATERIAL |     private val generator: ColorGenerator = ColorGenerator.MATERIAL | ||||||
| @@ -38,6 +34,7 @@ class ItemListAdapter( | |||||||
|  |  | ||||||
|     override val di: DI by closestDI(app) |     override val di: DI by closestDI(app) | ||||||
|     override val repository : Repository by instance() |     override val repository : Repository by instance() | ||||||
|  |     override val appSettingsService : AppSettingsService by instance() | ||||||
|  |  | ||||||
|     override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): ViewHolder { |     override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): ViewHolder { | ||||||
|         val binding = ListItemBinding.inflate(LayoutInflater.from(parent.context), parent, false) |         val binding = ListItemBinding.inflate(LayoutInflater.from(parent.context), parent, false) | ||||||
| @@ -52,9 +49,9 @@ class ItemListAdapter( | |||||||
|  |  | ||||||
|             binding.title.setOnTouchListener(LinkOnTouchListener()) |             binding.title.setOnTouchListener(LinkOnTouchListener()) | ||||||
|  |  | ||||||
|             binding.title.setLinkTextColor(appColors.colorAccent) |             binding.title.setLinkTextColor(c.resources.getColor(R.color.colorAccent)) | ||||||
|  |  | ||||||
|             binding.sourceTitleAndDate.text = itm.sourceAndDateText(repository.dateUtils) |             binding.sourceTitleAndDate.text = itm.sourceAuthorAndDate() | ||||||
|  |  | ||||||
|             if (itm.getThumbnail(repository.baseUrl).isEmpty()) { |             if (itm.getThumbnail(repository.baseUrl).isEmpty()) { | ||||||
|  |  | ||||||
| @@ -69,10 +66,10 @@ class ItemListAdapter( | |||||||
|  |  | ||||||
|                     binding.itemImage.setImageDrawable(drawable) |                     binding.itemImage.setImageDrawable(drawable) | ||||||
|                 } else { |                 } else { | ||||||
|                     c.circularBitmapDrawable(config, itm.getIcon(repository.baseUrl), binding.itemImage) |                     c.circularBitmapDrawable(itm.getIcon(repository.baseUrl), binding.itemImage) | ||||||
|                 } |                 } | ||||||
|             } else { |             } else { | ||||||
|                 c.bitmapCenterCrop(config, itm.getThumbnail(repository.baseUrl), binding.itemImage) |                 c.bitmapCenterCrop(itm.getThumbnail(repository.baseUrl), binding.itemImage) | ||||||
|             } |             } | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
| @@ -82,21 +79,16 @@ class ItemListAdapter( | |||||||
|     inner class ViewHolder(val binding: ListItemBinding) : RecyclerView.ViewHolder(binding.root) { |     inner class ViewHolder(val binding: ListItemBinding) : RecyclerView.ViewHolder(binding.root) { | ||||||
|  |  | ||||||
|         init { |         init { | ||||||
|             handleCustomTabActions() |             handleLinkOpening() | ||||||
|         } |         } | ||||||
|  |  | ||||||
|         private fun handleCustomTabActions() { |         private fun handleLinkOpening() { | ||||||
|             val customTabsIntent = c.buildCustomTabsIntent() |  | ||||||
|             helper.bindCustomTabsService(app) |  | ||||||
|  |  | ||||||
|             binding.root.setOnClickListener { |             binding.root.setOnClickListener { | ||||||
|  |                 repository.setReaderItems(items) | ||||||
|                 c.openItemUrl( |                 c.openItemUrl( | ||||||
|                     items, |  | ||||||
|                     bindingAdapterPosition, |                     bindingAdapterPosition, | ||||||
|                     items[bindingAdapterPosition].getLinkDecoded(), |                     items[bindingAdapterPosition].getLinkDecoded(), | ||||||
|                     customTabsIntent, |                     appSettingsService.isArticleViewerEnabled(), | ||||||
|                     internalBrowser, |  | ||||||
|                     articleViewer, |  | ||||||
|                     app |                     app | ||||||
|                 ) |                 ) | ||||||
|             } |             } | ||||||
|   | |||||||
| @@ -5,10 +5,9 @@ import android.graphics.Color | |||||||
| import android.widget.TextView | import android.widget.TextView | ||||||
| import androidx.recyclerview.widget.RecyclerView | import androidx.recyclerview.widget.RecyclerView | ||||||
| import bou.amine.apps.readerforselfossv2.android.R | import bou.amine.apps.readerforselfossv2.android.R | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.AppColors |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.Config |  | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository |  | ||||||
| import bou.amine.apps.readerforselfossv2.model.SelfossModel | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
|  | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
|  | import bou.amine.apps.readerforselfossv2.service.AppSettingsService | ||||||
| import bou.amine.apps.readerforselfossv2.utils.ItemType | import bou.amine.apps.readerforselfossv2.utils.ItemType | ||||||
| import com.google.android.material.snackbar.Snackbar | import com.google.android.material.snackbar.Snackbar | ||||||
| import kotlinx.coroutines.CoroutineScope | import kotlinx.coroutines.CoroutineScope | ||||||
| @@ -19,9 +18,8 @@ import org.kodein.di.DIAware | |||||||
| abstract class ItemsAdapter<VH : RecyclerView.ViewHolder?> : RecyclerView.Adapter<VH>(), DIAware { | abstract class ItemsAdapter<VH : RecyclerView.ViewHolder?> : RecyclerView.Adapter<VH>(), DIAware { | ||||||
|     abstract var items: ArrayList<SelfossModel.Item> |     abstract var items: ArrayList<SelfossModel.Item> | ||||||
|     abstract val repository: Repository |     abstract val repository: Repository | ||||||
|  |     abstract val appSettingsService: AppSettingsService | ||||||
|     abstract val app: Activity |     abstract val app: Activity | ||||||
|     abstract val appColors: AppColors |  | ||||||
|     abstract val config: Config |  | ||||||
|     abstract val updateItems: (ArrayList<SelfossModel.Item>) -> Unit |     abstract val updateItems: (ArrayList<SelfossModel.Item>) -> Unit | ||||||
|  |  | ||||||
|     fun updateAllItems(items: ArrayList<SelfossModel.Item>) { |     fun updateAllItems(items: ArrayList<SelfossModel.Item>) { | ||||||
| @@ -30,7 +28,7 @@ abstract class ItemsAdapter<VH : RecyclerView.ViewHolder?> : RecyclerView.Adapte | |||||||
|         updateItems(this.items) |         updateItems(this.items) | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun unmarkSnackbar(i: SelfossModel.Item, position: Int) { |     private fun unmarkSnackbar(item: SelfossModel.Item, position: Int) { | ||||||
|         val s = Snackbar |         val s = Snackbar | ||||||
|             .make( |             .make( | ||||||
|                 app.findViewById(R.id.coordLayout), |                 app.findViewById(R.id.coordLayout), | ||||||
| @@ -38,9 +36,7 @@ abstract class ItemsAdapter<VH : RecyclerView.ViewHolder?> : RecyclerView.Adapte | |||||||
|                 Snackbar.LENGTH_LONG |                 Snackbar.LENGTH_LONG | ||||||
|             ) |             ) | ||||||
|             .setAction(R.string.undo_string) { |             .setAction(R.string.undo_string) { | ||||||
|                 CoroutineScope(Dispatchers.IO).launch { |                 unreadItemAtIndex(item, position, false) | ||||||
|                     unreadItemAtIndex(position, false) |  | ||||||
|                 } |  | ||||||
|             } |             } | ||||||
|  |  | ||||||
|         val view = s.view |         val view = s.view | ||||||
| @@ -49,7 +45,7 @@ abstract class ItemsAdapter<VH : RecyclerView.ViewHolder?> : RecyclerView.Adapte | |||||||
|         s.show() |         s.show() | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun markSnackbar(position: Int) { |     private fun markSnackbar(item: SelfossModel.Item, position: Int) { | ||||||
|         val s = Snackbar |         val s = Snackbar | ||||||
|             .make( |             .make( | ||||||
|                 app.findViewById(R.id.coordLayout), |                 app.findViewById(R.id.coordLayout), | ||||||
| @@ -57,7 +53,7 @@ abstract class ItemsAdapter<VH : RecyclerView.ViewHolder?> : RecyclerView.Adapte | |||||||
|                 Snackbar.LENGTH_LONG |                 Snackbar.LENGTH_LONG | ||||||
|             ) |             ) | ||||||
|             .setAction(R.string.undo_string) { |             .setAction(R.string.undo_string) { | ||||||
|                 readItemAtIndex(position) |                 readItemAtIndex(item, position, false) | ||||||
|             } |             } | ||||||
|  |  | ||||||
|         val view = s.view |         val view = s.view | ||||||
| @@ -68,39 +64,36 @@ abstract class ItemsAdapter<VH : RecyclerView.ViewHolder?> : RecyclerView.Adapte | |||||||
|  |  | ||||||
|     fun handleItemAtIndex(position: Int) { |     fun handleItemAtIndex(position: Int) { | ||||||
|         if (items[position].unread) { |         if (items[position].unread) { | ||||||
|             readItemAtIndex(position) |             readItemAtIndex(items[position], position) | ||||||
|         } else { |         } else { | ||||||
|             unreadItemAtIndex(position) |             unreadItemAtIndex(items[position], position) | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun readItemAtIndex(position: Int, showSnackbar: Boolean = true) { |     private fun readItemAtIndex(item: SelfossModel.Item, position: Int, showSnackbar: Boolean = true) { | ||||||
|         val i = items[position] |  | ||||||
|         CoroutineScope(Dispatchers.IO).launch { |         CoroutineScope(Dispatchers.IO).launch { | ||||||
|             repository.markAsRead(i) |             repository.markAsRead(item) | ||||||
|         } |         } | ||||||
|         if (repository.displayedItems == ItemType.UNREAD) { |         if (repository.displayedItems == ItemType.UNREAD) { | ||||||
|             items.remove(i) |             items.remove(item) | ||||||
|             notifyItemRemoved(position) |             notifyItemRemoved(position) | ||||||
|             updateItems(items) |             updateItems(items) | ||||||
|         } else { |         } else { | ||||||
|             notifyItemChanged(position) |             notifyItemChanged(position) | ||||||
|         } |         } | ||||||
|         if (showSnackbar) { |         if (showSnackbar) { | ||||||
|             unmarkSnackbar(i, position) |             unmarkSnackbar(item, position) | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun unreadItemAtIndex(position: Int, showSnackbar: Boolean = true) { |     private fun unreadItemAtIndex(item: SelfossModel.Item, position: Int, showSnackbar: Boolean = true) { | ||||||
|         CoroutineScope(Dispatchers.IO).launch { |         CoroutineScope(Dispatchers.IO).launch { | ||||||
|             repository.unmarkAsRead(items[position]) |             repository.unmarkAsRead(item) | ||||||
|             // Todo: SharedItems.unreadItem(app, api, db, items[position]) |  | ||||||
|             // TODO: update db |  | ||||||
|  |  | ||||||
|         } |         } | ||||||
|         notifyItemChanged(position) |         notifyItemChanged(position) | ||||||
|         if (showSnackbar) { |         if (showSnackbar) { | ||||||
|             markSnackbar(position) |             markSnackbar(item, position) | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
|   | |||||||
| @@ -2,19 +2,21 @@ package bou.amine.apps.readerforselfossv2.android.adapters | |||||||
|  |  | ||||||
| import android.app.Activity | import android.app.Activity | ||||||
| import android.content.Context | import android.content.Context | ||||||
|  | import android.content.Intent | ||||||
| import android.view.LayoutInflater | import android.view.LayoutInflater | ||||||
|  | import android.view.View | ||||||
| import android.view.ViewGroup | import android.view.ViewGroup | ||||||
| import android.widget.Button | import android.widget.Button | ||||||
| import android.widget.Toast | import android.widget.Toast | ||||||
| import androidx.constraintlayout.widget.ConstraintLayout | import androidx.constraintlayout.widget.ConstraintLayout | ||||||
| import androidx.recyclerview.widget.RecyclerView | import androidx.recyclerview.widget.RecyclerView | ||||||
|  | import bou.amine.apps.readerforselfossv2.android.UpsertSourceActivity | ||||||
| import bou.amine.apps.readerforselfossv2.android.R | import bou.amine.apps.readerforselfossv2.android.R | ||||||
| import bou.amine.apps.readerforselfossv2.android.databinding.SourceListItemBinding | import bou.amine.apps.readerforselfossv2.android.databinding.SourceListItemBinding | ||||||
| import bou.amine.apps.readerforselfossv2.android.model.toTextDrawableString | import bou.amine.apps.readerforselfossv2.android.model.toTextDrawableString | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.Config |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.glide.circularBitmapDrawable | import bou.amine.apps.readerforselfossv2.android.utils.glide.circularBitmapDrawable | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository |  | ||||||
| import bou.amine.apps.readerforselfossv2.model.SelfossModel | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
|  | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
| import bou.amine.apps.readerforselfossv2.utils.getHtmlDecoded | import bou.amine.apps.readerforselfossv2.utils.getHtmlDecoded | ||||||
| import bou.amine.apps.readerforselfossv2.utils.getIcon | import bou.amine.apps.readerforselfossv2.utils.getIcon | ||||||
| import com.amulyakhare.textdrawable.TextDrawable | import com.amulyakhare.textdrawable.TextDrawable | ||||||
| @@ -33,7 +35,6 @@ class SourcesListAdapter( | |||||||
| ) : RecyclerView.Adapter<SourcesListAdapter.ViewHolder>(), DIAware { | ) : RecyclerView.Adapter<SourcesListAdapter.ViewHolder>(), DIAware { | ||||||
|     private val c: Context = app.baseContext |     private val c: Context = app.baseContext | ||||||
|     private val generator: ColorGenerator = ColorGenerator.MATERIAL |     private val generator: ColorGenerator = ColorGenerator.MATERIAL | ||||||
|     private lateinit var config: Config |  | ||||||
|     private lateinit var binding: SourceListItemBinding |     private lateinit var binding: SourceListItemBinding | ||||||
|  |  | ||||||
|     override val di: DI by closestDI(app) |     override val di: DI by closestDI(app) | ||||||
| @@ -46,7 +47,6 @@ class SourcesListAdapter( | |||||||
|  |  | ||||||
|     override fun onBindViewHolder(holder: ViewHolder, position: Int) { |     override fun onBindViewHolder(holder: ViewHolder, position: Int) { | ||||||
|         val itm = items[position] |         val itm = items[position] | ||||||
|         config = Config() |  | ||||||
|  |  | ||||||
|         if (itm.getIcon(repository.baseUrl).isEmpty()) { |         if (itm.getIcon(repository.baseUrl).isEmpty()) { | ||||||
|             val color = generator.getColor(itm.title.getHtmlDecoded()) |             val color = generator.getColor(itm.title.getHtmlDecoded()) | ||||||
| @@ -58,15 +58,26 @@ class SourcesListAdapter( | |||||||
|                     .build(itm.title.getHtmlDecoded().toTextDrawableString(), color) |                     .build(itm.title.getHtmlDecoded().toTextDrawableString(), color) | ||||||
|             binding.itemImage.setImageDrawable(drawable) |             binding.itemImage.setImageDrawable(drawable) | ||||||
|         } else { |         } else { | ||||||
|             c.circularBitmapDrawable(config, itm.getIcon(repository.baseUrl), binding.itemImage) |             c.circularBitmapDrawable(itm.getIcon(repository.baseUrl), binding.itemImage) | ||||||
|  |         } | ||||||
|  |  | ||||||
|  |         if (itm.error.isNotBlank()) { | ||||||
|  |             binding.errorText.visibility = View.VISIBLE | ||||||
|  |             binding.errorText.text = itm.error | ||||||
|  |         } else { | ||||||
|  |             binding.errorText.visibility = View.GONE | ||||||
|         } |         } | ||||||
|  |  | ||||||
|         binding.sourceTitle.text = itm.title.getHtmlDecoded() |         binding.sourceTitle.text = itm.title.getHtmlDecoded() | ||||||
|     } |     } | ||||||
|  |  | ||||||
|  |     override fun getItemId(position: Int) = position.toLong() | ||||||
|  |  | ||||||
|  |     override fun getItemViewType(position: Int) = position | ||||||
|  |  | ||||||
|     override fun getItemCount(): Int = items.size |     override fun getItemCount(): Int = items.size | ||||||
|  |  | ||||||
|     inner class ViewHolder(internal val mView: ConstraintLayout) : RecyclerView.ViewHolder(mView) { |     inner class ViewHolder(private val mView: ConstraintLayout) : RecyclerView.ViewHolder(mView) { | ||||||
|  |  | ||||||
|         init { |         init { | ||||||
|             handleClickListeners() |             handleClickListeners() | ||||||
| @@ -77,13 +88,13 @@ class SourcesListAdapter( | |||||||
|             val deleteBtn: Button = mView.findViewById(R.id.deleteBtn) |             val deleteBtn: Button = mView.findViewById(R.id.deleteBtn) | ||||||
|  |  | ||||||
|             deleteBtn.setOnClickListener { |             deleteBtn.setOnClickListener { | ||||||
|                 val (id) = items[adapterPosition] |                 val (id, title) = items[bindingAdapterPosition] | ||||||
|                 CoroutineScope(Dispatchers.IO).launch { |                 CoroutineScope(Dispatchers.IO).launch { | ||||||
|                     val successfullyDeletedSource = repository.deleteSource(id) |                     val successfullyDeletedSource = repository.deleteSource(id, title) | ||||||
|                     if (successfullyDeletedSource) { |                     if (successfullyDeletedSource) { | ||||||
|                         items.removeAt(adapterPosition) |                         items.removeAt(bindingAdapterPosition) | ||||||
|                         notifyItemRemoved(adapterPosition) |                         notifyItemRemoved(bindingAdapterPosition) | ||||||
|                         notifyItemRangeChanged(adapterPosition, itemCount) |                         notifyItemRangeChanged(bindingAdapterPosition, itemCount) | ||||||
|                     } else { |                     } else { | ||||||
|                         Toast.makeText( |                         Toast.makeText( | ||||||
|                             app, |                             app, | ||||||
| @@ -93,6 +104,14 @@ class SourcesListAdapter( | |||||||
|                     } |                     } | ||||||
|                 } |                 } | ||||||
|             } |             } | ||||||
|  |  | ||||||
|  |             mView.setOnClickListener { | ||||||
|  |                 val source = items[bindingAdapterPosition] | ||||||
|  |  | ||||||
|  |                 repository.setSelectedSource(source) | ||||||
|  |                 app.startActivity(Intent(app, UpsertSourceActivity::class.java)) | ||||||
|  |  | ||||||
|  |             } | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
| } | } | ||||||
|   | |||||||
| @@ -1,35 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.api.mercury |  | ||||||
|  |  | ||||||
| import com.google.gson.GsonBuilder |  | ||||||
| import okhttp3.OkHttpClient |  | ||||||
| import okhttp3.logging.HttpLoggingInterceptor |  | ||||||
| import retrofit2.Call |  | ||||||
| import retrofit2.Retrofit |  | ||||||
| import retrofit2.converter.gson.GsonConverterFactory |  | ||||||
|  |  | ||||||
| class MercuryApi() { |  | ||||||
|     private val service: MercuryService |  | ||||||
|  |  | ||||||
|     init { |  | ||||||
|  |  | ||||||
|         val interceptor = HttpLoggingInterceptor() |  | ||||||
|         interceptor.level = HttpLoggingInterceptor.Level.NONE |  | ||||||
|         val client = OkHttpClient.Builder().addInterceptor(interceptor).build() |  | ||||||
|  |  | ||||||
|         val gson = GsonBuilder() |  | ||||||
|             .setLenient() |  | ||||||
|             .create() |  | ||||||
|         val retrofit = |  | ||||||
|             Retrofit |  | ||||||
|                 .Builder() |  | ||||||
|                 .baseUrl("https://www.amine-bou.fr") |  | ||||||
|                 .client(client) |  | ||||||
|                 .addConverterFactory(GsonConverterFactory.create(gson)) |  | ||||||
|                 .build() |  | ||||||
|         service = retrofit.create(MercuryService::class.java) |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     fun parseUrl(url: String): Call<ParsedContent> { |  | ||||||
|         return service.parseUrl(url) |  | ||||||
|     } |  | ||||||
| } |  | ||||||
| @@ -1,59 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.api.mercury |  | ||||||
|  |  | ||||||
| import android.os.Parcel |  | ||||||
| import android.os.Parcelable |  | ||||||
| import com.google.gson.annotations.SerializedName |  | ||||||
|  |  | ||||||
| class ParsedContent( |  | ||||||
|     @SerializedName("title") val title: String, |  | ||||||
|     @SerializedName("content") val content: String?, |  | ||||||
|     @SerializedName("date_published") val date_published: String, |  | ||||||
|     @SerializedName("lead_image_url") val lead_image_url: String?, |  | ||||||
|     @SerializedName("dek") val dek: String, |  | ||||||
|     @SerializedName("url") val url: String, |  | ||||||
|     @SerializedName("domain") val domain: String, |  | ||||||
|     @SerializedName("excerpt") val excerpt: String, |  | ||||||
|     @SerializedName("total_pages") val total_pages: Int, |  | ||||||
|     @SerializedName("rendered_pages") val rendered_pages: Int, |  | ||||||
|     @SerializedName("next_page_url") val next_page_url: String |  | ||||||
| ) : Parcelable { |  | ||||||
|  |  | ||||||
|     companion object { |  | ||||||
|         @JvmField |  | ||||||
|         val CREATOR: Parcelable.Creator<ParsedContent> = |  | ||||||
|             object : Parcelable.Creator<ParsedContent> { |  | ||||||
|                 override fun createFromParcel(source: Parcel): ParsedContent = ParsedContent(source) |  | ||||||
|                 override fun newArray(size: Int): Array<ParsedContent?> = arrayOfNulls(size) |  | ||||||
|             } |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     constructor(source: Parcel) : this( |  | ||||||
|         title = source.readString().orEmpty(), |  | ||||||
|         content = source.readString(), |  | ||||||
|         date_published = source.readString().orEmpty(), |  | ||||||
|         lead_image_url = source.readString(), |  | ||||||
|         dek = source.readString().orEmpty(), |  | ||||||
|         url = source.readString().orEmpty(), |  | ||||||
|         domain = source.readString().orEmpty(), |  | ||||||
|         excerpt = source.readString().orEmpty(), |  | ||||||
|         total_pages = source.readInt(), |  | ||||||
|         rendered_pages = source.readInt(), |  | ||||||
|         next_page_url = source.readString().orEmpty() |  | ||||||
|     ) |  | ||||||
|  |  | ||||||
|     override fun describeContents() = 0 |  | ||||||
|  |  | ||||||
|     override fun writeToParcel(dest: Parcel, flags: Int) { |  | ||||||
|         dest.writeString(title) |  | ||||||
|         dest.writeString(content) |  | ||||||
|         dest.writeString(date_published) |  | ||||||
|         dest.writeString(lead_image_url) |  | ||||||
|         dest.writeString(dek) |  | ||||||
|         dest.writeString(url) |  | ||||||
|         dest.writeString(domain) |  | ||||||
|         dest.writeString(excerpt) |  | ||||||
|         dest.writeInt(total_pages) |  | ||||||
|         dest.writeInt(rendered_pages) |  | ||||||
|         dest.writeString(next_page_url) |  | ||||||
|     } |  | ||||||
| } |  | ||||||
| @@ -1,10 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.api.mercury |  | ||||||
|  |  | ||||||
| import retrofit2.Call |  | ||||||
| import retrofit2.http.GET |  | ||||||
| import retrofit2.http.Query |  | ||||||
|  |  | ||||||
| interface MercuryService { |  | ||||||
|     @GET("parser.php") |  | ||||||
|     fun parseUrl(@Query("link") link: String): Call<ParsedContent> |  | ||||||
| } |  | ||||||
| @@ -14,13 +14,10 @@ import bou.amine.apps.readerforselfossv2.android.MainActivity | |||||||
| import bou.amine.apps.readerforselfossv2.android.MyApp | import bou.amine.apps.readerforselfossv2.android.MyApp | ||||||
| import bou.amine.apps.readerforselfossv2.android.R | import bou.amine.apps.readerforselfossv2.android.R | ||||||
| import bou.amine.apps.readerforselfossv2.android.model.preloadImages | import bou.amine.apps.readerforselfossv2.android.model.preloadImages | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.Config |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.network.isNetworkAccessible | import bou.amine.apps.readerforselfossv2.android.utils.network.isNetworkAccessible | ||||||
| import bou.amine.apps.readerforselfossv2.dao.ACTION |  | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository |  | ||||||
| import bou.amine.apps.readerforselfossv2.model.SelfossModel | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
| import bou.amine.apps.readerforselfossv2.utils.ItemType | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
| import com.russhwolf.settings.Settings | import bou.amine.apps.readerforselfossv2.service.AppSettingsService | ||||||
| import kotlinx.coroutines.CoroutineScope | import kotlinx.coroutines.CoroutineScope | ||||||
| import kotlinx.coroutines.Dispatchers | import kotlinx.coroutines.Dispatchers | ||||||
| import kotlinx.coroutines.launch | import kotlinx.coroutines.launch | ||||||
| @@ -28,119 +25,93 @@ import org.kodein.di.DIAware | |||||||
| import org.kodein.di.instance | import org.kodein.di.instance | ||||||
| import java.util.* | import java.util.* | ||||||
| import kotlin.concurrent.schedule | import kotlin.concurrent.schedule | ||||||
| import kotlin.concurrent.thread |  | ||||||
|  |  | ||||||
| class LoadingWorker(val context: Context, params: WorkerParameters) : Worker(context, params), DIAware { | class LoadingWorker(val context: Context, params: WorkerParameters) : Worker(context, params), | ||||||
|  |     DIAware { | ||||||
|  |  | ||||||
|     override val di by lazy { (applicationContext as MyApp).di } |     override val di by lazy { (applicationContext as MyApp).di } | ||||||
|     private val repository : Repository by instance() |     private val repository: Repository by instance() | ||||||
|  |     private val appSettingsService: AppSettingsService by instance() | ||||||
|  |  | ||||||
| override fun doWork(): Result { |     override fun doWork(): Result { | ||||||
|     val settings = Settings() |         if (appSettingsService.isPeriodicRefreshEnabled() && isNetworkAccessible(context)) { | ||||||
|     val periodicRefresh = settings.getBoolean("periodic_refresh", false) |  | ||||||
|     if (periodicRefresh && isNetworkAccessible(context)) { |  | ||||||
|  |  | ||||||
|         CoroutineScope(Dispatchers.IO).launch { |             CoroutineScope(Dispatchers.IO).launch { | ||||||
|             val notificationManager = |                 val notificationManager = | ||||||
|                 applicationContext.getSystemService(Context.NOTIFICATION_SERVICE) as NotificationManager |                     applicationContext.getSystemService(Context.NOTIFICATION_SERVICE) as NotificationManager | ||||||
|  |  | ||||||
|             val notification = |                 val notification = | ||||||
|                 NotificationCompat.Builder(applicationContext, Config.syncChannelId) |                     NotificationCompat.Builder(applicationContext, AppSettingsService.syncChannelId) | ||||||
|                     .setContentTitle(context.getString(R.string.loading_notification_title)) |                         .setContentTitle(context.getString(R.string.loading_notification_title)) | ||||||
|                     .setContentText(context.getString(R.string.loading_notification_text)) |                         .setContentText(context.getString(R.string.loading_notification_text)) | ||||||
|                     .setOngoing(true) |                         .setOngoing(true) | ||||||
|                     .setPriority(PRIORITY_LOW) |                         .setPriority(PRIORITY_LOW) | ||||||
|                     .setChannelId(Config.syncChannelId) |                         .setChannelId(AppSettingsService.syncChannelId) | ||||||
|                     .setSmallIcon(R.drawable.ic_stat_cloud_download_black_24dp) |                         .setSmallIcon(R.drawable.ic_stat_cloud_download_black_24dp) | ||||||
|  |  | ||||||
|             notificationManager.notify(1, notification.build()) |                 notificationManager.notify(1, notification.build()) | ||||||
|  |  | ||||||
|             val notifyNewItems = settings.getBoolean("notify_new_items", false) |                 repository.handleDBActions() | ||||||
|  |  | ||||||
|             val actions: List<ACTION> = repository.getDBActions() |                 val apiItems = repository.tryToCacheItemsAndGetNewOnes() | ||||||
|  |                 if (appSettingsService.isNotifyNewItemsEnabled()) { | ||||||
|             actions.forEach { action -> |                     launch { | ||||||
|                 when { |                         handleNewItemsNotification(apiItems, notificationManager) | ||||||
|                     action.read -> doAndReportOnFail( |  | ||||||
|                         repository.markAsReadById(action.articleid.toInt()), |  | ||||||
|                         action |  | ||||||
|                     ) |  | ||||||
|                     action.unread -> doAndReportOnFail( |  | ||||||
|                         repository.unmarkAsReadById(action.articleid.toInt()), |  | ||||||
|                         action |  | ||||||
|                     ) |  | ||||||
|                     action.starred -> doAndReportOnFail( |  | ||||||
|                         repository.starrById(action.articleid.toInt()), |  | ||||||
|                         action |  | ||||||
|                     ) |  | ||||||
|                     action.unstarred -> doAndReportOnFail( |  | ||||||
|                         repository.unstarrById(action.articleid.toInt()), |  | ||||||
|                         action |  | ||||||
|                     ) |  | ||||||
|                 } |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             launch { |  | ||||||
|                 handleNewItemsNotification(repository.tryToCacheItemsAndGetNewOnes(), notifyNewItems, notificationManager) |  | ||||||
|             } |  | ||||||
|         } |  | ||||||
|     } |  | ||||||
|     return Result.success() |  | ||||||
| } |  | ||||||
|  |  | ||||||
|     private fun handleNewItemsNotification( |  | ||||||
|         newItems: List<SelfossModel.Item>?, |  | ||||||
|         notifyNewItems: Boolean, |  | ||||||
|         notificationManager: NotificationManager |  | ||||||
|     ) { |  | ||||||
|         CoroutineScope(Dispatchers.IO).launch { |  | ||||||
|                 val apiItems = newItems.orEmpty() |  | ||||||
|  |  | ||||||
|  |  | ||||||
|                 val newSize = apiItems.filter { it.unread }.size |  | ||||||
|                 if (notifyNewItems && newSize > 0) { |  | ||||||
|  |  | ||||||
|                     val intent = Intent(context, MainActivity::class.java).apply { |  | ||||||
|                         flags = Intent.FLAG_ACTIVITY_NEW_TASK or Intent.FLAG_ACTIVITY_CLEAR_TASK |  | ||||||
|                     } |  | ||||||
|                     val pflags = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) { |  | ||||||
|                         PendingIntent.FLAG_IMMUTABLE |  | ||||||
|                     } else { |  | ||||||
|                         0 |  | ||||||
|                     } |  | ||||||
|                     val pendingIntent: PendingIntent = PendingIntent.getActivity(context, 0, intent, pflags) |  | ||||||
|  |  | ||||||
|                     val newItemsNotification = |  | ||||||
|                         NotificationCompat.Builder(applicationContext, Config.newItemsChannelId) |  | ||||||
|                             .setContentTitle(context.getString(R.string.new_items_notification_title)) |  | ||||||
|                             .setContentText( |  | ||||||
|                                 context.getString( |  | ||||||
|                                     R.string.new_items_notification_text, |  | ||||||
|                                     newSize |  | ||||||
|                                 ) |  | ||||||
|                             ) |  | ||||||
|                             .setPriority(PRIORITY_DEFAULT) |  | ||||||
|                             .setChannelId(Config.newItemsChannelId) |  | ||||||
|                             .setContentIntent(pendingIntent) |  | ||||||
|                             .setAutoCancel(true) |  | ||||||
|                             .setSmallIcon(R.drawable.ic_tab_fiber_new_black_24dp) |  | ||||||
|  |  | ||||||
|                     Timer("", false).schedule(4000) { |  | ||||||
|                         notificationManager.notify(2, newItemsNotification.build()) |  | ||||||
|                     } |                     } | ||||||
|                 } |                 } | ||||||
|                 apiItems.map { it.preloadImages(context) } |                 apiItems.map { it.preloadImages(context) } | ||||||
|  |             } | ||||||
|  |         } | ||||||
|  |         return Result.success() | ||||||
|  |     } | ||||||
|  |  | ||||||
|  |     private fun handleNewItemsNotification( | ||||||
|  |         newItems: List<SelfossModel.Item>?, | ||||||
|  |         notificationManager: NotificationManager | ||||||
|  |     ) { | ||||||
|  |         CoroutineScope(Dispatchers.IO).launch { | ||||||
|  |             val apiItems = newItems.orEmpty() | ||||||
|  |  | ||||||
|  |  | ||||||
|  |             val newSize = apiItems.filter { it.unread }.size | ||||||
|  |             if (newSize > 0) { | ||||||
|  |  | ||||||
|  |                 val intent = Intent(context, MainActivity::class.java).apply { | ||||||
|  |                     flags = Intent.FLAG_ACTIVITY_NEW_TASK or Intent.FLAG_ACTIVITY_CLEAR_TASK | ||||||
|  |                 } | ||||||
|  |                 val pflags = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) { | ||||||
|  |                     PendingIntent.FLAG_IMMUTABLE | ||||||
|  |                 } else { | ||||||
|  |                     0 | ||||||
|  |                 } | ||||||
|  |                 val pendingIntent: PendingIntent = | ||||||
|  |                     PendingIntent.getActivity(context, 0, intent, pflags) | ||||||
|  |  | ||||||
|  |                 val newItemsNotification = | ||||||
|  |                     NotificationCompat.Builder( | ||||||
|  |                         applicationContext, | ||||||
|  |                         AppSettingsService.newItemsChannelId | ||||||
|  |                     ) | ||||||
|  |                         .setContentTitle(context.getString(R.string.new_items_notification_title)) | ||||||
|  |                         .setContentText( | ||||||
|  |                             context.getString( | ||||||
|  |                                 R.string.new_items_notification_text, | ||||||
|  |                                 newSize | ||||||
|  |                             ) | ||||||
|  |                         ) | ||||||
|  |                         .setPriority(PRIORITY_DEFAULT) | ||||||
|  |                         .setChannelId(AppSettingsService.newItemsChannelId) | ||||||
|  |                         .setContentIntent(pendingIntent) | ||||||
|  |                         .setAutoCancel(true) | ||||||
|  |                         .setSmallIcon(R.drawable.ic_tab_fiber_new_black_24dp) | ||||||
|  |  | ||||||
|  |                 Timer("", false).schedule(4000) { | ||||||
|  |                     notificationManager.notify(2, newItemsNotification.build()) | ||||||
|  |                 } | ||||||
|  |             } | ||||||
|             Timer("", false).schedule(4000) { |             Timer("", false).schedule(4000) { | ||||||
|                 notificationManager.cancel(1) |                 notificationManager.cancel(1) | ||||||
|             } |             } | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun doAndReportOnFail(result: Boolean, action: ACTION) { |  | ||||||
|         if (result) { |  | ||||||
|             thread { |  | ||||||
|                 repository.deleteDBAction(action) |  | ||||||
|             } |  | ||||||
|         } |  | ||||||
|     } |  | ||||||
| } | } | ||||||
| @@ -8,6 +8,7 @@ import android.graphics.Typeface | |||||||
| import android.graphics.drawable.ColorDrawable | import android.graphics.drawable.ColorDrawable | ||||||
| import android.net.Uri | import android.net.Uri | ||||||
| import android.os.Bundle | import android.os.Bundle | ||||||
|  | import android.util.TypedValue | ||||||
| import android.view.* | import android.view.* | ||||||
| import android.webkit.WebResourceResponse | import android.webkit.WebResourceResponse | ||||||
| import android.webkit.WebSettings | import android.webkit.WebSettings | ||||||
| @@ -15,23 +16,24 @@ import android.webkit.WebView | |||||||
| import android.webkit.WebViewClient | import android.webkit.WebViewClient | ||||||
| import android.widget.Toast | import android.widget.Toast | ||||||
| import androidx.appcompat.app.AlertDialog | import androidx.appcompat.app.AlertDialog | ||||||
| import androidx.browser.customtabs.CustomTabsIntent |  | ||||||
| import androidx.core.content.res.ResourcesCompat |  | ||||||
| import androidx.core.widget.NestedScrollView | import androidx.core.widget.NestedScrollView | ||||||
| import androidx.fragment.app.Fragment | import androidx.fragment.app.Fragment | ||||||
| import bou.amine.apps.readerforselfossv2.android.ImageActivity | import bou.amine.apps.readerforselfossv2.android.ImageActivity | ||||||
| import bou.amine.apps.readerforselfossv2.android.R | import bou.amine.apps.readerforselfossv2.android.R | ||||||
| import bou.amine.apps.readerforselfossv2.android.api.mercury.MercuryApi |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.api.mercury.ParsedContent |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.databinding.FragmentArticleBinding | import bou.amine.apps.readerforselfossv2.android.databinding.FragmentArticleBinding | ||||||
| import bou.amine.apps.readerforselfossv2.android.model.* | import bou.amine.apps.readerforselfossv2.android.model.ParecelableItem | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.AppColors | import bou.amine.apps.readerforselfossv2.android.model.toModel | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.* | import bou.amine.apps.readerforselfossv2.android.model.toParcelable | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.customtabs.CustomTabActivityHelper | import bou.amine.apps.readerforselfossv2.android.sendSilentlyWithAcraWithName | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.glide.getBitmapInputStream | import bou.amine.apps.readerforselfossv2.android.utils.glide.getBitmapInputStream | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.glide.loadMaybeBasicAuth | import bou.amine.apps.readerforselfossv2.android.utils.openInBrowserAsNewTask | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository | import bou.amine.apps.readerforselfossv2.android.utils.shareLink | ||||||
|  | import bou.amine.apps.readerforselfossv2.model.MercuryModel | ||||||
| import bou.amine.apps.readerforselfossv2.model.SelfossModel | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
|  | import bou.amine.apps.readerforselfossv2.model.StatusAndData | ||||||
|  | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
|  | import bou.amine.apps.readerforselfossv2.rest.MercuryApi | ||||||
|  | import bou.amine.apps.readerforselfossv2.service.AppSettingsService | ||||||
| import bou.amine.apps.readerforselfossv2.utils.getHtmlDecoded | import bou.amine.apps.readerforselfossv2.utils.getHtmlDecoded | ||||||
| import bou.amine.apps.readerforselfossv2.utils.getImages | import bou.amine.apps.readerforselfossv2.utils.getImages | ||||||
| import bou.amine.apps.readerforselfossv2.utils.getThumbnail | import bou.amine.apps.readerforselfossv2.utils.getThumbnail | ||||||
| @@ -41,7 +43,6 @@ import com.bumptech.glide.load.engine.DiskCacheStrategy | |||||||
| import com.bumptech.glide.request.RequestOptions | import com.bumptech.glide.request.RequestOptions | ||||||
| import com.github.rubensousa.floatingtoolbar.FloatingToolbar | import com.github.rubensousa.floatingtoolbar.FloatingToolbar | ||||||
| import com.google.android.material.floatingactionbutton.FloatingActionButton | import com.google.android.material.floatingactionbutton.FloatingActionButton | ||||||
| import com.russhwolf.settings.Settings |  | ||||||
| import kotlinx.coroutines.CoroutineScope | import kotlinx.coroutines.CoroutineScope | ||||||
| import kotlinx.coroutines.Dispatchers | import kotlinx.coroutines.Dispatchers | ||||||
| import kotlinx.coroutines.launch | import kotlinx.coroutines.launch | ||||||
| @@ -49,52 +50,41 @@ import org.kodein.di.DI | |||||||
| import org.kodein.di.DIAware | import org.kodein.di.DIAware | ||||||
| import org.kodein.di.android.x.closestDI | import org.kodein.di.android.x.closestDI | ||||||
| import org.kodein.di.instance | import org.kodein.di.instance | ||||||
| import retrofit2.Call |  | ||||||
| import retrofit2.Callback |  | ||||||
| import retrofit2.Response |  | ||||||
| import java.net.MalformedURLException | import java.net.MalformedURLException | ||||||
|  | import java.net.SocketTimeoutException | ||||||
| import java.net.URL | import java.net.URL | ||||||
| import java.util.* | import java.util.* | ||||||
| import java.util.concurrent.ExecutionException | import java.util.concurrent.ExecutionException | ||||||
|  |  | ||||||
|  |  | ||||||
|  | private const val IMAGE_JPG = "image/jpg" | ||||||
|  |  | ||||||
| class ArticleFragment : Fragment(), DIAware { | class ArticleFragment : Fragment(), DIAware { | ||||||
|     private var fontSize: Int = 16 |     private var fontSize: Int = 16 | ||||||
|     private lateinit var item: SelfossModel.Item |     private lateinit var item: SelfossModel.Item | ||||||
|     private var mCustomTabActivityHelper: CustomTabActivityHelper? = null |  | ||||||
|     private lateinit var url: String |     private lateinit var url: String | ||||||
|     private lateinit var contentText: String |     private lateinit var contentText: String | ||||||
|     private lateinit var contentSource: String |     private lateinit var contentSource: String | ||||||
|     private lateinit var contentImage: String |     private lateinit var contentImage: String | ||||||
|     private lateinit var contentTitle: String |     private lateinit var contentTitle: String | ||||||
|     private lateinit var allImages : ArrayList<String> |     private lateinit var allImages: ArrayList<String> | ||||||
|     private lateinit var fab: FloatingActionButton |     private lateinit var fab: FloatingActionButton | ||||||
|     private lateinit var appColors: AppColors |  | ||||||
|     private lateinit var textAlignment: String |     private lateinit var textAlignment: String | ||||||
|     private lateinit var config: Config |     private lateinit var binding: FragmentArticleBinding | ||||||
|     private var _binding: FragmentArticleBinding? = null |  | ||||||
|     private val binding get() = _binding!! |  | ||||||
|  |  | ||||||
|     override val di : DI by closestDI() |     override val di: DI by closestDI() | ||||||
|     private val repository: Repository by instance() |     private val repository: Repository by instance() | ||||||
|  |     private val appSettingsService: AppSettingsService by instance() | ||||||
|     private var settings = Settings() |  | ||||||
|  |  | ||||||
|     private var typeface: Typeface? = null |     private var typeface: Typeface? = null | ||||||
|     private var resId: Int = 0 |     private var resId: Int = 0 | ||||||
|     private var font = "" |     private var font = "" | ||||||
|     private var staticBar = false |     private var staticBar = false | ||||||
|  |  | ||||||
|     override fun onStop() { |     private val mercuryApi: MercuryApi by instance() | ||||||
|         super.onStop() |  | ||||||
|         if (mCustomTabActivityHelper != null) { |  | ||||||
|             mCustomTabActivityHelper!!.unbindCustomTabsService(activity) |  | ||||||
|         } |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     override fun onCreate(savedInstanceState: Bundle?) { |     override fun onCreate(savedInstanceState: Bundle?) { | ||||||
|         appColors = AppColors(requireActivity()) |  | ||||||
|         config = Config() |  | ||||||
|  |  | ||||||
|         super.onCreate(savedInstanceState) |         super.onCreate(savedInstanceState) | ||||||
|  |  | ||||||
|         val pi: ParecelableItem = requireArguments().getParcelable(ARG_ITEMS)!! |         val pi: ParecelableItem = requireArguments().getParcelable(ARG_ITEMS)!! | ||||||
| @@ -108,85 +98,28 @@ class ArticleFragment : Fragment(), DIAware { | |||||||
|         savedInstanceState: Bundle? |         savedInstanceState: Bundle? | ||||||
|     ): View { |     ): View { | ||||||
|         try { |         try { | ||||||
|             _binding = FragmentArticleBinding.inflate(inflater, container, false) |             binding = FragmentArticleBinding.inflate(inflater, container, false) | ||||||
|  |  | ||||||
|             url = item.getLinkDecoded() |             url = item.getLinkDecoded() | ||||||
|             contentText = item.content |             contentText = item.content | ||||||
|             contentTitle = item.title.getHtmlDecoded() |             contentTitle = item.title.getHtmlDecoded() | ||||||
|             contentImage = item.getThumbnail(repository.baseUrl) |             contentImage = item.getThumbnail(repository.baseUrl) | ||||||
|             contentSource = item.sourceAndDateText(repository.dateUtils) |             contentSource = item.sourceAuthorAndDate() | ||||||
|             allImages = item.getImages() |             allImages = item.getImages() | ||||||
|  |  | ||||||
|             fontSize = settings.getString("reader_font_size", "16").toInt() |             fontSize = appSettingsService.getFontSize() | ||||||
|             staticBar = settings.getBoolean("reader_static_bar", false) |             staticBar = appSettingsService.isStaticBarEnabled() | ||||||
|  |             font = appSettingsService.getFont() | ||||||
|             font = settings.getString("reader_font", "") |  | ||||||
|             if (font.isNotEmpty()) { |  | ||||||
|                 resId = requireContext().resources.getIdentifier(font, "font", requireContext().packageName) |  | ||||||
|                 typeface = try { |  | ||||||
|                     ResourcesCompat.getFont(requireContext(), resId)!! |  | ||||||
|                 } catch (e: java.lang.Exception) { |  | ||||||
|                     // Just to be sure |  | ||||||
|                     null |  | ||||||
|                 } |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             refreshAlignment() |             refreshAlignment() | ||||||
|  |  | ||||||
|             fab = binding.fab |             fab = binding.fab | ||||||
|  |  | ||||||
|             fab.backgroundTintList = ColorStateList.valueOf(appColors.colorAccent) |             fab.backgroundTintList = ColorStateList.valueOf(resources.getColor(R.color.colorAccent)) | ||||||
|  |  | ||||||
|             fab.rippleColor = appColors.colorAccentDark |             fab.rippleColor = resources.getColor(R.color.colorAccentDark) | ||||||
|  |  | ||||||
|             val floatingToolbar: FloatingToolbar = binding.floatingToolbar |             val floatingToolbar: FloatingToolbar = handleFloatingToolbar() | ||||||
|             floatingToolbar.attachFab(fab) |  | ||||||
|  |  | ||||||
|             floatingToolbar.background = ColorDrawable(appColors.colorAccent) |  | ||||||
|  |  | ||||||
|             val customTabsIntent = requireActivity().buildCustomTabsIntent() |  | ||||||
|             mCustomTabActivityHelper = CustomTabActivityHelper() |  | ||||||
|             mCustomTabActivityHelper!!.bindCustomTabsService(activity) |  | ||||||
|  |  | ||||||
|  |  | ||||||
|             floatingToolbar.setClickListener( |  | ||||||
|                 object : FloatingToolbar.ItemClickListener { |  | ||||||
|                     override fun onItemClick(item: MenuItem) { |  | ||||||
|                         when (item.itemId) { |  | ||||||
|                             R.id.more_action -> getContentFromMercury(customTabsIntent) |  | ||||||
|                             R.id.share_action -> requireActivity().shareLink(url, contentTitle) |  | ||||||
|                             R.id.open_action -> requireActivity().openInBrowserAsNewTask(this@ArticleFragment.item) |  | ||||||
|                             R.id.unread_action -> if (context != null) { |  | ||||||
|                                 if (this@ArticleFragment.item.unread) { |  | ||||||
|                                     CoroutineScope(Dispatchers.IO).launch { |  | ||||||
|                                         repository.markAsRead(this@ArticleFragment.item) |  | ||||||
|                                     } |  | ||||||
|                                     this@ArticleFragment.item.unread = false |  | ||||||
|                                     Toast.makeText( |  | ||||||
|                                         context, |  | ||||||
|                                         R.string.marked_as_read, |  | ||||||
|                                         Toast.LENGTH_LONG |  | ||||||
|                                     ).show() |  | ||||||
|                                 } else { |  | ||||||
|                                     CoroutineScope(Dispatchers.IO).launch { |  | ||||||
|                                         repository.unmarkAsRead(this@ArticleFragment.item) |  | ||||||
|                                     } |  | ||||||
|                                     this@ArticleFragment.item.unread = true |  | ||||||
|                                     Toast.makeText( |  | ||||||
|                                         context, |  | ||||||
|                                         R.string.marked_as_unread, |  | ||||||
|                                         Toast.LENGTH_LONG |  | ||||||
|                                     ).show() |  | ||||||
|                                 } |  | ||||||
|                             } |  | ||||||
|                             else -> Unit |  | ||||||
|                         } |  | ||||||
|                     } |  | ||||||
|  |  | ||||||
|                     override fun onItemLongClick(item: MenuItem?) { |  | ||||||
|                     } |  | ||||||
|                 } |  | ||||||
|             ) |  | ||||||
|  |  | ||||||
|             if (staticBar) { |             if (staticBar) { | ||||||
|                 fab.hide() |                 fab.hide() | ||||||
| @@ -198,28 +131,7 @@ class ArticleFragment : Fragment(), DIAware { | |||||||
|                 binding.source.typeface = typeface |                 binding.source.typeface = typeface | ||||||
|             } |             } | ||||||
|  |  | ||||||
|             if (contentText.isEmptyOrNullOrNullString()) { |             handleContent() | ||||||
|                 getContentFromMercury(customTabsIntent) |  | ||||||
|             } else { |  | ||||||
|                 binding.titleView.text = contentTitle |  | ||||||
|                 if (typeface != null) { |  | ||||||
|                     binding.titleView.typeface = typeface |  | ||||||
|                 } |  | ||||||
|  |  | ||||||
|                 htmlToWebview() |  | ||||||
|  |  | ||||||
|                 if (!contentImage.isEmptyOrNullOrNullString() && context != null) { |  | ||||||
|                     binding.imageView.visibility = View.VISIBLE |  | ||||||
|                     Glide |  | ||||||
|                         .with(requireContext()) |  | ||||||
|                         .asBitmap() |  | ||||||
|                         .loadMaybeBasicAuth(config, contentImage) |  | ||||||
|                         .apply(RequestOptions.fitCenterTransform()) |  | ||||||
|                         .into(binding.imageView) |  | ||||||
|                 } else { |  | ||||||
|                     binding.imageView.visibility = View.GONE |  | ||||||
|                 } |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             binding.nestedScrollView.setOnScrollChangeListener( |             binding.nestedScrollView.setOnScrollChangeListener( | ||||||
|                 NestedScrollView.OnScrollChangeListener { _, _, scrollY, _, oldScrollY -> |                 NestedScrollView.OnScrollChangeListener { _, _, scrollY, _, oldScrollY -> | ||||||
| @@ -237,12 +149,14 @@ class ArticleFragment : Fragment(), DIAware { | |||||||
|             ) |             ) | ||||||
|  |  | ||||||
|         } catch (e: InflateException) { |         } catch (e: InflateException) { | ||||||
|  |             e.sendSilentlyWithAcraWithName("webview not available") | ||||||
|             AlertDialog.Builder(requireContext()) |             AlertDialog.Builder(requireContext()) | ||||||
|                 .setMessage(requireContext().getString(R.string.webview_dialog_issue_message)) |                 .setMessage(requireContext().getString(R.string.webview_dialog_issue_message)) | ||||||
|                 .setTitle(requireContext().getString(R.string.webview_dialog_issue_title)) |                 .setTitle(requireContext().getString(R.string.webview_dialog_issue_title)) | ||||||
|                 .setPositiveButton(android.R.string.ok |                 .setPositiveButton( | ||||||
|  |                     android.R.string.ok | ||||||
|                 ) { _, _ -> |                 ) { _, _ -> | ||||||
|                     settings.putBoolean("prefer_article_viewer", false) |                     appSettingsService.disableArticleViewer() | ||||||
|                     requireActivity().finish() |                     requireActivity().finish() | ||||||
|                 } |                 } | ||||||
|                 .create() |                 .create() | ||||||
| @@ -252,110 +166,196 @@ class ArticleFragment : Fragment(), DIAware { | |||||||
|         return binding.root |         return binding.root | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     override fun onDestroyView() { |     private fun handleContent() { | ||||||
|         super.onDestroyView() |         if (contentText.isEmptyOrNullOrNullString()) { | ||||||
|         _binding = null |             if (repository.isNetworkAvailable()) { | ||||||
|  |                 getContentFromMercury() | ||||||
|  |             } | ||||||
|  |         } else { | ||||||
|  |             binding.titleView.text = contentTitle | ||||||
|  |             if (typeface != null) { | ||||||
|  |                 binding.titleView.typeface = typeface | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             htmlToWebview() | ||||||
|  |  | ||||||
|  |             if (!contentImage.isEmptyOrNullOrNullString() && context != null) { | ||||||
|  |                 binding.imageView.visibility = View.VISIBLE | ||||||
|  |                 Glide | ||||||
|  |                     .with(requireContext()) | ||||||
|  |                     .asBitmap() | ||||||
|  |                     .load(contentImage) | ||||||
|  |                     .apply(RequestOptions.fitCenterTransform()) | ||||||
|  |                     .into(binding.imageView) | ||||||
|  |             } else { | ||||||
|  |                 binding.imageView.visibility = View.GONE | ||||||
|  |             } | ||||||
|  |         } | ||||||
|  |     } | ||||||
|  |  | ||||||
|  |     private fun handleFloatingToolbar(): FloatingToolbar { | ||||||
|  |         val floatingToolbar: FloatingToolbar = binding.floatingToolbar | ||||||
|  |         floatingToolbar.attachFab(fab) | ||||||
|  |  | ||||||
|  |         floatingToolbar.background = ColorDrawable(resources.getColor(R.color.colorAccent)) | ||||||
|  |  | ||||||
|  |         floatingToolbar.setClickListener( | ||||||
|  |             object : FloatingToolbar.ItemClickListener { | ||||||
|  |                 override fun onItemClick(item: MenuItem) { | ||||||
|  |                     when (item.itemId) { | ||||||
|  |                         R.id.share_action -> requireActivity().shareLink(url, contentTitle) | ||||||
|  |                         R.id.open_action -> requireActivity().openInBrowserAsNewTask(this@ArticleFragment.item) | ||||||
|  |                         R.id.unread_action -> if (context != null) { | ||||||
|  |                             if (this@ArticleFragment.item.unread) { | ||||||
|  |                                 CoroutineScope(Dispatchers.IO).launch { | ||||||
|  |                                     repository.markAsRead(this@ArticleFragment.item) | ||||||
|  |                                 } | ||||||
|  |                                 this@ArticleFragment.item.unread = false | ||||||
|  |                                 Toast.makeText( | ||||||
|  |                                     context, | ||||||
|  |                                     R.string.marked_as_read, | ||||||
|  |                                     Toast.LENGTH_LONG | ||||||
|  |                                 ).show() | ||||||
|  |                             } else { | ||||||
|  |                                 CoroutineScope(Dispatchers.IO).launch { | ||||||
|  |                                     repository.unmarkAsRead(this@ArticleFragment.item) | ||||||
|  |                                 } | ||||||
|  |                                 this@ArticleFragment.item.unread = true | ||||||
|  |                                 Toast.makeText( | ||||||
|  |                                     context, | ||||||
|  |                                     R.string.marked_as_unread, | ||||||
|  |                                     Toast.LENGTH_LONG | ||||||
|  |                                 ).show() | ||||||
|  |                             } | ||||||
|  |                         } | ||||||
|  |                         else -> Unit | ||||||
|  |                     } | ||||||
|  |                 } | ||||||
|  |  | ||||||
|  |                 override fun onItemLongClick(item: MenuItem?) { | ||||||
|  |                     // We do nothing | ||||||
|  |                 } | ||||||
|  |             } | ||||||
|  |         ) | ||||||
|  |         return floatingToolbar | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun refreshAlignment() { |     private fun refreshAlignment() { | ||||||
|         textAlignment = when (settings.getInt("text_align", 1)) { |         textAlignment = when (appSettingsService.getActiveAllignment()) { | ||||||
|             1 -> "justify" |             1 -> "justify" | ||||||
|             2 -> "left" |             2 -> "left" | ||||||
|             else -> "justify" |             else -> "justify" | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun getContentFromMercury(customTabsIntent: CustomTabsIntent) { |     private fun getContentFromMercury() { | ||||||
|         if (repository.isNetworkAvailable()) { |  | ||||||
|         binding.progressBar.visibility = View.VISIBLE |         binding.progressBar.visibility = View.VISIBLE | ||||||
|         val parser = MercuryApi() |  | ||||||
|  |  | ||||||
|             parser.parseUrl(url).enqueue( |         CoroutineScope(Dispatchers.Main).launch { | ||||||
|                 object : Callback<ParsedContent> { |             try { | ||||||
|                     override fun onResponse( |                 val response = mercuryApi.query(url) | ||||||
|                         call: Call<ParsedContent>, |                 if (response.success && response.data != null && !response.data?.content.isNullOrEmpty()) { | ||||||
|                         response: Response<ParsedContent> |                     binding.titleView.text = response.data!!.title.orEmpty() | ||||||
|                     ) { |                     if (typeface != null) { | ||||||
|                         // TODO: clean all the following after finding the mercury content issue |                         binding.titleView.typeface = typeface | ||||||
|                         try { |  | ||||||
|                             if (response.body() != null && response.body()!!.content != null && !response.body()!!.content.isNullOrEmpty()) { |  | ||||||
|                                 try { |  | ||||||
|                                     binding.titleView.text = response.body()!!.title |  | ||||||
|                                     if (typeface != null) { |  | ||||||
|                                         binding.titleView.typeface = typeface |  | ||||||
|                                     } |  | ||||||
|                                     try { |  | ||||||
|                                         // Note: Mercury may return relative urls... If it does the url val will not be changed. |  | ||||||
|                                         URL(response.body()!!.url) |  | ||||||
|                                         url = response.body()!!.url |  | ||||||
|                                     } catch (e: MalformedURLException) { |  | ||||||
|                                         // Mercury returned a relative url. We do nothing. |  | ||||||
|                                     } |  | ||||||
|                                 } catch (e: Exception) { |  | ||||||
|                                 } |  | ||||||
|  |  | ||||||
|                                 try { |  | ||||||
|                                     contentText = response.body()!!.content.orEmpty() |  | ||||||
|                                     htmlToWebview() |  | ||||||
|                                 } catch (e: Exception) { |  | ||||||
|                                 } |  | ||||||
|  |  | ||||||
|                                 try { |  | ||||||
|                                     if (response.body()!!.lead_image_url != null && !response.body()!!.lead_image_url.isNullOrEmpty() && context != null) { |  | ||||||
|                                         binding.imageView.visibility = View.VISIBLE |  | ||||||
|                                         try { |  | ||||||
|                                             Glide |  | ||||||
|                                                 .with(requireContext()) |  | ||||||
|                                                 .asBitmap() |  | ||||||
|                                                 .loadMaybeBasicAuth( |  | ||||||
|                                                     config, |  | ||||||
|                                                     response.body()!!.lead_image_url.orEmpty() |  | ||||||
|                                                 ) |  | ||||||
|                                                 .apply(RequestOptions.fitCenterTransform()) |  | ||||||
|                                                 .into(binding.imageView) |  | ||||||
|                                         } catch (e: Exception) { |  | ||||||
|                                         } |  | ||||||
|                                     } else { |  | ||||||
|                                         binding.imageView.visibility = View.GONE |  | ||||||
|                                     } |  | ||||||
|                                 } catch (e: Exception) { |  | ||||||
|                                     if (context != null) { |  | ||||||
|                                     } |  | ||||||
|                                 } |  | ||||||
|  |  | ||||||
|                                 try { |  | ||||||
|                                     binding.nestedScrollView.scrollTo(0, 0) |  | ||||||
|  |  | ||||||
|                                     binding.progressBar.visibility = View.GONE |  | ||||||
|                                 } catch (e: Exception) { |  | ||||||
|                                     if (context != null) { |  | ||||||
|                                     } |  | ||||||
|                                 } |  | ||||||
|                             } else { |  | ||||||
|                                 try { |  | ||||||
|                                     openInBrowserAfterFailing(customTabsIntent) |  | ||||||
|                                 } catch (e: Exception) { |  | ||||||
|                                     if (context != null) { |  | ||||||
|                                     } |  | ||||||
|                                 } |  | ||||||
|                             } |  | ||||||
|                         } catch (e: Exception) { |  | ||||||
|                             if (context != null) { |  | ||||||
|                             } |  | ||||||
|                         } |  | ||||||
|                     } |                     } | ||||||
|  |                     URL(response.data!!.url) | ||||||
|  |                     url = response.data!!.url | ||||||
|  |  | ||||||
|                     override fun onFailure( |                     contentText = response.data!!.content.orEmpty() | ||||||
|                         call: Call<ParsedContent>, |                     htmlToWebview() | ||||||
|                         t: Throwable |  | ||||||
|                     ) = openInBrowserAfterFailing(customTabsIntent) |                     handleLeadImage(response) | ||||||
|  |  | ||||||
|  |                     binding.nestedScrollView.scrollTo(0, 0) | ||||||
|  |                     binding.progressBar.visibility = View.GONE | ||||||
|  |                 } else { | ||||||
|  |                     openInBrowserAfterFailing() | ||||||
|                 } |                 } | ||||||
|             ) |             } catch (e: SocketTimeoutException) { | ||||||
|  |                 openInBrowserAfterFailing() | ||||||
|  |             } catch (e: Exception) { | ||||||
|  |                 e.sendSilentlyWithAcraWithName("getContentFromMercury > $url") | ||||||
|  |                 openInBrowserAfterFailing() | ||||||
|  |             } | ||||||
|  |         } | ||||||
|  |     } | ||||||
|  |  | ||||||
|  |     private fun handleLeadImage(response: StatusAndData<MercuryModel.ParsedContent>) { | ||||||
|  |         if (!response.data?.lead_image_url.isNullOrEmpty() && context != null) { | ||||||
|  |             binding.imageView.visibility = View.VISIBLE | ||||||
|  |             Glide | ||||||
|  |                 .with(requireContext()) | ||||||
|  |                 .asBitmap() | ||||||
|  |                 .load( | ||||||
|  |                     response.data!!.lead_image_url.orEmpty() | ||||||
|  |                 ) | ||||||
|  |                 .apply(RequestOptions.fitCenterTransform()) | ||||||
|  |                 .into(binding.imageView) | ||||||
|  |         } else { | ||||||
|  |             binding.imageView.visibility = View.GONE | ||||||
|  |         } | ||||||
|  |     } | ||||||
|  |  | ||||||
|  |     private fun handleImageLoading() { | ||||||
|  |         binding.webcontent.webViewClient = object : WebViewClient() { | ||||||
|  |             @Deprecated("Deprecated in Java") | ||||||
|  |             override fun shouldOverrideUrlLoading(view: WebView?, url: String): Boolean { | ||||||
|  |                 if (binding.webcontent.hitTestResult.type != WebView.HitTestResult.SRC_IMAGE_ANCHOR_TYPE) { | ||||||
|  |                     requireContext().startActivity(Intent(Intent.ACTION_VIEW, Uri.parse(url))) | ||||||
|  |                 } | ||||||
|  |                 return true | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             @Deprecated("Deprecated in Java") | ||||||
|  |             override fun shouldInterceptRequest(view: WebView, url: String): WebResourceResponse? { | ||||||
|  |                 val glideOptions = RequestOptions.diskCacheStrategyOf(DiskCacheStrategy.ALL) | ||||||
|  |                 if (url.lowercase(Locale.US).contains(".jpg") || url.lowercase(Locale.US) | ||||||
|  |                         .contains(".jpeg") | ||||||
|  |                 ) { | ||||||
|  |                     try { | ||||||
|  |                         val image = | ||||||
|  |                             Glide.with(view).asBitmap().apply(glideOptions).load(url).submit().get() | ||||||
|  |                         return WebResourceResponse( | ||||||
|  |                             IMAGE_JPG, | ||||||
|  |                             "UTF-8", | ||||||
|  |                             getBitmapInputStream(image, Bitmap.CompressFormat.JPEG) | ||||||
|  |                         ) | ||||||
|  |                     } catch (e: ExecutionException) { | ||||||
|  |                         e.sendSilentlyWithAcraWithName("shouldInterceptRequest > jpeg > $url") | ||||||
|  |                     } | ||||||
|  |                 } else if (url.lowercase(Locale.US).contains(".png")) { | ||||||
|  |                     try { | ||||||
|  |                         val image = | ||||||
|  |                             Glide.with(view).asBitmap().apply(glideOptions).load(url).submit().get() | ||||||
|  |                         return WebResourceResponse( | ||||||
|  |                             IMAGE_JPG, | ||||||
|  |                             "UTF-8", | ||||||
|  |                             getBitmapInputStream(image, Bitmap.CompressFormat.PNG) | ||||||
|  |                         ) | ||||||
|  |                     } catch (e: ExecutionException) { | ||||||
|  |                         e.sendSilentlyWithAcraWithName("shouldInterceptRequest > png > $url") | ||||||
|  |                     } | ||||||
|  |                 } else if (url.lowercase(Locale.US).contains(".webp")) { | ||||||
|  |                     try { | ||||||
|  |                         val image = | ||||||
|  |                             Glide.with(view).asBitmap().apply(glideOptions).load(url).submit().get() | ||||||
|  |                         return WebResourceResponse( | ||||||
|  |                             IMAGE_JPG, | ||||||
|  |                             "UTF-8", | ||||||
|  |                             getBitmapInputStream(image, Bitmap.CompressFormat.WEBP) | ||||||
|  |                         ) | ||||||
|  |                     } catch (e: ExecutionException) { | ||||||
|  |                         e.sendSilentlyWithAcraWithName("shouldInterceptRequest > webp > $url") | ||||||
|  |                     } | ||||||
|  |                 } | ||||||
|  |  | ||||||
|  |                 return super.shouldInterceptRequest(view, url) | ||||||
|  |             } | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun htmlToWebview() { |     private fun htmlToWebview() { | ||||||
|         val stringColor = String.format("#%06X", 0xFFFFFF and appColors.colorAccent) |  | ||||||
|  |  | ||||||
|         val attrs: IntArray = intArrayOf(android.R.attr.fontFamily) |         val attrs: IntArray = intArrayOf(android.R.attr.fontFamily) | ||||||
|         val a: TypedArray = requireContext().obtainStyledAttributes(resId, attrs) |         val a: TypedArray = requireContext().obtainStyledAttributes(resId, attrs) | ||||||
| @@ -364,60 +364,29 @@ class ArticleFragment : Fragment(), DIAware { | |||||||
|         binding.webcontent.settings.standardFontFamily = a.getString(0) |         binding.webcontent.settings.standardFontFamily = a.getString(0) | ||||||
|         binding.webcontent.visibility = View.VISIBLE |         binding.webcontent.visibility = View.VISIBLE | ||||||
|  |  | ||||||
|         // TODO: Set the color strings programmatically |         val colorOnSurface = TypedValue() | ||||||
|         val (stringTextColor, stringBackgroundColor) = if (appColors.isDarkTheme) { |         requireContext().theme.resolveAttribute(R.attr.colorOnSurface, colorOnSurface, true) | ||||||
|             Pair("#FFFFFF", "#303030") |  | ||||||
|         } else { |         val colorSurface = TypedValue() | ||||||
|             Pair("#212121", "#FAFAFA") |         requireContext().theme.resolveAttribute(R.attr.colorSurface, colorSurface, true) | ||||||
|         } |  | ||||||
|  |  | ||||||
|         binding.webcontent.settings.useWideViewPort = true |         binding.webcontent.settings.useWideViewPort = true | ||||||
|         binding.webcontent.settings.loadWithOverviewMode = true |         binding.webcontent.settings.loadWithOverviewMode = true | ||||||
|         binding.webcontent.settings.javaScriptEnabled = false |         binding.webcontent.settings.javaScriptEnabled = false | ||||||
|  |  | ||||||
|         binding.webcontent.webViewClient = object : WebViewClient() { |         handleImageLoading() | ||||||
|             override fun shouldOverrideUrlLoading(view: WebView?, url : String): Boolean { |  | ||||||
|                 if (binding.webcontent.hitTestResult.type != WebView.HitTestResult.SRC_IMAGE_ANCHOR_TYPE) { |  | ||||||
|                     requireContext().startActivity(Intent(Intent.ACTION_VIEW, Uri.parse(url))) |  | ||||||
|                 } |  | ||||||
|                 return true |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             override fun shouldInterceptRequest(view: WebView?, url: String): WebResourceResponse? { |         val gestureDetector = | ||||||
|                 val glideOptions = RequestOptions.diskCacheStrategyOf(DiskCacheStrategy.ALL) |             GestureDetector(activity, object : GestureDetector.SimpleOnGestureListener() { | ||||||
|                 if (url.lowercase(Locale.US).contains(".jpg") || url.lowercase(Locale.US).contains(".jpeg")) { |                 override fun onSingleTapUp(e: MotionEvent): Boolean { | ||||||
|                     try { |                     return performClick() | ||||||
|                         val image = Glide.with(view).asBitmap().apply(glideOptions).load(url).submit().get() |  | ||||||
|                         return WebResourceResponse("image/jpg", "UTF-8", getBitmapInputStream(image, Bitmap.CompressFormat.JPEG)) |  | ||||||
|                     }catch ( e : ExecutionException) {} |  | ||||||
|                 } |  | ||||||
|                 else if (url.lowercase(Locale.US).contains(".png")) { |  | ||||||
|                     try { |  | ||||||
|                         val image = Glide.with(view).asBitmap().apply(glideOptions).load(url).submit().get() |  | ||||||
|                         return WebResourceResponse("image/jpg", "UTF-8", getBitmapInputStream(image, Bitmap.CompressFormat.PNG)) |  | ||||||
|                     }catch ( e : ExecutionException) {} |  | ||||||
|                 } |  | ||||||
|                 else if (url.lowercase(Locale.US).contains(".webp")) { |  | ||||||
|                     try { |  | ||||||
|                         val image = Glide.with(view).asBitmap().apply(glideOptions).load(url).submit().get() |  | ||||||
|                         return WebResourceResponse("image/jpg", "UTF-8", getBitmapInputStream(image, Bitmap.CompressFormat.WEBP)) |  | ||||||
|                     }catch ( e : ExecutionException) {} |  | ||||||
|                 } |                 } | ||||||
|  |             }) | ||||||
|  |  | ||||||
|                 return super.shouldInterceptRequest(view, url) |         binding.webcontent.setOnTouchListener { _, event -> gestureDetector.onTouchEvent(event) } | ||||||
|             } |  | ||||||
|         } |  | ||||||
|  |  | ||||||
|         val gestureDetector = GestureDetector(activity, object : GestureDetector.SimpleOnGestureListener() { |  | ||||||
|             override fun onSingleTapUp(e: MotionEvent?): Boolean { |  | ||||||
|                 return performClick() |  | ||||||
|             } |  | ||||||
|         }) |  | ||||||
|  |  | ||||||
|         binding.webcontent.setOnTouchListener { _, event -> gestureDetector.onTouchEvent(event)} |  | ||||||
|  |  | ||||||
|         binding.webcontent.settings.layoutAlgorithm = |         binding.webcontent.settings.layoutAlgorithm = | ||||||
|                 WebSettings.LayoutAlgorithm.TEXT_AUTOSIZING |             WebSettings.LayoutAlgorithm.TEXT_AUTOSIZING | ||||||
|  |  | ||||||
|         var baseUrl: String? = null |         var baseUrl: String? = null | ||||||
|  |  | ||||||
| @@ -425,16 +394,23 @@ class ArticleFragment : Fragment(), DIAware { | |||||||
|             val itemUrl = URL(url) |             val itemUrl = URL(url) | ||||||
|             baseUrl = itemUrl.protocol + "://" + itemUrl.host |             baseUrl = itemUrl.protocol + "://" + itemUrl.host | ||||||
|         } catch (e: MalformedURLException) { |         } catch (e: MalformedURLException) { | ||||||
|  |             e.sendSilentlyWithAcraWithName("htmlToWebview > item url") | ||||||
|         } |         } | ||||||
|  |  | ||||||
|         val fontName =  when (font) { |         val fontName = when (font) { | ||||||
|             getString(R.string.open_sans_font_id) -> "Open Sans" |             getString(R.string.open_sans_font_id) -> "Open Sans" | ||||||
|             getString(R.string.roboto_font_id) -> "Roboto" |             getString(R.string.roboto_font_id) -> "Roboto" | ||||||
|  |             getString(R.string.source_code_pro_font_id) -> "Source Code Pro" | ||||||
|             else -> "" |             else -> "" | ||||||
|         } |         } | ||||||
|  |  | ||||||
|         val fontLinkAndStyle = if (font.isNotEmpty()) { |         val fontLinkAndStyle = if (font.isNotEmpty()) { | ||||||
|             """<link href="https://fonts.googleapis.com/css?family=${fontName.replace(" ", "+")}" rel="stylesheet"> |             """<link href="https://fonts.googleapis.com/css?family=${ | ||||||
|  |                 fontName.replace( | ||||||
|  |                     " ", | ||||||
|  |                     "+" | ||||||
|  |                 ) | ||||||
|  |             }" rel="stylesheet"> | ||||||
|                 |<style> |                 |<style> | ||||||
|                 |   * { |                 |   * { | ||||||
|                 |       font-family: '$fontName'; |                 |       font-family: '$fontName'; | ||||||
| @@ -458,10 +434,15 @@ class ArticleFragment : Fragment(), DIAware { | |||||||
|                 |        max-width: 100%; |                 |        max-width: 100%; | ||||||
|                 |      } |                 |      } | ||||||
|                 |      a { |                 |      a { | ||||||
|                 |        color: $stringColor !important; |                 |        color: ${ | ||||||
|  |                 String.format( | ||||||
|  |                     "#%06X", | ||||||
|  |                     0xFFFFFF and resources.getColor(R.color.colorAccent) | ||||||
|  |                 ) | ||||||
|  |             } !important; | ||||||
|                 |      } |                 |      } | ||||||
|                 |      *:not(a) { |                 |      *:not(a) { | ||||||
|                 |        color: $stringTextColor; |                 |        color: ${String.format("#%06X", 0xFFFFFF and colorOnSurface.data)}; | ||||||
|                 |      } |                 |      } | ||||||
|                 |      * { |                 |      * { | ||||||
|                 |        font-size: ${fontSize}px; |                 |        font-size: ${fontSize}px; | ||||||
| @@ -469,11 +450,26 @@ class ArticleFragment : Fragment(), DIAware { | |||||||
|                 |        word-break: break-word; |                 |        word-break: break-word; | ||||||
|                 |        overflow:hidden; |                 |        overflow:hidden; | ||||||
|                 |        line-height: 1.5em; |                 |        line-height: 1.5em; | ||||||
|                 |        background-color: $stringBackgroundColor; |                 |        background-color: ${ | ||||||
|  |                 String.format( | ||||||
|  |                     "#%06X", | ||||||
|  |                     0xFFFFFF and colorSurface.data | ||||||
|  |                 ) | ||||||
|  |             }; | ||||||
|                 |      } |                 |      } | ||||||
|                 |      body, html { |                 |      body, html { | ||||||
|                 |        background-color: $stringBackgroundColor !important; |                 |        background-color: ${ | ||||||
|                 |        border-color: $stringBackgroundColor  !important; |                 String.format( | ||||||
|  |                     "#%06X", | ||||||
|  |                     0xFFFFFF and colorSurface.data | ||||||
|  |                 ) | ||||||
|  |             } !important; | ||||||
|  |                 |        border-color: ${ | ||||||
|  |                 String.format( | ||||||
|  |                     "#%06X", | ||||||
|  |                     0xFFFFFF and colorSurface.data | ||||||
|  |                 ) | ||||||
|  |             }  !important; | ||||||
|                 |        padding: 0 !important; |                 |        padding: 0 !important; | ||||||
|                 |        margin: 0 !important; |                 |        margin: 0 !important; | ||||||
|                 |      } |                 |      } | ||||||
| @@ -483,7 +479,12 @@ class ArticleFragment : Fragment(), DIAware { | |||||||
|                 |      pre, code { |                 |      pre, code { | ||||||
|                 |        white-space: pre-wrap; |                 |        white-space: pre-wrap; | ||||||
|                 |        width:100%; |                 |        width:100%; | ||||||
|                 |        background-color: $stringBackgroundColor; |                 |        background-color: ${ | ||||||
|  |                 String.format( | ||||||
|  |                     "#%06X", | ||||||
|  |                     0xFFFFFF and colorSurface.data | ||||||
|  |                 ) | ||||||
|  |             }; | ||||||
|                 |      } |                 |      } | ||||||
|                 |   </style> |                 |   </style> | ||||||
|                 |   $fontLinkAndStyle |                 |   $fontLinkAndStyle | ||||||
| @@ -499,28 +500,24 @@ class ArticleFragment : Fragment(), DIAware { | |||||||
|  |  | ||||||
|     fun scrollDown() { |     fun scrollDown() { | ||||||
|         val height = binding.nestedScrollView.measuredHeight |         val height = binding.nestedScrollView.measuredHeight | ||||||
|         binding.nestedScrollView.smoothScrollBy(0, height/2) |         binding.nestedScrollView.smoothScrollBy(0, height / 2) | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     fun scrollUp() { |     fun scrollUp() { | ||||||
|         val height = binding.nestedScrollView.measuredHeight |         val height = binding.nestedScrollView.measuredHeight | ||||||
|         binding.nestedScrollView.smoothScrollBy(0, -height/2) |         binding.nestedScrollView.smoothScrollBy(0, -height / 2) | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     private fun openInBrowserAfterFailing(customTabsIntent: CustomTabsIntent) { |     private fun openInBrowserAfterFailing() { | ||||||
|         binding.progressBar.visibility = View.GONE |         binding.progressBar.visibility = View.GONE | ||||||
|         requireActivity().openItemUrlInternalBrowser( |         requireActivity().openInBrowserAsNewTask(this@ArticleFragment.item) | ||||||
|                 url, |  | ||||||
|                 customTabsIntent, |  | ||||||
|                 requireActivity() |  | ||||||
|         ) |  | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     companion object { |     companion object { | ||||||
|         private const val ARG_ITEMS = "items" |         private const val ARG_ITEMS = "items" | ||||||
|  |  | ||||||
|         fun newInstance( |         fun newInstance( | ||||||
|                 item: SelfossModel.Item |             item: SelfossModel.Item | ||||||
|         ): ArticleFragment { |         ): ArticleFragment { | ||||||
|             val fragment = ArticleFragment() |             val fragment = ArticleFragment() | ||||||
|             val args = Bundle() |             val args = Bundle() | ||||||
| @@ -532,9 +529,10 @@ class ArticleFragment : Fragment(), DIAware { | |||||||
|  |  | ||||||
|     fun performClick(): Boolean { |     fun performClick(): Boolean { | ||||||
|         if (binding.webcontent.hitTestResult.type == WebView.HitTestResult.IMAGE_TYPE || |         if (binding.webcontent.hitTestResult.type == WebView.HitTestResult.IMAGE_TYPE || | ||||||
|                 binding.webcontent.hitTestResult.type == WebView.HitTestResult.SRC_IMAGE_ANCHOR_TYPE) { |             binding.webcontent.hitTestResult.type == WebView.HitTestResult.SRC_IMAGE_ANCHOR_TYPE | ||||||
|  |         ) { | ||||||
|  |  | ||||||
|             val position : Int = allImages.indexOf(binding.webcontent.hitTestResult.extra) |             val position: Int = allImages.indexOf(binding.webcontent.hitTestResult.extra) | ||||||
|  |  | ||||||
|             val intent = Intent(activity, ImageActivity::class.java) |             val intent = Intent(activity, ImageActivity::class.java) | ||||||
|             intent.putExtra("allImages", allImages) |             intent.putExtra("allImages", allImages) | ||||||
|   | |||||||
| @@ -0,0 +1,214 @@ | |||||||
|  | package bou.amine.apps.readerforselfossv2.android.fragments | ||||||
|  |  | ||||||
|  | import android.content.Context | ||||||
|  | import android.graphics.Color | ||||||
|  | import android.graphics.drawable.Drawable | ||||||
|  | import android.graphics.drawable.GradientDrawable | ||||||
|  | import android.os.Build | ||||||
|  | import android.os.Bundle | ||||||
|  | import android.text.TextUtils | ||||||
|  | import android.view.LayoutInflater | ||||||
|  | import android.view.View | ||||||
|  | import android.view.View.GONE | ||||||
|  | import android.view.View.VISIBLE | ||||||
|  | import android.view.ViewGroup | ||||||
|  | import bou.amine.apps.readerforselfossv2.android.HomeActivity | ||||||
|  | import bou.amine.apps.readerforselfossv2.android.R | ||||||
|  | import bou.amine.apps.readerforselfossv2.android.databinding.FilterFragmentBinding | ||||||
|  | import bou.amine.apps.readerforselfossv2.android.sendSilentlyWithAcraWithName | ||||||
|  | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
|  | import bou.amine.apps.readerforselfossv2.utils.getHtmlDecoded | ||||||
|  | import bou.amine.apps.readerforselfossv2.utils.getIcon | ||||||
|  | import com.bumptech.glide.Glide | ||||||
|  | import com.bumptech.glide.load.DataSource | ||||||
|  | import com.bumptech.glide.load.engine.GlideException | ||||||
|  | import com.bumptech.glide.request.RequestListener | ||||||
|  | import com.bumptech.glide.request.target.Target | ||||||
|  | import com.google.android.material.bottomsheet.BottomSheetDialogFragment | ||||||
|  | import com.google.android.material.chip.Chip | ||||||
|  | import kotlinx.coroutines.CoroutineScope | ||||||
|  | import kotlinx.coroutines.Dispatchers | ||||||
|  | import kotlinx.coroutines.launch | ||||||
|  | import org.kodein.di.DI | ||||||
|  | import org.kodein.di.DIAware | ||||||
|  | import org.kodein.di.android.x.closestDI | ||||||
|  | import org.kodein.di.instance | ||||||
|  |  | ||||||
|  |  | ||||||
|  | class FilterSheetFragment : BottomSheetDialogFragment(), DIAware { | ||||||
|  |  | ||||||
|  |     private lateinit var binding: FilterFragmentBinding | ||||||
|  |     override val di: DI by closestDI() | ||||||
|  |     private val repository: Repository by instance() | ||||||
|  |  | ||||||
|  |     private var selectedChip: Chip? = null | ||||||
|  |  | ||||||
|  |     override fun onCreateView( | ||||||
|  |         inflater: LayoutInflater, | ||||||
|  |         container: ViewGroup?, | ||||||
|  |         savedInstanceState: Bundle? | ||||||
|  |     ): View { | ||||||
|  |         binding = | ||||||
|  |             FilterFragmentBinding.inflate( | ||||||
|  |                 inflater, | ||||||
|  |                 container, | ||||||
|  |                 false | ||||||
|  |             ) | ||||||
|  |  | ||||||
|  |         val context: Context? = context | ||||||
|  |  | ||||||
|  |  | ||||||
|  |         if (context == null) { | ||||||
|  |             dismiss() | ||||||
|  |             Exception("FilterSheetFragment context is null").sendSilentlyWithAcraWithName("FilterSheetFragment > onCreateView") | ||||||
|  |         } else { | ||||||
|  |             CoroutineScope(Dispatchers.Main).launch { | ||||||
|  |                 handleTagChips(context) | ||||||
|  |                 handleSourceChips(context) | ||||||
|  |  | ||||||
|  |                 binding.progressBar2.visibility = GONE | ||||||
|  |                 binding.filterView.visibility = VISIBLE | ||||||
|  |             } | ||||||
|  |         } | ||||||
|  |  | ||||||
|  |         binding.floatingActionButton2.setOnClickListener { | ||||||
|  |             (activity as HomeActivity).getElementsAccordingToTab() | ||||||
|  |             (activity as HomeActivity).fetchOnEmptyList() | ||||||
|  |             dismiss() | ||||||
|  |         } | ||||||
|  |         return binding.root | ||||||
|  |     } | ||||||
|  |  | ||||||
|  |     private suspend fun handleSourceChips( | ||||||
|  |         context: Context | ||||||
|  |     ) { | ||||||
|  |         val sourceGroup = binding.sourcesGroup | ||||||
|  |  | ||||||
|  |         repository.getSources().forEach { source -> | ||||||
|  |             val c = Chip(context) | ||||||
|  |             c.ellipsize = TextUtils.TruncateAt.END | ||||||
|  |  | ||||||
|  |             Glide.with(context) | ||||||
|  |                 .load(source.getIcon(repository.baseUrl)) | ||||||
|  |                 .listener(object : RequestListener<Drawable?> { | ||||||
|  |                     override fun onLoadFailed( | ||||||
|  |                         e: GlideException?, | ||||||
|  |                         model: Any?, | ||||||
|  |                         target: Target<Drawable?>?, | ||||||
|  |                         isFirstResource: Boolean | ||||||
|  |                     ): Boolean { | ||||||
|  |                         return false | ||||||
|  |                     } | ||||||
|  |  | ||||||
|  |                     override fun onResourceReady( | ||||||
|  |                         resource: Drawable?, | ||||||
|  |                         model: Any?, | ||||||
|  |                         target: Target<Drawable?>?, | ||||||
|  |                         dataSource: DataSource?, | ||||||
|  |                         isFirstResource: Boolean | ||||||
|  |                     ): Boolean { | ||||||
|  |                         try { | ||||||
|  |                             c.chipIcon = resource | ||||||
|  |                         } catch (e: Exception) { | ||||||
|  |                             e.sendSilentlyWithAcraWithName("sources > onResourceReady") | ||||||
|  |                         } | ||||||
|  |                         return false | ||||||
|  |                     } | ||||||
|  |                 }).preload() | ||||||
|  |  | ||||||
|  |             c.text = source.title.getHtmlDecoded() | ||||||
|  |  | ||||||
|  |             c.setOnCloseIconClickListener { | ||||||
|  |                 (it as Chip).isCloseIconVisible = false | ||||||
|  |                 selectedChip = null | ||||||
|  |                 repository.setSourceFilter(null) | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             c.setOnClickListener { | ||||||
|  |                 if (selectedChip != null) { | ||||||
|  |                     selectedChip!!.isCloseIconVisible = false | ||||||
|  |                 } | ||||||
|  |                 (it as Chip).isCloseIconVisible = true | ||||||
|  |                 selectedChip = it | ||||||
|  |                 repository.setSourceFilter(source) | ||||||
|  |  | ||||||
|  |                 repository.setTagFilter(null) | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |  | ||||||
|  |             if (repository.sourceFilter.value?.equals(source) == true) { | ||||||
|  |                 c.isCloseIconVisible = true | ||||||
|  |                 selectedChip = c | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             c.isEnabled = source.error.isBlank() | ||||||
|  |  | ||||||
|  |             if (source.error.isNotBlank() && Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) { | ||||||
|  |                 c.tooltipText = source.error | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             sourceGroup.addView(c) | ||||||
|  |         } | ||||||
|  |     } | ||||||
|  |  | ||||||
|  |     private suspend fun handleTagChips( | ||||||
|  |         context: Context, | ||||||
|  |     ) { | ||||||
|  |         val tagGroup = binding.tagsGroup | ||||||
|  |  | ||||||
|  |         val tags = repository.getTags() | ||||||
|  |  | ||||||
|  |         tags.forEach { tag -> | ||||||
|  |             val c = Chip(context) | ||||||
|  |             c.ellipsize = TextUtils.TruncateAt.END | ||||||
|  |             c.text = tag.tag | ||||||
|  |  | ||||||
|  |             try { | ||||||
|  |                 val gd = GradientDrawable() | ||||||
|  |                 val gdColor = try { | ||||||
|  |                     Color.parseColor(tag.color) | ||||||
|  |                 } catch (e: IllegalArgumentException) { | ||||||
|  |                     e.sendSilentlyWithAcraWithName("color issue " + tag.color) | ||||||
|  |                     resources.getColor(R.color.colorPrimary) | ||||||
|  |                 } | ||||||
|  |                 gd.setColor(gdColor) | ||||||
|  |                 gd.shape = GradientDrawable.RECTANGLE | ||||||
|  |                 gd.setSize(30, 30) | ||||||
|  |                 gd.cornerRadius = 30F | ||||||
|  |                 c.chipIcon = gd | ||||||
|  |             } catch (e: Exception) { | ||||||
|  |                 e.sendSilentlyWithAcraWithName("tags > GradientDrawable") | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             c.setOnCloseIconClickListener { | ||||||
|  |                 (it as Chip).isCloseIconVisible = false | ||||||
|  |                 selectedChip = null | ||||||
|  |                 repository.setTagFilter(null) | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             c.setOnClickListener { | ||||||
|  |                 if (selectedChip != null) { | ||||||
|  |                     selectedChip!!.isCloseIconVisible = false | ||||||
|  |                 } | ||||||
|  |                 (it as Chip).isCloseIconVisible = true | ||||||
|  |                 selectedChip = it | ||||||
|  |                 repository.setTagFilter(tag) | ||||||
|  |  | ||||||
|  |                 repository.setSourceFilter(null) | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             if (repository.tagFilter.value?.equals(tag) == true) { | ||||||
|  |                 c.isCloseIconVisible = true | ||||||
|  |                 selectedChip = c | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             tagGroup.addView(c) | ||||||
|  |         } | ||||||
|  |     } | ||||||
|  |  | ||||||
|  |     companion object { | ||||||
|  |         const val TAG = "FilterModalBottomSheet" | ||||||
|  |     } | ||||||
|  |  | ||||||
|  |  | ||||||
|  | } | ||||||
| @@ -1,7 +1,9 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.fragments | package bou.amine.apps.readerforselfossv2.android.fragments | ||||||
|  |  | ||||||
| import android.os.Bundle | import android.os.Bundle | ||||||
| import android.view.* | import android.view.LayoutInflater | ||||||
|  | import android.view.View | ||||||
|  | import android.view.ViewGroup | ||||||
| import androidx.fragment.app.Fragment | import androidx.fragment.app.Fragment | ||||||
| import bou.amine.apps.readerforselfossv2.android.databinding.FragmentImageBinding | import bou.amine.apps.readerforselfossv2.android.databinding.FragmentImageBinding | ||||||
| import com.bumptech.glide.Glide | import com.bumptech.glide.Glide | ||||||
| @@ -26,7 +28,7 @@ class ImageFragment : Fragment() { | |||||||
|         val view = binding?.root |         val view = binding?.root | ||||||
|  |  | ||||||
|         binding!!.photoView.visibility = View.VISIBLE |         binding!!.photoView.visibility = View.VISIBLE | ||||||
|         Glide.with(activity) |         Glide.with(requireActivity()) | ||||||
|                 .asBitmap() |                 .asBitmap() | ||||||
|                 .apply(glideOptions) |                 .apply(glideOptions) | ||||||
|                 .load(imageUrl) |                 .load(imageUrl) | ||||||
|   | |||||||
| @@ -2,6 +2,7 @@ package bou.amine.apps.readerforselfossv2.android.model | |||||||
|  |  | ||||||
| import android.content.Context | import android.content.Context | ||||||
| import android.webkit.URLUtil | import android.webkit.URLUtil | ||||||
|  | import bou.amine.apps.readerforselfossv2.android.sendSilentlyWithAcraWithName | ||||||
| import bou.amine.apps.readerforselfossv2.model.SelfossModel | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
| import bou.amine.apps.readerforselfossv2.utils.getImages | import bou.amine.apps.readerforselfossv2.utils.getImages | ||||||
| import com.bumptech.glide.Glide | import com.bumptech.glide.Glide | ||||||
| @@ -23,6 +24,7 @@ fun SelfossModel.Item.preloadImages(context: Context) : Boolean { | |||||||
|             } |             } | ||||||
|         } |         } | ||||||
|     } catch (e : Error) { |     } catch (e : Error) { | ||||||
|  |         e.sendSilentlyWithAcraWithName("preloadImages") | ||||||
|         return false |         return false | ||||||
|     } |     } | ||||||
|  |  | ||||||
| @@ -35,6 +37,7 @@ fun String.toTextDrawableString(): String { | |||||||
|         try { |         try { | ||||||
|             textDrawable.append(s[0]) |             textDrawable.append(s[0]) | ||||||
|         } catch (e: StringIndexOutOfBoundsException) { |         } catch (e: StringIndexOutOfBoundsException) { | ||||||
|  |             e.sendSilentlyWithAcraWithName("toTextDrawableString") | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|     return textDrawable.toString() |     return textDrawable.toString() | ||||||
|   | |||||||
| @@ -3,7 +3,6 @@ package bou.amine.apps.readerforselfossv2.android.model | |||||||
| import android.os.Parcel | import android.os.Parcel | ||||||
| import android.os.Parcelable | import android.os.Parcelable | ||||||
| import bou.amine.apps.readerforselfossv2.model.SelfossModel | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
| import com.google.gson.annotations.SerializedName |  | ||||||
|  |  | ||||||
| fun SelfossModel.Item.toParcelable() : ParecelableItem = | fun SelfossModel.Item.toParcelable() : ParecelableItem = | ||||||
|     ParecelableItem( |     ParecelableItem( | ||||||
| @@ -17,7 +16,8 @@ fun SelfossModel.Item.toParcelable() : ParecelableItem = | |||||||
|         this.icon, |         this.icon, | ||||||
|         this.link, |         this.link, | ||||||
|         this.sourcetitle, |         this.sourcetitle, | ||||||
|         this.tags.joinToString(",") |         this.tags.joinToString(","), | ||||||
|  |         this.author | ||||||
|     ) |     ) | ||||||
| fun ParecelableItem.toModel() : SelfossModel.Item = | fun ParecelableItem.toModel() : SelfossModel.Item = | ||||||
|     SelfossModel.Item( |     SelfossModel.Item( | ||||||
| @@ -31,20 +31,22 @@ fun ParecelableItem.toModel() : SelfossModel.Item = | |||||||
|         this.icon, |         this.icon, | ||||||
|         this.link, |         this.link, | ||||||
|         this.sourcetitle, |         this.sourcetitle, | ||||||
|         this.tags.split(",") |         this.tags.split(","), | ||||||
|  |         this.author | ||||||
|     ) |     ) | ||||||
| data class ParecelableItem( | data class ParecelableItem( | ||||||
|     @SerializedName("id") val id: Int, |     val id: Int, | ||||||
|     @SerializedName("datetime") val datetime: String, |     val datetime: String, | ||||||
|     @SerializedName("title") val title: String, |     val title: String, | ||||||
|     @SerializedName("content") val content: String, |     val content: String, | ||||||
|     @SerializedName("unread") var unread: Boolean, |     var unread: Boolean, | ||||||
|     @SerializedName("starred") var starred: Boolean, |     var starred: Boolean, | ||||||
|     @SerializedName("thumbnail") val thumbnail: String?, |     val thumbnail: String?, | ||||||
|     @SerializedName("icon") val icon: String?, |     val icon: String?, | ||||||
|     @SerializedName("link") val link: String, |     val link: String, | ||||||
|     @SerializedName("sourcetitle") val sourcetitle: String, |     val sourcetitle: String, | ||||||
|     @SerializedName("tags") val tags: String |     val tags: String, | ||||||
|  |     val author: String? | ||||||
| ) : Parcelable { | ) : Parcelable { | ||||||
|  |  | ||||||
|     companion object { |     companion object { | ||||||
| @@ -66,7 +68,8 @@ data class ParecelableItem( | |||||||
|         icon = source.readString(), |         icon = source.readString(), | ||||||
|         link = source.readString().orEmpty(), |         link = source.readString().orEmpty(), | ||||||
|         sourcetitle = source.readString().orEmpty(), |         sourcetitle = source.readString().orEmpty(), | ||||||
|         tags = source.readString().orEmpty() |         tags = source.readString().orEmpty(), | ||||||
|  |         author = source.readString().orEmpty() | ||||||
|     ) |     ) | ||||||
|  |  | ||||||
|     override fun describeContents() = 0 |     override fun describeContents() = 0 | ||||||
| @@ -83,5 +86,6 @@ data class ParecelableItem( | |||||||
|         dest.writeString(link) |         dest.writeString(link) | ||||||
|         dest.writeString(sourcetitle) |         dest.writeString(sourcetitle) | ||||||
|         dest.writeString(tags) |         dest.writeString(tags) | ||||||
|  |         dest.writeString(author) | ||||||
|     } |     } | ||||||
| } | } | ||||||
| @@ -3,39 +3,35 @@ package bou.amine.apps.readerforselfossv2.android.settings | |||||||
| import android.content.Intent | import android.content.Intent | ||||||
| import android.net.Uri | import android.net.Uri | ||||||
| import android.os.Bundle | import android.os.Bundle | ||||||
| import android.text.* | import android.text.Editable | ||||||
| import androidx.preference.EditTextPreference | import android.text.InputFilter | ||||||
| import androidx.preference.PreferenceManager | import android.text.InputType | ||||||
| import android.view.* | import android.text.TextWatcher | ||||||
| import android.widget.Toast | import android.widget.Toast | ||||||
| import androidx.appcompat.app.AppCompatActivity | import androidx.appcompat.app.AppCompatActivity | ||||||
|  | import androidx.appcompat.app.AppCompatDelegate | ||||||
| import androidx.core.widget.addTextChangedListener | import androidx.core.widget.addTextChangedListener | ||||||
|  | import androidx.preference.EditTextPreference | ||||||
| import androidx.preference.Preference | import androidx.preference.Preference | ||||||
| import androidx.preference.PreferenceFragmentCompat | import androidx.preference.PreferenceFragmentCompat | ||||||
| import bou.amine.apps.readerforselfossv2.android.R | import bou.amine.apps.readerforselfossv2.android.R | ||||||
| import bou.amine.apps.readerforselfossv2.android.databinding.ActivitySettingsBinding | import bou.amine.apps.readerforselfossv2.android.databinding.ActivitySettingsBinding | ||||||
| import bou.amine.apps.readerforselfossv2.android.themes.Toppings | import bou.amine.apps.readerforselfossv2.android.sendSilentlyWithAcraWithName | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.Config | import bou.amine.apps.readerforselfossv2.service.AppSettingsService | ||||||
| import com.ftinc.scoop.Scoop | import com.mikepenz.aboutlibraries.LibsBuilder | ||||||
| import com.russhwolf.settings.Settings | import org.kodein.di.DIAware | ||||||
| import java.lang.NumberFormatException | import org.kodein.di.android.closestDI | ||||||
|  |  | ||||||
| private const val TITLE_TAG = "settingsActivityTitle" | private const val TITLE_TAG = "settingsActivityTitle" | ||||||
|  |  | ||||||
| class SettingsActivity : AppCompatActivity(), | class SettingsActivity : AppCompatActivity(), | ||||||
|         PreferenceFragmentCompat.OnPreferenceStartFragmentCallback { |         PreferenceFragmentCompat.OnPreferenceStartFragmentCallback, DIAware { | ||||||
|  |     override val di by closestDI() | ||||||
|  |  | ||||||
|     override fun onCreate(savedInstanceState: Bundle?) { |     override fun onCreate(savedInstanceState: Bundle?) { | ||||||
|         super.onCreate(savedInstanceState) |         super.onCreate(savedInstanceState) | ||||||
|         if (PreferenceManager.getDefaultSharedPreferences(this).getBoolean("dark_theme", false)) { |  | ||||||
|             setTheme(R.style.NoBarDark) |  | ||||||
|         } |  | ||||||
|         val binding = ActivitySettingsBinding.inflate(layoutInflater) |         val binding = ActivitySettingsBinding.inflate(layoutInflater) | ||||||
|  |  | ||||||
|         val scoop = Scoop.getInstance() |  | ||||||
|         scoop.bind(this, Toppings.PRIMARY.value, binding.toolbar) |  | ||||||
|         scoop.bindStatusBar(this, Toppings.PRIMARY_DARK.value) |  | ||||||
|  |  | ||||||
|         setContentView(binding.root) |         setContentView(binding.root) | ||||||
|         if (savedInstanceState == null) { |         if (savedInstanceState == null) { | ||||||
|             supportFragmentManager |             supportFragmentManager | ||||||
| @@ -65,11 +61,13 @@ class SettingsActivity : AppCompatActivity(), | |||||||
|     } |     } | ||||||
|  |  | ||||||
|     override fun onSupportNavigateUp(): Boolean { |     override fun onSupportNavigateUp(): Boolean { | ||||||
|         if (supportFragmentManager.popBackStackImmediate()) { |         return if (supportFragmentManager.popBackStackImmediate()) { | ||||||
|             supportActionBar?.title = getText(R.string.title_activity_settings) |             supportActionBar?.title = getText(R.string.title_activity_settings) | ||||||
|             return true |             false | ||||||
|  |         } else { | ||||||
|  |             super.onBackPressed() | ||||||
|  |             true | ||||||
|         } |         } | ||||||
|         return super.onSupportNavigateUp() |  | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     override fun onPreferenceStartFragment( |     override fun onPreferenceStartFragment( | ||||||
| @@ -98,6 +96,21 @@ class SettingsActivity : AppCompatActivity(), | |||||||
|     class MainPreferenceFragment : PreferenceFragmentCompat() { |     class MainPreferenceFragment : PreferenceFragmentCompat() { | ||||||
|         override fun onCreatePreferences(savedInstanceState: Bundle?, rootKey: String?) { |         override fun onCreatePreferences(savedInstanceState: Bundle?, rootKey: String?) { | ||||||
|             setPreferencesFromResource(R.xml.pref_main, rootKey) |             setPreferencesFromResource(R.xml.pref_main, rootKey) | ||||||
|  |  | ||||||
|  |             preferenceManager.findPreference<Preference>("currentMode")?.onPreferenceChangeListener = Preference.OnPreferenceChangeListener { _, newValue -> | ||||||
|  |                 AppCompatDelegate.setDefaultNightMode(newValue.toString().toInt()) // ListPreference Only takes string-arrays ¯\_(ツ)_/¯ | ||||||
|  |                 true | ||||||
|  |             } | ||||||
|  |  | ||||||
|  |             preferenceManager.findPreference<Preference>("action_about")?.onPreferenceClickListener = Preference.OnPreferenceClickListener { _ -> | ||||||
|  |                 context?.let { | ||||||
|  |                     LibsBuilder() | ||||||
|  |                         .withAboutIconShown(true) | ||||||
|  |                         .withAboutVersionShown(true) | ||||||
|  |                         .start(it) | ||||||
|  |                 } | ||||||
|  |                 true | ||||||
|  |             } | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
| @@ -114,6 +127,7 @@ class SettingsActivity : AppCompatActivity(), | |||||||
|                                 val input: Int = (dest.toString() + source.toString()).toInt() |                                 val input: Int = (dest.toString() + source.toString()).toInt() | ||||||
|                                 if (input in 1..200) return@InputFilter null |                                 if (input in 1..200) return@InputFilter null | ||||||
|                             } catch (nfe: NumberFormatException) { |                             } catch (nfe: NumberFormatException) { | ||||||
|  |                                 nfe.sendSilentlyWithAcraWithName("GeneralPreferenceFragment") | ||||||
|                                 Toast.makeText(activity, R.string.items_number_should_be_number, Toast.LENGTH_LONG).show() |                                 Toast.makeText(activity, R.string.items_number_should_be_number, Toast.LENGTH_LONG).show() | ||||||
|                             } |                             } | ||||||
|                             "" |                             "" | ||||||
| @@ -131,12 +145,17 @@ class SettingsActivity : AppCompatActivity(), | |||||||
|             fontSize?.setOnBindEditTextListener { editText -> |             fontSize?.setOnBindEditTextListener { editText -> | ||||||
|                 editText.inputType = InputType.TYPE_CLASS_NUMBER |                 editText.inputType = InputType.TYPE_CLASS_NUMBER | ||||||
|                 editText.addTextChangedListener { object : TextWatcher { |                 editText.addTextChangedListener { object : TextWatcher { | ||||||
|                     override fun beforeTextChanged(charSequence: CharSequence, i: Int, i1: Int, i2: Int) {} |                     override fun beforeTextChanged(charSequence: CharSequence, i: Int, i1: Int, i2: Int) { | ||||||
|                     override fun onTextChanged(charSequence: CharSequence, i: Int, i1: Int, i2: Int) {} |                         // We do nothing | ||||||
|  |                     } | ||||||
|  |                     override fun onTextChanged(charSequence: CharSequence, i: Int, i1: Int, i2: Int) { | ||||||
|  |                         // We do nothing | ||||||
|  |                     } | ||||||
|                     override fun afterTextChanged(editable: Editable) { |                     override fun afterTextChanged(editable: Editable) { | ||||||
|                         try { |                         try { | ||||||
|                             editText.textSize = editable.toString().toInt().toFloat() |                             editText.textSize = editable.toString().toInt().toFloat() | ||||||
|                         } catch (e: NumberFormatException) { |                         } catch (e: NumberFormatException) { | ||||||
|  |                             e.sendSilentlyWithAcraWithName("ArticleViewerPreferenceFragment > afterTextChanged") | ||||||
|                         } |                         } | ||||||
|                     } |                     } | ||||||
|                 } } |                 } } | ||||||
| @@ -146,6 +165,7 @@ class SettingsActivity : AppCompatActivity(), | |||||||
|                                 val input = (dest.toString() + source.toString()).toInt() |                                 val input = (dest.toString() + source.toString()).toInt() | ||||||
|                                 if (input > 0) return@InputFilter null |                                 if (input > 0) return@InputFilter null | ||||||
|                             } catch (nfe: NumberFormatException) { |                             } catch (nfe: NumberFormatException) { | ||||||
|  |                                 nfe.sendSilentlyWithAcraWithName("ArticleViewerPreferenceFragment > filters") | ||||||
|                             } |                             } | ||||||
|                             "" |                             "" | ||||||
|                         } |                         } | ||||||
| @@ -163,26 +183,11 @@ class SettingsActivity : AppCompatActivity(), | |||||||
|     class ThemePreferenceFragment : PreferenceFragmentCompat() { |     class ThemePreferenceFragment : PreferenceFragmentCompat() { | ||||||
|         override fun onCreatePreferences(savedInstanceState: Bundle?, rootKey: String?) { |         override fun onCreatePreferences(savedInstanceState: Bundle?, rootKey: String?) { | ||||||
|             setPreferencesFromResource(R.xml.pref_theme, rootKey) |             setPreferencesFromResource(R.xml.pref_theme, rootKey) | ||||||
|             setHasOptionsMenu(true) |  | ||||||
|         } |  | ||||||
|  |  | ||||||
|         override fun onCreateOptionsMenu(menu: Menu, inflater: MenuInflater) { |             preferenceManager.findPreference<Preference>("currentMode")?.onPreferenceChangeListener = Preference.OnPreferenceChangeListener { _, newValue -> | ||||||
|             super.onCreateOptionsMenu(menu, inflater) |                 AppCompatDelegate.setDefaultNightMode(newValue.toString().toInt()) // ListPreference Only takes string-arrays ¯\_(ツ)_/¯ | ||||||
|             inflater.inflate(R.menu.settings_theme, menu) |                 true | ||||||
|         } |  | ||||||
|  |  | ||||||
|         override fun onOptionsItemSelected(item: MenuItem): Boolean { |  | ||||||
|             val id = item.itemId |  | ||||||
|             if (id == R.id.clear) { |  | ||||||
|                 val settings = Settings() |  | ||||||
|                 settings.remove("color_primary") |  | ||||||
|                 settings.remove("color_primary_dark") |  | ||||||
|                 settings.remove("color_accent") |  | ||||||
|                 settings.remove("color_accent_dark") |  | ||||||
|                 settings.remove("dark_theme") |  | ||||||
|                 requireActivity().recreate() |  | ||||||
|             } |             } | ||||||
|             return super.onOptionsItemSelected(item) |  | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
|  |  | ||||||
| @@ -196,17 +201,17 @@ class SettingsActivity : AppCompatActivity(), | |||||||
|             setPreferencesFromResource(R.xml.pref_links, rootKey) |             setPreferencesFromResource(R.xml.pref_links, rootKey) | ||||||
|  |  | ||||||
|             preferenceManager.findPreference<Preference>("trackerLink")?.onPreferenceClickListener = Preference.OnPreferenceClickListener { |             preferenceManager.findPreference<Preference>("trackerLink")?.onPreferenceClickListener = Preference.OnPreferenceClickListener { | ||||||
|                 openUrl(Uri.parse(Config.trackerUrl)) |                 openUrl(Uri.parse(AppSettingsService.trackerUrl)) | ||||||
|                 true |                 true | ||||||
|             } |             } | ||||||
|  |  | ||||||
|             preferenceManager.findPreference<Preference>("sourceLink")?.onPreferenceClickListener = Preference.OnPreferenceClickListener { |             preferenceManager.findPreference<Preference>("sourceLink")?.onPreferenceClickListener = Preference.OnPreferenceClickListener { | ||||||
|                 openUrl(Uri.parse(Config.sourceUrl)) |                 openUrl(Uri.parse(AppSettingsService.sourceUrl)) | ||||||
|                 false |                 false | ||||||
|             } |             } | ||||||
|  |  | ||||||
|             preferenceManager.findPreference<Preference>("translation")?.onPreferenceClickListener = Preference.OnPreferenceClickListener { |             preferenceManager.findPreference<Preference>("translation")?.onPreferenceClickListener = Preference.OnPreferenceClickListener { | ||||||
|                 openUrl(Uri.parse(Config.translationUrl)) |                 openUrl(Uri.parse(AppSettingsService.translationUrl)) | ||||||
|                 false |                 false | ||||||
|             } |             } | ||||||
|         } |         } | ||||||
|   | |||||||
| @@ -1,61 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.themes |  | ||||||
|  |  | ||||||
| import android.app.Activity |  | ||||||
| import androidx.annotation.ColorInt |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.R |  | ||||||
| import com.russhwolf.settings.Settings |  | ||||||
|  |  | ||||||
| class AppColors(a: Activity) { |  | ||||||
|  |  | ||||||
|     @ColorInt val colorPrimary: Int |  | ||||||
|     @ColorInt val colorPrimaryDark: Int |  | ||||||
|     @ColorInt val colorAccent: Int |  | ||||||
|     @ColorInt val colorAccentDark: Int |  | ||||||
|     @ColorInt val colorBackground: Int |  | ||||||
|     @ColorInt val textColor: Int |  | ||||||
|     val isDarkTheme: Boolean |  | ||||||
|  |  | ||||||
|     init { |  | ||||||
|         val settings = Settings() |  | ||||||
|  |  | ||||||
|         colorPrimary = |  | ||||||
|                 settings.getInt( |  | ||||||
|                     "color_primary", |  | ||||||
|                     a.resources.getColor(R.color.colorPrimary) |  | ||||||
|                 ) |  | ||||||
|         colorPrimaryDark = |  | ||||||
|                 settings.getInt( |  | ||||||
|                     "color_primary_dark", |  | ||||||
|                     a.resources.getColor(R.color.colorPrimaryDark) |  | ||||||
|                 ) |  | ||||||
|         colorAccent = |  | ||||||
|                 settings.getInt( |  | ||||||
|                     "color_accent", |  | ||||||
|                     a.resources.getColor(R.color.colorAccent) |  | ||||||
|                 ) |  | ||||||
|         colorAccentDark = |  | ||||||
|                 settings.getInt( |  | ||||||
|                     "color_accent_dark", |  | ||||||
|                     a.resources.getColor(R.color.colorAccentDark) |  | ||||||
|                 ) |  | ||||||
|         isDarkTheme = |  | ||||||
|                 settings.getBoolean( |  | ||||||
|                     "dark_theme", |  | ||||||
|                     false |  | ||||||
|                 ) |  | ||||||
|  |  | ||||||
|         colorBackground = if (isDarkTheme) { |  | ||||||
|             a.setTheme(R.style.NoBarDark) |  | ||||||
|             a.resources.getColor(R.color.darkBackground) |  | ||||||
|         } else { |  | ||||||
|             a.setTheme(R.style.NoBar) |  | ||||||
|             a.resources.getColor(R.color.grey_50) |  | ||||||
|         } |  | ||||||
|  |  | ||||||
|         textColor = if (isDarkTheme) { |  | ||||||
|             a.resources.getColor(R.color.white) |  | ||||||
|         } else { |  | ||||||
|             a.resources.getColor(R.color.grey_900) |  | ||||||
|         } |  | ||||||
|     } |  | ||||||
| } |  | ||||||
| @@ -1,8 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.themes |  | ||||||
|  |  | ||||||
| enum class Toppings(val value: Int) { |  | ||||||
|     PRIMARY(1), |  | ||||||
|     PRIMARY_DARK(2), |  | ||||||
|     ACCENT(3), |  | ||||||
|     ACCENT_DARK(4) |  | ||||||
| } |  | ||||||
| @@ -1,62 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.utils |  | ||||||
|  |  | ||||||
| import android.app.Activity |  | ||||||
| import android.content.Context |  | ||||||
| import android.content.Intent |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.LoginActivity |  | ||||||
| import com.russhwolf.settings.Settings |  | ||||||
|  |  | ||||||
| class Config { |  | ||||||
|  |  | ||||||
|     val settings = Settings() |  | ||||||
|  |  | ||||||
|     val baseUrl: String |  | ||||||
|         get() = settings.getString("url", "") |  | ||||||
|  |  | ||||||
|     val userLogin: String |  | ||||||
|         get() = settings.getString("login", "") |  | ||||||
|  |  | ||||||
|     val userPassword: String |  | ||||||
|         get() = settings.getString("password", "") |  | ||||||
|  |  | ||||||
|     val httpUserLogin: String |  | ||||||
|         get() = settings.getString("httpUserName", "") |  | ||||||
|  |  | ||||||
|     val httpUserPassword: String |  | ||||||
|         get() = settings.getString("httpPassword", "") |  | ||||||
|  |  | ||||||
|     companion object { |  | ||||||
|         const val settingsName = "paramsselfoss" |  | ||||||
|  |  | ||||||
|         const val feedbackEmail = "aminecmi@pm.me.com" |  | ||||||
|  |  | ||||||
|         const val translationUrl = "https://crwd.in/readerforselfoss" |  | ||||||
|  |  | ||||||
|         const val sourceUrl = "https://gitea.amine-louveau.fr/Louvorg/ReaderForSelfoss-multiplatform" |  | ||||||
|  |  | ||||||
|         const val trackerUrl = "https://gitea.amine-louveau.fr/Louvorg/ReaderForSelfoss-multiplatform/issues" |  | ||||||
|  |  | ||||||
|         const val syncChannelId = "sync-channel-id" |  | ||||||
|  |  | ||||||
|         const val newItemsChannelId = "new-items-channel-id" |  | ||||||
|  |  | ||||||
|         var apiVersion = 0 |  | ||||||
|  |  | ||||||
|         /* Execute logout and clear all settings to default */ |  | ||||||
|         fun logoutAndRedirect( |  | ||||||
|             c: Context, |  | ||||||
|             callingActivity: Activity, |  | ||||||
|             baseUrlFail: Boolean = false |  | ||||||
|         ): Boolean { |  | ||||||
|             val settings = Settings() |  | ||||||
|             settings.clear() |  | ||||||
|             val intent = Intent(c, LoginActivity::class.java) |  | ||||||
|             if (baseUrlFail) { |  | ||||||
|                 intent.putExtra("baseUrlFail", baseUrlFail) |  | ||||||
|             } |  | ||||||
|             c.startActivity(intent) |  | ||||||
|             callingActivity.finish() |  | ||||||
|             return true |  | ||||||
|         } |  | ||||||
|     } |  | ||||||
| } |  | ||||||
| @@ -1,43 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.utils |  | ||||||
|  |  | ||||||
| import okhttp3.OkHttpClient |  | ||||||
| import java.security.cert.CertificateException |  | ||||||
| import java.security.cert.X509Certificate |  | ||||||
| import javax.net.ssl.SSLContext |  | ||||||
| import javax.net.ssl.TrustManager |  | ||||||
| import javax.net.ssl.X509TrustManager |  | ||||||
|  |  | ||||||
| fun getUnsafeHttpClient(): OkHttpClient.Builder = |  | ||||||
|     try { |  | ||||||
|         // Create a trust manager that does not validate certificate chains |  | ||||||
|         val trustAllCerts = arrayOf<TrustManager>(object : X509TrustManager { |  | ||||||
|             override fun getAcceptedIssuers(): Array<X509Certificate> = |  | ||||||
|                 arrayOf() |  | ||||||
|  |  | ||||||
|             @Throws(CertificateException::class) |  | ||||||
|             override fun checkClientTrusted( |  | ||||||
|                 chain: Array<java.security.cert.X509Certificate>, |  | ||||||
|                 authType: String |  | ||||||
|             ) { |  | ||||||
|             } |  | ||||||
|  |  | ||||||
|             @Throws(CertificateException::class) |  | ||||||
|             override fun checkServerTrusted( |  | ||||||
|                 chain: Array<java.security.cert.X509Certificate>, |  | ||||||
|                 authType: String |  | ||||||
|             ) { |  | ||||||
|             } |  | ||||||
|         }) |  | ||||||
|  |  | ||||||
|         // Install the all-trusting trust manager |  | ||||||
|         val sslContext = SSLContext.getInstance("SSL") |  | ||||||
|         sslContext.init(null, trustAllCerts, java.security.SecureRandom()) |  | ||||||
|  |  | ||||||
|         val sslSocketFactory = sslContext.socketFactory |  | ||||||
|  |  | ||||||
|         OkHttpClient.Builder() |  | ||||||
|             .sslSocketFactory(sslSocketFactory, trustAllCerts[0] as X509TrustManager) |  | ||||||
|             .hostnameVerifier { _, _ -> true } |  | ||||||
|     } catch (e: Exception) { |  | ||||||
|         throw RuntimeException(e) |  | ||||||
|     } |  | ||||||
| @@ -1,13 +1,9 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.utils | package bou.amine.apps.readerforselfossv2.android.utils | ||||||
|  |  | ||||||
| import android.app.Activity | import android.app.Activity | ||||||
| import android.app.PendingIntent |  | ||||||
| import android.content.ActivityNotFoundException |  | ||||||
| import android.content.Context | import android.content.Context | ||||||
| import android.content.Intent | import android.content.Intent | ||||||
| import android.graphics.BitmapFactory |  | ||||||
| import android.net.Uri | import android.net.Uri | ||||||
| import android.os.Build |  | ||||||
| import android.text.Spannable | import android.text.Spannable | ||||||
| import android.text.style.ClickableSpan | import android.text.style.ClickableSpan | ||||||
| import android.util.Patterns | import android.util.Patterns | ||||||
| @@ -15,109 +11,15 @@ import android.view.MotionEvent | |||||||
| import android.view.View | import android.view.View | ||||||
| import android.widget.TextView | import android.widget.TextView | ||||||
| import android.widget.Toast | import android.widget.Toast | ||||||
| import androidx.browser.customtabs.CustomTabsIntent |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.R | import bou.amine.apps.readerforselfossv2.android.R | ||||||
| import bou.amine.apps.readerforselfossv2.android.ReaderActivity | import bou.amine.apps.readerforselfossv2.android.ReaderActivity | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.customtabs.CustomTabActivityHelper |  | ||||||
| import bou.amine.apps.readerforselfossv2.model.SelfossModel | import bou.amine.apps.readerforselfossv2.model.SelfossModel | ||||||
| import bou.amine.apps.readerforselfossv2.utils.toStringUriWithHttp | import bou.amine.apps.readerforselfossv2.utils.toStringUriWithHttp | ||||||
| import okhttp3.HttpUrl.Companion.toHttpUrlOrNull | import okhttp3.HttpUrl.Companion.toHttpUrlOrNull | ||||||
|  |  | ||||||
| fun Context.buildCustomTabsIntent(): CustomTabsIntent { |  | ||||||
|  |  | ||||||
|     val actionIntent = Intent(Intent.ACTION_SEND) |  | ||||||
|     actionIntent.type = "text/plain" |  | ||||||
|     val pflags = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) { |  | ||||||
|         PendingIntent.FLAG_IMMUTABLE |  | ||||||
|     } else { |  | ||||||
|         0 |  | ||||||
|     } |  | ||||||
|     val createPendingShareIntent: PendingIntent = PendingIntent.getActivity( |  | ||||||
|             this, |  | ||||||
|             0, |  | ||||||
|             actionIntent, |  | ||||||
|             pflags |  | ||||||
|         ) |  | ||||||
|  |  | ||||||
|     val intentBuilder = CustomTabsIntent.Builder() |  | ||||||
|  |  | ||||||
|     // TODO: change to primary when it's possible to customize custom tabs title color |  | ||||||
|     //intentBuilder.setToolbarColor(c.getResources().getColor(R.color.colorPrimary)); |  | ||||||
|     intentBuilder.setToolbarColor(resources.getColor(R.color.colorAccentDark)) |  | ||||||
|     intentBuilder.setShowTitle(true) |  | ||||||
|  |  | ||||||
|  |  | ||||||
|     intentBuilder.setStartAnimations( |  | ||||||
|         this, |  | ||||||
|         R.anim.slide_in_right, |  | ||||||
|         R.anim.slide_out_left |  | ||||||
|     ) |  | ||||||
|     intentBuilder.setExitAnimations( |  | ||||||
|         this, |  | ||||||
|         android.R.anim.slide_in_left, |  | ||||||
|         android.R.anim.slide_out_right |  | ||||||
|     ) |  | ||||||
|  |  | ||||||
|     val closeicon = BitmapFactory.decodeResource(resources, R.drawable.ic_close_white_24dp) |  | ||||||
|     intentBuilder.setCloseButtonIcon(closeicon) |  | ||||||
|  |  | ||||||
|     val shareLabel = this.getString(R.string.label_share) |  | ||||||
|     val icon = BitmapFactory.decodeResource( |  | ||||||
|         resources, |  | ||||||
|         R.drawable.ic_share_white_24dp |  | ||||||
|     ) |  | ||||||
|     intentBuilder.setActionButton(icon, shareLabel, createPendingShareIntent) |  | ||||||
|  |  | ||||||
|     return intentBuilder.build() |  | ||||||
| } |  | ||||||
|  |  | ||||||
| fun Context.openItemUrlInternally( |  | ||||||
|     allItems: ArrayList<SelfossModel.Item>, |  | ||||||
|     currentItem: Int, |  | ||||||
|     linkDecoded: String, |  | ||||||
|     customTabsIntent: CustomTabsIntent, |  | ||||||
|     articleViewer: Boolean, |  | ||||||
|     app: Activity |  | ||||||
| ) { |  | ||||||
|     if (articleViewer) { |  | ||||||
|         ReaderActivity.allItems = allItems |  | ||||||
|         val intent = Intent(this, ReaderActivity::class.java) |  | ||||||
|         intent.putExtra("currentItem", currentItem) |  | ||||||
|         app.startActivity(intent) |  | ||||||
|     } else { |  | ||||||
|         this.openItemUrlInternalBrowser( |  | ||||||
|                 linkDecoded, |  | ||||||
|                 customTabsIntent, |  | ||||||
|                 app) |  | ||||||
|     } |  | ||||||
| } |  | ||||||
|  |  | ||||||
| fun Context.openItemUrlInternalBrowser( |  | ||||||
|         linkDecoded: String, |  | ||||||
|         customTabsIntent: CustomTabsIntent, |  | ||||||
|         app: Activity |  | ||||||
| ) { |  | ||||||
|     try { |  | ||||||
|         CustomTabActivityHelper.openCustomTab( |  | ||||||
|                 app, |  | ||||||
|                 customTabsIntent, |  | ||||||
|                 Uri.parse(linkDecoded) |  | ||||||
|         ) { _, uri -> |  | ||||||
|             val intent = Intent(Intent.ACTION_VIEW, uri) |  | ||||||
|             intent.flags = Intent.FLAG_ACTIVITY_NEW_TASK |  | ||||||
|             startActivity(intent) |  | ||||||
|         } |  | ||||||
|     } catch (e: Exception) { |  | ||||||
|         openInBrowser(linkDecoded, app) |  | ||||||
|     } |  | ||||||
| } |  | ||||||
|  |  | ||||||
| fun Context.openItemUrl( | fun Context.openItemUrl( | ||||||
|     allItems: ArrayList<SelfossModel.Item>, |  | ||||||
|     currentItem: Int, |     currentItem: Int, | ||||||
|     linkDecoded: String, |     linkDecoded: String, | ||||||
|     customTabsIntent: CustomTabsIntent, |  | ||||||
|     internalBrowser: Boolean, |  | ||||||
|     articleViewer: Boolean, |     articleViewer: Boolean, | ||||||
|     app: Activity |     app: Activity | ||||||
| ) { | ) { | ||||||
| @@ -129,41 +31,23 @@ fun Context.openItemUrl( | |||||||
|             Toast.LENGTH_LONG |             Toast.LENGTH_LONG | ||||||
|         ).show() |         ).show() | ||||||
|     } else { |     } else { | ||||||
|         if (!internalBrowser) { |         if (articleViewer) { | ||||||
|             openInBrowser(linkDecoded, app) |             val intent = Intent(this, ReaderActivity::class.java) | ||||||
|         } else if (articleViewer) { |             intent.putExtra("currentItem", currentItem) | ||||||
|             this.openItemUrlInternally( |             app.startActivity(intent) | ||||||
|                 allItems, |  | ||||||
|                 currentItem, |  | ||||||
|                 linkDecoded, |  | ||||||
|                 customTabsIntent, |  | ||||||
|                 articleViewer, |  | ||||||
|                 app |  | ||||||
|             ) |  | ||||||
|         } else { |         } else { | ||||||
|             this.openItemUrlInternalBrowser( |             val intent = Intent(Intent.ACTION_VIEW) | ||||||
|                     linkDecoded, |             intent.flags = Intent.FLAG_ACTIVITY_NEW_TASK | ||||||
|                     customTabsIntent, |             intent.data = Uri.parse(linkDecoded.toStringUriWithHttp()) | ||||||
|                     app |             startActivity(intent) | ||||||
|             ) |  | ||||||
|         } |         } | ||||||
|     } |     } | ||||||
| } | } | ||||||
|  |  | ||||||
| private fun openInBrowser(linkDecoded: String, app: Activity) { |  | ||||||
|     val intent = Intent(Intent.ACTION_VIEW) |  | ||||||
|     intent.data = Uri.parse(linkDecoded) |  | ||||||
|     try { |  | ||||||
|         app.startActivity(intent) |  | ||||||
|     } catch (e: ActivityNotFoundException) { |  | ||||||
|         Toast.makeText(app.baseContext, e.message, Toast.LENGTH_LONG).show() |  | ||||||
|     } |  | ||||||
| } |  | ||||||
|  |  | ||||||
| fun String.isUrlValid(): Boolean = | fun String.isUrlValid(): Boolean = | ||||||
|     this.toHttpUrlOrNull() != null && Patterns.WEB_URL.matcher(this).matches() |     this.toHttpUrlOrNull() != null && Patterns.WEB_URL.matcher(this).matches() | ||||||
|  |  | ||||||
| fun String.isBaseUrlValid(ctx: Context): Boolean { | fun String.isBaseUrlInvalid(): Boolean { | ||||||
|     val baseUrl = this.toHttpUrlOrNull() |     val baseUrl = this.toHttpUrlOrNull() | ||||||
|     var existsAndEndsWithSlash = false |     var existsAndEndsWithSlash = false | ||||||
|     if (baseUrl != null) { |     if (baseUrl != null) { | ||||||
| @@ -171,7 +55,7 @@ fun String.isBaseUrlValid(ctx: Context): Boolean { | |||||||
|         existsAndEndsWithSlash = "" == pathSegments[pathSegments.size - 1] |         existsAndEndsWithSlash = "" == pathSegments[pathSegments.size - 1] | ||||||
|     } |     } | ||||||
|  |  | ||||||
|     return Patterns.WEB_URL.matcher(this).matches() && existsAndEndsWithSlash |     return !(Patterns.WEB_URL.matcher(this).matches() && existsAndEndsWithSlash) | ||||||
| } | } | ||||||
|  |  | ||||||
| fun Context.openInBrowserAsNewTask(i: SelfossModel.Item) { | fun Context.openInBrowserAsNewTask(i: SelfossModel.Item) { | ||||||
| @@ -181,7 +65,7 @@ fun Context.openInBrowserAsNewTask(i: SelfossModel.Item) { | |||||||
|     startActivity(intent) |     startActivity(intent) | ||||||
| } | } | ||||||
|  |  | ||||||
| class LinkOnTouchListener: View.OnTouchListener { | class LinkOnTouchListener : View.OnTouchListener { | ||||||
|     override fun onTouch(v: View?, event: MotionEvent?): Boolean { |     override fun onTouch(v: View?, event: MotionEvent?): Boolean { | ||||||
|         var ret = false |         var ret = false | ||||||
|         val widget: TextView = v as TextView |         val widget: TextView = v as TextView | ||||||
| @@ -191,7 +75,8 @@ class LinkOnTouchListener: View.OnTouchListener { | |||||||
|         val action = event!!.action |         val action = event!!.action | ||||||
|  |  | ||||||
|         if (action == MotionEvent.ACTION_UP || |         if (action == MotionEvent.ACTION_UP || | ||||||
|             action == MotionEvent.ACTION_DOWN) { |             action == MotionEvent.ACTION_DOWN | ||||||
|  |         ) { | ||||||
|             var x: Float = event.x |             var x: Float = event.x | ||||||
|             var y: Float = event.y |             var y: Float = event.y | ||||||
|  |  | ||||||
|   | |||||||
| @@ -1,153 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.utils.customtabs; |  | ||||||
|  |  | ||||||
|  |  | ||||||
| import android.app.Activity; |  | ||||||
| import android.net.Uri; |  | ||||||
| import android.os.Bundle; |  | ||||||
| import androidx.browser.customtabs.CustomTabsClient; |  | ||||||
| import androidx.browser.customtabs.CustomTabsIntent; |  | ||||||
| import androidx.browser.customtabs.CustomTabsServiceConnection; |  | ||||||
| import androidx.browser.customtabs.CustomTabsSession; |  | ||||||
|  |  | ||||||
| import java.util.List; |  | ||||||
|  |  | ||||||
| /** |  | ||||||
|  * This is a helper class to manage the connection to the Custom Tabs Service. |  | ||||||
|  */ |  | ||||||
| public class CustomTabActivityHelper implements ServiceConnectionCallback { |  | ||||||
|     private CustomTabsSession mCustomTabsSession; |  | ||||||
|     private CustomTabsClient mClient; |  | ||||||
|     private CustomTabsServiceConnection mConnection; |  | ||||||
|     private ConnectionCallback mConnectionCallback; |  | ||||||
|  |  | ||||||
|     /** |  | ||||||
|      * Opens the URL on a Custom Tab if possible. Otherwise fallsback to opening it on a WebView. |  | ||||||
|      * |  | ||||||
|      * @param activity         The host activity. |  | ||||||
|      * @param customTabsIntent a CustomTabsIntent to be used if Custom Tabs is available. |  | ||||||
|      * @param uri              the Uri to be opened. |  | ||||||
|      * @param fallback         a CustomTabFallback to be used if Custom Tabs is not available. |  | ||||||
|      */ |  | ||||||
|     public static void openCustomTab(Activity activity, |  | ||||||
|                                      CustomTabsIntent customTabsIntent, |  | ||||||
|                                      Uri uri, |  | ||||||
|                                      CustomTabFallback fallback) { |  | ||||||
|         String packageName = CustomTabsHelper.getPackageNameToUse(activity); |  | ||||||
|  |  | ||||||
|         //If we cant find a package name, it means theres no browser that supports |  | ||||||
|         //Chrome Custom Tabs installed. So, we fallback to the webview |  | ||||||
|         if (packageName == null) { |  | ||||||
|             if (fallback != null) { |  | ||||||
|                 fallback.openUri(activity, uri); |  | ||||||
|             } |  | ||||||
|         } else { |  | ||||||
|             customTabsIntent.intent.setPackage(packageName); |  | ||||||
|             customTabsIntent.launchUrl(activity, uri); |  | ||||||
|         } |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     /** |  | ||||||
|      * Unbinds the Activity from the Custom Tabs Service. |  | ||||||
|      * |  | ||||||
|      * @param activity the activity that is connected to the service. |  | ||||||
|      */ |  | ||||||
|     public void unbindCustomTabsService(Activity activity) { |  | ||||||
|         if (mConnection == null) return; |  | ||||||
|         activity.unbindService(mConnection); |  | ||||||
|         mClient = null; |  | ||||||
|         mCustomTabsSession = null; |  | ||||||
|         mConnection = null; |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     /** |  | ||||||
|      * Creates or retrieves an exiting CustomTabsSession. |  | ||||||
|      * |  | ||||||
|      * @return a CustomTabsSession. |  | ||||||
|      */ |  | ||||||
|     public CustomTabsSession getSession() { |  | ||||||
|         if (mClient == null) { |  | ||||||
|             mCustomTabsSession = null; |  | ||||||
|         } else if (mCustomTabsSession == null) { |  | ||||||
|             mCustomTabsSession = mClient.newSession(null); |  | ||||||
|         } |  | ||||||
|         return mCustomTabsSession; |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     /** |  | ||||||
|      * Register a Callback to be called when connected or disconnected from the Custom Tabs Service. |  | ||||||
|      * |  | ||||||
|      * @param connectionCallback |  | ||||||
|      */ |  | ||||||
|     public void setConnectionCallback(ConnectionCallback connectionCallback) { |  | ||||||
|         this.mConnectionCallback = connectionCallback; |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     /** |  | ||||||
|      * Binds the Activity to the Custom Tabs Service. |  | ||||||
|      * |  | ||||||
|      * @param activity the activity to be binded to the service. |  | ||||||
|      */ |  | ||||||
|     public void bindCustomTabsService(Activity activity) { |  | ||||||
|         if (mClient != null) return; |  | ||||||
|  |  | ||||||
|         String packageName = CustomTabsHelper.getPackageNameToUse(activity); |  | ||||||
|         if (packageName == null) return; |  | ||||||
|  |  | ||||||
|         mConnection = new ServiceConnection(this); |  | ||||||
|         CustomTabsClient.bindCustomTabsService(activity, packageName, mConnection); |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     /** |  | ||||||
|      * @return true if call to mayLaunchUrl was accepted. |  | ||||||
|      * @see {@link CustomTabsSession#mayLaunchUrl(Uri, Bundle, List)}. |  | ||||||
|      */ |  | ||||||
|     public boolean mayLaunchUrl(Uri uri, Bundle extras, List<Bundle> otherLikelyBundles) { |  | ||||||
|         if (mClient == null) return false; |  | ||||||
|  |  | ||||||
|         CustomTabsSession session = getSession(); |  | ||||||
|         return session != null && session.mayLaunchUrl(uri, extras, otherLikelyBundles); |  | ||||||
|  |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @Override |  | ||||||
|     public void onServiceConnected(CustomTabsClient client) { |  | ||||||
|         mClient = client; |  | ||||||
|         mClient.warmup(0L); |  | ||||||
|         if (mConnectionCallback != null) mConnectionCallback.onCustomTabsConnected(); |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @Override |  | ||||||
|     public void onServiceDisconnected() { |  | ||||||
|         mClient = null; |  | ||||||
|         mCustomTabsSession = null; |  | ||||||
|         if (mConnectionCallback != null) mConnectionCallback.onCustomTabsDisconnected(); |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     /** |  | ||||||
|      * A Callback for when the service is connected or disconnected. Use those callbacks to |  | ||||||
|      * handle UI changes when the service is connected or disconnected. |  | ||||||
|      */ |  | ||||||
|     public interface ConnectionCallback { |  | ||||||
|         /** |  | ||||||
|          * Called when the service is connected. |  | ||||||
|          */ |  | ||||||
|         void onCustomTabsConnected(); |  | ||||||
|  |  | ||||||
|         /** |  | ||||||
|          * Called when the service is disconnected. |  | ||||||
|          */ |  | ||||||
|         void onCustomTabsDisconnected(); |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     /** |  | ||||||
|      * To be used as a fallback to open the Uri when Custom Tabs is not available. |  | ||||||
|      */ |  | ||||||
|     public interface CustomTabFallback { |  | ||||||
|         /** |  | ||||||
|          * @param activity The Activity that wants to open the Uri. |  | ||||||
|          * @param uri      The uri to be opened by the fallback. |  | ||||||
|          */ |  | ||||||
|         void openUri(Activity activity, Uri uri); |  | ||||||
|     } |  | ||||||
|  |  | ||||||
| } |  | ||||||
| @@ -1,130 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.utils.customtabs; |  | ||||||
|  |  | ||||||
|  |  | ||||||
| import android.content.Context; |  | ||||||
| import android.content.Intent; |  | ||||||
| import android.content.IntentFilter; |  | ||||||
| import android.content.pm.PackageManager; |  | ||||||
| import android.content.pm.ResolveInfo; |  | ||||||
| import android.net.Uri; |  | ||||||
| import androidx.browser.customtabs.CustomTabsService; |  | ||||||
| import android.text.TextUtils; |  | ||||||
| import android.util.Log; |  | ||||||
|  |  | ||||||
| import java.util.ArrayList; |  | ||||||
| import java.util.List; |  | ||||||
|  |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.customtabs.helpers.KeepAliveService; |  | ||||||
|  |  | ||||||
| @SuppressWarnings("ALL") |  | ||||||
| class CustomTabsHelper { |  | ||||||
|     private static final String TAG = "CustomTabsHelper"; |  | ||||||
|     private static final String STABLE_PACKAGE = "com.android.chrome"; |  | ||||||
|     private static final String BETA_PACKAGE = "com.chrome.beta"; |  | ||||||
|     private static final String DEV_PACKAGE = "com.chrome.dev"; |  | ||||||
|     private static final String LOCAL_PACKAGE = "com.google.android.apps.chrome"; |  | ||||||
|     private static final String EXTRA_CUSTOM_TABS_KEEP_ALIVE = |  | ||||||
|             "android.support.customtabs.extra.KEEP_ALIVE"; |  | ||||||
|  |  | ||||||
|     private static String sPackageNameToUse; |  | ||||||
|  |  | ||||||
|     private CustomTabsHelper() { |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     public static void addKeepAliveExtra(Context context, Intent intent) { |  | ||||||
|         Intent keepAliveIntent = new Intent().setClassName( |  | ||||||
|                 context.getPackageName(), KeepAliveService.class.getCanonicalName()); |  | ||||||
|         intent.putExtra(EXTRA_CUSTOM_TABS_KEEP_ALIVE, keepAliveIntent); |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     /** |  | ||||||
|      * Goes through all apps that handle VIEW intents and have a warmup service. Picks |  | ||||||
|      * the one chosen by the user if there is one, otherwise makes a best effort to return a |  | ||||||
|      * valid package name. |  | ||||||
|      * <p> |  | ||||||
|      * This is <strong>not</strong> threadsafe. |  | ||||||
|      * |  | ||||||
|      * @param context {@link Context} to use for accessing {@link PackageManager}. |  | ||||||
|      * @return The package name recommended to use for connecting to custom tabs related components. |  | ||||||
|      */ |  | ||||||
|     public static String getPackageNameToUse(Context context) { |  | ||||||
|         if (sPackageNameToUse != null) return sPackageNameToUse; |  | ||||||
|  |  | ||||||
|         PackageManager pm = context.getPackageManager(); |  | ||||||
|         // Get default VIEW intent handler. |  | ||||||
|         Intent activityIntent = new Intent(Intent.ACTION_VIEW, Uri.parse("http://www.example.com")); |  | ||||||
|         ResolveInfo defaultViewHandlerInfo = pm.resolveActivity(activityIntent, 0); |  | ||||||
|         String defaultViewHandlerPackageName = null; |  | ||||||
|         if (defaultViewHandlerInfo != null) { |  | ||||||
|             defaultViewHandlerPackageName = defaultViewHandlerInfo.activityInfo.packageName; |  | ||||||
|         } |  | ||||||
|  |  | ||||||
|         // Get all apps that can handle VIEW intents. |  | ||||||
|         List<ResolveInfo> resolvedActivityList = pm.queryIntentActivities(activityIntent, 0); |  | ||||||
|         List<String> packagesSupportingCustomTabs = new ArrayList<>(); |  | ||||||
|         for (ResolveInfo info : resolvedActivityList) { |  | ||||||
|             Intent serviceIntent = new Intent(); |  | ||||||
|             serviceIntent.setAction(CustomTabsService.ACTION_CUSTOM_TABS_CONNECTION); |  | ||||||
|             serviceIntent.setPackage(info.activityInfo.packageName); |  | ||||||
|             if (pm.resolveService(serviceIntent, 0) != null) { |  | ||||||
|                 packagesSupportingCustomTabs.add(info.activityInfo.packageName); |  | ||||||
|             } |  | ||||||
|         } |  | ||||||
|  |  | ||||||
|         // Now packagesSupportingCustomTabs contains all apps that can handle both VIEW intents |  | ||||||
|         // and service calls. |  | ||||||
|         if (packagesSupportingCustomTabs.isEmpty()) { |  | ||||||
|             sPackageNameToUse = null; |  | ||||||
|         } else if (packagesSupportingCustomTabs.size() == 1) { |  | ||||||
|             sPackageNameToUse = packagesSupportingCustomTabs.get(0); |  | ||||||
|         } else if (!TextUtils.isEmpty(defaultViewHandlerPackageName) |  | ||||||
|                 && !hasSpecializedHandlerIntents(context, activityIntent) |  | ||||||
|                 && packagesSupportingCustomTabs.contains(defaultViewHandlerPackageName)) { |  | ||||||
|             sPackageNameToUse = defaultViewHandlerPackageName; |  | ||||||
|         } else if (packagesSupportingCustomTabs.contains(STABLE_PACKAGE)) { |  | ||||||
|             sPackageNameToUse = STABLE_PACKAGE; |  | ||||||
|         } else if (packagesSupportingCustomTabs.contains(BETA_PACKAGE)) { |  | ||||||
|             sPackageNameToUse = BETA_PACKAGE; |  | ||||||
|         } else if (packagesSupportingCustomTabs.contains(DEV_PACKAGE)) { |  | ||||||
|             sPackageNameToUse = DEV_PACKAGE; |  | ||||||
|         } else if (packagesSupportingCustomTabs.contains(LOCAL_PACKAGE)) { |  | ||||||
|             sPackageNameToUse = LOCAL_PACKAGE; |  | ||||||
|         } |  | ||||||
|         return sPackageNameToUse; |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     /** |  | ||||||
|      * Used to check whether there is a specialized handler for a given intent. |  | ||||||
|      * |  | ||||||
|      * @param intent The intent to check with. |  | ||||||
|      * @return Whether there is a specialized handler for the given intent. |  | ||||||
|      */ |  | ||||||
|     private static boolean hasSpecializedHandlerIntents(Context context, Intent intent) { |  | ||||||
|         try { |  | ||||||
|             PackageManager pm = context.getPackageManager(); |  | ||||||
|             List<ResolveInfo> handlers = pm.queryIntentActivities( |  | ||||||
|                     intent, |  | ||||||
|                     PackageManager.GET_RESOLVED_FILTER); |  | ||||||
|             if (handlers == null || handlers.isEmpty()) { |  | ||||||
|                 return false; |  | ||||||
|             } |  | ||||||
|             for (ResolveInfo resolveInfo : handlers) { |  | ||||||
|                 IntentFilter filter = resolveInfo.filter; |  | ||||||
|                 if (filter == null) continue; |  | ||||||
|                 if (filter.countDataAuthorities() == 0 || filter.countDataPaths() == 0) continue; |  | ||||||
|                 if (resolveInfo.activityInfo == null) continue; |  | ||||||
|                 return true; |  | ||||||
|             } |  | ||||||
|         } catch (RuntimeException e) { |  | ||||||
|             Log.e(TAG, "Runtime exception while getting specialized handlers"); |  | ||||||
|         } |  | ||||||
|         return false; |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     /** |  | ||||||
|      * @return All possible chrome package names that provide custom tabs feature. |  | ||||||
|      */ |  | ||||||
|     public static String[] getPackages() { |  | ||||||
|         return new String[]{"", STABLE_PACKAGE, BETA_PACKAGE, DEV_PACKAGE, LOCAL_PACKAGE}; |  | ||||||
|     } |  | ||||||
| } |  | ||||||
| @@ -1,33 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.utils.customtabs; |  | ||||||
|  |  | ||||||
|  |  | ||||||
| import android.content.ComponentName; |  | ||||||
| import androidx.browser.customtabs.CustomTabsClient; |  | ||||||
| import androidx.browser.customtabs.CustomTabsServiceConnection; |  | ||||||
|  |  | ||||||
| import java.lang.ref.WeakReference; |  | ||||||
|  |  | ||||||
| /** |  | ||||||
|  * Implementation for the CustomTabsServiceConnection that avoids leaking the |  | ||||||
|  * ServiceConnectionCallback |  | ||||||
|  */ |  | ||||||
| public class ServiceConnection extends CustomTabsServiceConnection { |  | ||||||
|     // A weak reference to the ServiceConnectionCallback to avoid leaking it. |  | ||||||
|     private WeakReference<ServiceConnectionCallback> mConnectionCallback; |  | ||||||
|  |  | ||||||
|     public ServiceConnection(ServiceConnectionCallback connectionCallback) { |  | ||||||
|         mConnectionCallback = new WeakReference<>(connectionCallback); |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @Override |  | ||||||
|     public void onCustomTabsServiceConnected(ComponentName name, CustomTabsClient client) { |  | ||||||
|         ServiceConnectionCallback connectionCallback = mConnectionCallback.get(); |  | ||||||
|         if (connectionCallback != null) connectionCallback.onServiceConnected(client); |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     @Override |  | ||||||
|     public void onServiceDisconnected(ComponentName name) { |  | ||||||
|         ServiceConnectionCallback connectionCallback = mConnectionCallback.get(); |  | ||||||
|         if (connectionCallback != null) connectionCallback.onServiceDisconnected(); |  | ||||||
|     } |  | ||||||
| } |  | ||||||
| @@ -1,19 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.utils.customtabs; |  | ||||||
|  |  | ||||||
|  |  | ||||||
| import androidx.browser.customtabs.CustomTabsClient; |  | ||||||
|  |  | ||||||
|  |  | ||||||
| public interface ServiceConnectionCallback { |  | ||||||
|     /** |  | ||||||
|      * Called when the service is connected. |  | ||||||
|      * |  | ||||||
|      * @param client a CustomTabsClient |  | ||||||
|      */ |  | ||||||
|     void onServiceConnected(CustomTabsClient client); |  | ||||||
|  |  | ||||||
|     /** |  | ||||||
|      * Called when the service is disconnected. |  | ||||||
|      */ |  | ||||||
|     void onServiceDisconnected(); |  | ||||||
| } |  | ||||||
| @@ -1,15 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.utils.customtabs.helpers; |  | ||||||
|  |  | ||||||
| import android.app.Service; |  | ||||||
| import android.content.Intent; |  | ||||||
| import android.os.Binder; |  | ||||||
| import android.os.IBinder; |  | ||||||
|  |  | ||||||
| public class KeepAliveService extends Service { |  | ||||||
|     private static final Binder sBinder = new Binder(); |  | ||||||
|  |  | ||||||
|     @Override |  | ||||||
|     public IBinder onBind(Intent intent) { |  | ||||||
|         return sBinder; |  | ||||||
|     } |  | ||||||
| } |  | ||||||
| @@ -1,15 +0,0 @@ | |||||||
| /* From https://github.com/mikepenz/MaterialDrawer/blob/develop/app/src/main/java/com/mikepenz/materialdrawer/app/drawerItems/CustomBaseViewHolder.java */ |  | ||||||
| package bou.amine.apps.readerforselfossv2.android.utils.drawer |  | ||||||
|  |  | ||||||
| import androidx.recyclerview.widget.RecyclerView |  | ||||||
| import android.view.View |  | ||||||
| import android.widget.ImageView |  | ||||||
| import android.widget.TextView |  | ||||||
|  |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.R |  | ||||||
|  |  | ||||||
| open class CustomBaseViewHolder(var view: View) : RecyclerView.ViewHolder(view) { |  | ||||||
|     var icon: ImageView = view.findViewById(R.id.material_drawer_icon) |  | ||||||
|     var name: TextView = view.findViewById(R.id.material_drawer_name) |  | ||||||
|     var description: TextView = view.findViewById(R.id.material_drawer_description) |  | ||||||
| } |  | ||||||
| @@ -2,33 +2,26 @@ package bou.amine.apps.readerforselfossv2.android.utils.glide | |||||||
|  |  | ||||||
| import android.content.Context | import android.content.Context | ||||||
| import android.graphics.Bitmap | import android.graphics.Bitmap | ||||||
| import android.graphics.drawable.Drawable |  | ||||||
| import android.util.Base64 |  | ||||||
| import androidx.core.graphics.drawable.RoundedBitmapDrawableFactory |  | ||||||
| import android.widget.ImageView | import android.widget.ImageView | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.Config | import androidx.core.graphics.drawable.RoundedBitmapDrawableFactory | ||||||
| import com.bumptech.glide.Glide | import com.bumptech.glide.Glide | ||||||
| import com.bumptech.glide.RequestBuilder |  | ||||||
| import com.bumptech.glide.RequestManager |  | ||||||
| import com.bumptech.glide.load.model.GlideUrl |  | ||||||
| import com.bumptech.glide.load.model.LazyHeaders |  | ||||||
| import com.bumptech.glide.request.RequestOptions | import com.bumptech.glide.request.RequestOptions | ||||||
| import com.bumptech.glide.request.target.BitmapImageViewTarget | import com.bumptech.glide.request.target.BitmapImageViewTarget | ||||||
| import java.io.ByteArrayInputStream | import java.io.ByteArrayInputStream | ||||||
| import java.io.ByteArrayOutputStream | import java.io.ByteArrayOutputStream | ||||||
| import java.io.InputStream | import java.io.InputStream | ||||||
|  |  | ||||||
| fun Context.bitmapCenterCrop(config: Config, url: String, iv: ImageView) = | fun Context.bitmapCenterCrop(url: String, iv: ImageView) = | ||||||
|     Glide.with(this) |     Glide.with(this) | ||||||
|         .asBitmap() |         .asBitmap() | ||||||
|         .loadMaybeBasicAuth(config, url) |         .load(url) | ||||||
|         .apply(RequestOptions.centerCropTransform()) |         .apply(RequestOptions.centerCropTransform()) | ||||||
|         .into(iv) |         .into(iv) | ||||||
|  |  | ||||||
| fun Context.circularBitmapDrawable(config: Config, url: String, iv: ImageView) = | fun Context.circularBitmapDrawable(url: String, iv: ImageView) = | ||||||
|     Glide.with(this) |     Glide.with(this) | ||||||
|         .asBitmap() |         .asBitmap() | ||||||
|         .loadMaybeBasicAuth(config, url) |         .load(url) | ||||||
|         .apply(RequestOptions.centerCropTransform()) |         .apply(RequestOptions.centerCropTransform()) | ||||||
|         .into(object : BitmapImageViewTarget(iv) { |         .into(object : BitmapImageViewTarget(iv) { | ||||||
|             override fun setResource(resource: Bitmap?) { |             override fun setResource(resource: Bitmap?) { | ||||||
| @@ -41,26 +34,6 @@ fun Context.circularBitmapDrawable(config: Config, url: String, iv: ImageView) = | |||||||
|             } |             } | ||||||
|         }) |         }) | ||||||
|  |  | ||||||
| fun RequestBuilder<Bitmap>.loadMaybeBasicAuth(config: Config, url: String): RequestBuilder<Bitmap> { |  | ||||||
|     val builder: LazyHeaders.Builder = LazyHeaders.Builder() |  | ||||||
|     if (config.httpUserLogin.isNotEmpty() || config.httpUserPassword.isNotEmpty()) { |  | ||||||
|         val basicAuth = "Basic " + Base64.encodeToString("${config.httpUserLogin}:${config.httpUserPassword}".toByteArray(), Base64.NO_WRAP) |  | ||||||
|         builder.addHeader("Authorization", basicAuth) |  | ||||||
|     } |  | ||||||
|     val glideUrl = GlideUrl(url, builder.build()) |  | ||||||
|     return this.load(glideUrl) |  | ||||||
| } |  | ||||||
|  |  | ||||||
| fun RequestManager.loadMaybeBasicAuth(config: Config, url: String): RequestBuilder<Drawable> { |  | ||||||
|     val builder: LazyHeaders.Builder = LazyHeaders.Builder() |  | ||||||
|     if (config.httpUserLogin.isNotEmpty() || config.httpUserPassword.isNotEmpty()) { |  | ||||||
|         val basicAuth = "Basic " + Base64.encodeToString("${config.httpUserLogin}:${config.httpUserPassword}".toByteArray(), Base64.NO_WRAP) |  | ||||||
|         builder.addHeader("Authorization", basicAuth) |  | ||||||
|     } |  | ||||||
|     val glideUrl = GlideUrl(url, builder.build()) |  | ||||||
|     return this.load(glideUrl) |  | ||||||
| } |  | ||||||
|  |  | ||||||
| fun getBitmapInputStream(bitmap:Bitmap,compressFormat: Bitmap.CompressFormat): InputStream { | fun getBitmapInputStream(bitmap:Bitmap,compressFormat: Bitmap.CompressFormat): InputStream { | ||||||
|     val byteArrayOutputStream = ByteArrayOutputStream() |     val byteArrayOutputStream = ByteArrayOutputStream() | ||||||
|     bitmap.compress(compressFormat, 80, byteArrayOutputStream) |     bitmap.compress(compressFormat, 80, byteArrayOutputStream) | ||||||
|   | |||||||
| @@ -1,33 +0,0 @@ | |||||||
| package bou.amine.apps.readerforselfossv2.android.utils.glide |  | ||||||
|  |  | ||||||
| import android.content.Context |  | ||||||
| import bou.amine.apps.readerforselfossv2.android.utils.getUnsafeHttpClient |  | ||||||
| import com.bumptech.glide.Glide |  | ||||||
| import com.bumptech.glide.GlideBuilder |  | ||||||
| import com.bumptech.glide.Registry |  | ||||||
| import com.bumptech.glide.load.model.GlideUrl |  | ||||||
| import com.bumptech.glide.module.GlideModule |  | ||||||
| import com.russhwolf.settings.Settings |  | ||||||
| import java.io.InputStream |  | ||||||
|  |  | ||||||
| class SelfSignedGlideModule : GlideModule { |  | ||||||
|  |  | ||||||
|     override fun applyOptions(context: Context?, builder: GlideBuilder?) { |  | ||||||
|     } |  | ||||||
|  |  | ||||||
|     override fun registerComponents(context: Context?, glide: Glide?, registry: Registry?) { |  | ||||||
|  |  | ||||||
|         if (context != null) { |  | ||||||
|             val settings = Settings() |  | ||||||
|             if (settings.getBoolean("isSelfSignedCert", false)) { |  | ||||||
|                 val client = getUnsafeHttpClient().build() |  | ||||||
|  |  | ||||||
|                 registry?.append( |  | ||||||
|                     GlideUrl::class.java, |  | ||||||
|                     InputStream::class.java, |  | ||||||
|                     com.bumptech.glide.integration.okhttp3.OkHttpUrlLoader.Factory(client) |  | ||||||
|                 ) |  | ||||||
|             } |  | ||||||
|         } |  | ||||||
|     } |  | ||||||
| } |  | ||||||
| @@ -2,26 +2,27 @@ package bou.amine.apps.readerforselfossv2.android.viewmodel | |||||||
|  |  | ||||||
| import androidx.lifecycle.ViewModel | import androidx.lifecycle.ViewModel | ||||||
| import androidx.lifecycle.viewModelScope | import androidx.lifecycle.viewModelScope | ||||||
| import bou.amine.apps.readerforselfossv2.android.R |  | ||||||
| import bou.amine.apps.readerforselfossv2.repository.Repository | import bou.amine.apps.readerforselfossv2.repository.Repository | ||||||
| import kotlinx.coroutines.flow.MutableSharedFlow | import kotlinx.coroutines.flow.MutableSharedFlow | ||||||
| import kotlinx.coroutines.flow.asSharedFlow | import kotlinx.coroutines.flow.asSharedFlow | ||||||
| import kotlinx.coroutines.launch | import kotlinx.coroutines.launch | ||||||
|  |  | ||||||
| class AppViewModel(private val repository: Repository) : ViewModel() { | class AppViewModel(private val repository: Repository) : ViewModel() { | ||||||
|     private val _toastMessageProvider = MutableSharedFlow<Int>() |     private val _networkAvailableProvider = MutableSharedFlow<Boolean>() | ||||||
|     val toastMessageProvider = _toastMessageProvider.asSharedFlow() |     val networkAvailableProvider = _networkAvailableProvider.asSharedFlow() | ||||||
|     private var wasConnected = true |     private var wasConnected = true | ||||||
|  |  | ||||||
|     init { |     init { | ||||||
|         viewModelScope.launch { |         viewModelScope.launch { | ||||||
|             repository.isConnectionAvailable.collect { isConnected -> |             repository.isConnectionAvailable.collect { isConnected -> | ||||||
|                 if (isConnected && !wasConnected && repository.connectionMonitored) { |                 if (repository.connectionMonitored) { | ||||||
|                     _toastMessageProvider.emit(R.string.network_connectivity_retrieved) |                     if (isConnected && !wasConnected && repository.connectionMonitored) { | ||||||
|                     wasConnected = true |                         _networkAvailableProvider.emit(true) | ||||||
|                 } else if (!isConnected && wasConnected && repository.connectionMonitored){ |                         wasConnected = true | ||||||
|                     _toastMessageProvider.emit(R.string.network_connectivity_lost) |                     } else if (!isConnected && wasConnected && repository.connectionMonitored){ | ||||||
|                     wasConnected = false |                         _networkAvailableProvider.emit(false) | ||||||
|  |                         wasConnected = false | ||||||
|  |                     } | ||||||
|                 } |                 } | ||||||
|             } |             } | ||||||
|         } |         } | ||||||
|   | |||||||
| @@ -1,16 +0,0 @@ | |||||||
| <?xml version="1.0" encoding="utf-8"?> |  | ||||||
| <!-- Copyright 2015 Google Inc. All Rights Reserved. |  | ||||||
|      Licensed under the Apache License, Version 2.0 (the "License"); |  | ||||||
|      you may not use this file except in compliance with the License. |  | ||||||
|      You may obtain a copy of the License at |  | ||||||
|          http://www.apache.org/licenses/LICENSE-2.0 |  | ||||||
|      Unless required by applicable law or agreed to in writing, software |  | ||||||
|      distributed under the License is distributed on an "AS IS" BASIS, |  | ||||||
|      WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |  | ||||||
|      See the License for the specific language governing permissions and |  | ||||||
|      limitations under the License. |  | ||||||
| --> |  | ||||||
| <set xmlns:android="http://schemas.android.com/apk/res/android"> |  | ||||||
|     <translate android:fromXDelta="100%p" android:toXDelta="0" |  | ||||||
|                android:duration="@android:integer/config_mediumAnimTime"/> |  | ||||||
| </set> |  | ||||||
| @@ -1,16 +0,0 @@ | |||||||
| <?xml version="1.0" encoding="utf-8"?> |  | ||||||
| <!-- Copyright 2015 Google Inc. All Rights Reserved. |  | ||||||
|      Licensed under the Apache License, Version 2.0 (the "License"); |  | ||||||
|      you may not use this file except in compliance with the License. |  | ||||||
|      You may obtain a copy of the License at |  | ||||||
|          http://www.apache.org/licenses/LICENSE-2.0 |  | ||||||
|      Unless required by applicable law or agreed to in writing, software |  | ||||||
|      distributed under the License is distributed on an "AS IS" BASIS, |  | ||||||
|      WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |  | ||||||
|      See the License for the specific language governing permissions and |  | ||||||
|      limitations under the License. |  | ||||||
| --> |  | ||||||
| <set xmlns:android="http://schemas.android.com/apk/res/android"> |  | ||||||
|     <translate android:fromXDelta="0" android:toXDelta="-100%p" |  | ||||||
|                android:duration="@android:integer/config_mediumAnimTime"/> |  | ||||||
| </set> |  | ||||||
| @@ -1,8 +1,11 @@ | |||||||
| <?xml version="1.0" encoding="utf-8"?> | <?xml version="1.0" encoding="utf-8"?> | ||||||
| <layer-list xmlns:android="http://schemas.android.com/apk/res/android"> | <layer-list xmlns:android="http://schemas.android.com/apk/res/android"> | ||||||
|  |  | ||||||
|     <item |     <item> | ||||||
|         android:drawable="@color/ic_launcher_background"/> |         <shape android:shape="rectangle" > | ||||||
|  |             <solid android:color="?attr/colorSurface" /> | ||||||
|  |         </shape> | ||||||
|  |     </item> | ||||||
|  |  | ||||||
|     <item> |     <item> | ||||||
|         <bitmap |         <bitmap | ||||||
|   | |||||||
										
											Binary file not shown.
										
									
								
							| Before Width: | Height: | Size: 406 B | 
							
								
								
									
										5
									
								
								androidApp/src/main/res/drawable/checkerboard.xml
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										5
									
								
								androidApp/src/main/res/drawable/checkerboard.xml
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,5 @@ | |||||||
|  | <bitmap | ||||||
|  |     xmlns:android="http://schemas.android.com/apk/res/android" | ||||||
|  |     android:dither="true" | ||||||
|  |     android:src="@drawable/checktile" | ||||||
|  |     android:tileMode="repeat"/> | ||||||
							
								
								
									
										
											BIN
										
									
								
								androidApp/src/main/res/drawable/checktile.png
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										
											BIN
										
									
								
								androidApp/src/main/res/drawable/checktile.png
									
									
									
									
									
										Normal file
									
								
							
										
											Binary file not shown.
										
									
								
							| After Width: | Height: | Size: 235 B | 
| @@ -0,0 +1,5 @@ | |||||||
|  | <vector android:height="24dp" android:tint="#000000" | ||||||
|  |     android:viewportHeight="24" android:viewportWidth="24" | ||||||
|  |     android:width="24dp" xmlns:android="http://schemas.android.com/apk/res/android"> | ||||||
|  |     <path android:fillColor="@android:color/white" android:pathData="M20,8h-2.81c-0.45,-0.78 -1.07,-1.45 -1.82,-1.96L17,4.41 15.59,3l-2.17,2.17C12.96,5.06 12.49,5 12,5c-0.49,0 -0.96,0.06 -1.41,0.17L8.41,3 7,4.41l1.62,1.63C7.88,6.55 7.26,7.22 6.81,8L4,8v2h2.09c-0.05,0.33 -0.09,0.66 -0.09,1v1L4,12v2h2v1c0,0.34 0.04,0.67 0.09,1L4,16v2h2.81c1.04,1.79 2.97,3 5.19,3s4.15,-1.21 5.19,-3L20,18v-2h-2.09c0.05,-0.33 0.09,-0.66 0.09,-1v-1h2v-2h-2v-1c0,-0.34 -0.04,-0.67 -0.09,-1L20,10L20,8zM14,16h-4v-2h4v2zM14,12h-4v-2h4v2z"/> | ||||||
|  | </vector> | ||||||
| @@ -0,0 +1,5 @@ | |||||||
|  | <vector android:height="24dp" android:tint="#FFFFFF" | ||||||
|  |     android:viewportHeight="24" android:viewportWidth="24" | ||||||
|  |     android:width="24dp" xmlns:android="http://schemas.android.com/apk/res/android"> | ||||||
|  |     <path android:fillColor="@android:color/white" android:pathData="M4.25,5.61C6.27,8.2 10,13 10,13v6c0,0.55 0.45,1 1,1h2c0.55,0 1,-0.45 1,-1v-6c0,0 3.72,-4.8 5.74,-7.39C20.25,4.95 19.78,4 18.95,4H5.04C4.21,4 3.74,4.95 4.25,5.61z"/> | ||||||
|  | </vector> | ||||||
| @@ -1,9 +0,0 @@ | |||||||
| <vector xmlns:android="http://schemas.android.com/apk/res/android" |  | ||||||
|         android:width="24dp" |  | ||||||
|         android:height="24dp" |  | ||||||
|         android:viewportWidth="24.0" |  | ||||||
|         android:viewportHeight="24.0"> |  | ||||||
|     <path |  | ||||||
|         android:fillColor="#FF000000" |  | ||||||
|         android:pathData="M20,8h-2.81c-0.45,-0.78 -1.07,-1.45 -1.82,-1.96L17,4.41 15.59,3l-2.17,2.17C12.96,5.06 12.49,5 12,5c-0.49,0 -0.96,0.06 -1.41,0.17L8.41,3 7,4.41l1.62,1.63C7.88,6.55 7.26,7.22 6.81,8L4,8v2h2.09c-0.05,0.33 -0.09,0.66 -0.09,1v1L4,12v2h2v1c0,0.34 0.04,0.67 0.09,1L4,16v2h2.81c1.04,1.79 2.97,3 5.19,3s4.15,-1.21 5.19,-3L20,18v-2h-2.09c0.05,-0.33 0.09,-0.66 0.09,-1v-1h2v-2h-2v-1c0,-0.34 -0.04,-0.67 -0.09,-1L20,10L20,8zM14,16h-4v-2h4v2zM14,12h-4v-2h4v2z"/> |  | ||||||
| </vector> |  | ||||||
| @@ -1,5 +0,0 @@ | |||||||
| <vector android:height="24dp" android:tint="#FFFFFF" |  | ||||||
|     android:viewportHeight="24.0" android:viewportWidth="24.0" |  | ||||||
|     android:width="24dp" xmlns:android="http://schemas.android.com/apk/res/android"> |  | ||||||
|     <path android:fillColor="#FF000000" android:pathData="M20,8h-2.81c-0.45,-0.78 -1.07,-1.45 -1.82,-1.96L17,4.41 15.59,3l-2.17,2.17C12.96,5.06 12.49,5 12,5c-0.49,0 -0.96,0.06 -1.41,0.17L8.41,3 7,4.41l1.62,1.63C7.88,6.55 7.26,7.22 6.81,8L4,8v2h2.09c-0.05,0.33 -0.09,0.66 -0.09,1v1L4,12v2h2v1c0,0.34 0.04,0.67 0.09,1L4,16v2h2.81c1.04,1.79 2.97,3 5.19,3s4.15,-1.21 5.19,-3L20,18v-2h-2.09c0.05,-0.33 0.09,-0.66 0.09,-1v-1h2v-2h-2v-1c0,-0.34 -0.04,-0.67 -0.09,-1L20,10L20,8zM14,16h-4v-2h4v2zM14,12h-4v-2h4v2z"/> |  | ||||||
| </vector> |  | ||||||
| @@ -1,9 +0,0 @@ | |||||||
| <vector xmlns:android="http://schemas.android.com/apk/res/android" |  | ||||||
|         android:width="24dp" |  | ||||||
|         android:height="24dp" |  | ||||||
|         android:viewportWidth="24.0" |  | ||||||
|         android:viewportHeight="24.0"> |  | ||||||
|     <path |  | ||||||
|         android:fillColor="#FFFFFFFF" |  | ||||||
|         android:pathData="M13,12h7v1.5h-7zM13,9.5h7L20,11h-7zM13,14.5h7L20,16h-7zM21,4L3,4c-1.1,0 -2,0.9 -2,2v13c0,1.1 0.9,2 2,2h18c1.1,0 2,-0.9 2,-2L23,6c0,-1.1 -0.9,-2 -2,-2zM21,19h-9L12,6h9v13z"/> |  | ||||||
| </vector> |  | ||||||
| @@ -1,5 +0,0 @@ | |||||||
| <vector android:height="24dp" android:tint="#FFFFFF" |  | ||||||
|     android:viewportHeight="24.0" android:viewportWidth="24.0" |  | ||||||
|     android:width="24dp" xmlns:android="http://schemas.android.com/apk/res/android"> |  | ||||||
|     <path android:fillColor="#FF000000" android:pathData="M19,6.41L17.59,5 12,10.59 6.41,5 5,6.41 10.59,12 5,17.59 6.41,19 12,13.41 17.59,19 19,17.59 13.41,12z"/> |  | ||||||
| </vector> |  | ||||||
| @@ -1,5 +0,0 @@ | |||||||
| <vector android:height="24dp" android:tint="#FFFFFF" |  | ||||||
|     android:viewportHeight="24.0" android:viewportWidth="24.0" |  | ||||||
|     android:width="24dp" xmlns:android="http://schemas.android.com/apk/res/android"> |  | ||||||
|     <path android:fillColor="#FF000000" android:pathData="M12,3c-4.97,0 -9,4.03 -9,9s4.03,9 9,9c0.83,0 1.5,-0.67 1.5,-1.5 0,-0.39 -0.15,-0.74 -0.39,-1.01 -0.23,-0.26 -0.38,-0.61 -0.38,-0.99 0,-0.83 0.67,-1.5 1.5,-1.5L16,16c2.76,0 5,-2.24 5,-5 0,-4.42 -4.03,-8 -9,-8zM6.5,12c-0.83,0 -1.5,-0.67 -1.5,-1.5S5.67,9 6.5,9 8,9.67 8,10.5 7.33,12 6.5,12zM9.5,8C8.67,8 8,7.33 8,6.5S8.67,5 9.5,5s1.5,0.67 1.5,1.5S10.33,8 9.5,8zM14.5,8c-0.83,0 -1.5,-0.67 -1.5,-1.5S13.67,5 14.5,5s1.5,0.67 1.5,1.5S15.33,8 14.5,8zM17.5,12c-0.83,0 -1.5,-0.67 -1.5,-1.5S16.67,9 17.5,9s1.5,0.67 1.5,1.5 -0.67,1.5 -1.5,1.5z"/> |  | ||||||
| </vector> |  | ||||||
| @@ -1,5 +0,0 @@ | |||||||
| <vector android:height="24dp" android:tint="#FFFFFF" |  | ||||||
|     android:viewportHeight="24.0" android:viewportWidth="24.0" |  | ||||||
|     android:width="24dp" xmlns:android="http://schemas.android.com/apk/res/android"> |  | ||||||
|     <path android:fillColor="#FF000000" android:pathData="M13,3c-4.97,0 -9,4.03 -9,9L1,12l3.89,3.89 0.07,0.14L9,12L6,12c0,-3.87 3.13,-7 7,-7s7,3.13 7,7 -3.13,7 -7,7c-1.93,0 -3.68,-0.79 -4.94,-2.06l-1.42,1.42C8.27,19.99 10.51,21 13,21c4.97,0 9,-4.03 9,-9s-4.03,-9 -9,-9zM12,8v5l4.28,2.54 0.72,-1.21 -3.5,-2.08L13.5,8L12,8z"/> |  | ||||||
| </vector> |  | ||||||
| @@ -1,5 +0,0 @@ | |||||||
| <vector android:height="24dp" android:tint="#FFFFFF" |  | ||||||
|     android:viewportHeight="24.0" android:viewportWidth="24.0" |  | ||||||
|     android:width="24dp" xmlns:android="http://schemas.android.com/apk/res/android"> |  | ||||||
|     <path android:fillColor="#FF000000" android:pathData="M17.65,6.35C16.2,4.9 14.21,4 12,4c-4.42,0 -7.99,3.58 -7.99,8s3.57,8 7.99,8c3.73,0 6.84,-2.55 7.73,-6h-2.08c-0.82,2.33 -3.04,4 -5.65,4 -3.31,0 -6,-2.69 -6,-6s2.69,-6 6,-6c1.66,0 3.14,0.69 4.22,1.78L13,11h7V4l-2.35,2.35z"/> |  | ||||||
| </vector> |  | ||||||
| @@ -1,7 +0,0 @@ | |||||||
| <?xml version="1.0" encoding="utf-8"?> |  | ||||||
| <font-family xmlns:app="http://schemas.android.com/apk/res-auto" |  | ||||||
|         app:fontProviderAuthority="com.google.android.gms.fonts" |  | ||||||
|         app:fontProviderPackage="com.google.android.gms" |  | ||||||
|         app:fontProviderQuery="Open Sans" |  | ||||||
|         app:fontProviderCerts="@array/com_google_android_gms_fonts_certs"> |  | ||||||
| </font-family> |  | ||||||
| @@ -1,7 +0,0 @@ | |||||||
| <?xml version="1.0" encoding="utf-8"?> |  | ||||||
| <font-family xmlns:app="http://schemas.android.com/apk/res-auto" |  | ||||||
|         app:fontProviderAuthority="com.google.android.gms.fonts" |  | ||||||
|         app:fontProviderPackage="com.google.android.gms" |  | ||||||
|         app:fontProviderQuery="Roboto" |  | ||||||
|         app:fontProviderCerts="@array/com_google_android_gms_fonts_certs"> |  | ||||||
| </font-family> |  | ||||||
| @@ -28,12 +28,12 @@ | |||||||
|                     android:layout_width="match_parent" |                     android:layout_width="match_parent" | ||||||
|                     android:layout_height="wrap_content"> |                     android:layout_height="wrap_content"> | ||||||
|  |  | ||||||
|                     <androidx.appcompat.widget.Toolbar |                     <androidx.appcompat.widget.Toolbar app:popupTheme="?attr/toolbarPopupTheme" android:theme="@style/ToolBarStyle" | ||||||
|                         android:id="@+id/toolBar" |                         android:id="@+id/toolBar" | ||||||
|                         android:layout_width="match_parent" |                         android:layout_width="match_parent" | ||||||
|                         android:layout_height="?attr/actionBarSize" |                         android:layout_height="?attr/actionBarSize" | ||||||
|                         app:theme="@style/ToolBarStyle" |  | ||||||
|                         app:popupTheme="?attr/toolbarPopupTheme" /> |                          /> | ||||||
|  |  | ||||||
|                 </com.google.android.material.appbar.AppBarLayout> |                 </com.google.android.material.appbar.AppBarLayout> | ||||||
|  |  | ||||||
| @@ -78,16 +78,11 @@ | |||||||
|  |  | ||||||
|         </androidx.coordinatorlayout.widget.CoordinatorLayout> |         </androidx.coordinatorlayout.widget.CoordinatorLayout> | ||||||
|         <com.ashokvarma.bottomnavigation.BottomNavigationBar |         <com.ashokvarma.bottomnavigation.BottomNavigationBar | ||||||
|             android:layout_gravity="bottom" |  | ||||||
|             android:id="@+id/bottomBar" |             android:id="@+id/bottomBar" | ||||||
|             android:layout_width="match_parent" |             android:layout_width="match_parent" | ||||||
|             android:layout_height="60dp"/> |             android:layout_height="60dp" | ||||||
|  |             android:layout_gravity="bottom" | ||||||
|  |             app:bnbActiveColor="@color/colorAccent" | ||||||
|  |             app:bnbBackgroundColor="?attr/bottomBarBackground" /> | ||||||
|     </androidx.coordinatorlayout.widget.CoordinatorLayout> |     </androidx.coordinatorlayout.widget.CoordinatorLayout> | ||||||
|  |  | ||||||
|     <com.mikepenz.materialdrawer.widget.MaterialDrawerSliderView |  | ||||||
|         android:id="@+id/mainDrawer" |  | ||||||
|         android:layout_width="wrap_content" |  | ||||||
|         android:layout_height="match_parent" |  | ||||||
|         android:layout_gravity="start" |  | ||||||
|         android:fitsSystemWindows="true" /> |  | ||||||
| </androidx.drawerlayout.widget.DrawerLayout> | </androidx.drawerlayout.widget.DrawerLayout> | ||||||
| @@ -1,33 +1,40 @@ | |||||||
| <?xml version="1.0" encoding="utf-8"?> | <?xml version="1.0" encoding="utf-8"?> | ||||||
| <androidx.constraintlayout.widget.ConstraintLayout xmlns:android="http://schemas.android.com/apk/res/android" | <androidx.constraintlayout.motion.widget.MotionLayout xmlns:android="http://schemas.android.com/apk/res/android" | ||||||
|     xmlns:app="http://schemas.android.com/apk/res-auto" |     xmlns:app="http://schemas.android.com/apk/res-auto" | ||||||
|  |     android:id="@+id/container" | ||||||
|     android:layout_width="match_parent" |     android:layout_width="match_parent" | ||||||
|     android:layout_height="match_parent"> |     android:layout_height="match_parent" | ||||||
|  |     app:layoutDescription="@xml/image_close_scene"> | ||||||
|  |  | ||||||
|     <com.google.android.material.appbar.AppBarLayout |     <com.google.android.material.appbar.AppBarLayout | ||||||
|         android:id="@+id/appBarLayout" |         android:id="@+id/appBarLayout" | ||||||
|         android:layout_width="match_parent" |         android:layout_width="match_parent" | ||||||
|         android:layout_height="wrap_content" |         android:layout_height="wrap_content"> | ||||||
|         app:layout_constraintEnd_toEndOf="parent" |  | ||||||
|         app:layout_constraintStart_toStartOf="parent" |  | ||||||
|         app:layout_constraintTop_toTopOf="parent"> |  | ||||||
|  |  | ||||||
|         <androidx.appcompat.widget.Toolbar |         <androidx.appcompat.widget.Toolbar android:theme="@style/ToolBarStyle" | ||||||
|             android:id="@+id/toolBar" |             android:id="@+id/toolBar" | ||||||
|             android:layout_width="match_parent" |             android:layout_width="match_parent" | ||||||
|             android:layout_height="?attr/actionBarSize" |             android:layout_height="?attr/actionBarSize" | ||||||
|             app:popupTheme="?attr/toolbarPopupTheme" |  | ||||||
|             app:theme="@style/ToolBarStyle" /> |             /> | ||||||
|  |  | ||||||
|     </com.google.android.material.appbar.AppBarLayout> |     </com.google.android.material.appbar.AppBarLayout> | ||||||
|  |  | ||||||
|     <androidx.viewpager2.widget.ViewPager2 |     <androidx.core.widget.NestedScrollView | ||||||
|         android:id="@+id/pager" |         android:id="@+id/scrollView" | ||||||
|         android:layout_width="match_parent" |         android:layout_width="match_parent" | ||||||
|         android:layout_height="0dp" |         android:layout_height="match_parent" | ||||||
|         app:layout_constraintBottom_toBottomOf="parent" |         android:fillViewport="true" | ||||||
|         app:layout_constraintEnd_toEndOf="parent" |         app:layout_constraintTop_toBottomOf="@+id/appBarLayout"> | ||||||
|         app:layout_constraintStart_toStartOf="parent" |  | ||||||
|         app:layout_constraintTop_toBottomOf="@+id/appBarLayout" /> |  | ||||||
|  |  | ||||||
| </androidx.constraintlayout.widget.ConstraintLayout> |         <androidx.viewpager2.widget.ViewPager2 | ||||||
|  |             android:id="@+id/pager" | ||||||
|  |             android:layout_width="match_parent" | ||||||
|  |             android:layout_height="match_parent" | ||||||
|  |             app:layout_constraintBottom_toBottomOf="parent" | ||||||
|  |             app:layout_constraintEnd_toEndOf="parent" | ||||||
|  |             app:layout_constraintStart_toStartOf="parent" /> | ||||||
|  |     </androidx.core.widget.NestedScrollView> | ||||||
|  |  | ||||||
|  |  | ||||||
|  | </androidx.constraintlayout.motion.widget.MotionLayout> | ||||||
|   | |||||||
| @@ -10,12 +10,12 @@ | |||||||
|         android:layout_width="match_parent" |         android:layout_width="match_parent" | ||||||
|         android:layout_height="wrap_content"> |         android:layout_height="wrap_content"> | ||||||
|  |  | ||||||
|         <androidx.appcompat.widget.Toolbar |         <androidx.appcompat.widget.Toolbar app:popupTheme="?attr/toolbarPopupTheme" android:theme="@style/ToolBarStyle" | ||||||
|             android:id="@+id/toolbar" |             android:id="@+id/toolbar" | ||||||
|             android:layout_width="match_parent" |             android:layout_width="match_parent" | ||||||
|             android:layout_height="?attr/actionBarSize" |             android:layout_height="?attr/actionBarSize" | ||||||
|             app:theme="@style/ToolBarStyle" |  | ||||||
|             app:popupTheme="?attr/toolbarPopupTheme" /> |              /> | ||||||
|  |  | ||||||
|     </com.google.android.material.appbar.AppBarLayout> |     </com.google.android.material.appbar.AppBarLayout> | ||||||
|     <LinearLayout |     <LinearLayout | ||||||
| @@ -82,45 +82,6 @@ | |||||||
|                     android:maxLines="1" |                     android:maxLines="1" | ||||||
|                     android:visibility="gone" /> |                     android:visibility="gone" /> | ||||||
|  |  | ||||||
|                 <com.google.android.material.switchmaterial.SwitchMaterial |  | ||||||
|                     android:id="@+id/withHttpLogin" |  | ||||||
|                     android:layout_width="match_parent" |  | ||||||
|                     android:layout_height="wrap_content" |  | ||||||
|                     android:layout_weight="1" |  | ||||||
|                     android:text="@string/withHttpLoginSwitch" /> |  | ||||||
|  |  | ||||||
|                 <EditText |  | ||||||
|                     android:id="@+id/httpLoginView" |  | ||||||
|                     android:layout_width="match_parent" |  | ||||||
|                     android:layout_height="wrap_content" |  | ||||||
|                     android:autofillHints="username" |  | ||||||
|                     android:hint="@string/prompt_http_login" |  | ||||||
|                     android:inputType="text" |  | ||||||
|                     android:visibility="gone" /> |  | ||||||
|  |  | ||||||
|                 <EditText |  | ||||||
|                     android:id="@+id/httpPasswordView" |  | ||||||
|                     android:layout_width="match_parent" |  | ||||||
|                     android:layout_height="wrap_content" |  | ||||||
|                     android:autofillHints="password" |  | ||||||
|                     android:hint="@string/prompt_http_password" |  | ||||||
|                     android:inputType="textPassword" |  | ||||||
|                     android:visibility="gone" /> |  | ||||||
|  |  | ||||||
|                 <com.google.android.material.switchmaterial.SwitchMaterial |  | ||||||
|                     android:id="@+id/withSelfhostedCert" |  | ||||||
|                     android:layout_width="match_parent" |  | ||||||
|                     android:layout_height="wrap_content" |  | ||||||
|                     android:text="@string/self_hosted_cert_switch" /> |  | ||||||
|  |  | ||||||
|                 <TextView |  | ||||||
|                     android:id="@+id/warningText" |  | ||||||
|                     android:layout_width="match_parent" |  | ||||||
|                     android:layout_height="wrap_content" |  | ||||||
|                     android:text="@string/self_signed_cert_warning" |  | ||||||
|                     android:textAppearance="@style/TextAppearance.AppCompat.Medium" |  | ||||||
|                     android:visibility="gone" /> |  | ||||||
|  |  | ||||||
|                 <Button |                 <Button | ||||||
|                     android:id="@+id/signInButton" |                     android:id="@+id/signInButton" | ||||||
|                     style="?android:textAppearanceSmall" |                     style="?android:textAppearanceSmall" | ||||||
|   | |||||||
| @@ -17,8 +17,10 @@ | |||||||
|             android:id="@+id/toolBar" |             android:id="@+id/toolBar" | ||||||
|             android:layout_width="match_parent" |             android:layout_width="match_parent" | ||||||
|             android:layout_height="?attr/actionBarSize" |             android:layout_height="?attr/actionBarSize" | ||||||
|  |             android:theme="@style/ToolBarStyle" | ||||||
|             app:popupTheme="?attr/toolbarPopupTheme" |             app:popupTheme="?attr/toolbarPopupTheme" | ||||||
|             app:theme="@style/ToolBarStyle" /> |  | ||||||
|  |             /> | ||||||
|  |  | ||||||
|     </com.google.android.material.appbar.AppBarLayout> |     </com.google.android.material.appbar.AppBarLayout> | ||||||
|  |  | ||||||
|   | |||||||
| @@ -1,4 +1,5 @@ | |||||||
| <LinearLayout xmlns:android="http://schemas.android.com/apk/res/android" | <LinearLayout xmlns:android="http://schemas.android.com/apk/res/android" | ||||||
|  |     xmlns:app="http://schemas.android.com/apk/res-auto" | ||||||
|     android:id="@+id/layout" |     android:id="@+id/layout" | ||||||
|     android:layout_width="match_parent" |     android:layout_width="match_parent" | ||||||
|     android:layout_height="match_parent" |     android:layout_height="match_parent" | ||||||
| @@ -8,11 +9,11 @@ | |||||||
|         android:layout_width="match_parent" |         android:layout_width="match_parent" | ||||||
|         android:layout_height="wrap_content"> |         android:layout_height="wrap_content"> | ||||||
|  |  | ||||||
|         <androidx.appcompat.widget.Toolbar |         <androidx.appcompat.widget.Toolbar app:popupTheme="?attr/toolbarPopupTheme" android:theme="@style/ToolBarStyle" | ||||||
|             android:id="@+id/toolbar" |             android:id="@+id/toolbar" | ||||||
|             android:layout_width="match_parent" |             android:layout_width="match_parent" | ||||||
|             android:layout_height="?attr/actionBarSize" |             android:layout_height="?attr/actionBarSize" | ||||||
|             android:theme="@style/ToolBarStyle" /> |              /> | ||||||
|     </com.google.android.material.appbar.AppBarLayout> |     </com.google.android.material.appbar.AppBarLayout> | ||||||
|  |  | ||||||
|     <FrameLayout |     <FrameLayout | ||||||
|   | |||||||
| @@ -10,12 +10,12 @@ | |||||||
|         android:layout_width="match_parent" |         android:layout_width="match_parent" | ||||||
|         android:layout_height="wrap_content"> |         android:layout_height="wrap_content"> | ||||||
|  |  | ||||||
|         <androidx.appcompat.widget.Toolbar |         <androidx.appcompat.widget.Toolbar app:popupTheme="?attr/toolbarPopupTheme" android:theme="@style/ToolBarStyle" | ||||||
|             android:id="@+id/toolbar" |             android:id="@+id/toolbar" | ||||||
|             android:layout_width="match_parent" |             android:layout_width="match_parent" | ||||||
|             android:layout_height="?attr/actionBarSize" |             android:layout_height="?attr/actionBarSize" | ||||||
|             app:theme="@style/ToolBarStyle" |  | ||||||
|             app:popupTheme="?attr/toolbarPopupTheme" /> |              /> | ||||||
|  |  | ||||||
|     </com.google.android.material.appbar.AppBarLayout> |     </com.google.android.material.appbar.AppBarLayout> | ||||||
|  |  | ||||||
|   | |||||||
| @@ -4,7 +4,7 @@ | |||||||
|     xmlns:tools="http://schemas.android.com/tools" |     xmlns:tools="http://schemas.android.com/tools" | ||||||
|     android:layout_width="match_parent" |     android:layout_width="match_parent" | ||||||
|     android:layout_height="match_parent" |     android:layout_height="match_parent" | ||||||
|     tools:context="bou.amine.apps.readerforselfossv2.android.AddSourceActivity"> |     tools:context="bou.amine.apps.readerforselfossv2.android.UpsertSourceActivity"> | ||||||
|     <LinearLayout |     <LinearLayout | ||||||
|         android:layout_width="match_parent" |         android:layout_width="match_parent" | ||||||
|         android:layout_height="wrap_content" |         android:layout_height="wrap_content" | ||||||
| @@ -14,12 +14,12 @@ | |||||||
|             android:layout_width="match_parent" |             android:layout_width="match_parent" | ||||||
|             android:layout_height="wrap_content"> |             android:layout_height="wrap_content"> | ||||||
| 
 | 
 | ||||||
|             <androidx.appcompat.widget.Toolbar |             <androidx.appcompat.widget.Toolbar app:popupTheme="?attr/toolbarPopupTheme" android:theme="@style/ToolBarStyle" | ||||||
|                 android:id="@+id/toolbar" |                 android:id="@+id/toolbar" | ||||||
|                 android:layout_width="match_parent" |                 android:layout_width="match_parent" | ||||||
|                 android:layout_height="?attr/actionBarSize" |                 android:layout_height="?attr/actionBarSize" | ||||||
|                 app:theme="@style/ToolBarStyle" | 
 | ||||||
|                 app:popupTheme="?attr/toolbarPopupTheme" /> |                  /> | ||||||
| 
 | 
 | ||||||
|         </com.google.android.material.appbar.AppBarLayout> |         </com.google.android.material.appbar.AppBarLayout> | ||||||
| 
 | 
 | ||||||
| @@ -41,36 +41,20 @@ | |||||||
|             app:layout_constraintHorizontal_bias="1.0" |             app:layout_constraintHorizontal_bias="1.0" | ||||||
|             app:layout_constraintVertical_bias="0.0"> |             app:layout_constraintVertical_bias="0.0"> | ||||||
| 
 | 
 | ||||||
|             <TextView |  | ||||||
|                 android:text="@string/add_source" |  | ||||||
|                 android:layout_width="wrap_content" |  | ||||||
|                 android:layout_height="wrap_content" |  | ||||||
|                 android:id="@+id/textView2" |  | ||||||
|                 android:textAppearance="@style/TextAppearance.AppCompat.Large" |  | ||||||
|                 android:textAlignment="center" |  | ||||||
|                 android:layout_marginTop="16dp" |  | ||||||
|                 app:layout_constraintTop_toTopOf="parent" |  | ||||||
|                 android:layout_marginEnd="16dp" |  | ||||||
|                 app:layout_constraintRight_toRightOf="parent" |  | ||||||
|                 android:layout_marginRight="16dp" |  | ||||||
|                 android:layout_marginStart="16dp" |  | ||||||
|                 app:layout_constraintLeft_toLeftOf="parent" |  | ||||||
|                 android:layout_marginLeft="16dp" |  | ||||||
|                 android:gravity="center_horizontal" /> |  | ||||||
| 
 | 
 | ||||||
|             <EditText |             <EditText | ||||||
|  |                 android:id="@+id/nameInput" | ||||||
|                 android:layout_width="match_parent" |                 android:layout_width="match_parent" | ||||||
|                 android:layout_height="wrap_content" |                 android:layout_height="wrap_content" | ||||||
|  |                 android:layout_marginTop="16dp" | ||||||
|  |                 android:autofillHints="false" | ||||||
|                 android:ems="10" |                 android:ems="10" | ||||||
|                 android:id="@+id/nameInput" |                 android:hint="@string/add_source_hint_name" | ||||||
|                 android:layout_marginTop="32dp" |                 android:inputType="text" | ||||||
|                 app:layout_constraintTop_toBottomOf="@+id/textView2" |                 android:textColorHint="?android:textColorPrimary" | ||||||
|                 app:layout_constraintLeft_toLeftOf="parent" |                 app:layout_constraintLeft_toLeftOf="parent" | ||||||
|                 app:layout_constraintRight_toRightOf="parent" |                 app:layout_constraintRight_toRightOf="parent" | ||||||
|                 android:inputType="text" |                 app:layout_constraintTop_toTopOf="parent" /> | ||||||
|                 android:hint="@string/add_source_hint_name" |  | ||||||
|                 android:textColorHint="?android:textColorPrimary" |  | ||||||
|                 android:autofillHints="false" /> |  | ||||||
| 
 | 
 | ||||||
|             <EditText |             <EditText | ||||||
|                 android:layout_width="match_parent" |                 android:layout_width="match_parent" | ||||||
| @@ -107,8 +91,7 @@ | |||||||
|                 app:layout_constraintTop_toBottomOf="@+id/tags" |                 app:layout_constraintTop_toBottomOf="@+id/tags" | ||||||
|                 app:layout_constraintRight_toRightOf="parent" |                 app:layout_constraintRight_toRightOf="parent" | ||||||
|                 app:layout_constraintLeft_toLeftOf="parent" |                 app:layout_constraintLeft_toLeftOf="parent" | ||||||
|                 android:layout_height="40dp" |                 android:layout_height="40dp"/> | ||||||
|                 android:theme="@style/App.Spinner"/> |  | ||||||
| 
 | 
 | ||||||
|             <Button |             <Button | ||||||
|                 android:text="@string/add_source_save" |                 android:text="@string/add_source_save" | ||||||
| @@ -116,7 +99,7 @@ | |||||||
|                 android:layout_height="wrap_content" |                 android:layout_height="wrap_content" | ||||||
|                 android:id="@+id/saveBtn" |                 android:id="@+id/saveBtn" | ||||||
|                 android:elevation="5dp" |                 android:elevation="5dp" | ||||||
|                 android:textColor="?attr/colorAccent" |                 android:textColor="?android:textColorPrimary" | ||||||
|                 android:layout_marginEnd="16dp" |                 android:layout_marginEnd="16dp" | ||||||
|                 app:layout_constraintRight_toRightOf="parent" |                 app:layout_constraintRight_toRightOf="parent" | ||||||
|                 android:layout_marginRight="16dp" |                 android:layout_marginRight="16dp" | ||||||
| @@ -16,8 +16,7 @@ | |||||||
|     app:layout_constraintTop_toTopOf="parent" |     app:layout_constraintTop_toTopOf="parent" | ||||||
|     card_view:cardElevation="2dp" |     card_view:cardElevation="2dp" | ||||||
|     card_view:cardUseCompatPadding="true" |     card_view:cardUseCompatPadding="true" | ||||||
|     card_view:layout_constraintBottom_toBottomOf="parent" |     card_view:layout_constraintBottom_toBottomOf="parent"> | ||||||
|     app:cardBackgroundColor="?cardBackgroundColor"> |  | ||||||
|  |  | ||||||
|     <androidx.constraintlayout.widget.ConstraintLayout |     <androidx.constraintlayout.widget.ConstraintLayout | ||||||
|         android:layout_width="match_parent" |         android:layout_width="match_parent" | ||||||
|   | |||||||
							
								
								
									
										96
									
								
								androidApp/src/main/res/layout/filter_fragment.xml
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										96
									
								
								androidApp/src/main/res/layout/filter_fragment.xml
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,96 @@ | |||||||
|  | <?xml version="1.0" encoding="utf-8"?> | ||||||
|  | <androidx.constraintlayout.widget.ConstraintLayout | ||||||
|  |     xmlns:android="http://schemas.android.com/apk/res/android" | ||||||
|  |     xmlns:app="http://schemas.android.com/apk/res-auto" | ||||||
|  |     xmlns:tools="http://schemas.android.com/tools" | ||||||
|  |     android:layout_width="match_parent" | ||||||
|  |     android:layout_height="match_parent"> | ||||||
|  |  | ||||||
|  |     <ProgressBar | ||||||
|  |         android:id="@+id/progressBar2" | ||||||
|  |         style="?android:attr/progressBarStyle" | ||||||
|  |         android:layout_width="48dp" | ||||||
|  |         android:layout_height="48dp" | ||||||
|  |         app:layout_constraintBottom_toBottomOf="parent" | ||||||
|  |         app:layout_constraintEnd_toEndOf="parent" | ||||||
|  |         app:layout_constraintStart_toStartOf="parent" | ||||||
|  |         app:layout_constraintTop_toTopOf="parent" | ||||||
|  |         tools:visibility="gone" /> | ||||||
|  |  | ||||||
|  |     <androidx.core.widget.NestedScrollView | ||||||
|  |         android:layout_width="match_parent" | ||||||
|  |         android:layout_height="match_parent" | ||||||
|  |         android:fillViewport="true"> | ||||||
|  |  | ||||||
|  |         <androidx.constraintlayout.widget.ConstraintLayout | ||||||
|  |             android:id="@+id/filterView" | ||||||
|  |             android:layout_width="match_parent" | ||||||
|  |             android:layout_height="wrap_content" | ||||||
|  |             android:visibility="gone" | ||||||
|  |             tools:visibility="visible"> | ||||||
|  |  | ||||||
|  |             <TextView | ||||||
|  |                 android:id="@+id/filterTagsTitle" | ||||||
|  |                 style="@style/MaterialAlertDialog.MaterialComponents.Title.Text" | ||||||
|  |                 android:layout_width="wrap_content" | ||||||
|  |                 android:layout_height="wrap_content" | ||||||
|  |                 android:layout_marginStart="24dp" | ||||||
|  |                 android:layout_marginTop="16dp" | ||||||
|  |                 android:text="@string/filter_item_tags" | ||||||
|  |                 app:layout_constraintStart_toStartOf="parent" | ||||||
|  |                 app:layout_constraintTop_toTopOf="parent" /> | ||||||
|  |  | ||||||
|  |             <TextView | ||||||
|  |                 android:id="@+id/filterSourcesTitle" | ||||||
|  |                 style="@style/MaterialAlertDialog.MaterialComponents.Title.Text" | ||||||
|  |                 android:layout_width="wrap_content" | ||||||
|  |                 android:layout_height="wrap_content" | ||||||
|  |                 android:layout_marginStart="24dp" | ||||||
|  |                 android:layout_marginTop="24dp" | ||||||
|  |                 android:text="@string/filter_item_sources" | ||||||
|  |                 app:layout_constraintStart_toStartOf="parent" | ||||||
|  |                 app:layout_constraintTop_toBottomOf="@+id/tagsGroup" /> | ||||||
|  |  | ||||||
|  |  | ||||||
|  |             <com.google.android.material.chip.ChipGroup | ||||||
|  |                 android:id="@+id/tagsGroup" | ||||||
|  |                 android:layout_width="match_parent" | ||||||
|  |                 android:layout_height="wrap_content" | ||||||
|  |                 android:layout_marginStart="16dp" | ||||||
|  |                 android:layout_marginTop="24dp" | ||||||
|  |                 app:layout_constraintStart_toStartOf="parent" | ||||||
|  |                 app:layout_constraintTop_toBottomOf="@+id/filterTagsTitle" | ||||||
|  |                 app:singleSelection="true"> | ||||||
|  |  | ||||||
|  |             </com.google.android.material.chip.ChipGroup> | ||||||
|  |  | ||||||
|  |             <com.google.android.material.chip.ChipGroup | ||||||
|  |                 android:id="@+id/sourcesGroup" | ||||||
|  |                 android:layout_width="match_parent" | ||||||
|  |                 android:layout_height="wrap_content" | ||||||
|  |                 android:layout_marginStart="16dp" | ||||||
|  |                 android:layout_marginTop="24dp" | ||||||
|  |                 app:layout_constraintStart_toStartOf="parent" | ||||||
|  |                 app:layout_constraintTop_toBottomOf="@+id/filterSourcesTitle"> | ||||||
|  |  | ||||||
|  |             </com.google.android.material.chip.ChipGroup> | ||||||
|  |  | ||||||
|  |  | ||||||
|  |             <com.google.android.material.floatingactionbutton.FloatingActionButton | ||||||
|  |                 android:id="@+id/floatingActionButton2" | ||||||
|  |                 android:layout_width="wrap_content" | ||||||
|  |                 android:layout_height="wrap_content" | ||||||
|  |                 android:layout_marginEnd="16dp" | ||||||
|  |  | ||||||
|  |                 android:layout_marginTop="8dp" | ||||||
|  |                 android:clickable="true" | ||||||
|  |                 app:backgroundTint="@color/colorAccent" | ||||||
|  |                 app:layout_constraintEnd_toEndOf="parent" | ||||||
|  |                 app:layout_constraintTop_toTopOf="parent" | ||||||
|  |                 app:rippleColor="@color/colorAccentDark" | ||||||
|  |                 app:srcCompat="@drawable/ic_menu_search_white_24dp" /> | ||||||
|  |  | ||||||
|  |         </androidx.constraintlayout.widget.ConstraintLayout> | ||||||
|  |     </androidx.core.widget.NestedScrollView> | ||||||
|  |  | ||||||
|  | </androidx.constraintlayout.widget.ConstraintLayout> | ||||||
| @@ -66,7 +66,7 @@ | |||||||
|                 android:layout_marginRight="16dp" |                 android:layout_marginRight="16dp" | ||||||
|                 android:layout_marginTop="24dp" |                 android:layout_marginTop="24dp" | ||||||
|                 android:paddingBottom="48dp" |                 android:paddingBottom="48dp" | ||||||
|                 android:background="?android:colorBackground" |                 android:background="?attr/webviewBackground" | ||||||
|                 app:layout_constraintHorizontal_bias="0.0" |                 app:layout_constraintHorizontal_bias="0.0" | ||||||
|                 app:layout_constraintLeft_toLeftOf="parent" |                 app:layout_constraintLeft_toLeftOf="parent" | ||||||
|                 app:layout_constraintRight_toRightOf="parent" |                 app:layout_constraintRight_toRightOf="parent" | ||||||
|   | |||||||
| @@ -1,16 +1,16 @@ | |||||||
| <?xml version="1.0" encoding="utf-8"?> | <?xml version="1.0" encoding="utf-8"?> | ||||||
| <androidx.coordinatorlayout.widget.CoordinatorLayout xmlns:android="http://schemas.android.com/apk/res/android" | <androidx.constraintlayout.widget.ConstraintLayout xmlns:android="http://schemas.android.com/apk/res/android" | ||||||
|     xmlns:app="http://schemas.android.com/apk/res-auto" |     xmlns:app="http://schemas.android.com/apk/res-auto" | ||||||
|     android:layout_width="match_parent" |     android:layout_width="match_parent" | ||||||
|     android:layout_height="match_parent"> |     android:layout_height="match_parent"> | ||||||
|  |  | ||||||
|     <com.github.chrisbanes.photoview.PhotoView |         <com.github.chrisbanes.photoview.PhotoView | ||||||
|         android:id="@+id/photoView" |             android:id="@+id/photoView" | ||||||
|         android:layout_width="match_parent" |             android:layout_width="match_parent" | ||||||
|         android:layout_height="match_parent" |             android:layout_height="match_parent" | ||||||
|         android:layout_centerVertical="true" |             android:layout_centerVertical="true" | ||||||
|         android:layout_centerHorizontal="true" |             android:adjustViewBounds="true" | ||||||
|         android:background="@android:color/black" |             android:background="@drawable/checkerboard" | ||||||
|         app:srcCompat="@android:drawable/screen_background_dark" /> |             app:srcCompat="@android:drawable/screen_background_dark" /> | ||||||
|  |  | ||||||
| </androidx.coordinatorlayout.widget.CoordinatorLayout> | </androidx.constraintlayout.widget.ConstraintLayout> | ||||||
| @@ -3,18 +3,40 @@ | |||||||
|     xmlns:app="http://schemas.android.com/apk/res-auto" |     xmlns:app="http://schemas.android.com/apk/res-auto" | ||||||
|     xmlns:tools="http://schemas.android.com/tools" |     xmlns:tools="http://schemas.android.com/tools" | ||||||
|     android:layout_width="match_parent" |     android:layout_width="match_parent" | ||||||
|     android:layout_height="48dp" |     android:layout_height="wrap_content" | ||||||
|     android:orientation="vertical"> |     android:orientation="vertical"> | ||||||
|  |  | ||||||
|  |  | ||||||
|  |     <Button | ||||||
|  |         android:id="@+id/deleteBtn" | ||||||
|  |         style="@style/Widget.AppCompat.Button.Borderless" | ||||||
|  |         android:layout_width="48dp" | ||||||
|  |         android:layout_height="wrap_content" | ||||||
|  |         android:layout_marginBottom="8dp" | ||||||
|  |         android:layout_marginEnd="8dp" | ||||||
|  |         android:layout_marginTop="8dp" | ||||||
|  |         android:background="@drawable/ic_remove_circle_outline_black_24dp" | ||||||
|  |         android:backgroundTint="?android:textColorSecondary" | ||||||
|  |         android:contentDescription="@string/remove_source" | ||||||
|  |         android:elevation="4dp" | ||||||
|  |         app:iconSize="34dp" | ||||||
|  |         app:layout_constraintBottom_toBottomOf="parent" | ||||||
|  |         app:layout_constraintEnd_toEndOf="parent" | ||||||
|  |         app:layout_constraintTop_toTopOf="parent" | ||||||
|  |         app:layout_constraintVertical_bias="0.0" /> | ||||||
|  |  | ||||||
|     <ImageView |     <ImageView | ||||||
|         android:id="@+id/itemImage" |         android:id="@+id/itemImage" | ||||||
|         android:layout_width="36dp" |         android:layout_width="36dp" | ||||||
|         android:layout_height="36dp" |         android:layout_height="36dp" | ||||||
|  |         android:layout_marginBottom="8dp" | ||||||
|  |         android:layout_marginLeft="8dp" | ||||||
|  |         android:layout_marginTop="8dp" | ||||||
|         android:importantForAccessibility="no" |         android:importantForAccessibility="no" | ||||||
|         app:layout_constraintBottom_toBottomOf="parent" |         app:layout_constraintBottom_toBottomOf="parent" | ||||||
|         app:layout_constraintLeft_toLeftOf="parent" |         app:layout_constraintLeft_toLeftOf="parent" | ||||||
|         app:layout_constraintTop_toTopOf="parent" /> |         app:layout_constraintTop_toTopOf="parent" | ||||||
|  |         app:layout_constraintVertical_bias="0.0" /> | ||||||
|  |  | ||||||
|     <TextView |     <TextView | ||||||
|         android:id="@+id/sourceTitle" |         android:id="@+id/sourceTitle" | ||||||
| @@ -25,26 +47,30 @@ | |||||||
|         android:gravity="start" |         android:gravity="start" | ||||||
|         android:maxLines="1" |         android:maxLines="1" | ||||||
|         android:textAlignment="textStart" |         android:textAlignment="textStart" | ||||||
|         android:textSize="13sp" |  | ||||||
|         android:textColor="?android:textColorPrimary" |         android:textColor="?android:textColorPrimary" | ||||||
|         app:layout_constraintBottom_toBottomOf="parent" |         android:textSize="13sp" | ||||||
|  |         app:layout_constraintBottom_toTopOf="@+id/errorText" | ||||||
|         app:layout_constraintEnd_toStartOf="@+id/deleteBtn" |         app:layout_constraintEnd_toStartOf="@+id/deleteBtn" | ||||||
|         app:layout_constraintStart_toEndOf="@+id/itemImage" |         app:layout_constraintStart_toEndOf="@+id/itemImage" | ||||||
|         app:layout_constraintTop_toTopOf="parent" |         app:layout_constraintTop_toTopOf="parent" | ||||||
|         tools:text="source title" /> |         tools:text="source title" /> | ||||||
|  |  | ||||||
|     <Button |     <TextView | ||||||
|         android:id="@+id/deleteBtn" |         android:id="@+id/errorText" | ||||||
|         style="@style/Widget.AppCompat.Button.Borderless" |         android:layout_width="0dp" | ||||||
|         android:layout_width="34dp" |         android:layout_height="wrap_content" | ||||||
|         android:layout_height="34dp" |         android:layout_marginBottom="8dp" | ||||||
|         android:layout_marginEnd="8dp" |         android:layout_marginEnd="16dp" | ||||||
|         android:background="@drawable/ic_remove_circle_outline_black_24dp" |         android:layout_marginStart="16dp" | ||||||
|         android:backgroundTint="?android:textColorSecondary" |         android:layout_marginTop="8dp" | ||||||
|         android:elevation="4dp" |         android:textAppearance="@style/TextAppearance.AppCompat.Small" | ||||||
|         android:contentDescription="@string/remove_source" |         android:textColor="@color/red" | ||||||
|  |         android:visibility="gone" | ||||||
|         app:layout_constraintBottom_toBottomOf="parent" |         app:layout_constraintBottom_toBottomOf="parent" | ||||||
|         app:layout_constraintEnd_toEndOf="parent" |         app:layout_constraintEnd_toEndOf="parent" | ||||||
|         app:layout_constraintTop_toTopOf="parent" /> |         app:layout_constraintStart_toStartOf="parent" | ||||||
|  |         app:layout_constraintTop_toBottomOf="@+id/itemImage" | ||||||
|  |         tools:text="Test" | ||||||
|  |         tools:visibility="visible" /> | ||||||
|  |  | ||||||
| </androidx.constraintlayout.widget.ConstraintLayout> | </androidx.constraintlayout.widget.ConstraintLayout> | ||||||
| @@ -8,16 +8,32 @@ | |||||||
|         app:showAsAction="ifRoom|collapseActionView" |         app:showAsAction="ifRoom|collapseActionView" | ||||||
|         app:actionViewClass="androidx.appcompat.widget.SearchView" /> |         app:actionViewClass="androidx.appcompat.widget.SearchView" /> | ||||||
|  |  | ||||||
|  |     <item android:id="@+id/action_filter" | ||||||
|  |         android:title="@string/menu_home_filter" | ||||||
|  |         android:icon="@drawable/ic_baseline_filter_alt_24" | ||||||
|  |         android:orderInCategory="1" | ||||||
|  |         app:showAsAction="always" /> | ||||||
|  |  | ||||||
|     <item android:id="@+id/readAll" |     <item android:id="@+id/readAll" | ||||||
|           android:icon="@drawable/ic_menu_done_all_white_24dp" |           android:icon="@drawable/ic_menu_done_all_white_24dp" | ||||||
|           android:title="@string/readAll" |           android:title="@string/readAll" | ||||||
|           android:orderInCategory="1" |           android:orderInCategory="2" | ||||||
|           app:showAsAction="always"/> |           app:showAsAction="ifRoom"/> | ||||||
|  |  | ||||||
|  |     <item android:id="@+id/action_sources" | ||||||
|  |         android:title="@string/menu_home_sources" | ||||||
|  |         android:orderInCategory="97" | ||||||
|  |         app:showAsAction="never"/> | ||||||
|  |  | ||||||
|  |     <item android:id="@+id/action_settings" | ||||||
|  |         android:title="@string/title_activity_settings" | ||||||
|  |         android:orderInCategory="98" | ||||||
|  |         app:showAsAction="never"/> | ||||||
|  |  | ||||||
|     <item |     <item | ||||||
|         android:id="@+id/refresh" |         android:id="@+id/refresh" | ||||||
|         android:icon="@drawable/ic_menu_refresh_white_24dp" |         app:showAsAction="never" | ||||||
|         android:orderInCategory="99" |         android:orderInCategory="101" | ||||||
|         android:title="@string/menu_home_refresh" /> |         android:title="@string/menu_home_refresh" /> | ||||||
|  |  | ||||||
|     <item android:id="@+id/action_disconnect" |     <item android:id="@+id/action_disconnect" | ||||||
|   | |||||||
| @@ -8,12 +8,6 @@ | |||||||
|         android:title="@string/unmark" |         android:title="@string/unmark" | ||||||
|         app:showAsAction="ifRoom" /> |         app:showAsAction="ifRoom" /> | ||||||
|  |  | ||||||
|     <item |  | ||||||
|         android:id="@+id/more_action" |  | ||||||
|         android:icon="@drawable/ic_chrome_reader_mode_white_24dp" |  | ||||||
|         android:title="@string/reader_action_more" |  | ||||||
|         app:showAsAction="ifRoom" /> |  | ||||||
|  |  | ||||||
|     <item |     <item | ||||||
|         android:id="@+id/open_action" |         android:id="@+id/open_action" | ||||||
|         android:icon="@drawable/ic_open_in_browser_white_24dp" |         android:icon="@drawable/ic_open_in_browser_white_24dp" | ||||||
|   | |||||||
| @@ -1,10 +0,0 @@ | |||||||
| <?xml version="1.0" encoding="utf-8"?> |  | ||||||
| <menu xmlns:app="http://schemas.android.com/apk/res-auto" |  | ||||||
|     xmlns:android="http://schemas.android.com/apk/res/android"> |  | ||||||
|  |  | ||||||
|     <item |  | ||||||
|         android:id="@+id/clear" |  | ||||||
|         android:icon="@drawable/ic_history_white_24dp" |  | ||||||
|         android:title="@string/drawer_action_clear" |  | ||||||
|         app:showAsAction="ifRoom" /> |  | ||||||
| </menu> |  | ||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Lector per a Selfoss"</string> |     <string name="app_name">"Lector per a Selfoss"</string> | ||||||
|     <string name="title_activity_login">"Inicia la sessió"</string> |     <string name="title_activity_login">"Inicia la sessió"</string> | ||||||
|     <string name="prompt_password">"Contrasenya"</string> |     <string name="prompt_password">"Contrasenya"</string> | ||||||
|     <string name="prompt_http_password">"Contrasenya HTTP"</string> |  | ||||||
|     <string name="action_sign_in">"Vés-hi"</string> |     <string name="action_sign_in">"Vés-hi"</string> | ||||||
|     <string name="error_invalid_password">"La contrasenya és massa curta"</string> |     <string name="error_invalid_password">"La contrasenya és massa curta"</string> | ||||||
|     <string name="error_field_required">"Camp necessari"</string> |     <string name="error_field_required">"Camp necessari"</string> | ||||||
|     <string name="prompt_url">"URL"</string> |     <string name="prompt_url">"URL"</string> | ||||||
|     <string name="withLoginSwitch">"Autenticació (si és necessària)"</string> |     <string name="withLoginSwitch">"Autenticació (si és necessària)"</string> | ||||||
|     <string name="withHttpLoginSwitch">"Autenticació HTTP (si és necessària)"</string> |  | ||||||
|     <string name="login_url_problem">"Pot ser que falti una \"/\" al final de l'url."</string> |     <string name="login_url_problem">"Pot ser que falti una \"/\" al final de l'url."</string> | ||||||
|     <string name="prompt_login">"Nom d'usuari"</string> |     <string name="prompt_login">"Nom d'usuari"</string> | ||||||
|     <string name="prompt_http_login">"Nom d'usuari HTTP"</string> |  | ||||||
|     <string name="label_share">"Comparteix"</string> |  | ||||||
|     <string name="readAll">"Llegeix-ho tot"</string> |     <string name="readAll">"Llegeix-ho tot"</string> | ||||||
|     <string name="action_disconnect">"Desconnecta't"</string> |     <string name="action_disconnect">"Desconnecta't"</string> | ||||||
|     <string name="title_activity_settings">"Configuració"</string> |     <string name="title_activity_settings">"Configuració"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Torneu a comprovar la informació."</string> |     <string name="wrong_infos">"Torneu a comprovar la informació."</string> | ||||||
|     <string name="all_posts_not_read">"No s'han llegit totes les publicacions"</string> |     <string name="all_posts_not_read">"No s'han llegit totes les publicacions"</string> | ||||||
|     <string name="all_posts_read">"S'han llegit totes les publicacions"</string> |     <string name="all_posts_read">"S'han llegit totes les publicacions"</string> | ||||||
|     <string name="cant_get_favs">"No es poden obtenir preferits"</string> |  | ||||||
|     <string name="cant_get_new_elements">"No es pot accedir als articles nous"</string> |  | ||||||
|     <string name="cant_get_read">"No es poden llegir els articles"</string> |  | ||||||
|     <string name="nothing_here">"No hi ha res"</string> |     <string name="nothing_here">"No hi ha res"</string> | ||||||
|     <string name="tab_new">"Nou"</string> |     <string name="tab_new">"Nou"</string> | ||||||
|     <string name="tab_read">"Tot"</string> |     <string name="tab_read">"Tot"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"Informa d'un error o pregunta sobre funcions noves"</string> |     <string name="issue_tracker_summary">"Informa d'un error o pregunta sobre funcions noves"</string> | ||||||
|     <string name="warning_wrong_url">"ADVERTÈNCIA"</string> |     <string name="warning_wrong_url">"ADVERTÈNCIA"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Visualització de targeta"</string> |     <string name="pref_switch_card_view_title">"Visualització de targeta"</string> | ||||||
|     <string name="cant_mark_favortie">"No es pot marcar l'article com a preferit"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"No es pot treure l'element de preferits"</string> |  | ||||||
|     <string name="share">"Comparteix"</string> |     <string name="share">"Comparteix"</string> | ||||||
|     <string name="rating_prompt_title">"Us agrada l'aplicació?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"Sí."</string> |  | ||||||
|     <string name="rating_prompt_no">"No gaire…"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"Ens podeu dir per què?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"D'acord."</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Ara no."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Perfecte! Ens podeu puntuar a la Botiga?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"Sí."</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Ara no."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Gràcies. La vostra opinió ens ajuda a millorar l'aplicació."</string> |  | ||||||
|     <string name="switch_unread_count">"Mostra el recompte d'articles no llegits amb un distintiu a la barra inferior."</string> |     <string name="switch_unread_count">"Mostra el recompte d'articles no llegits amb un distintiu a la barra inferior."</string> | ||||||
|     <string name="switch_unread_count_title">"Recompte d'articles no llegits"</string> |     <string name="switch_unread_count_title">"Recompte d'articles no llegits"</string> | ||||||
|     <string name="display_all_counts_title">"Recompte d'articles llegits i preferits"</string> |     <string name="display_all_counts_title">"Recompte d'articles llegits i preferits"</string> | ||||||
|     <string name="text_wrong_url">"Sembla que esteu utilitzant un URL no vàlid. Assegureu-vos que és correcte, i si el problema persisteix, poseu-vos en contacte amb mi (a través de l'enllaç de contacte que hi ha a la Botiga). Tingueu en compte que per utilitzar aquesta aplicació cal que també utilitzeu Selfoss. Si no, no podreu accedir a canals RSS."</string> |     <string name="text_wrong_url">"Sembla que esteu utilitzant un URL no vàlid. Assegureu-vos que és correcte, i si el problema persisteix, poseu-vos en contacte amb mi (a través de l'enllaç de contacte que hi ha a la Botiga). Tingueu en compte que per utilitzar aquesta aplicació cal que també utilitzeu Selfoss. Si no, no podreu accedir a canals RSS."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Obre els enllaços dins de l'aplicació"</string> |     <string name="pref_article_viewer_title">"Obre els enllaços dins de l'aplicació"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Els articles s'obriran dins de l'aplicació"</string> |     <string name="pref_article_viewer_on">"Els articles s'obriran dins de l'aplicació"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Els articles s'obriran amb el navegador predeterminat"</string> |     <string name="pref_article_viewer_off">"Els articles s'obriran amb el navegador predeterminat"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Obre el visualitzador d'articles"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"S'obrirà el visualitzador d'articles en lloc del navegador intern"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"S'obrirà el navegador intern en lloc del visualitzador d'articles"</string> |  | ||||||
|     <string name="pref_general_category_links">"Gestió d'enllaços"</string> |     <string name="pref_general_category_links">"Gestió d'enllaços"</string> | ||||||
|     <string name="pref_general_category_displaying">"Visualització"</string> |     <string name="pref_general_category_displaying">"Visualització"</string> | ||||||
|     <string name="pref_switch_card_view_on">"Els articles es mostraran com a targetes"</string> |     <string name="pref_switch_card_view_on">"Els articles es mostraran com a targetes"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">L\'alçada de les targetes s\'ajustarà al seu contingut</string> |     <string name="card_height_on">L\'alçada de les targetes s\'ajustarà al seu contingut</string> | ||||||
|     <string name="card_height_off">L\'alçada de les targetes serà fixa</string> |     <string name="card_height_off">L\'alçada de les targetes serà fixa</string> | ||||||
|     <string name="source_code">Codi font</string> |     <string name="source_code">Codi font</string> | ||||||
|     <string name="cant_mark_read">No es pot marcar l\'article com a llegit</string> |     <string name="filter_item_tags">Etiquetes</string> | ||||||
|     <string name="cant_mark_unread">Can\'t mark article as unread</string> |     <string name="filter_item_sources">Fonts</string> | ||||||
|     <string name="drawer_error_loading_tags">S\'ha produït un error en carregar les etiquetes</string> |  | ||||||
|     <string name="drawer_error_loading_sources">S\'ha produït un error en carregar les fonts</string> |  | ||||||
|     <string name="drawer_item_filters">Filtres</string> |  | ||||||
|     <string name="drawer_action_clear">Esborra</string> |  | ||||||
|     <string name="drawer_item_tags">Etiquetes</string> |  | ||||||
|     <string name="drawer_item_sources">Fonts</string> |  | ||||||
|     <string name="drawer_action_edit">Edita</string> |  | ||||||
|     <string name="no_tags_loaded">No s\'ha carregat cap etiqueta</string> |  | ||||||
|     <string name="no_sources_loaded">No s\'ha carregat cap font</string> |  | ||||||
|     <string name="drawer_loading">S\'està carregant…</string> |  | ||||||
|     <string name="menu_home_search">Cerca</string> |     <string name="menu_home_search">Cerca</string> | ||||||
|     <string name="can_delete_source">No es pot suprimir la font</string> |     <string name="can_delete_source">No es pot suprimir la font</string> | ||||||
|     <string name="base_url_error">S\'ha produït un error en comunicar-se amb la instància de Selfoss. Si el problema persisteix, posa\'t en contacte amb mi.</string> |     <string name="base_url_error">S\'ha produït un error en comunicar-se amb la instància de Selfoss. Si el problema persisteix, posa\'t en contacte amb mi.</string> | ||||||
|     <string name="pref_header_theme">Temes</string> |     <string name="pref_header_theme">Temes</string> | ||||||
|     <string name="default_theme">Predeterminat</string> |  | ||||||
|     <string name="default_dark_theme">Predeterminat/Fosc</string> |  | ||||||
|     <string name="pref_header_debug">Depuració</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Utilitzeu un certificat autoallotjat?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Per raons de seguretat, els certificats autosignats no seran compatibles per defecte. En activar aquesta opció, sereu responsable de qualsevol problema de seguretat que es pugui produir.</string> |  | ||||||
|     <string name="pref_selfoss_category">API de Selfoss</string> |     <string name="pref_selfoss_category">API de Selfoss</string> | ||||||
|     <string name="pref_api_items_number_title">Nombre d\'elements carregats</string> |     <string name="pref_api_items_number_title">Nombre d\'elements carregats</string> | ||||||
|     <string name="pref_hidden_tags">Etiquetes ocultes</string> |  | ||||||
|     <string name="summary_debug_identifier">Identificador de depuració</string> |  | ||||||
|     <string name="unique_id_to_clipboard">S\'ha copiat l\'identificador al porta-retalls</string> |  | ||||||
|     <string name="display_header_drawer_summary">Mostra una capçalera amb la instància URL de Selfoss al panell lateral.</string> |  | ||||||
|     <string name="display_header_drawer_title">Capçalera de menú</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Carrega articles en desplaçar</string> |     <string name="pref_general_infinite_loading_title">Carrega articles en desplaçar</string> | ||||||
|     <string name="translation">Traducció</string> |     <string name="translation">Traducció</string> | ||||||
|     <string name="cant_open_invalid_url">L\'element URL no és vàlid. Estic intentant solucionar aquest problema perquè l\'aplicació no falli.</string> |     <string name="cant_open_invalid_url">L\'element URL no és vàlid. Estic intentant solucionar aquest problema perquè l\'aplicació no falli.</string> | ||||||
|     <string name="drawer_report_bug">Informa d\'un error</string> |  | ||||||
|     <string name="items_number_should_be_number">El nombre d\'elements ha de ser enter.</string> |     <string name="items_number_should_be_number">El nombre d\'elements ha de ser enter.</string> | ||||||
|     <string name="reader_action_more">Més informació</string> |  | ||||||
|     <string name="reader_action_open">Obre al navegador</string> |     <string name="reader_action_open">Obre al navegador</string> | ||||||
|     <string name="reader_action_share">Comparteix</string> |     <string name="reader_action_share">Comparteix</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Es marcaran els articles com a llegits en lliscar el dit d\'un article a l\'altre.</string> |     <string name="pref_switch_actions_pager_scroll_on">Es marcaran els articles com a llegits en lliscar el dit d\'un article a l\'altre.</string> | ||||||
|     <string name="add_to_favs_reader">Afegeix als preferits</string> |     <string name="add_to_favs_reader">Afegeix als preferits</string> | ||||||
|     <string name="remove_to_favs_reader">Suprimeix dels preferits</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Mida de la lletra del lector d’articles</string> |     <string name="pref_content_reader_font_size">Mida de la lletra del lector d’articles</string> | ||||||
|     <string name="pref_header_viewer">Visualitzador d\'articles</string> |     <string name="pref_header_viewer">Visualitzador d\'articles</string> | ||||||
|     <string name="refresh_dialog_message">Aquesta acció actualitzarà la vostra instància de Selfoss.</string> |     <string name="refresh_dialog_message">Aquesta acció actualitzarà la vostra instància de Selfoss.</string> | ||||||
|     <string name="markall_dialog_message">Aquesta acció marcarà els elements com a llegits.</string> |     <string name="markall_dialog_message">Aquesta acció marcarà els elements com a llegits.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Marca com a llegit en lliscar el dit</string> |     <string name="pref_switch_actions_pager_scroll">Marca com a llegit en lliscar el dit</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">No es marcaran els articles com a llegits en lliscar el dit d\'un article a l\'altre.</string> |     <string name="pref_switch_actions_pager_scroll_off">No es marcaran els articles com a llegits en lliscar el dit d\'un article a l\'altre.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Envia informes d\'error automàtics</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">S\'enviaran informes d\'error automàticament</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Us preguntarem abans d\'enviar un informe d\'error.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Informes d\'error</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Registre de depuració (s\'enviarà automàticament)</string> |  | ||||||
|     <string name="acra_login">Habilita el registre</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Etiquetes ocultes</string> |  | ||||||
|     <string name="unmark">Marca com no llegit</string> |     <string name="unmark">Marca com no llegit</string> | ||||||
|     <string name="pref_header_offline">Sense connexió i memòria clau</string> |     <string name="pref_header_offline">Sense connexió i memòria clau</string> | ||||||
|     <string name="pref_switch_items_caching_off">Els articles no es guardaran a la memòria del dispositiu i l\'aplicació no es podrà utilitzar sense connexió.</string> |     <string name="pref_switch_items_caching_off">Els articles no es guardaran a la memòria del dispositiu i l\'aplicació no es podrà utilitzar sense connexió.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Guarda els elements per utilitzar-los sense connexió</string> |     <string name="pref_switch_items_caching">Guarda els elements per utilitzar-los sense connexió</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Sense connexió!</string> |  | ||||||
|     <string name="network_connectivity_lost">"Network connection lost"</string> |     <string name="network_connectivity_lost">"Network connection lost"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Network connection is now available"</string> |     <string name="network_connectivity_retrieved">"Network connection is now available"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sincronitza els articles</string> |     <string name="pref_switch_periodic_refresh">Sincronitza els articles</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Els articles se sincronitzaran periòdicament</string> |     <string name="pref_switch_periodic_refresh_on">Els articles se sincronitzaran periòdicament</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Interval de sincronització ( >= 15 minuts)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Interval de sincronització ( >= 15 minuts)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Sincronitza només quan el telèfon s\'està carregant</string> |     <string name="pref_switch_refresh_when_charging">Sincronitza només quan el telèfon s\'està carregant</string> | ||||||
|     <string name="loading_notification_title">S\'està carregant...</string> |     <string name="loading_notification_title">S\'està carregant…</string> | ||||||
|     <string name="loading_notification_text">Selfoss està sincronitzant els articles</string> |     <string name="loading_notification_text">Selfoss està sincronitzant els articles</string> | ||||||
|     <string name="notification_channel_sync">Notificació de sincronització</string> |     <string name="notification_channel_sync">Notificació de sincronització</string> | ||||||
|     <string name="new_items_channel_sync">Notificació d\'elements nous</string> |     <string name="new_items_channel_sync">Notificació d\'elements nous</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Reader für selfoss"</string> |     <string name="app_name">"Reader für selfoss"</string> | ||||||
|     <string name="title_activity_login">"Anmelden"</string> |     <string name="title_activity_login">"Anmelden"</string> | ||||||
|     <string name="prompt_password">"Passwort"</string> |     <string name="prompt_password">"Passwort"</string> | ||||||
|     <string name="prompt_http_password">"HTTP Passwort"</string> |  | ||||||
|     <string name="action_sign_in">"Fortfahren"</string> |     <string name="action_sign_in">"Fortfahren"</string> | ||||||
|     <string name="error_invalid_password">"Passwort ist nicht lang genug"</string> |     <string name="error_invalid_password">"Passwort ist nicht lang genug"</string> | ||||||
|     <string name="error_field_required">"Pflichtfeld"</string> |     <string name="error_field_required">"Pflichtfeld"</string> | ||||||
|     <string name="prompt_url">"URL"</string> |     <string name="prompt_url">"URL"</string> | ||||||
|     <string name="withLoginSwitch">"Anmeldung erforderlich?"</string> |     <string name="withLoginSwitch">"Anmeldung erforderlich?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"HTTP Anmeldung erforderlich?"</string> |  | ||||||
|     <string name="login_url_problem">"Ups. Du musst eventuell ein \"/\" am Ende der URL anhängen."</string> |     <string name="login_url_problem">"Ups. Du musst eventuell ein \"/\" am Ende der URL anhängen."</string> | ||||||
|     <string name="prompt_login">"Benutzername"</string> |     <string name="prompt_login">"Benutzername"</string> | ||||||
|     <string name="prompt_http_login">"HTTP Benutzername"</string> |  | ||||||
|     <string name="label_share">"Teilen"</string> |  | ||||||
|     <string name="readAll">"Alle gelesen"</string> |     <string name="readAll">"Alle gelesen"</string> | ||||||
|     <string name="action_disconnect">"Verbindung trennen"</string> |     <string name="action_disconnect">"Verbindung trennen"</string> | ||||||
|     <string name="title_activity_settings">"Einstellungen"</string> |     <string name="title_activity_settings">"Einstellungen"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Überprüfe deine Angaben noch einmal."</string> |     <string name="wrong_infos">"Überprüfe deine Angaben noch einmal."</string> | ||||||
|     <string name="all_posts_not_read">"Nicht alle Beiträge wurden gelesen"</string> |     <string name="all_posts_not_read">"Nicht alle Beiträge wurden gelesen"</string> | ||||||
|     <string name="all_posts_read">"Alle Beiträge wurden gelesen"</string> |     <string name="all_posts_read">"Alle Beiträge wurden gelesen"</string> | ||||||
|     <string name="cant_get_favs">"Favoriten können nicht abgerufen werden"</string> |  | ||||||
|     <string name="cant_get_new_elements">"Neue Artikel können nicht abgerufen werden"</string> |  | ||||||
|     <string name="cant_get_read">"Gelese Artikel können nicht abgerufen werden"</string> |  | ||||||
|     <string name="nothing_here">"Keine Einträge vorhanden"</string> |     <string name="nothing_here">"Keine Einträge vorhanden"</string> | ||||||
|     <string name="tab_new">"Neu"</string> |     <string name="tab_new">"Neu"</string> | ||||||
|     <string name="tab_read">"Alle"</string> |     <string name="tab_read">"Alle"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"Melde einen Bug oder rege ein neues Feature an"</string> |     <string name="issue_tracker_summary">"Melde einen Bug oder rege ein neues Feature an"</string> | ||||||
|     <string name="warning_wrong_url">"WARNUNG"</string> |     <string name="warning_wrong_url">"WARNUNG"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Kachelansicht"</string> |     <string name="pref_switch_card_view_title">"Kachelansicht"</string> | ||||||
|     <string name="cant_mark_favortie">"Artikel kann nicht als Favorit markiert werden"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"Eintrag kann nicht aus Favoriten entfernt werden"</string> |  | ||||||
|     <string name="share">"Teilen"</string> |     <string name="share">"Teilen"</string> | ||||||
|     <string name="rating_prompt_title">"Gefällt Dir die App?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"Ja!"</string> |  | ||||||
|     <string name="rating_prompt_no">"Nicht wirklich…"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"Magst du uns sagen warum?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"OK!"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Nicht jetzt."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Wunderbar! Magst du uns im Play Store bewerten?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"Sicher!"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Nicht jetzt."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Vielen Dank, dein Feedback hilft die App zu verbessern!"</string> |  | ||||||
|     <string name="switch_unread_count">"Zeige die Zahl ungelesener Artikel in der unteren Leiste."</string> |     <string name="switch_unread_count">"Zeige die Zahl ungelesener Artikel in der unteren Leiste."</string> | ||||||
|     <string name="switch_unread_count_title">"Zeige Anzahl ungelesener Artikel"</string> |     <string name="switch_unread_count_title">"Zeige Anzahl ungelesener Artikel"</string> | ||||||
|     <string name="display_all_counts_title">"Zeige Anzahl der Favoriten und gelesenen Artikel"</string> |     <string name="display_all_counts_title">"Zeige Anzahl der Favoriten und gelesenen Artikel"</string> | ||||||
|     <string name="text_wrong_url">"Sie scheinen eine ungültige URL verwenden. Stellen Sie sicher, dass die URL richtig ist. Sollte das Problem weiterhin bestehen kontaktieren Sie mich (über den Playstore-Kontakt-Link). Bitte beachten Sie, dass Sie Selfoss benötigen um RSS-Feeds zu lesen."</string> |     <string name="text_wrong_url">"Sie scheinen eine ungültige URL verwenden. Stellen Sie sicher, dass die URL richtig ist. Sollte das Problem weiterhin bestehen kontaktieren Sie mich (über den Playstore-Kontakt-Link). Bitte beachten Sie, dass Sie Selfoss benötigen um RSS-Feeds zu lesen."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Öffne Links innerhalb der App"</string> |     <string name="pref_article_viewer_title">"Öffne Links innerhalb der App"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Artikel werden innerhalb der App geöffnet"</string> |     <string name="pref_article_viewer_on">"Artikel werden innerhalb der App geöffnet"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Artikel werden mit deinem Standard-Browser geöffnet"</string> |     <string name="pref_article_viewer_off">"Artikel werden mit deinem Standard-Browser geöffnet"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Verwenden Sie den Artikel-viewer"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Artikel-Viewer wird anstelle des internen Browser verwendet"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Der internen Browser wird anstelle des Artikel-Viewer verwendet"</string> |  | ||||||
|     <string name="pref_general_category_links">"Umgang mit Links"</string> |     <string name="pref_general_category_links">"Umgang mit Links"</string> | ||||||
|     <string name="pref_general_category_displaying">"Ansicht"</string> |     <string name="pref_general_category_displaying">"Ansicht"</string> | ||||||
|     <string name="pref_switch_card_view_on">"Artikel werden als Kacheln angezeigt"</string> |     <string name="pref_switch_card_view_on">"Artikel werden als Kacheln angezeigt"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">Kartenhöhe passt sich Inhalt an</string> |     <string name="card_height_on">Kartenhöhe passt sich Inhalt an</string> | ||||||
|     <string name="card_height_off">Kartenhöhe ist fix</string> |     <string name="card_height_off">Kartenhöhe ist fix</string> | ||||||
|     <string name="source_code">Quellcode</string> |     <string name="source_code">Quellcode</string> | ||||||
|     <string name="cant_mark_read">Artikel kann nicht als gelesen markiert werden</string> |     <string name="filter_item_tags">Tags</string> | ||||||
|     <string name="cant_mark_unread">Can\'t mark article as unread</string> |     <string name="filter_item_sources">Quellen</string> | ||||||
|     <string name="drawer_error_loading_tags">Fehler beim Laden der Tags…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Fehler beim Laden der Quellen…</string> |  | ||||||
|     <string name="drawer_item_filters">Filter</string> |  | ||||||
|     <string name="drawer_action_clear">leeren</string> |  | ||||||
|     <string name="drawer_item_tags">Tags</string> |  | ||||||
|     <string name="drawer_item_sources">Quellen</string> |  | ||||||
|     <string name="drawer_action_edit">bearbeiten</string> |  | ||||||
|     <string name="no_tags_loaded">No tags loaded</string> |  | ||||||
|     <string name="no_sources_loaded">Keine Quellen geladen</string> |  | ||||||
|     <string name="drawer_loading">Lade…</string> |  | ||||||
|     <string name="menu_home_search">Suche</string> |     <string name="menu_home_search">Suche</string> | ||||||
|     <string name="can_delete_source">Can\'t delete the source…</string> |     <string name="can_delete_source">Can\'t delete the source…</string> | ||||||
|     <string name="base_url_error">Beim Versuch deine Selfoss-Instanz zu erreichen ist ein Fehler aufgetreten. Solltet dieser Fehler bestehen bleiben, trete bitte mit mir in Kontakt.</string> |     <string name="base_url_error">Beim Versuch deine Selfoss-Instanz zu erreichen ist ein Fehler aufgetreten. Solltet dieser Fehler bestehen bleiben, trete bitte mit mir in Kontakt.</string> | ||||||
|     <string name="pref_header_theme">Designs</string> |     <string name="pref_header_theme">Designs</string> | ||||||
|     <string name="default_theme">Standard</string> |  | ||||||
|     <string name="default_dark_theme">Standard (Dunkel)</string> |  | ||||||
|     <string name="pref_header_debug">Debug</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Verwenden Sie einen selbst gehostetes Zertifikat?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Due to security reasons, self signed certificates are not supported by default. By activating this, I\'ll not be responsible of any security problem you encounter.</string> |  | ||||||
|     <string name="pref_selfoss_category">selfoss API</string> |     <string name="pref_selfoss_category">selfoss API</string> | ||||||
|     <string name="pref_api_items_number_title">Loaded items number</string> |     <string name="pref_api_items_number_title">Loaded items number</string> | ||||||
|     <string name="pref_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="summary_debug_identifier">Debug identifier</string> |  | ||||||
|     <string name="unique_id_to_clipboard">Identifier copied to your clipboard</string> |  | ||||||
|     <string name="display_header_drawer_summary">Display a header with the selfoss instance url on the lateral drawer.</string> |  | ||||||
|     <string name="display_header_drawer_title">Account header</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Load more articles on scroll</string> |     <string name="pref_general_infinite_loading_title">Load more articles on scroll</string> | ||||||
|     <string name="translation">Übersetzung</string> |     <string name="translation">Übersetzung</string> | ||||||
|     <string name="cant_open_invalid_url">The item url is invalid. I\'m looking into solving this issue so the app won\'t crash.</string> |     <string name="cant_open_invalid_url">The item url is invalid. I\'m looking into solving this issue so the app won\'t crash.</string> | ||||||
|     <string name="drawer_report_bug">Melde einen Fehler</string> |  | ||||||
|     <string name="items_number_should_be_number">The items number should be an integer.</string> |     <string name="items_number_should_be_number">The items number should be an integer.</string> | ||||||
|     <string name="reader_action_more">Read more</string> |  | ||||||
|     <string name="reader_action_open">Im Browser öffnen</string> |     <string name="reader_action_open">Im Browser öffnen</string> | ||||||
|     <string name="reader_action_share">Teilen</string> |     <string name="reader_action_share">Teilen</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> |     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> | ||||||
|     <string name="add_to_favs_reader">Zu Favoriten hinzufügen</string> |     <string name="add_to_favs_reader">Zu Favoriten hinzufügen</string> | ||||||
|     <string name="remove_to_favs_reader">Aus Favoriten entfernen</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Article reader content font size</string> |     <string name="pref_content_reader_font_size">Article reader content font size</string> | ||||||
|     <string name="pref_header_viewer">Article viewer</string> |     <string name="pref_header_viewer">Article viewer</string> | ||||||
|     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> |     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> | ||||||
|     <string name="markall_dialog_message">Dies wird alle Elemente als gelesen markieren.</string> |     <string name="markall_dialog_message">Dies wird alle Elemente als gelesen markieren.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Beim Wischen als gelesen markieren</string> |     <string name="pref_switch_actions_pager_scroll">Beim Wischen als gelesen markieren</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> |     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Automatically send crash reports</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Fehlerberichte werden automatisch gesendet</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Will ask everytime when sending crash reports.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Fehlerberichte</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Debug logging (these will be sent without a dialog)</string> |  | ||||||
|     <string name="acra_login">Protokollierung aktivieren</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="unmark">Eintrag als ungelesen markieren</string> |     <string name="unmark">Eintrag als ungelesen markieren</string> | ||||||
|     <string name="pref_header_offline">Offline and cache</string> |     <string name="pref_header_offline">Offline and cache</string> | ||||||
|     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> |     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Save items for offline use</string> |     <string name="pref_switch_items_caching">Save items for offline use</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Nicht verbunden !</string> |  | ||||||
|     <string name="network_connectivity_lost">"Die Netzwerkverbindung wurde unterbrochen"</string> |     <string name="network_connectivity_lost">"Die Netzwerkverbindung wurde unterbrochen"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Netzwerkverbindung ist jetzt verfügbar"</string> |     <string name="network_connectivity_retrieved">"Netzwerkverbindung ist jetzt verfügbar"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Synchronisiere Artikel</string> |     <string name="pref_switch_periodic_refresh">Synchronisiere Artikel</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Die Artikel werden regelmäßig synchronisiert</string> |     <string name="pref_switch_periodic_refresh_on">Die Artikel werden regelmäßig synchronisiert</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Nur aktualisieren, wenn das Telefon aufgeladen wird</string> |     <string name="pref_switch_refresh_when_charging">Nur aktualisieren, wenn das Telefon aufgeladen wird</string> | ||||||
|     <string name="loading_notification_title">Lädt...</string> |     <string name="loading_notification_title">Lädt…</string> | ||||||
|     <string name="loading_notification_text">Selfoss synchronisiert Ihre Artikel</string> |     <string name="loading_notification_text">Selfoss synchronisiert Ihre Artikel</string> | ||||||
|     <string name="notification_channel_sync">Sync notification</string> |     <string name="notification_channel_sync">Sync notification</string> | ||||||
|     <string name="new_items_channel_sync">New items notification</string> |     <string name="new_items_channel_sync">New items notification</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Lector para Selfoss"</string> |     <string name="app_name">"Lector para Selfoss"</string> | ||||||
|     <string name="title_activity_login">"Iniciar sesión"</string> |     <string name="title_activity_login">"Iniciar sesión"</string> | ||||||
|     <string name="prompt_password">"Contraseña"</string> |     <string name="prompt_password">"Contraseña"</string> | ||||||
|     <string name="prompt_http_password">"Contraseña HTTP"</string> |  | ||||||
|     <string name="action_sign_in">"Empezar"</string> |     <string name="action_sign_in">"Empezar"</string> | ||||||
|     <string name="error_invalid_password">"La contraseña no es suficientemente larga"</string> |     <string name="error_invalid_password">"La contraseña no es suficientemente larga"</string> | ||||||
|     <string name="error_field_required">"Campo requerido"</string> |     <string name="error_field_required">"Campo requerido"</string> | ||||||
|     <string name="prompt_url">"Url"</string> |     <string name="prompt_url">"Url"</string> | ||||||
|     <string name="withLoginSwitch">"Inicio de sesión requerido ?"</string> |     <string name="withLoginSwitch">"Inicio de sesión requerido ?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"Inicio de sesión HTTP requerido ?"</string> |  | ||||||
|     <string name="login_url_problem">"Oops. Puede que necesite añadir un \"/\" al final de la url."</string> |     <string name="login_url_problem">"Oops. Puede que necesite añadir un \"/\" al final de la url."</string> | ||||||
|     <string name="prompt_login">"Nombre de usuario"</string> |     <string name="prompt_login">"Nombre de usuario"</string> | ||||||
|     <string name="prompt_http_login">"Nombre de usuario HTTP"</string> |  | ||||||
|     <string name="label_share">"Compartir"</string> |  | ||||||
|     <string name="readAll">"Leer todo"</string> |     <string name="readAll">"Leer todo"</string> | ||||||
|     <string name="action_disconnect">"Desconectar"</string> |     <string name="action_disconnect">"Desconectar"</string> | ||||||
|     <string name="title_activity_settings">"Configuración"</string> |     <string name="title_activity_settings">"Configuración"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Revise sus datos de nuevo."</string> |     <string name="wrong_infos">"Revise sus datos de nuevo."</string> | ||||||
|     <string name="all_posts_not_read">"No todas las publicaciones fueron leídas"</string> |     <string name="all_posts_not_read">"No todas las publicaciones fueron leídas"</string> | ||||||
|     <string name="all_posts_read">"Todas las publicaciones fueron leídas"</string> |     <string name="all_posts_read">"Todas las publicaciones fueron leídas"</string> | ||||||
|     <string name="cant_get_favs">"No se pueden obtener favoritos"</string> |  | ||||||
|     <string name="cant_get_new_elements">"No puede recibir nuevos artículos"</string> |  | ||||||
|     <string name="cant_get_read">"No puede recibir artículos leídos"</string> |  | ||||||
|     <string name="nothing_here">"Nada aquí"</string> |     <string name="nothing_here">"Nada aquí"</string> | ||||||
|     <string name="tab_new">"Nuevo"</string> |     <string name="tab_new">"Nuevo"</string> | ||||||
|     <string name="tab_read">"Todo"</string> |     <string name="tab_read">"Todo"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"Reportar un error o solicitar una nueva función"</string> |     <string name="issue_tracker_summary">"Reportar un error o solicitar una nueva función"</string> | ||||||
|     <string name="warning_wrong_url">"ADVERTENCIA"</string> |     <string name="warning_wrong_url">"ADVERTENCIA"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Vista de la tarjeta"</string> |     <string name="pref_switch_card_view_title">"Vista de la tarjeta"</string> | ||||||
|     <string name="cant_mark_favortie">"No puede marcar el artículo como favorito"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"No se puede quitar el artículo de favoritos"</string> |  | ||||||
|     <string name="share">"Compartir"</string> |     <string name="share">"Compartir"</string> | ||||||
|     <string name="rating_prompt_title">"¿Disfrutando la aplicación?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"¡Sí!"</string> |  | ||||||
|     <string name="rating_prompt_no">"La verdad es que no…"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"¿Puede decirnos por qué?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"¡Vale!"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Ahora no."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"¡Excelente! ¿Puede valorarnos en la tienda?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"¡Claro!"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"No en este momento."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"¡Gracias, sus comentarios ayudan a mejorar la aplicación!"</string> |  | ||||||
|     <string name="switch_unread_count">"Mostrar el recuento no leído como una insignia de la barra inferior."</string> |     <string name="switch_unread_count">"Mostrar el recuento no leído como una insignia de la barra inferior."</string> | ||||||
|     <string name="switch_unread_count_title">"Mostrar recuento no leído"</string> |     <string name="switch_unread_count_title">"Mostrar recuento no leído"</string> | ||||||
|     <string name="display_all_counts_title">"Mostrar recuento de favoritos y leídos"</string> |     <string name="display_all_counts_title">"Mostrar recuento de favoritos y leídos"</string> | ||||||
|     <string name="text_wrong_url">"Parece estar tratando de utilizar una dirección URL inválida. Asegúrese de que sea correcta y si el problema persiste, póngase en contacto conmigo (mediante el enlace de contacto de la tienda). Tenga en cuenta que la aplicación necesita utilizar Selfoss. No se puede acceder al contenido RSS sin él."</string> |     <string name="text_wrong_url">"Parece estar tratando de utilizar una dirección URL inválida. Asegúrese de que sea correcta y si el problema persiste, póngase en contacto conmigo (mediante el enlace de contacto de la tienda). Tenga en cuenta que la aplicación necesita utilizar Selfoss. No se puede acceder al contenido RSS sin él."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Abrir enlaces dentro de la aplicación"</string> |     <string name="pref_article_viewer_title">"Abrir enlaces dentro de la aplicación"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Los artículos se abrirán dentro de la aplicación"</string> |     <string name="pref_article_viewer_on">"Los artículos se abrirán dentro de la aplicación"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Los artículos se abrirán con tu navegador predeterminado"</string> |     <string name="pref_article_viewer_off">"Los artículos se abrirán con tu navegador predeterminado"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Utilizar el visor de artículo"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Se usará el visor de artículos en lugar del navegador interno"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Se utilizará el navegador interno en lugar del visor de artículo"</string> |  | ||||||
|     <string name="pref_general_category_links">"Control de enlaces"</string> |     <string name="pref_general_category_links">"Control de enlaces"</string> | ||||||
|     <string name="pref_general_category_displaying">"Mostrando"</string> |     <string name="pref_general_category_displaying">"Mostrando"</string> | ||||||
|     <string name="pref_switch_card_view_on">"Los artículos se mostrarán como tarjetas"</string> |     <string name="pref_switch_card_view_on">"Los artículos se mostrarán como tarjetas"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">Altura de tarjetas se ajustará a su contenido</string> |     <string name="card_height_on">Altura de tarjetas se ajustará a su contenido</string> | ||||||
|     <string name="card_height_off">Se fijará la altura de la tarjeta</string> |     <string name="card_height_off">Se fijará la altura de la tarjeta</string> | ||||||
|     <string name="source_code">Código fuente</string> |     <string name="source_code">Código fuente</string> | ||||||
|     <string name="cant_mark_read">No puede marcar el artículo como leído</string> |     <string name="filter_item_tags">Etiquetas</string> | ||||||
|     <string name="cant_mark_unread">No se puede marcar el artículo como no leído</string> |     <string name="filter_item_sources">Fuentes</string> | ||||||
|     <string name="drawer_error_loading_tags">Error al cargar etiquetas…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Error al cargar fuentes…</string> |  | ||||||
|     <string name="drawer_item_filters">Filtros</string> |  | ||||||
|     <string name="drawer_action_clear">limpiar</string> |  | ||||||
|     <string name="drawer_item_tags">Etiquetas</string> |  | ||||||
|     <string name="drawer_item_sources">Fuentes</string> |  | ||||||
|     <string name="drawer_action_edit">editar</string> |  | ||||||
|     <string name="no_tags_loaded">No hay etiquetas cargadas</string> |  | ||||||
|     <string name="no_sources_loaded">No hay fuentes cargadas</string> |  | ||||||
|     <string name="drawer_loading">Cargando…</string> |  | ||||||
|     <string name="menu_home_search">Buscar</string> |     <string name="menu_home_search">Buscar</string> | ||||||
|     <string name="can_delete_source">No se puede eliminar la fuente…</string> |     <string name="can_delete_source">No se puede eliminar la fuente…</string> | ||||||
|     <string name="base_url_error">Hubo un problema al intentar comunicarse con su instancia de Selfoss. Si el problema persiste, póngase en contacto conmigo.</string> |     <string name="base_url_error">Hubo un problema al intentar comunicarse con su instancia de Selfoss. Si el problema persiste, póngase en contacto conmigo.</string> | ||||||
|     <string name="pref_header_theme">Temas</string> |     <string name="pref_header_theme">Temas</string> | ||||||
|     <string name="default_theme">Predeterminado</string> |  | ||||||
|     <string name="default_dark_theme">Predeterminado/Oscuro</string> |  | ||||||
|     <string name="pref_header_debug">Depurar</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Utilizando un certificado alojado propiamente ?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Por razones de seguridad, los certificados propios no son compatibles por defecto. Activando esto, no seré responsable de cualquier problema de seguridad que encuentre.</string> |  | ||||||
|     <string name="pref_selfoss_category">Api de Selfoss</string> |     <string name="pref_selfoss_category">Api de Selfoss</string> | ||||||
|     <string name="pref_api_items_number_title">Número de artículos cargados</string> |     <string name="pref_api_items_number_title">Número de artículos cargados</string> | ||||||
|     <string name="pref_hidden_tags">Etiquetas ocultas</string> |  | ||||||
|     <string name="summary_debug_identifier">Identificador de depuración</string> |  | ||||||
|     <string name="unique_id_to_clipboard">Identificador copiado a su portapapeles</string> |  | ||||||
|     <string name="display_header_drawer_summary">Mostrar una cabecera con la url de instancia de selfoss en el cajón lateral.</string> |  | ||||||
|     <string name="display_header_drawer_title">Cabecera de cuenta</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Cargar más artículos en desplazamiento</string> |     <string name="pref_general_infinite_loading_title">Cargar más artículos en desplazamiento</string> | ||||||
|     <string name="translation">Traducción</string> |     <string name="translation">Traducción</string> | ||||||
|     <string name="cant_open_invalid_url">La url del elemento no es válida. Estoy buscando resolver este problema para que la aplicación no colapse.</string> |     <string name="cant_open_invalid_url">La url del elemento no es válida. Estoy buscando resolver este problema para que la aplicación no colapse.</string> | ||||||
|     <string name="drawer_report_bug">Reportar un error</string> |  | ||||||
|     <string name="items_number_should_be_number">El número de artículos debe ser un número entero.</string> |     <string name="items_number_should_be_number">El número de artículos debe ser un número entero.</string> | ||||||
|     <string name="reader_action_more">Leer más</string> |  | ||||||
|     <string name="reader_action_open">Abrir en el navegador</string> |     <string name="reader_action_open">Abrir en el navegador</string> | ||||||
|     <string name="reader_action_share">Compartir</string> |     <string name="reader_action_share">Compartir</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Marcar artículos como leidos al desplazarse entre ellos.</string> |     <string name="pref_switch_actions_pager_scroll_on">Marcar artículos como leidos al desplazarse entre ellos.</string> | ||||||
|     <string name="add_to_favs_reader">Añadir a Favoritos</string> |     <string name="add_to_favs_reader">Añadir a Favoritos</string> | ||||||
|     <string name="remove_to_favs_reader">Eliminar de favoritos</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Tamaño de la fuente del lector</string> |     <string name="pref_content_reader_font_size">Tamaño de la fuente del lector</string> | ||||||
|     <string name="pref_header_viewer">Visor de artículos</string> |     <string name="pref_header_viewer">Visor de artículos</string> | ||||||
|     <string name="refresh_dialog_message">Esto actualizará su instancia de Selfoss.</string> |     <string name="refresh_dialog_message">Esto actualizará su instancia de Selfoss.</string> | ||||||
|     <string name="markall_dialog_message">Esto marcará todos los artículos como leídos.</string> |     <string name="markall_dialog_message">Esto marcará todos los artículos como leídos.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Marcar artículos como leídos al deslizar con el dedo hacia los lados</string> |     <string name="pref_switch_actions_pager_scroll">Marcar artículos como leídos al deslizar con el dedo hacia los lados</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">No marcar artículos como leídos al deslizar con el dedo hacia los lados.</string> |     <string name="pref_switch_actions_pager_scroll_off">No marcar artículos como leídos al deslizar con el dedo hacia los lados.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Enviar automáticamente informe de fallos</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Se enviaran automáticamente los informes de fallos</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Le preguntará al enviar informes de fallos.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Informe de fallos</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Registro de depuración (éstos se enviarán sin diálogo)</string> |  | ||||||
|     <string name="acra_login">Habilitar el registro</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Etiquetas ocultas</string> |  | ||||||
|     <string name="unmark">Marcar artículo como no leído</string> |     <string name="unmark">Marcar artículo como no leído</string> | ||||||
|     <string name="pref_header_offline">Sin conexión y caché</string> |     <string name="pref_header_offline">Sin conexión y caché</string> | ||||||
|     <string name="pref_switch_items_caching_off">Los artículos no se guardarán en la memoria del dispositivo y la aplicación no se podrá utilizar sin conexión.</string> |     <string name="pref_switch_items_caching_off">Los artículos no se guardarán en la memoria del dispositivo y la aplicación no se podrá utilizar sin conexión.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Guardar elementos para uso sin conexión</string> |     <string name="pref_switch_items_caching">Guardar elementos para uso sin conexión</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Sin conexión!</string> |  | ||||||
|     <string name="network_connectivity_lost">"Network connection lost"</string> |     <string name="network_connectivity_lost">"Network connection lost"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Network connection is now available"</string> |     <string name="network_connectivity_retrieved">"Network connection is now available"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sincronizar artículos</string> |     <string name="pref_switch_periodic_refresh">Sincronizar artículos</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Los artículos se sincronizarán periódicamente</string> |     <string name="pref_switch_periodic_refresh_on">Los artículos se sincronizarán periódicamente</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Intervalo de sincronización (>= 15 minutos)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Intervalo de sincronización (>= 15 minutos)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Sólo refrescar cuando el teléfono está cargando</string> |     <string name="pref_switch_refresh_when_charging">Sólo refrescar cuando el teléfono está cargando</string> | ||||||
|     <string name="loading_notification_title">Cargando...</string> |     <string name="loading_notification_title">Cargando…</string> | ||||||
|     <string name="loading_notification_text">Selfoss está sincronizando tus artículos</string> |     <string name="loading_notification_text">Selfoss está sincronizando tus artículos</string> | ||||||
|     <string name="notification_channel_sync">Notificación de sincronización</string> |     <string name="notification_channel_sync">Notificación de sincronización</string> | ||||||
|     <string name="new_items_channel_sync">Notificación de elementos nuevos</string> |     <string name="new_items_channel_sync">Notificación de elementos nuevos</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Reader for Selfoss"</string> |     <string name="app_name">"Reader for Selfoss"</string> | ||||||
|     <string name="title_activity_login">"Log in"</string> |     <string name="title_activity_login">"Log in"</string> | ||||||
|     <string name="prompt_password">"Password"</string> |     <string name="prompt_password">"Password"</string> | ||||||
|     <string name="prompt_http_password">"HTTP Password"</string> |  | ||||||
|     <string name="action_sign_in">"Go"</string> |     <string name="action_sign_in">"Go"</string> | ||||||
|     <string name="error_invalid_password">"Password not long enough"</string> |     <string name="error_invalid_password">"Password not long enough"</string> | ||||||
|     <string name="error_field_required">"Field required"</string> |     <string name="error_field_required">"Field required"</string> | ||||||
|     <string name="prompt_url">"Url"</string> |     <string name="prompt_url">"Url"</string> | ||||||
|     <string name="withLoginSwitch">"Login required ?"</string> |     <string name="withLoginSwitch">"Login required ?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"HTTP Login required ?"</string> |  | ||||||
|     <string name="login_url_problem">"Oops. You may need to add a \"/\" at the end of the url."</string> |     <string name="login_url_problem">"Oops. You may need to add a \"/\" at the end of the url."</string> | ||||||
|     <string name="prompt_login">"Username"</string> |     <string name="prompt_login">"Username"</string> | ||||||
|     <string name="prompt_http_login">"HTTP Username"</string> |  | ||||||
|     <string name="label_share">"Share"</string> |  | ||||||
|     <string name="readAll">"Read all"</string> |     <string name="readAll">"Read all"</string> | ||||||
|     <string name="action_disconnect">"Disconnect"</string> |     <string name="action_disconnect">"Disconnect"</string> | ||||||
|     <string name="title_activity_settings">"Settings"</string> |     <string name="title_activity_settings">"Settings"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Check your details again."</string> |     <string name="wrong_infos">"Check your details again."</string> | ||||||
|     <string name="all_posts_not_read">"All posts weren't read"</string> |     <string name="all_posts_not_read">"All posts weren't read"</string> | ||||||
|     <string name="all_posts_read">"All posts were read"</string> |     <string name="all_posts_read">"All posts were read"</string> | ||||||
|     <string name="cant_get_favs">"Can't get favorites"</string> |  | ||||||
|     <string name="cant_get_new_elements">"Can't get new articles"</string> |  | ||||||
|     <string name="cant_get_read">"Can't get read articles"</string> |  | ||||||
|     <string name="nothing_here">"Nothing here"</string> |     <string name="nothing_here">"Nothing here"</string> | ||||||
|     <string name="tab_new">"New"</string> |     <string name="tab_new">"New"</string> | ||||||
|     <string name="tab_read">"All"</string> |     <string name="tab_read">"All"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"Report a bug or ask for a new feature"</string> |     <string name="issue_tracker_summary">"Report a bug or ask for a new feature"</string> | ||||||
|     <string name="warning_wrong_url">"WARNING"</string> |     <string name="warning_wrong_url">"WARNING"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Card View"</string> |     <string name="pref_switch_card_view_title">"Card View"</string> | ||||||
|     <string name="cant_mark_favortie">"Can't mark article as favorite"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"Can't remove item from favorite"</string> |  | ||||||
|     <string name="share">"Share"</string> |     <string name="share">"Share"</string> | ||||||
|     <string name="rating_prompt_title">"Enjoying the app ?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"Yes !"</string> |  | ||||||
|     <string name="rating_prompt_no">"Not really …"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"Can you tell us why ?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"OK !"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Not now."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Great ! Can you rate us on the Store ?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"Sure !"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Not right now."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Thanks, your feedback help enhance the app !"</string> |  | ||||||
|     <string name="switch_unread_count">"Display the unread count as a badge for the bottom bar."</string> |     <string name="switch_unread_count">"Display the unread count as a badge for the bottom bar."</string> | ||||||
|     <string name="switch_unread_count_title">"Display unread count"</string> |     <string name="switch_unread_count_title">"Display unread count"</string> | ||||||
|     <string name="display_all_counts_title">"Display count for favorite and read"</string> |     <string name="display_all_counts_title">"Display count for favorite and read"</string> | ||||||
|     <string name="text_wrong_url">"You seem to be trying to use an invalid URL. Make sure it is correct, and if the problem persists, contact me (via the store contact link). Please note that the app needs you to be using Selfoss. You can't access RSS feeds without it."</string> |     <string name="text_wrong_url">"You seem to be trying to use an invalid URL. Make sure it is correct, and if the problem persists, contact me (via the store contact link). Please note that the app needs you to be using Selfoss. You can't access RSS feeds without it."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Open links inside the app"</string> |     <string name="pref_article_viewer_title">"Open links inside the app"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Articles will open inside the app"</string> |     <string name="pref_article_viewer_on">"Articles will open inside the app"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Articles will open with your default browser"</string> |     <string name="pref_article_viewer_off">"Articles will open with your default browser"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Use the article viewer"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Will use the article viewer instead of the internal browser"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Will use the internal browser instead of the article viewer"</string> |  | ||||||
|     <string name="pref_general_category_links">"Link handling"</string> |     <string name="pref_general_category_links">"Link handling"</string> | ||||||
|     <string name="pref_general_category_displaying">"Displaying"</string> |     <string name="pref_general_category_displaying">"Displaying"</string> | ||||||
|     <string name="pref_switch_card_view_on">"The articles will be displayed as cards"</string> |     <string name="pref_switch_card_view_on">"The articles will be displayed as cards"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">Cards height will adjust to its content</string> |     <string name="card_height_on">Cards height will adjust to its content</string> | ||||||
|     <string name="card_height_off">Card height will be fixed</string> |     <string name="card_height_off">Card height will be fixed</string> | ||||||
|     <string name="source_code">Source code</string> |     <string name="source_code">Source code</string> | ||||||
|     <string name="cant_mark_read">Can\'t mark article as read</string> |     <string name="filter_item_tags">Tags</string> | ||||||
|     <string name="cant_mark_unread">Can\'t mark article as unread</string> |     <string name="filter_item_sources">Sources</string> | ||||||
|     <string name="drawer_error_loading_tags">Error loading tags…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Error loading sources…</string> |  | ||||||
|     <string name="drawer_item_filters">Filters</string> |  | ||||||
|     <string name="drawer_action_clear">clear</string> |  | ||||||
|     <string name="drawer_item_tags">Tags</string> |  | ||||||
|     <string name="drawer_item_sources">Sources</string> |  | ||||||
|     <string name="drawer_action_edit">edit</string> |  | ||||||
|     <string name="no_tags_loaded">No tags loaded</string> |  | ||||||
|     <string name="no_sources_loaded">No sources loaded</string> |  | ||||||
|     <string name="drawer_loading">Loading …</string> |  | ||||||
|     <string name="menu_home_search">Search</string> |     <string name="menu_home_search">Search</string> | ||||||
|     <string name="can_delete_source">Can\'t delete the source…</string> |     <string name="can_delete_source">Can\'t delete the source…</string> | ||||||
|     <string name="base_url_error">There was an issue when trying to communicate with your Selfoss Instance. If the issue persists, please get in touch with me.</string> |     <string name="base_url_error">There was an issue when trying to communicate with your Selfoss Instance. If the issue persists, please get in touch with me.</string> | ||||||
|     <string name="pref_header_theme">Themes</string> |     <string name="pref_header_theme">Themes</string> | ||||||
|     <string name="default_theme">Default</string> |  | ||||||
|     <string name="default_dark_theme">Default/Dark</string> |  | ||||||
|     <string name="pref_header_debug">Debug</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Using a self hosted certificate ?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Due to security reasons, self signed certificates are not supported by default. By activating this, I\'ll not be responsible of any security problem you encounter.</string> |  | ||||||
|     <string name="pref_selfoss_category">Selfoss Api</string> |     <string name="pref_selfoss_category">Selfoss Api</string> | ||||||
|     <string name="pref_api_items_number_title">Loaded items number</string> |     <string name="pref_api_items_number_title">Loaded items number</string> | ||||||
|     <string name="pref_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="summary_debug_identifier">Debug identifier</string> |  | ||||||
|     <string name="unique_id_to_clipboard">Identifier copied to your clipboard</string> |  | ||||||
|     <string name="display_header_drawer_summary">Display a header with the selfoss instance url on the lateral drawer.</string> |  | ||||||
|     <string name="display_header_drawer_title">Account header</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Load more articles on scroll</string> |     <string name="pref_general_infinite_loading_title">Load more articles on scroll</string> | ||||||
|     <string name="translation">Translation</string> |     <string name="translation">Translation</string> | ||||||
|     <string name="cant_open_invalid_url">The item url is invalid. I\'m looking into solving this issue so the app won\'t crash.</string> |     <string name="cant_open_invalid_url">The item url is invalid. I\'m looking into solving this issue so the app won\'t crash.</string> | ||||||
|     <string name="drawer_report_bug">Report a bug</string> |  | ||||||
|     <string name="items_number_should_be_number">The items number should be an integer.</string> |     <string name="items_number_should_be_number">The items number should be an integer.</string> | ||||||
|     <string name="reader_action_more">Read more</string> |  | ||||||
|     <string name="reader_action_open">Open in browser</string> |     <string name="reader_action_open">Open in browser</string> | ||||||
|     <string name="reader_action_share">Share</string> |     <string name="reader_action_share">Share</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> |     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> | ||||||
|     <string name="add_to_favs_reader">Add to favorites</string> |     <string name="add_to_favs_reader">Add to favorites</string> | ||||||
|     <string name="remove_to_favs_reader">Remove from favorites</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Article reader content font size</string> |     <string name="pref_content_reader_font_size">Article reader content font size</string> | ||||||
|     <string name="pref_header_viewer">Article viewer</string> |     <string name="pref_header_viewer">Article viewer</string> | ||||||
|     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> |     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> | ||||||
|     <string name="markall_dialog_message">This will mark all the items as read.</string> |     <string name="markall_dialog_message">This will mark all the items as read.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> |     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> |     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Automatically send crash reports</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Will send crash reports automatically</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Will ask everytime when sending crash reports.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Crash reports</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Debug logging (these will be sent without a dialog)</string> |  | ||||||
|     <string name="acra_login">Enable logging</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="unmark">Mark item as unread</string> |     <string name="unmark">Mark item as unread</string> | ||||||
|     <string name="pref_header_offline">Offline and cache</string> |     <string name="pref_header_offline">Offline and cache</string> | ||||||
|     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> |     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Save items for offline use</string> |     <string name="pref_switch_items_caching">Save items for offline use</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Not connected !</string> |  | ||||||
|     <string name="network_connectivity_lost">"Network connection lost"</string> |     <string name="network_connectivity_lost">"Network connection lost"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Network connection is now available"</string> |     <string name="network_connectivity_retrieved">"Network connection is now available"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sync articles</string> |     <string name="pref_switch_periodic_refresh">Sync articles</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> |     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> |     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> | ||||||
|     <string name="loading_notification_title">Loading ...</string> |     <string name="loading_notification_title">Loading …</string> | ||||||
|     <string name="loading_notification_text">Selfoss is syncing your articles</string> |     <string name="loading_notification_text">Selfoss is syncing your articles</string> | ||||||
|     <string name="notification_channel_sync">Sync notification</string> |     <string name="notification_channel_sync">Sync notification</string> | ||||||
|     <string name="new_items_channel_sync">New items notification</string> |     <string name="new_items_channel_sync">New items notification</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Reader for Selfoss"</string> |     <string name="app_name">"Reader for Selfoss"</string> | ||||||
|     <string name="title_activity_login">"Login"</string> |     <string name="title_activity_login">"Login"</string> | ||||||
|     <string name="prompt_password">"Mot de passe"</string> |     <string name="prompt_password">"Mot de passe"</string> | ||||||
|     <string name="prompt_http_password">"Mot de passe HTTP"</string> |  | ||||||
|     <string name="action_sign_in">"Valider"</string> |     <string name="action_sign_in">"Valider"</string> | ||||||
|     <string name="error_invalid_password">"Mot de passe trop court"</string> |     <string name="error_invalid_password">"Mot de passe trop court"</string> | ||||||
|     <string name="error_field_required">"Champ requis"</string> |     <string name="error_field_required">"Champ requis"</string> | ||||||
|     <string name="prompt_url">"Url Selfoss"</string> |     <string name="prompt_url">"Url Selfoss"</string> | ||||||
|     <string name="withLoginSwitch">"Avec login ?"</string> |     <string name="withLoginSwitch">"Avec login ?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"Avec login HTTP ?"</string> |     <string name="login_url_problem">"Petit souci. Il manque peut-être un / à la fin ?"</string> | ||||||
|     <string name="login_url_problem">"Petit souci. Il manque peut être un / à la fin ?"</string> |  | ||||||
|     <string name="prompt_login">"Utilisateur"</string> |     <string name="prompt_login">"Utilisateur"</string> | ||||||
|     <string name="prompt_http_login">"Utilisateur HTTP"</string> |  | ||||||
|     <string name="label_share">"Partager"</string> |  | ||||||
|     <string name="readAll">"Tout lire"</string> |     <string name="readAll">"Tout lire"</string> | ||||||
|     <string name="action_disconnect">"Déconnecter"</string> |     <string name="action_disconnect">"Déconnecter"</string> | ||||||
|     <string name="title_activity_settings">"Paramètres"</string> |     <string name="title_activity_settings">"Paramètres"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Vérifiez vos informations."</string> |     <string name="wrong_infos">"Vérifiez vos informations."</string> | ||||||
|     <string name="all_posts_not_read">"Tous les posts n'ont pas été lus"</string> |     <string name="all_posts_not_read">"Tous les posts n'ont pas été lus"</string> | ||||||
|     <string name="all_posts_read">"Tous les posts sont lus"</string> |     <string name="all_posts_read">"Tous les posts sont lus"</string> | ||||||
|     <string name="cant_get_favs">"Impossible de récupérer les éléments favoris."</string> |  | ||||||
|     <string name="cant_get_new_elements">"Impossible de récupérer les nouveaux éléments."</string> |  | ||||||
|     <string name="cant_get_read">"Impossible de récupérer les éléments lus."</string> |  | ||||||
|     <string name="nothing_here">"Il n'y a rien ici !"</string> |     <string name="nothing_here">"Il n'y a rien ici !"</string> | ||||||
|     <string name="tab_new">"Non lus"</string> |     <string name="tab_new">"Non lus"</string> | ||||||
|     <string name="tab_read">"Tous"</string> |     <string name="tab_read">"Tous"</string> | ||||||
| @@ -40,37 +33,22 @@ | |||||||
|     <string name="addStringNoUrl">"Identifiez-vous pour ajouter une source."</string> |     <string name="addStringNoUrl">"Identifiez-vous pour ajouter une source."</string> | ||||||
|     <string name="cant_get_sources">"Impossible de récupérer la liste des sources"</string> |     <string name="cant_get_sources">"Impossible de récupérer la liste des sources"</string> | ||||||
|     <string name="cant_create_source">"Impossible de créer la source."</string> |     <string name="cant_create_source">"Impossible de créer la source."</string> | ||||||
|     <string name="cant_get_spouts_no_network">"Can't get spouts list because of a network issue."</string> |     <string name="cant_get_spouts_no_network">"Impossible d'obtenir la liste des spouts en raison d'un problème de réseau."</string> | ||||||
|     <string name="cant_get_spouts">"Can't get spouts list. There may ben an api issue."</string> |     <string name="cant_get_spouts">"Impossible d'obtenir la liste des spouts. Cela pourrait venir de l'api."</string> | ||||||
|     <string name="form_not_complete">"Il manque des données. Terminez le formulaire."</string> |     <string name="form_not_complete">"Il manque des données. Terminez le formulaire."</string> | ||||||
|     <string name="pref_header_links">"Liens utiles"</string> |     <string name="pref_header_links">"Liens utiles"</string> | ||||||
|     <string name="issue_tracker_link">"Suivi des problèmes"</string> |     <string name="issue_tracker_link">"Suivi des problèmes"</string> | ||||||
|     <string name="issue_tracker_summary">"Pour signaler un bug ou demander une nouvelle fonctionnalité"</string> |     <string name="issue_tracker_summary">"Pour signaler un bug ou demander une nouvelle fonctionnalité"</string> | ||||||
|     <string name="warning_wrong_url">"ATTENTION"</string> |     <string name="warning_wrong_url">"ATTENTION"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Card View"</string> |     <string name="pref_switch_card_view_title">"Vue en carte"</string> | ||||||
|     <string name="cant_mark_favortie">"Impossible de marquer l'élément comme favoris"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"Impossible de retirer l'élément des favoris"</string> |  | ||||||
|     <string name="share">"Partager"</string> |     <string name="share">"Partager"</string> | ||||||
|     <string name="rating_prompt_title">"Vous aimez l'application ?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"Oui."</string> |  | ||||||
|     <string name="rating_prompt_no">"Pas vraiment …"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"Pouvez-vous nous dire pourquoi ?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"Oui !"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Pas maintenant."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Super ! Pouvez-vous nous noter sur le store ?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"D'accord !"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Peut-être plus tard."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Merci, cela nous aide à améliorer l'application !"</string> |  | ||||||
|     <string name="switch_unread_count">"Afficher le nombre d'articles non lus sur la barre en bas de l'écran"</string> |     <string name="switch_unread_count">"Afficher le nombre d'articles non lus sur la barre en bas de l'écran"</string> | ||||||
|     <string name="switch_unread_count_title">"Afficher le nombre de non lus"</string> |     <string name="switch_unread_count_title">"Afficher le nombre de non lus"</string> | ||||||
|     <string name="display_all_counts_title">"Afficher le nombre de favoris et d'articles lus"</string> |     <string name="display_all_counts_title">"Afficher le nombre de favoris et d'articles lus"</string> | ||||||
|     <string name="text_wrong_url">"Vous semblez essayer de vous connecter avec une URL invalide. Assurez-vous que c'est la bonne, et si le problème persiste, contactez-moi via le lien du play store. Notez aussi que l'application ne peut fonctionner sans l'application web Selfoss. Vous ne pouvez pas utiliser l'application pour accéder directement aux flux RSS."</string> |     <string name="text_wrong_url">"Vous semblez essayer de vous connecter avec une URL invalide. Assurez-vous que c'est la bonne, et si le problème persiste, contactez-moi via le lien du play store. Notez aussi que l'application ne peut fonctionner sans l'application web Selfoss. Vous ne pouvez pas utiliser l'application pour accéder directement aux flux RSS."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Ouvrir les liens dans l'application"</string> |     <string name="pref_article_viewer_title">"Ouvrir les liens dans l'application"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Les articles s'ouvriront dans l'application"</string> |     <string name="pref_article_viewer_on">"Les articles s'ouvriront dans l'application"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Les articles s'ouvriront dans votre naviguateur par défaut"</string> |     <string name="pref_article_viewer_off">"Les articles s'ouvriront dans votre naviguateur par défaut"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Utiliser le visionneur d'articles"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Utiliser le naviguateur interne"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Utiliser le naviguateur interne au lieu du visionneur d'articles"</string> |  | ||||||
|     <string name="pref_general_category_links">"Gestion des liens"</string> |     <string name="pref_general_category_links">"Gestion des liens"</string> | ||||||
|     <string name="pref_general_category_displaying">"Affichage"</string> |     <string name="pref_general_category_displaying">"Affichage"</string> | ||||||
|     <string name="pref_switch_card_view_on">"Les articles seront affichés en forme de carte"</string> |     <string name="pref_switch_card_view_on">"Les articles seront affichés en forme de carte"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">La taille de la carte s\'adaptera au contenu</string> |     <string name="card_height_on">La taille de la carte s\'adaptera au contenu</string> | ||||||
|     <string name="card_height_off">La taille de la carte sera fixe</string> |     <string name="card_height_off">La taille de la carte sera fixe</string> | ||||||
|     <string name="source_code">Code source</string> |     <string name="source_code">Code source</string> | ||||||
|     <string name="cant_mark_read">Impossible de marquer l\'article comme lu</string> |     <string name="filter_item_tags">Tags</string> | ||||||
|     <string name="cant_mark_unread">Impossible de marquer l\'article comme non lu</string> |     <string name="filter_item_sources">Sources</string> | ||||||
|     <string name="drawer_error_loading_tags">Erreur lors du chargement des tags…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Erreur lors du chargement des sources…</string> |  | ||||||
|     <string name="drawer_item_filters">Filtres</string> |  | ||||||
|     <string name="drawer_action_clear">raz</string> |  | ||||||
|     <string name="drawer_item_tags">Tags</string> |  | ||||||
|     <string name="drawer_item_sources">Sources</string> |  | ||||||
|     <string name="drawer_action_edit">éditer</string> |  | ||||||
|     <string name="no_tags_loaded">Pas de tags chargés</string> |  | ||||||
|     <string name="no_sources_loaded">Pas de sources chargés</string> |  | ||||||
|     <string name="drawer_loading">Chargement …</string> |  | ||||||
|     <string name="menu_home_search">Rechercher</string> |     <string name="menu_home_search">Rechercher</string> | ||||||
|     <string name="can_delete_source">Impossible de supprimer la source…</string> |     <string name="can_delete_source">Impossible de supprimer la source…</string> | ||||||
|     <string name="base_url_error">Il y a eu un souci lors de la communication avec votre instance Selfoss. Si le problèmes persiste, contactez-moi pour trouver une solution.</string> |     <string name="base_url_error">Il y a eu un souci lors de la communication avec votre instance Selfoss. Si le problèmes persiste, contactez-moi pour trouver une solution.</string> | ||||||
|     <string name="pref_header_theme">Thèmes</string> |     <string name="pref_header_theme">Thèmes</string> | ||||||
|     <string name="default_theme">Par défaut</string> |  | ||||||
|     <string name="default_dark_theme">Par défaut/Foncé</string> |  | ||||||
|     <string name="pref_header_debug">Debug</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Certificat auto-signé ?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Pour des raisons de sécurité, les certificats auto-signés sont désactivés par défaut. En les activant, je ne serais pas responsable de quelconques problèmes de sécurité rencontrés.</string> |  | ||||||
|     <string name="pref_selfoss_category">Api Selfoss</string> |     <string name="pref_selfoss_category">Api Selfoss</string> | ||||||
|     <string name="pref_api_items_number_title">Nombre d\'articles chargés</string> |     <string name="pref_api_items_number_title">Nombre d\'articles chargés</string> | ||||||
|     <string name="pref_hidden_tags">Tags Cachés</string> |  | ||||||
|     <string name="summary_debug_identifier">Identifiant de debug</string> |  | ||||||
|     <string name="unique_id_to_clipboard">Texte copié</string> |  | ||||||
|     <string name="display_header_drawer_summary">Afficher une entête avec l\'url de votre instance de Selfoss en haut du drawer lateral.</string> |  | ||||||
|     <string name="display_header_drawer_title">Entête de compte</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Charger plus d\'articles au scroll</string> |     <string name="pref_general_infinite_loading_title">Charger plus d\'articles au scroll</string> | ||||||
|     <string name="translation">Traduction</string> |     <string name="translation">Traduction</string> | ||||||
|     <string name="cant_open_invalid_url">L’url de l’élément n’est pas valide. En attendant la résolution du problème, le lien ne s\'ouvrira pas.</string> |     <string name="cant_open_invalid_url">L’url de l’élément n’est pas valide. En attendant la résolution du problème, le lien ne s\'ouvrira pas.</string> | ||||||
|     <string name="drawer_report_bug">Signaler un bug</string> |  | ||||||
|     <string name="items_number_should_be_number">Le nombre d\'articles doit être un entier.</string> |     <string name="items_number_should_be_number">Le nombre d\'articles doit être un entier.</string> | ||||||
|     <string name="reader_action_more">Lire plus</string> |  | ||||||
|     <string name="reader_action_open">Ouvrir</string> |     <string name="reader_action_open">Ouvrir</string> | ||||||
|     <string name="reader_action_share">Partager</string> |     <string name="reader_action_share">Partager</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Marquer les articles comme lus à la navigation dans le lecteur d\'article.</string> |     <string name="pref_switch_actions_pager_scroll_on">Marquer les articles comme lus à la navigation dans le lecteur d\'article.</string> | ||||||
|     <string name="add_to_favs_reader">Ajouter aux favoris</string> |     <string name="add_to_favs_reader">Ajouter aux favoris</string> | ||||||
|     <string name="remove_to_favs_reader">Supprimer des favoris</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Taille du texte du contenu du lecteur d\'articles</string> |     <string name="pref_content_reader_font_size">Taille du texte du contenu du lecteur d\'articles</string> | ||||||
|     <string name="pref_header_viewer">Lecteur d\'articles</string> |     <string name="pref_header_viewer">Lecteur d\'articles</string> | ||||||
|     <string name="refresh_dialog_message">En validant, votre instance Selfoss sera mise à jour.</string> |     <string name="refresh_dialog_message">En validant, votre instance Selfoss sera mise à jour.</string> | ||||||
|     <string name="markall_dialog_message">Marquer tous les éléments comme lus ?</string> |     <string name="markall_dialog_message">Marquer tous les éléments comme lus ?</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Marquer comme lu à la navigation.</string> |     <string name="pref_switch_actions_pager_scroll">Marquer comme lu à la navigation.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Ne pas marquer les articles comme lus à la navigation.</string> |     <string name="pref_switch_actions_pager_scroll_off">Ne pas marquer les articles comme lus à la navigation.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Envoyer automatiquement les rapports d\'erreur</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Enverra automatiquement les rapports d\'erreur</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Demandera une confirmation à chaque incident.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Rapport d\'erreur</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Log de debug (seront envoyés automatiquement)</string> |  | ||||||
|     <string name="acra_login">Activer les logs</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Tags Cachés</string> |  | ||||||
|     <string name="unmark">Marquer l\'article comme non lu</string> |     <string name="unmark">Marquer l\'article comme non lu</string> | ||||||
|     <string name="pref_header_offline">Hors ligne et cache</string> |     <string name="pref_header_offline">Hors ligne et cache</string> | ||||||
|     <string name="pref_switch_items_caching_off">Les articles ne seront pas enregistrés et l\'application ne sera pas utilisable hors ligne.</string> |     <string name="pref_switch_items_caching_off">Les articles ne seront pas enregistrés et l\'application ne sera pas utilisable hors ligne.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Sauvegarder les articles pour une utilisation hors ligne</string> |     <string name="pref_switch_items_caching">Sauvegarder les articles pour une utilisation hors ligne</string> | ||||||
|     <string name="pref_switch_update_sources">Vérifier les nouvelles sources et tags</string> |     <string name="pref_switch_update_sources">Vérifier les nouvelles sources et tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Désactivez cette option si votre serveur reçoit trop de requêtes.</string> |     <string name="pref_switch_update_sources_summary">Désactivez cette option si votre serveur reçoit trop de requêtes.</string> | ||||||
|     <string name="no_network_connectivity">Hors connexion !</string> |  | ||||||
|     <string name="network_connectivity_lost">"Connexion au réseau perdue"</string> |     <string name="network_connectivity_lost">"Connexion au réseau perdue"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Connexion réseau de nouveau disponible"</string> |     <string name="network_connectivity_retrieved">"Connexion réseau de nouveau disponible"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Synchroniser les articles</string> |     <string name="pref_switch_periodic_refresh">Synchroniser les articles</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Articles seront périodiquement synchronisées</string> |     <string name="pref_switch_periodic_refresh_on">Articles seront périodiquement synchronisées</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Interval de synchronisation ( >= 15 minutes)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Interval de synchronisation ( >= 15 minutes)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Synchroniser uniquement lorsque le téléphone est en charge</string> |     <string name="pref_switch_refresh_when_charging">Synchroniser uniquement lorsque le téléphone est en charge</string> | ||||||
|     <string name="loading_notification_title">Chargement ...</string> |     <string name="loading_notification_title">Chargement …</string> | ||||||
|     <string name="loading_notification_text">Selfoss synchronise vos articles</string> |     <string name="loading_notification_text">Selfoss synchronise vos articles</string> | ||||||
|     <string name="notification_channel_sync">Notification de synchronisation</string> |     <string name="notification_channel_sync">Notification de synchronisation</string> | ||||||
|     <string name="new_items_channel_sync">Notification de nouveaux articles</string> |     <string name="new_items_channel_sync">Notification de nouveaux articles</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">La barre sera affichée</string> |     <string name="reader_static_bar_on">La barre sera affichée</string> | ||||||
|     <string name="reader_static_bar_off">La barre sera affichée grâce au bouton</string> |     <string name="reader_static_bar_off">La barre sera affichée grâce au bouton</string> | ||||||
|     <string name="remove_source">Supprimer la source</string> |     <string name="remove_source">Supprimer la source</string> | ||||||
|  |     <string name="pref_theme_title">Thème Clair/Sombre</string> | ||||||
|  |     <string name="mode_dark">Thème sombre</string> | ||||||
|  |     <string name="mode_system">Utiliser les paramètres système</string> | ||||||
|  |     <string name="mode_light">Thème clair</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Lector para selfoss"</string> |     <string name="app_name">"Lector para selfoss"</string> | ||||||
|     <string name="title_activity_login">"Conectar"</string> |     <string name="title_activity_login">"Conectar"</string> | ||||||
|     <string name="prompt_password">"Contrasinal"</string> |     <string name="prompt_password">"Contrasinal"</string> | ||||||
|     <string name="prompt_http_password">"Contrasinal HTTP"</string> |  | ||||||
|     <string name="action_sign_in">"Ir"</string> |     <string name="action_sign_in">"Ir"</string> | ||||||
|     <string name="error_invalid_password">"O contrasinal non é suficientemente longo"</string> |     <string name="error_invalid_password">"O contrasinal non é suficientemente longo"</string> | ||||||
|     <string name="error_field_required">"Campo requirido"</string> |     <string name="error_field_required">"Campo requirido"</string> | ||||||
|     <string name="prompt_url">"URL"</string> |     <string name="prompt_url">"URL"</string> | ||||||
|     <string name="withLoginSwitch">"É preciso iniciar sesión?"</string> |     <string name="withLoginSwitch">"É preciso iniciar sesión?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"É preciso iniciar sesión?"</string> |  | ||||||
|     <string name="login_url_problem">"Ups! Pode que precises engadir un \"/\" o final da URL."</string> |     <string name="login_url_problem">"Ups! Pode que precises engadir un \"/\" o final da URL."</string> | ||||||
|     <string name="prompt_login">"Nome de usuario"</string> |     <string name="prompt_login">"Nome de usuario"</string> | ||||||
|     <string name="prompt_http_login">"Nome de usuario HTTP"</string> |  | ||||||
|     <string name="label_share">"Compartir"</string> |  | ||||||
|     <string name="readAll">"Ler todos"</string> |     <string name="readAll">"Ler todos"</string> | ||||||
|     <string name="action_disconnect">"Desconectar"</string> |     <string name="action_disconnect">"Desconectar"</string> | ||||||
|     <string name="title_activity_settings">"Axustes"</string> |     <string name="title_activity_settings">"Axustes"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Comprobar os teus detalles de novo."</string> |     <string name="wrong_infos">"Comprobar os teus detalles de novo."</string> | ||||||
|     <string name="all_posts_not_read">"Non se leron todas as publicacións"</string> |     <string name="all_posts_not_read">"Non se leron todas as publicacións"</string> | ||||||
|     <string name="all_posts_read">"Leronse todas as publicacións"</string> |     <string name="all_posts_read">"Leronse todas as publicacións"</string> | ||||||
|     <string name="cant_get_favs">"Non se poden obter os favoritos"</string> |  | ||||||
|     <string name="cant_get_new_elements">"Non se poden recibir os novos artigos"</string> |  | ||||||
|     <string name="cant_get_read">"Non se poden recibir os artigos lidos"</string> |  | ||||||
|     <string name="nothing_here">"Non hai nada aquí"</string> |     <string name="nothing_here">"Non hai nada aquí"</string> | ||||||
|     <string name="tab_new">"Novo"</string> |     <string name="tab_new">"Novo"</string> | ||||||
|     <string name="tab_read">"Todos"</string> |     <string name="tab_read">"Todos"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"Informar dun erro ou pedir unha nova característica"</string> |     <string name="issue_tracker_summary">"Informar dun erro ou pedir unha nova característica"</string> | ||||||
|     <string name="warning_wrong_url">"AVISO"</string> |     <string name="warning_wrong_url">"AVISO"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Vista de tarxeta"</string> |     <string name="pref_switch_card_view_title">"Vista de tarxeta"</string> | ||||||
|     <string name="cant_mark_favortie">"Non se pode marcar o artigo como favorito"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"Non se pode eliminar o elemento dos favoritos"</string> |  | ||||||
|     <string name="share">"Compartir"</string> |     <string name="share">"Compartir"</string> | ||||||
|     <string name="rating_prompt_title">"Estás gozando coa aplicación?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"Si !"</string> |  | ||||||
|     <string name="rating_prompt_no">"Non moito …"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"Podes dicirnos por qué?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"Dacordo!"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Agora non."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Xenial! Podes puntuarnos na tenda?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"Claro!"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Agora mesmo non."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Grazas, a túa opinión axudanos a mellorar a aplicación!"</string> |  | ||||||
|     <string name="switch_unread_count">"Mostrar o reconto de artigos non lidos cunha insignia na barra inferior."</string> |     <string name="switch_unread_count">"Mostrar o reconto de artigos non lidos cunha insignia na barra inferior."</string> | ||||||
|     <string name="switch_unread_count_title">"Mostrar reconto de artigos non lidos"</string> |     <string name="switch_unread_count_title">"Mostrar reconto de artigos non lidos"</string> | ||||||
|     <string name="display_all_counts_title">"Mostrar reconto de artigos lidos e favoritos"</string> |     <string name="display_all_counts_title">"Mostrar reconto de artigos lidos e favoritos"</string> | ||||||
|     <string name="text_wrong_url">"Semella que intentas usar unha URL non válida. Asegúrate de que é correcta, e se o problema persiste, ponte en contacto conmigo (a través da ligazón de contacto na tenda). Por favor ten en conta que a aplicación precisa que uses Selfoss. Non podes acceder a canles RSS se non o tes."</string> |     <string name="text_wrong_url">"Semella que intentas usar unha URL non válida. Asegúrate de que é correcta, e se o problema persiste, ponte en contacto conmigo (a través da ligazón de contacto na tenda). Por favor ten en conta que a aplicación precisa que uses Selfoss. Non podes acceder a canles RSS se non o tes."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Abrir ligazóns dentro da aplicación"</string> |     <string name="pref_article_viewer_title">"Abrir ligazóns dentro da aplicación"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Os artigos abriranse dentro da aplicación"</string> |     <string name="pref_article_viewer_on">"Os artigos abriranse dentro da aplicación"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Os artigos abriranse co teu navegador prederminado"</string> |     <string name="pref_article_viewer_off">"Os artigos abriranse co teu navegador prederminado"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Usar o visor de artigos"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Usarase o visor de artigos en lugar do navegador interno"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Usarase o navegador interno en lugar do visor de artigos"</string> |  | ||||||
|     <string name="pref_general_category_links">"Xestión de ligazóns"</string> |     <string name="pref_general_category_links">"Xestión de ligazóns"</string> | ||||||
|     <string name="pref_general_category_displaying">"Visualización"</string> |     <string name="pref_general_category_displaying">"Visualización"</string> | ||||||
|     <string name="pref_switch_card_view_on">"Os artigos amosaranse coma tarxetas"</string> |     <string name="pref_switch_card_view_on">"Os artigos amosaranse coma tarxetas"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">A altura das tarxetas axustarase ao seu contido</string> |     <string name="card_height_on">A altura das tarxetas axustarase ao seu contido</string> | ||||||
|     <string name="card_height_off">A altura das tarxetas será fixa</string> |     <string name="card_height_off">A altura das tarxetas será fixa</string> | ||||||
|     <string name="source_code">Código fonte</string> |     <string name="source_code">Código fonte</string> | ||||||
|     <string name="cant_mark_read">Non se pode marcar o artigo como lido</string> |     <string name="filter_item_tags">Etiquetas</string> | ||||||
|     <string name="cant_mark_unread">Non se pode marcar o artigo como non lido</string> |     <string name="filter_item_sources">Fontes</string> | ||||||
|     <string name="drawer_error_loading_tags">Produciuse un erro ao cargar as etiquetas…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Produciuse un erro ao cargar as fontes…</string> |  | ||||||
|     <string name="drawer_item_filters">Filtros</string> |  | ||||||
|     <string name="drawer_action_clear">limpar</string> |  | ||||||
|     <string name="drawer_item_tags">Etiquetas</string> |  | ||||||
|     <string name="drawer_item_sources">Fontes</string> |  | ||||||
|     <string name="drawer_action_edit">editar</string> |  | ||||||
|     <string name="no_tags_loaded">Non se cargou ningunha etiqueta</string> |  | ||||||
|     <string name="no_sources_loaded">Non se cargou ningunha fonte</string> |  | ||||||
|     <string name="drawer_loading">Cargando…</string> |  | ||||||
|     <string name="menu_home_search">Procurar</string> |     <string name="menu_home_search">Procurar</string> | ||||||
|     <string name="can_delete_source">Non se puido eliminar a fonte…</string> |     <string name="can_delete_source">Non se puido eliminar a fonte…</string> | ||||||
|     <string name="base_url_error">Houno unha incidencia ao tratar de comunicarse coa túa instancia de Selfoss. Se o problema persiste, prégolle que se poña en contacto conmigo.</string> |     <string name="base_url_error">Houno unha incidencia ao tratar de comunicarse coa túa instancia de Selfoss. Se o problema persiste, prégolle que se poña en contacto conmigo.</string> | ||||||
|     <string name="pref_header_theme">Temas</string> |     <string name="pref_header_theme">Temas</string> | ||||||
|     <string name="default_theme">Predeterminado</string> |  | ||||||
|     <string name="default_dark_theme">Predeterminado/Escuro</string> |  | ||||||
|     <string name="pref_header_debug">Depuración</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Utilizas un certificado autoaloxado?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Por razóns de seguridade, por defecto non se permiten os certificados autoasinados. Activando isto, non serei responsable de calquera problema de seguridade que atopes.</string> |  | ||||||
|     <string name="pref_selfoss_category">API de Selfoss</string> |     <string name="pref_selfoss_category">API de Selfoss</string> | ||||||
|     <string name="pref_api_items_number_title">Número de elementos cargados</string> |     <string name="pref_api_items_number_title">Número de elementos cargados</string> | ||||||
|     <string name="pref_hidden_tags">Etiquetas ocultas</string> |  | ||||||
|     <string name="summary_debug_identifier">Identificador de depuración</string> |  | ||||||
|     <string name="unique_id_to_clipboard">Copiouse o identificador ao portapapeis</string> |  | ||||||
|     <string name="display_header_drawer_summary">Amosar unha cabeceira coa URL da instancia de Selfoss no panel lateral.</string> |  | ||||||
|     <string name="display_header_drawer_title">Cabeceira da conta</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Cargar máis artigos ao desprazarse</string> |     <string name="pref_general_infinite_loading_title">Cargar máis artigos ao desprazarse</string> | ||||||
|     <string name="translation">Traducción</string> |     <string name="translation">Traducción</string> | ||||||
|     <string name="cant_open_invalid_url">A URL do elemento non é válida. Estou tratando de solucionar isto pra que a aplicación non falle.</string> |     <string name="cant_open_invalid_url">A URL do elemento non é válida. Estou tratando de solucionar isto pra que a aplicación non falle.</string> | ||||||
|     <string name="drawer_report_bug">Informar dun erro</string> |  | ||||||
|     <string name="items_number_should_be_number">O número de elementos debería ser un enteiro.</string> |     <string name="items_number_should_be_number">O número de elementos debería ser un enteiro.</string> | ||||||
|     <string name="reader_action_more">Ler máis</string> |  | ||||||
|     <string name="reader_action_open">Abrir no navegador</string> |     <string name="reader_action_open">Abrir no navegador</string> | ||||||
|     <string name="reader_action_share">Compartir</string> |     <string name="reader_action_share">Compartir</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Marcar artigos como lidos cando se desliza o dedo dun a outro.</string> |     <string name="pref_switch_actions_pager_scroll_on">Marcar artigos como lidos cando se desliza o dedo dun a outro.</string> | ||||||
|     <string name="add_to_favs_reader">Engadir a favoritos</string> |     <string name="add_to_favs_reader">Engadir a favoritos</string> | ||||||
|     <string name="remove_to_favs_reader">Eliminar dos favoritos</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Tamaño da fonte do lector</string> |     <string name="pref_content_reader_font_size">Tamaño da fonte do lector</string> | ||||||
|     <string name="pref_header_viewer">Visor de artigos</string> |     <string name="pref_header_viewer">Visor de artigos</string> | ||||||
|     <string name="refresh_dialog_message">Isto actualizará a súa instancia de Selfoss.</string> |     <string name="refresh_dialog_message">Isto actualizará a súa instancia de Selfoss.</string> | ||||||
|     <string name="markall_dialog_message">Isto marcara todos os elementos como lidos.</string> |     <string name="markall_dialog_message">Isto marcara todos os elementos como lidos.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Marcar artigos como lidos ao deslizar co dedo cara os lados</string> |     <string name="pref_switch_actions_pager_scroll">Marcar artigos como lidos ao deslizar co dedo cara os lados</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Non marcar artigos como lidos ao deslizar co dedo cara os lados.</string> |     <string name="pref_switch_actions_pager_scroll_off">Non marcar artigos como lidos ao deslizar co dedo cara os lados.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Enviar automáticamente informes de erros</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Enviaranse automáticamente os informes de erros</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Preguntarase cada vez pra enviar os informes de erros.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Informes de erros</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Rexistro de depuración (Estes enviaranse automáticamente)</string> |  | ||||||
|     <string name="acra_login">Habilitar o rexistro</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Etiquetas ocultas</string> |  | ||||||
|     <string name="unmark">Marcar artículo como non lido</string> |     <string name="unmark">Marcar artículo como non lido</string> | ||||||
|     <string name="pref_header_offline">Sen conexión e caché</string> |     <string name="pref_header_offline">Sen conexión e caché</string> | ||||||
|     <string name="pref_switch_items_caching_off">Os artigos non se gardaran na memoria do dispositivo e non se poderá utilizar a aplicación sen conexión.</string> |     <string name="pref_switch_items_caching_off">Os artigos non se gardaran na memoria do dispositivo e non se poderá utilizar a aplicación sen conexión.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Gardar elementos para uso sen conexión</string> |     <string name="pref_switch_items_caching">Gardar elementos para uso sen conexión</string> | ||||||
|     <string name="pref_switch_update_sources">Comproba novas fontes e etiquetas</string> |     <string name="pref_switch_update_sources">Comproba novas fontes e etiquetas</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Deshabilita isto se o teu servidor está recibindo demasiadas peticións de base de datos.</string> |     <string name="pref_switch_update_sources_summary">Deshabilita isto se o teu servidor está recibindo demasiadas peticións de base de datos.</string> | ||||||
|     <string name="no_network_connectivity">Non conectado!</string> |  | ||||||
|     <string name="network_connectivity_lost">"Perdeuse a conexión de rede"</string> |     <string name="network_connectivity_lost">"Perdeuse a conexión de rede"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Conexión de rede xa dispoñíbel"</string> |     <string name="network_connectivity_retrieved">"Conexión de rede xa dispoñíbel"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sincronizar artigos</string> |     <string name="pref_switch_periodic_refresh">Sincronizar artigos</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Os artigos sincronizaranse periódicamente</string> |     <string name="pref_switch_periodic_refresh_on">Os artigos sincronizaranse periódicamente</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Intervalo de sincronización (>= 15 minutos)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Intervalo de sincronización (>= 15 minutos)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Só refrescar cando o teléfono se está a cargar</string> |     <string name="pref_switch_refresh_when_charging">Só refrescar cando o teléfono se está a cargar</string> | ||||||
|     <string name="loading_notification_title">Cargando...</string> |     <string name="loading_notification_title">Cargando…</string> | ||||||
|     <string name="loading_notification_text">Selfoss está sincronizando os teus ar tigos</string> |     <string name="loading_notification_text">Selfoss está sincronizando os teus ar tigos</string> | ||||||
|     <string name="notification_channel_sync">Notificación de sincronización</string> |     <string name="notification_channel_sync">Notificación de sincronización</string> | ||||||
|     <string name="new_items_channel_sync">Notificación de actualizacións</string> |     <string name="new_items_channel_sync">Notificación de actualizacións</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">A barra inferior mostrarase sempre</string> |     <string name="reader_static_bar_on">A barra inferior mostrarase sempre</string> | ||||||
|     <string name="reader_static_bar_off">A barra inferior pode mostrarse a través do botón flotante</string> |     <string name="reader_static_bar_off">A barra inferior pode mostrarse a través do botón flotante</string> | ||||||
|     <string name="remove_source">Eliminar fonte</string> |     <string name="remove_source">Eliminar fonte</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Reader for Selfoss"</string> |     <string name="app_name">"Reader for Selfoss"</string> | ||||||
|     <string name="title_activity_login">"Masuk"</string> |     <string name="title_activity_login">"Masuk"</string> | ||||||
|     <string name="prompt_password">"Kata sandi"</string> |     <string name="prompt_password">"Kata sandi"</string> | ||||||
|     <string name="prompt_http_password">"Kata sandi HTTP"</string> |  | ||||||
|     <string name="action_sign_in">"Mulai"</string> |     <string name="action_sign_in">"Mulai"</string> | ||||||
|     <string name="error_invalid_password">"Kata sandinya tidak cukup panjang"</string> |     <string name="error_invalid_password">"Kata sandinya tidak cukup panjang"</string> | ||||||
|     <string name="error_field_required">"Kolom wajib diisi"</string> |     <string name="error_field_required">"Kolom wajib diisi"</string> | ||||||
|     <string name="prompt_url">"URL"</string> |     <string name="prompt_url">"URL"</string> | ||||||
|     <string name="withLoginSwitch">"Harus masuk?"</string> |     <string name="withLoginSwitch">"Harus masuk?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"Otentikasi HTTP diperlukan?"</string> |  | ||||||
|     <string name="login_url_problem">"Ups. Anda mungkin harus menambahkan \"/\" di akhir url."</string> |     <string name="login_url_problem">"Ups. Anda mungkin harus menambahkan \"/\" di akhir url."</string> | ||||||
|     <string name="prompt_login">"Nama pengguna"</string> |     <string name="prompt_login">"Nama pengguna"</string> | ||||||
|     <string name="prompt_http_login">"Nama pengguna HTTP"</string> |  | ||||||
|     <string name="label_share">"Bagikan"</string> |  | ||||||
|     <string name="readAll">"Baca semua"</string> |     <string name="readAll">"Baca semua"</string> | ||||||
|     <string name="action_disconnect">"Putuskan sambungan"</string> |     <string name="action_disconnect">"Putuskan sambungan"</string> | ||||||
|     <string name="title_activity_settings">"Pengaturan"</string> |     <string name="title_activity_settings">"Pengaturan"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Periksa kembali detail Anda."</string> |     <string name="wrong_infos">"Periksa kembali detail Anda."</string> | ||||||
|     <string name="all_posts_not_read">"Semua pos belum dibaca"</string> |     <string name="all_posts_not_read">"Semua pos belum dibaca"</string> | ||||||
|     <string name="all_posts_read">"Semua pos sudah dibaca"</string> |     <string name="all_posts_read">"Semua pos sudah dibaca"</string> | ||||||
|     <string name="cant_get_favs">"Gagal menuju favorit"</string> |  | ||||||
|     <string name="cant_get_new_elements">"Gagal ke artikel baru"</string> |  | ||||||
|     <string name="cant_get_read">"Gagal ke artikel yang dibaca"</string> |  | ||||||
|     <string name="nothing_here">"Tidak ada di sini"</string> |     <string name="nothing_here">"Tidak ada di sini"</string> | ||||||
|     <string name="tab_new">"Baru"</string> |     <string name="tab_new">"Baru"</string> | ||||||
|     <string name="tab_read">"Semua"</string> |     <string name="tab_read">"Semua"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"Laporkan bug atau meminta fitur baru"</string> |     <string name="issue_tracker_summary">"Laporkan bug atau meminta fitur baru"</string> | ||||||
|     <string name="warning_wrong_url">"PERINGATAN"</string> |     <string name="warning_wrong_url">"PERINGATAN"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Tampilan Kartu"</string> |     <string name="pref_switch_card_view_title">"Tampilan Kartu"</string> | ||||||
|     <string name="cant_mark_favortie">"Tidak dapat menandai artikel sebagai favorit"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"Tidak dapat melepas item dari favorit"</string> |  | ||||||
|     <string name="share">"Bagikan"</string> |     <string name="share">"Bagikan"</string> | ||||||
|     <string name="rating_prompt_title">"Suka aplikasi ini?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"Ya !"</string> |  | ||||||
|     <string name="rating_prompt_no">"Tidak suka …"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"Bisakah Anda memberitahu kami alasannya?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"Oke !"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Tidak sekarang."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Bagus! Dapatkah Anda memberi nilai kami di Store ?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"Tentu saja !"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Jangan sekarang."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Terima kasih, umpan balik Anda membantu pengembangan aplikasi !"</string> |  | ||||||
|     <string name="switch_unread_count">"Tampilkan jumlah item yang belum dibaca di bilah bawah."</string> |     <string name="switch_unread_count">"Tampilkan jumlah item yang belum dibaca di bilah bawah."</string> | ||||||
|     <string name="switch_unread_count_title">"Tampilkan jumlah item yang belum dibaca"</string> |     <string name="switch_unread_count_title">"Tampilkan jumlah item yang belum dibaca"</string> | ||||||
|     <string name="display_all_counts_title">"Tampilkan jumlah item untuk favorit dan sudah dibaca"</string> |     <string name="display_all_counts_title">"Tampilkan jumlah item untuk favorit dan sudah dibaca"</string> | ||||||
|     <string name="text_wrong_url">"Sepertinya Anda mencoba menggunakan URL yang tidak valid. Pastikan itu benar, jika masalah terus berlanjut, hubungi saya (melalui link kontak toko). Harap dicatat bahwa aplikasi ini mengharuskan Anda menggunakan Selfoss. Tanpa itu, Anda tidak bisa mengakses umpan RSS."</string> |     <string name="text_wrong_url">"Sepertinya Anda mencoba menggunakan URL yang tidak valid. Pastikan itu benar, jika masalah terus berlanjut, hubungi saya (melalui link kontak toko). Harap dicatat bahwa aplikasi ini mengharuskan Anda menggunakan Selfoss. Tanpa itu, Anda tidak bisa mengakses umpan RSS."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Buka tautan dalam aplikasi"</string> |     <string name="pref_article_viewer_title">"Buka tautan dalam aplikasi"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Artikel akan dibuka di dalam aplikasi"</string> |     <string name="pref_article_viewer_on">"Artikel akan dibuka di dalam aplikasi"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Artikel akan dibuka dalam peramban bawaan Anda"</string> |     <string name="pref_article_viewer_off">"Artikel akan dibuka dalam peramban bawaan Anda"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Gunakan pratinjau artikel"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Lihat artikel di penampil daripada peramban internal"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Gunakan peramban internal dan bukan penampil artikel"</string> |  | ||||||
|     <string name="pref_general_category_links">"Pengolahan tautan"</string> |     <string name="pref_general_category_links">"Pengolahan tautan"</string> | ||||||
|     <string name="pref_general_category_displaying">"Tampilan"</string> |     <string name="pref_general_category_displaying">"Tampilan"</string> | ||||||
|     <string name="pref_switch_card_view_on">"Artikel ini akan ditampilkan dalam bentuk kartu"</string> |     <string name="pref_switch_card_view_on">"Artikel ini akan ditampilkan dalam bentuk kartu"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">Tinggi kartu akan disesuaikan dengan konten</string> |     <string name="card_height_on">Tinggi kartu akan disesuaikan dengan konten</string> | ||||||
|     <string name="card_height_off">Ukuran kartu akan tetap</string> |     <string name="card_height_off">Ukuran kartu akan tetap</string> | ||||||
|     <string name="source_code">Kode sumber</string> |     <string name="source_code">Kode sumber</string> | ||||||
|     <string name="cant_mark_read">Tidak dapat menandai artikel sebagai telah dibaca</string> |     <string name="filter_item_tags">Tag</string> | ||||||
|     <string name="cant_mark_unread">Can\'t mark article as unread</string> |     <string name="filter_item_sources">Sumber</string> | ||||||
|     <string name="drawer_error_loading_tags">Kesalahan saat memuat tag…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Kesalahan saat memuat sumber…</string> |  | ||||||
|     <string name="drawer_item_filters">Filter</string> |  | ||||||
|     <string name="drawer_action_clear">kosongkan</string> |  | ||||||
|     <string name="drawer_item_tags">Tag</string> |  | ||||||
|     <string name="drawer_item_sources">Sumber</string> |  | ||||||
|     <string name="drawer_action_edit">suntung</string> |  | ||||||
|     <string name="no_tags_loaded">Tidak ada tag yang dimuat</string> |  | ||||||
|     <string name="no_sources_loaded">Tak ada sumber yang dimuat</string> |  | ||||||
|     <string name="drawer_loading">Memuat …</string> |  | ||||||
|     <string name="menu_home_search">Cari</string> |     <string name="menu_home_search">Cari</string> | ||||||
|     <string name="can_delete_source">Tidak dapat menghapus sumber…</string> |     <string name="can_delete_source">Tidak dapat menghapus sumber…</string> | ||||||
|     <string name="base_url_error">Ada masalah saat berkomunikasi dengan Selfoss Anda. Jika masalah berlanjut, tolong hubungi saya.</string> |     <string name="base_url_error">Ada masalah saat berkomunikasi dengan Selfoss Anda. Jika masalah berlanjut, tolong hubungi saya.</string> | ||||||
|     <string name="pref_header_theme">Tema</string> |     <string name="pref_header_theme">Tema</string> | ||||||
|     <string name="default_theme">Bawaan</string> |  | ||||||
|     <string name="default_dark_theme">Bawaan/Gelap</string> |  | ||||||
|     <string name="pref_header_debug">Debug</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Sertifikat yang ditandatangani sendiri?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Untuk alasan keamanan, sertifikat yang ditandatangani sendiri tidak didukung secara bawaan. Jika Anda mengaktifkan item ini, saya tidak akan bertanggung jawab atas masalah keamanan yang Anda hadapi.</string> |  | ||||||
|     <string name="pref_selfoss_category">Selfoss Api</string> |     <string name="pref_selfoss_category">Selfoss Api</string> | ||||||
|     <string name="pref_api_items_number_title">Item nomor dimuat</string> |     <string name="pref_api_items_number_title">Item nomor dimuat</string> | ||||||
|     <string name="pref_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="summary_debug_identifier">Identifikasi debug</string> |  | ||||||
|     <string name="unique_id_to_clipboard">Salin pengenal ke papan klip Anda</string> |  | ||||||
|     <string name="display_header_drawer_summary">Kop dengan alamat link Selfoss ditampilkan di laci lateral.</string> |  | ||||||
|     <string name="display_header_drawer_title">Kop akun</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Muat lebih banyak artikel saat membalik halaman</string> |     <string name="pref_general_infinite_loading_title">Muat lebih banyak artikel saat membalik halaman</string> | ||||||
|     <string name="translation">Terjemahan</string> |     <string name="translation">Terjemahan</string> | ||||||
|     <string name="cant_open_invalid_url">Alamat tautan proyek tidak valid. Saya mencoba memecahkan masalah ini untuk menghindari aplikasi berhenti.</string> |     <string name="cant_open_invalid_url">Alamat tautan proyek tidak valid. Saya mencoba memecahkan masalah ini untuk menghindari aplikasi berhenti.</string> | ||||||
|     <string name="drawer_report_bug">Laporkan bug</string> |  | ||||||
|     <string name="items_number_should_be_number">Jumlah item harus berupa bilangan bulat.</string> |     <string name="items_number_should_be_number">Jumlah item harus berupa bilangan bulat.</string> | ||||||
|     <string name="reader_action_more">Baca lebih lanjut</string> |  | ||||||
|     <string name="reader_action_open">Buka di peramban</string> |     <string name="reader_action_open">Buka di peramban</string> | ||||||
|     <string name="reader_action_share">Bagikan</string> |     <string name="reader_action_share">Bagikan</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> |     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> | ||||||
|     <string name="add_to_favs_reader">Add to favorites</string> |     <string name="add_to_favs_reader">Add to favorites</string> | ||||||
|     <string name="remove_to_favs_reader">Remove from favorites</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Article reader content font size</string> |     <string name="pref_content_reader_font_size">Article reader content font size</string> | ||||||
|     <string name="pref_header_viewer">Article viewer</string> |     <string name="pref_header_viewer">Article viewer</string> | ||||||
|     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> |     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> | ||||||
|     <string name="markall_dialog_message">This will mark all the items as read.</string> |     <string name="markall_dialog_message">This will mark all the items as read.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> |     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> |     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Automatically send crash reports</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Will send crash reports automatically</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Will ask everytime when sending crash reports.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Crash reports</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Debug logging (these will be sent without a dialog)</string> |  | ||||||
|     <string name="acra_login">Enable logging</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="unmark">Mark item as unread</string> |     <string name="unmark">Mark item as unread</string> | ||||||
|     <string name="pref_header_offline">Offline and cache</string> |     <string name="pref_header_offline">Offline and cache</string> | ||||||
|     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> |     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Save items for offline use</string> |     <string name="pref_switch_items_caching">Save items for offline use</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Not connected !</string> |  | ||||||
|     <string name="network_connectivity_lost">"Network connection lost"</string> |     <string name="network_connectivity_lost">"Network connection lost"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Network connection is now available"</string> |     <string name="network_connectivity_retrieved">"Network connection is now available"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sync articles</string> |     <string name="pref_switch_periodic_refresh">Sync articles</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> |     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> |     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> | ||||||
|     <string name="loading_notification_title">Loading ...</string> |     <string name="loading_notification_title">Loading …</string> | ||||||
|     <string name="loading_notification_text">Selfoss is syncing your articles</string> |     <string name="loading_notification_text">Selfoss is syncing your articles</string> | ||||||
|     <string name="notification_channel_sync">Sync notification</string> |     <string name="notification_channel_sync">Sync notification</string> | ||||||
|     <string name="new_items_channel_sync">New items notification</string> |     <string name="new_items_channel_sync">New items notification</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Lettore RSS per Selfoss"</string> |     <string name="app_name">"Lettore RSS per Selfoss"</string> | ||||||
|     <string name="title_activity_login">"Accedi"</string> |     <string name="title_activity_login">"Accedi"</string> | ||||||
|     <string name="prompt_password">"Password"</string> |     <string name="prompt_password">"Password"</string> | ||||||
|     <string name="prompt_http_password">"Password HTTP"</string> |  | ||||||
|     <string name="action_sign_in">"Vai"</string> |     <string name="action_sign_in">"Vai"</string> | ||||||
|     <string name="error_invalid_password">"La password non è sufficientemente lunga"</string> |     <string name="error_invalid_password">"La password non è sufficientemente lunga"</string> | ||||||
|     <string name="error_field_required">"Campo obbligatorio"</string> |     <string name="error_field_required">"Campo obbligatorio"</string> | ||||||
|     <string name="prompt_url">"URL"</string> |     <string name="prompt_url">"URL"</string> | ||||||
|     <string name="withLoginSwitch">"È richiesto l'accesso?"</string> |     <string name="withLoginSwitch">"È richiesto l'accesso?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"Accesso HTTP necessario?"</string> |  | ||||||
|     <string name="login_url_problem">"Oops. Potrebbe essere necessario aggiungere un \"/\" alla fine dell'url."</string> |     <string name="login_url_problem">"Oops. Potrebbe essere necessario aggiungere un \"/\" alla fine dell'url."</string> | ||||||
|     <string name="prompt_login">"Nome utente"</string> |     <string name="prompt_login">"Nome utente"</string> | ||||||
|     <string name="prompt_http_login">"Nome utente HTTP"</string> |  | ||||||
|     <string name="label_share">"Condividi"</string> |  | ||||||
|     <string name="readAll">"Segna tutte come lette"</string> |     <string name="readAll">"Segna tutte come lette"</string> | ||||||
|     <string name="action_disconnect">"Scollegati"</string> |     <string name="action_disconnect">"Scollegati"</string> | ||||||
|     <string name="title_activity_settings">"Impostazioni"</string> |     <string name="title_activity_settings">"Impostazioni"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Controlla nuovamente i dati."</string> |     <string name="wrong_infos">"Controlla nuovamente i dati."</string> | ||||||
|     <string name="all_posts_not_read">"All posts weren't read"</string> |     <string name="all_posts_not_read">"All posts weren't read"</string> | ||||||
|     <string name="all_posts_read">"Tutti i messaggi sono stati letti"</string> |     <string name="all_posts_read">"Tutti i messaggi sono stati letti"</string> | ||||||
|     <string name="cant_get_favs">"Non è possibile ottenere i preferiti"</string> |  | ||||||
|     <string name="cant_get_new_elements">"Non è possibile ottenere nuovi articoli"</string> |  | ||||||
|     <string name="cant_get_read">"Can't get read articles"</string> |  | ||||||
|     <string name="nothing_here">"Non c'è niente qui"</string> |     <string name="nothing_here">"Non c'è niente qui"</string> | ||||||
|     <string name="tab_new">"Nuovi"</string> |     <string name="tab_new">"Nuovi"</string> | ||||||
|     <string name="tab_read">"Tutti"</string> |     <string name="tab_read">"Tutti"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"Segnalare un bug o richiedere una nuova funzionalità"</string> |     <string name="issue_tracker_summary">"Segnalare un bug o richiedere una nuova funzionalità"</string> | ||||||
|     <string name="warning_wrong_url">"ATTENZIONE"</string> |     <string name="warning_wrong_url">"ATTENZIONE"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Visualizzazione a schede"</string> |     <string name="pref_switch_card_view_title">"Visualizzazione a schede"</string> | ||||||
|     <string name="cant_mark_favortie">"Can't mark article as favorite"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"Can't remove item from favorite"</string> |  | ||||||
|     <string name="share">"Share"</string> |     <string name="share">"Share"</string> | ||||||
|     <string name="rating_prompt_title">"Enjoying the app ?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"Yes !"</string> |  | ||||||
|     <string name="rating_prompt_no">"Not really …"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"Can you tell us why ?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"OK !"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Not now."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Great ! Can you rate us on the Store ?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"Sure !"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Not right now."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Thanks, your feedback help enhance the app !"</string> |  | ||||||
|     <string name="switch_unread_count">"Display the unread count as a badge for the bottom bar."</string> |     <string name="switch_unread_count">"Display the unread count as a badge for the bottom bar."</string> | ||||||
|     <string name="switch_unread_count_title">"Display unread count"</string> |     <string name="switch_unread_count_title">"Display unread count"</string> | ||||||
|     <string name="display_all_counts_title">"Display count for favorite and read"</string> |     <string name="display_all_counts_title">"Display count for favorite and read"</string> | ||||||
|     <string name="text_wrong_url">"You seem to be trying to use an invalid URL. Make sure it is correct, and if the problem persists, contact me (via the store contact link). Please note that the app needs you to be using Selfoss. You can't access RSS feeds without it."</string> |     <string name="text_wrong_url">"You seem to be trying to use an invalid URL. Make sure it is correct, and if the problem persists, contact me (via the store contact link). Please note that the app needs you to be using Selfoss. You can't access RSS feeds without it."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Open links inside the app"</string> |     <string name="pref_article_viewer_title">"Open links inside the app"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Articles will open inside the app"</string> |     <string name="pref_article_viewer_on">"Articles will open inside the app"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Articles will open with your default browser"</string> |     <string name="pref_article_viewer_off">"Articles will open with your default browser"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Use the article viewer"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Will use the article viewer instead of the internal browser"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Will use the internal browser instead of the article viewer"</string> |  | ||||||
|     <string name="pref_general_category_links">"Link handling"</string> |     <string name="pref_general_category_links">"Link handling"</string> | ||||||
|     <string name="pref_general_category_displaying">"Displaying"</string> |     <string name="pref_general_category_displaying">"Displaying"</string> | ||||||
|     <string name="pref_switch_card_view_on">"The articles will be displayed as cards"</string> |     <string name="pref_switch_card_view_on">"The articles will be displayed as cards"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">Cards height will adjust to its content</string> |     <string name="card_height_on">Cards height will adjust to its content</string> | ||||||
|     <string name="card_height_off">Card height will be fixed</string> |     <string name="card_height_off">Card height will be fixed</string> | ||||||
|     <string name="source_code">Codice sorgente</string> |     <string name="source_code">Codice sorgente</string> | ||||||
|     <string name="cant_mark_read">Impossibile contrassegnare l\'articolo come già letto</string> |     <string name="filter_item_tags">Tags</string> | ||||||
|     <string name="cant_mark_unread">Can\'t mark article as unread</string> |     <string name="filter_item_sources">Fonti</string> | ||||||
|     <string name="drawer_error_loading_tags">Errore nel caricamento dei tag…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Errore nel caricamento delle fonti…</string> |  | ||||||
|     <string name="drawer_item_filters">Filtri</string> |  | ||||||
|     <string name="drawer_action_clear">cancella</string> |  | ||||||
|     <string name="drawer_item_tags">Tags</string> |  | ||||||
|     <string name="drawer_item_sources">Fonti</string> |  | ||||||
|     <string name="drawer_action_edit">modifica</string> |  | ||||||
|     <string name="no_tags_loaded">Nessun tag caricato</string> |  | ||||||
|     <string name="no_sources_loaded">No sources loaded</string> |  | ||||||
|     <string name="drawer_loading">Caricamento…</string> |  | ||||||
|     <string name="menu_home_search">Cerca</string> |     <string name="menu_home_search">Cerca</string> | ||||||
|     <string name="can_delete_source">Non è possibile eliminare la fonte…</string> |     <string name="can_delete_source">Non è possibile eliminare la fonte…</string> | ||||||
|     <string name="base_url_error">There was an issue when trying to communicate with your Selfoss Instance. If the issue persists, please get in touch with me.</string> |     <string name="base_url_error">There was an issue when trying to communicate with your Selfoss Instance. If the issue persists, please get in touch with me.</string> | ||||||
|     <string name="pref_header_theme">Temi</string> |     <string name="pref_header_theme">Temi</string> | ||||||
|     <string name="default_theme">Predefinito</string> |  | ||||||
|     <string name="default_dark_theme">Predefinito (Scuro)</string> |  | ||||||
|     <string name="pref_header_debug">Debug</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Using a self hosted certificate ?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Due to security reasons, self signed certificates are not supported by default. By activating this, I\'ll not be responsible of any security problem you encounter.</string> |  | ||||||
|     <string name="pref_selfoss_category">Api di Selfoss</string> |     <string name="pref_selfoss_category">Api di Selfoss</string> | ||||||
|     <string name="pref_api_items_number_title">Numero di elementi caricati</string> |     <string name="pref_api_items_number_title">Numero di elementi caricati</string> | ||||||
|     <string name="pref_hidden_tags">Tag nascosti</string> |  | ||||||
|     <string name="summary_debug_identifier">Debug identifier</string> |  | ||||||
|     <string name="unique_id_to_clipboard">Identifier copied to your clipboard</string> |  | ||||||
|     <string name="display_header_drawer_summary">Display a header with the selfoss instance url on the lateral drawer.</string> |  | ||||||
|     <string name="display_header_drawer_title">Account header</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Load more articles on scroll</string> |     <string name="pref_general_infinite_loading_title">Load more articles on scroll</string> | ||||||
|     <string name="translation">Traduzioni</string> |     <string name="translation">Traduzioni</string> | ||||||
|     <string name="cant_open_invalid_url">The item url is invalid. I\'m looking into solving this issue so the app won\'t crash.</string> |     <string name="cant_open_invalid_url">The item url is invalid. I\'m looking into solving this issue so the app won\'t crash.</string> | ||||||
|     <string name="drawer_report_bug">Segnala un bug</string> |  | ||||||
|     <string name="items_number_should_be_number">The items number should be an integer.</string> |     <string name="items_number_should_be_number">The items number should be an integer.</string> | ||||||
|     <string name="reader_action_more">Read more</string> |  | ||||||
|     <string name="reader_action_open">Open in browser</string> |     <string name="reader_action_open">Open in browser</string> | ||||||
|     <string name="reader_action_share">Share</string> |     <string name="reader_action_share">Share</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> |     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> | ||||||
|     <string name="add_to_favs_reader">Add to favorites</string> |     <string name="add_to_favs_reader">Add to favorites</string> | ||||||
|     <string name="remove_to_favs_reader">Remove from favorites</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Article reader content font size</string> |     <string name="pref_content_reader_font_size">Article reader content font size</string> | ||||||
|     <string name="pref_header_viewer">Article viewer</string> |     <string name="pref_header_viewer">Article viewer</string> | ||||||
|     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> |     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> | ||||||
|     <string name="markall_dialog_message">This will mark all the items as read.</string> |     <string name="markall_dialog_message">This will mark all the items as read.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> |     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> |     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Automatically send crash reports</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Will send crash reports automatically</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Will ask everytime when sending crash reports.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Crash reports</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Debug logging (these will be sent without a dialog)</string> |  | ||||||
|     <string name="acra_login">Enable logging</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="unmark">Segna come non letto</string> |     <string name="unmark">Segna come non letto</string> | ||||||
|     <string name="pref_header_offline">Offline and cache</string> |     <string name="pref_header_offline">Offline and cache</string> | ||||||
|     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> |     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Save items for offline use</string> |     <string name="pref_switch_items_caching">Save items for offline use</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Not connected !</string> |  | ||||||
|     <string name="network_connectivity_lost">"Network connection lost"</string> |     <string name="network_connectivity_lost">"Network connection lost"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Network connection is now available"</string> |     <string name="network_connectivity_retrieved">"Network connection is now available"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sync articles</string> |     <string name="pref_switch_periodic_refresh">Sync articles</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> |     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> |     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> | ||||||
|     <string name="loading_notification_title">Loading ...</string> |     <string name="loading_notification_title">Loading …</string> | ||||||
|     <string name="loading_notification_text">Selfoss is syncing your articles</string> |     <string name="loading_notification_text">Selfoss is syncing your articles</string> | ||||||
|     <string name="notification_channel_sync">Sync notification</string> |     <string name="notification_channel_sync">Sync notification</string> | ||||||
|     <string name="new_items_channel_sync">New items notification</string> |     <string name="new_items_channel_sync">New items notification</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Reader for Selfoss"</string> |     <string name="app_name">"Reader for Selfoss"</string> | ||||||
|     <string name="title_activity_login">"로그인"</string> |     <string name="title_activity_login">"로그인"</string> | ||||||
|     <string name="prompt_password">"비밀번호"</string> |     <string name="prompt_password">"비밀번호"</string> | ||||||
|     <string name="prompt_http_password">"HTTP 암호"</string> |  | ||||||
|     <string name="action_sign_in">"Go"</string> |     <string name="action_sign_in">"Go"</string> | ||||||
|     <string name="error_invalid_password">"패스워드가 짧습니다."</string> |     <string name="error_invalid_password">"패스워드가 짧습니다."</string> | ||||||
|     <string name="error_field_required">"필수 항목"</string> |     <string name="error_field_required">"필수 항목"</string> | ||||||
|     <string name="prompt_url">"Url"</string> |     <string name="prompt_url">"Url"</string> | ||||||
|     <string name="withLoginSwitch">"로그인이 필요합니까?"</string> |     <string name="withLoginSwitch">"로그인이 필요합니까?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"HTTP 로그인이 필요 합니까?"</string> |  | ||||||
|     <string name="login_url_problem">"죄송합니다. Url의 끝에 \"/\"를 추가할 필요가 있습니다."</string> |     <string name="login_url_problem">"죄송합니다. Url의 끝에 \"/\"를 추가할 필요가 있습니다."</string> | ||||||
|     <string name="prompt_login">"사용자 이름"</string> |     <string name="prompt_login">"사용자 이름"</string> | ||||||
|     <string name="prompt_http_login">"HTTP 사용자 이름"</string> |  | ||||||
|     <string name="label_share">"공유"</string> |  | ||||||
|     <string name="readAll">"모두 읽기"</string> |     <string name="readAll">"모두 읽기"</string> | ||||||
|     <string name="action_disconnect">"연결 해제"</string> |     <string name="action_disconnect">"연결 해제"</string> | ||||||
|     <string name="title_activity_settings">"설정"</string> |     <string name="title_activity_settings">"설정"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"세부 정보를 다시 확인하세요."</string> |     <string name="wrong_infos">"세부 정보를 다시 확인하세요."</string> | ||||||
|     <string name="all_posts_not_read">"모든 게시물을 읽지 않았습니다."</string> |     <string name="all_posts_not_read">"모든 게시물을 읽지 않았습니다."</string> | ||||||
|     <string name="all_posts_read">"모든 게시물을 읽었습니다."</string> |     <string name="all_posts_read">"모든 게시물을 읽었습니다."</string> | ||||||
|     <string name="cant_get_favs">"즐겨찾기를 가져올 수 없습니다."</string> |  | ||||||
|     <string name="cant_get_new_elements">"새로운 기사를 가져올 수 없습니다."</string> |  | ||||||
|     <string name="cant_get_read">"읽은 기사를 가져올 수 없습니다."</string> |  | ||||||
|     <string name="nothing_here">"비어있음"</string> |     <string name="nothing_here">"비어있음"</string> | ||||||
|     <string name="tab_new">"새로운"</string> |     <string name="tab_new">"새로운"</string> | ||||||
|     <string name="tab_read">"전체"</string> |     <string name="tab_read">"전체"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"버그를 보고 하거나 새기능에 대해 요청하세요."</string> |     <string name="issue_tracker_summary">"버그를 보고 하거나 새기능에 대해 요청하세요."</string> | ||||||
|     <string name="warning_wrong_url">"경고"</string> |     <string name="warning_wrong_url">"경고"</string> | ||||||
|     <string name="pref_switch_card_view_title">"카드 형식 보기"</string> |     <string name="pref_switch_card_view_title">"카드 형식 보기"</string> | ||||||
|     <string name="cant_mark_favortie">"좋아하는 문서를 마크할 수 없습니다."</string> |  | ||||||
|     <string name="cant_unmark_favortie">"좋아하는 항목에서 제거할 수 없습니다."</string> |  | ||||||
|     <string name="share">"공유"</string> |     <string name="share">"공유"</string> | ||||||
|     <string name="rating_prompt_title">"이 앱에 만족하십니까?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"예!"</string> |  | ||||||
|     <string name="rating_prompt_no">"설마..."</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"이유를 우리에게 말해줄 수 있습니까?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"OK!"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"나중에"</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Great ! Can you rate us on the Store ?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"Sure !"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Not right now."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Thanks, your feedback help enhance the app !"</string> |  | ||||||
|     <string name="switch_unread_count">"Display the unread count as a badge for the bottom bar."</string> |     <string name="switch_unread_count">"Display the unread count as a badge for the bottom bar."</string> | ||||||
|     <string name="switch_unread_count_title">"Display unread count"</string> |     <string name="switch_unread_count_title">"Display unread count"</string> | ||||||
|     <string name="display_all_counts_title">"Display count for favorite and read"</string> |     <string name="display_all_counts_title">"Display count for favorite and read"</string> | ||||||
|     <string name="text_wrong_url">"You seem to be trying to use an invalid URL. Make sure it is correct, and if the problem persists, contact me (via the store contact link). Please note that the app needs you to be using Selfoss. You can't access RSS feeds without it."</string> |     <string name="text_wrong_url">"You seem to be trying to use an invalid URL. Make sure it is correct, and if the problem persists, contact me (via the store contact link). Please note that the app needs you to be using Selfoss. You can't access RSS feeds without it."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Open links inside the app"</string> |     <string name="pref_article_viewer_title">"Open links inside the app"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Articles will open inside the app"</string> |     <string name="pref_article_viewer_on">"Articles will open inside the app"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Articles will open with your default browser"</string> |     <string name="pref_article_viewer_off">"Articles will open with your default browser"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Use the article viewer"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Will use the article viewer instead of the internal browser"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Will use the internal browser instead of the article viewer"</string> |  | ||||||
|     <string name="pref_general_category_links">"Link handling"</string> |     <string name="pref_general_category_links">"Link handling"</string> | ||||||
|     <string name="pref_general_category_displaying">"Displaying"</string> |     <string name="pref_general_category_displaying">"Displaying"</string> | ||||||
|     <string name="pref_switch_card_view_on">"The articles will be displayed as cards"</string> |     <string name="pref_switch_card_view_on">"The articles will be displayed as cards"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">Cards height will adjust to its content</string> |     <string name="card_height_on">Cards height will adjust to its content</string> | ||||||
|     <string name="card_height_off">Card height will be fixed</string> |     <string name="card_height_off">Card height will be fixed</string> | ||||||
|     <string name="source_code">Source code</string> |     <string name="source_code">Source code</string> | ||||||
|     <string name="cant_mark_read">Can\'t mark article as read</string> |     <string name="filter_item_tags">Tags</string> | ||||||
|     <string name="cant_mark_unread">Can\'t mark article as unread</string> |     <string name="filter_item_sources">Sources</string> | ||||||
|     <string name="drawer_error_loading_tags">Error loading tags…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Error loading sources…</string> |  | ||||||
|     <string name="drawer_item_filters">Filters</string> |  | ||||||
|     <string name="drawer_action_clear">clear</string> |  | ||||||
|     <string name="drawer_item_tags">Tags</string> |  | ||||||
|     <string name="drawer_item_sources">Sources</string> |  | ||||||
|     <string name="drawer_action_edit">edit</string> |  | ||||||
|     <string name="no_tags_loaded">No tags loaded</string> |  | ||||||
|     <string name="no_sources_loaded">No sources loaded</string> |  | ||||||
|     <string name="drawer_loading">Loading …</string> |  | ||||||
|     <string name="menu_home_search">Search</string> |     <string name="menu_home_search">Search</string> | ||||||
|     <string name="can_delete_source">Can\'t delete the source…</string> |     <string name="can_delete_source">Can\'t delete the source…</string> | ||||||
|     <string name="base_url_error">There was an issue when trying to communicate with your Selfoss Instance. If the issue persists, please get in touch with me.</string> |     <string name="base_url_error">There was an issue when trying to communicate with your Selfoss Instance. If the issue persists, please get in touch with me.</string> | ||||||
|     <string name="pref_header_theme">Themes</string> |     <string name="pref_header_theme">Themes</string> | ||||||
|     <string name="default_theme">Default</string> |  | ||||||
|     <string name="default_dark_theme">Default/Dark</string> |  | ||||||
|     <string name="pref_header_debug">Debug</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Using a self hosted certificate ?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Due to security reasons, self signed certificates are not supported by default. By activating this, I\'ll not be responsible of any security problem you encounter.</string> |  | ||||||
|     <string name="pref_selfoss_category">Selfoss Api</string> |     <string name="pref_selfoss_category">Selfoss Api</string> | ||||||
|     <string name="pref_api_items_number_title">Loaded items number</string> |     <string name="pref_api_items_number_title">Loaded items number</string> | ||||||
|     <string name="pref_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="summary_debug_identifier">Debug identifier</string> |  | ||||||
|     <string name="unique_id_to_clipboard">Identifier copied to your clipboard</string> |  | ||||||
|     <string name="display_header_drawer_summary">Display a header with the selfoss instance url on the lateral drawer.</string> |  | ||||||
|     <string name="display_header_drawer_title">Account header</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Load more articles on scroll</string> |     <string name="pref_general_infinite_loading_title">Load more articles on scroll</string> | ||||||
|     <string name="translation">Translation</string> |     <string name="translation">Translation</string> | ||||||
|     <string name="cant_open_invalid_url">The item url is invalid. I\'m looking into solving this issue so the app won\'t crash.</string> |     <string name="cant_open_invalid_url">The item url is invalid. I\'m looking into solving this issue so the app won\'t crash.</string> | ||||||
|     <string name="drawer_report_bug">Report a bug</string> |  | ||||||
|     <string name="items_number_should_be_number">The items number should be an integer.</string> |     <string name="items_number_should_be_number">The items number should be an integer.</string> | ||||||
|     <string name="reader_action_more">Read more</string> |  | ||||||
|     <string name="reader_action_open">Open in browser</string> |     <string name="reader_action_open">Open in browser</string> | ||||||
|     <string name="reader_action_share">Share</string> |     <string name="reader_action_share">Share</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> |     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> | ||||||
|     <string name="add_to_favs_reader">Add to favorites</string> |     <string name="add_to_favs_reader">Add to favorites</string> | ||||||
|     <string name="remove_to_favs_reader">Remove from favorites</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Article reader content font size</string> |     <string name="pref_content_reader_font_size">Article reader content font size</string> | ||||||
|     <string name="pref_header_viewer">Article viewer</string> |     <string name="pref_header_viewer">Article viewer</string> | ||||||
|     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> |     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> | ||||||
|     <string name="markall_dialog_message">This will mark all the items as read.</string> |     <string name="markall_dialog_message">This will mark all the items as read.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> |     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> |     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Automatically send crash reports</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Will send crash reports automatically</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Will ask everytime when sending crash reports.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Crash reports</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Debug logging (these will be sent without a dialog)</string> |  | ||||||
|     <string name="acra_login">Enable logging</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="unmark">Mark item as unread</string> |     <string name="unmark">Mark item as unread</string> | ||||||
|     <string name="pref_header_offline">Offline and cache</string> |     <string name="pref_header_offline">Offline and cache</string> | ||||||
|     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> |     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Save items for offline use</string> |     <string name="pref_switch_items_caching">Save items for offline use</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Not connected !</string> |  | ||||||
|     <string name="network_connectivity_lost">"Network connection lost"</string> |     <string name="network_connectivity_lost">"Network connection lost"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Network connection is now available"</string> |     <string name="network_connectivity_retrieved">"Network connection is now available"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sync articles</string> |     <string name="pref_switch_periodic_refresh">Sync articles</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> |     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> |     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> | ||||||
|     <string name="loading_notification_title">Loading ...</string> |     <string name="loading_notification_title">Loading …</string> | ||||||
|     <string name="loading_notification_text">Selfoss is syncing your articles</string> |     <string name="loading_notification_text">Selfoss is syncing your articles</string> | ||||||
|     <string name="notification_channel_sync">Sync notification</string> |     <string name="notification_channel_sync">Sync notification</string> | ||||||
|     <string name="new_items_channel_sync">New items notification</string> |     <string name="new_items_channel_sync">New items notification</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
							
								
								
									
										11
									
								
								androidApp/src/main/res/values-night/strings.xml
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										11
									
								
								androidApp/src/main/res/values-night/strings.xml
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,11 @@ | |||||||
|  | <?xml version="1.0" encoding="utf-8"?> | ||||||
|  | <resources> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
|  | </resources> | ||||||
							
								
								
									
										13
									
								
								androidApp/src/main/res/values-night/styles.xml
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										13
									
								
								androidApp/src/main/res/values-night/styles.xml
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,13 @@ | |||||||
|  | <resources> | ||||||
|  |     <style name="NoBar" parent="Theme.MaterialComponents.DayNight.NoActionBar"> | ||||||
|  |         <item name="colorPrimary">@color/colorPrimary</item> | ||||||
|  |         <item name="colorPrimaryDark">@color/colorPrimaryDark</item> | ||||||
|  |         <item name="colorAccent">@color/colorAccent</item> | ||||||
|  |         <item name="colorAccentDark">@color/colorAccentDark</item> | ||||||
|  |         <item name="preferenceTheme">@style/PreferenceStyle</item> | ||||||
|  |         <item name="android:statusBarColor">@color/dark</item> | ||||||
|  |         <item name="bottomBarBackground">@color/dark</item> | ||||||
|  |         <item name="toolbarPopupTheme">@style/ThemeOverlay.AppCompat.Dark</item> | ||||||
|  |         <item name="webviewBackground">@color/dark</item> | ||||||
|  |     </style> | ||||||
|  | </resources> | ||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Selfoss Reader"</string> |     <string name="app_name">"Selfoss Reader"</string> | ||||||
|     <string name="title_activity_login">"Inloggen"</string> |     <string name="title_activity_login">"Inloggen"</string> | ||||||
|     <string name="prompt_password">"Wachtwoord"</string> |     <string name="prompt_password">"Wachtwoord"</string> | ||||||
|     <string name="prompt_http_password">"HTTP Wachtwoord"</string> |  | ||||||
|     <string name="action_sign_in">"Inloggen"</string> |     <string name="action_sign_in">"Inloggen"</string> | ||||||
|     <string name="error_invalid_password">"Wachtwoord niet lang genoeg"</string> |     <string name="error_invalid_password">"Wachtwoord niet lang genoeg"</string> | ||||||
|     <string name="error_field_required">"Dit veld is verplicht"</string> |     <string name="error_field_required">"Dit veld is verplicht"</string> | ||||||
|     <string name="prompt_url">"Selfoss server"</string> |     <string name="prompt_url">"Selfoss server"</string> | ||||||
|     <string name="withLoginSwitch">"Authenticatie vereist?"</string> |     <string name="withLoginSwitch">"Authenticatie vereist?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"HTTP Authenticatie vereist?"</string> |  | ||||||
|     <string name="login_url_problem">"Oeps, ben je soms de \"/\" vergeten aan het eind?"</string> |     <string name="login_url_problem">"Oeps, ben je soms de \"/\" vergeten aan het eind?"</string> | ||||||
|     <string name="prompt_login">"Gebruikersnaam"</string> |     <string name="prompt_login">"Gebruikersnaam"</string> | ||||||
|     <string name="prompt_http_login">"HTTP Gebruikersnaam"</string> |  | ||||||
|     <string name="label_share">"Delen"</string> |  | ||||||
|     <string name="readAll">"Alles lezen"</string> |     <string name="readAll">"Alles lezen"</string> | ||||||
|     <string name="action_disconnect">"Verbinding verbreken"</string> |     <string name="action_disconnect">"Verbinding verbreken"</string> | ||||||
|     <string name="title_activity_settings">"Instellingen"</string> |     <string name="title_activity_settings">"Instellingen"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Controleer de gegevens nogmaals."</string> |     <string name="wrong_infos">"Controleer de gegevens nogmaals."</string> | ||||||
|     <string name="all_posts_not_read">"Fout bij markeren als gelezen"</string> |     <string name="all_posts_not_read">"Fout bij markeren als gelezen"</string> | ||||||
|     <string name="all_posts_read">"Alle artikelen gemarkeerd als gelezen"</string> |     <string name="all_posts_read">"Alle artikelen gemarkeerd als gelezen"</string> | ||||||
|     <string name="cant_get_favs">"Ophalen favorieten mislukt"</string> |  | ||||||
|     <string name="cant_get_new_elements">"Ophalen nieuwe artikelen mislukt"</string> |  | ||||||
|     <string name="cant_get_read">"Ophalen reeds gelezen artikelen mislukt"</string> |  | ||||||
|     <string name="nothing_here">"Niets gevonden"</string> |     <string name="nothing_here">"Niets gevonden"</string> | ||||||
|     <string name="tab_new">"Nieuw"</string> |     <string name="tab_new">"Nieuw"</string> | ||||||
|     <string name="tab_read">"Alle"</string> |     <string name="tab_read">"Alle"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"Rapporteer een probleem of dien een verzoek in"</string> |     <string name="issue_tracker_summary">"Rapporteer een probleem of dien een verzoek in"</string> | ||||||
|     <string name="warning_wrong_url">"WAARSCHUWING"</string> |     <string name="warning_wrong_url">"WAARSCHUWING"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Kaart weergave"</string> |     <string name="pref_switch_card_view_title">"Kaart weergave"</string> | ||||||
|     <string name="cant_mark_favortie">"Kan het artikel niet markeren als favoriet"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"Kan het item niet verwijderen uit favorieten"</string> |  | ||||||
|     <string name="share">"Delen"</string> |     <string name="share">"Delen"</string> | ||||||
|     <string name="rating_prompt_title">"Bevalt deze app?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"Ja!"</string> |  | ||||||
|     <string name="rating_prompt_no">"Niet echt…"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"Kun je ons vertellen waarom?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"OK!"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Niet nu."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Fantastisch! Wil je een review achter laten in de Store?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"Vanzelfsprekend"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Niet op dit moment"</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Bedankt, jouw feedback helpt ons de app te verbeteren"</string> |  | ||||||
|     <string name="switch_unread_count">"Geef het aantal ongelezen artikelen weer in de balk onderaan"</string> |     <string name="switch_unread_count">"Geef het aantal ongelezen artikelen weer in de balk onderaan"</string> | ||||||
|     <string name="switch_unread_count_title">"Geef aantal ongelezen weer"</string> |     <string name="switch_unread_count_title">"Geef aantal ongelezen weer"</string> | ||||||
|     <string name="display_all_counts_title">"Geef aantal weer bij favorieten en gelezen"</string> |     <string name="display_all_counts_title">"Geef aantal weer bij favorieten en gelezen"</string> | ||||||
|     <string name="text_wrong_url">"De gebruikte link lijkt onjuist. Controleer deze. Mocht het probleem blijven, neem dan contact met me op (via de contact link in de store). Om deze app te kunnen gebruiken heb je Selfoss nodig."</string> |     <string name="text_wrong_url">"De gebruikte link lijkt onjuist. Controleer deze. Mocht het probleem blijven, neem dan contact met me op (via de contact link in de store). Om deze app te kunnen gebruiken heb je Selfoss nodig."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Links opnemen in interne browser"</string> |     <string name="pref_article_viewer_title">"Links opnemen in interne browser"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Artikelen worden in de interne browser geopend"</string> |     <string name="pref_article_viewer_on">"Artikelen worden in de interne browser geopend"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Artikelen worden geopend in de standaard browser"</string> |     <string name="pref_article_viewer_off">"Artikelen worden geopend in de standaard browser"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Gebruik artikel viewer"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Artikelen in viewer weergeven in plaats van de interne browser"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Artikelen in interne browser weergeven in plaats van viewer"</string> |  | ||||||
|     <string name="pref_general_category_links">"Links"</string> |     <string name="pref_general_category_links">"Links"</string> | ||||||
|     <string name="pref_general_category_displaying">"Weergave"</string> |     <string name="pref_general_category_displaying">"Weergave"</string> | ||||||
|     <string name="pref_switch_card_view_on">"De artikelen worden als kaarten weergegeven"</string> |     <string name="pref_switch_card_view_on">"De artikelen worden als kaarten weergegeven"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">Hoogte aanpassen aan de hand van kaartinhoud</string> |     <string name="card_height_on">Hoogte aanpassen aan de hand van kaartinhoud</string> | ||||||
|     <string name="card_height_off">Vaste hoogte</string> |     <string name="card_height_off">Vaste hoogte</string> | ||||||
|     <string name="source_code">Broncode</string> |     <string name="source_code">Broncode</string> | ||||||
|     <string name="cant_mark_read">Impossible de marquer l\'article comme lu</string> |     <string name="filter_item_tags">Tags</string> | ||||||
|     <string name="cant_mark_unread">Can\'t mark article as unread</string> |     <string name="filter_item_sources">Bronnen</string> | ||||||
|     <string name="drawer_error_loading_tags">Fout bij het laden van tags…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Fout bij laden van bronnen…</string> |  | ||||||
|     <string name="drawer_item_filters">Filters</string> |  | ||||||
|     <string name="drawer_action_clear">wissen</string> |  | ||||||
|     <string name="drawer_item_tags">Tags</string> |  | ||||||
|     <string name="drawer_item_sources">Bronnen</string> |  | ||||||
|     <string name="drawer_action_edit">bewerken</string> |  | ||||||
|     <string name="no_tags_loaded">Geen tags geladen</string> |  | ||||||
|     <string name="no_sources_loaded">Geen bronnen geladen</string> |  | ||||||
|     <string name="drawer_loading">Bezig met laden …</string> |  | ||||||
|     <string name="menu_home_search">Zoeken</string> |     <string name="menu_home_search">Zoeken</string> | ||||||
|     <string name="can_delete_source">Kan de bron niet verwijderen…</string> |     <string name="can_delete_source">Kan de bron niet verwijderen…</string> | ||||||
|     <string name="base_url_error">Er was een probleem bij het communiceren met uw Selfoss Instance. Als het probleem blijft, neem dan contact met mij op.</string> |     <string name="base_url_error">Er was een probleem bij het communiceren met uw Selfoss Instance. Als het probleem blijft, neem dan contact met mij op.</string> | ||||||
|     <string name="pref_header_theme">Thema \'s</string> |     <string name="pref_header_theme">Thema \'s</string> | ||||||
|     <string name="default_theme">Standaard</string> |  | ||||||
|     <string name="default_dark_theme">Standaard/Donker</string> |  | ||||||
|     <string name="pref_header_debug">Fout opsporen</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Gebruik een zelf gehost certificaat?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Vanwege veiligheidsredenen worden zelfondertekende certificaten niet standaard ondersteund. Door dit te activeren, ben ik niet verantwoordelijk voor beveiligingsproblemen die u tegenkomt.</string> |  | ||||||
|     <string name="pref_selfoss_category">Selfoss Api</string> |     <string name="pref_selfoss_category">Selfoss Api</string> | ||||||
|     <string name="pref_api_items_number_title">Geladen items nummer</string> |     <string name="pref_api_items_number_title">Geladen items nummer</string> | ||||||
|     <string name="pref_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="summary_debug_identifier">ID voor foutopsporing</string> |  | ||||||
|     <string name="unique_id_to_clipboard">ID naar uw klembord gekopieerd</string> |  | ||||||
|     <string name="display_header_drawer_summary">Laat een koptekst weergeven met de url van de selfoss instantie in de zijlade.</string> |  | ||||||
|     <string name="display_header_drawer_title">Account titel</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Laad meer artikelen door te bladeren</string> |     <string name="pref_general_infinite_loading_title">Laad meer artikelen door te bladeren</string> | ||||||
|     <string name="translation">Vertaling</string> |     <string name="translation">Vertaling</string> | ||||||
|     <string name="cant_open_invalid_url">De URL is ongeldig. Ik probeer dit probleem op te lossen, zodat de toepassing niet wordt afgesloten.</string> |     <string name="cant_open_invalid_url">De URL is ongeldig. Ik probeer dit probleem op te lossen, zodat de toepassing niet wordt afgesloten.</string> | ||||||
|     <string name="drawer_report_bug">Een fout melden</string> |  | ||||||
|     <string name="items_number_should_be_number">Het aantal items moet een geheel getal zijn.</string> |     <string name="items_number_should_be_number">Het aantal items moet een geheel getal zijn.</string> | ||||||
|     <string name="reader_action_more">Lees meer</string> |  | ||||||
|     <string name="reader_action_open">Openen in browser</string> |     <string name="reader_action_open">Openen in browser</string> | ||||||
|     <string name="reader_action_share">Delen</string> |     <string name="reader_action_share">Delen</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> |     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> | ||||||
|     <string name="add_to_favs_reader">Add to favorites</string> |     <string name="add_to_favs_reader">Add to favorites</string> | ||||||
|     <string name="remove_to_favs_reader">Remove from favorites</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Article reader content font size</string> |     <string name="pref_content_reader_font_size">Article reader content font size</string> | ||||||
|     <string name="pref_header_viewer">Article viewer</string> |     <string name="pref_header_viewer">Article viewer</string> | ||||||
|     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> |     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> | ||||||
|     <string name="markall_dialog_message">This will mark all the items as read.</string> |     <string name="markall_dialog_message">This will mark all the items as read.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> |     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> |     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Automatically send crash reports</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Will send crash reports automatically</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Will ask everytime when sending crash reports.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Crash reports</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Debug logging (these will be sent without a dialog)</string> |  | ||||||
|     <string name="acra_login">Enable logging</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="unmark">Mark item as unread</string> |     <string name="unmark">Mark item as unread</string> | ||||||
|     <string name="pref_header_offline">Offline and cache</string> |     <string name="pref_header_offline">Offline and cache</string> | ||||||
|     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> |     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Save items for offline use</string> |     <string name="pref_switch_items_caching">Save items for offline use</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Not connected !</string> |  | ||||||
|     <string name="network_connectivity_lost">"Network connection lost"</string> |     <string name="network_connectivity_lost">"Network connection lost"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Network connection is now available"</string> |     <string name="network_connectivity_retrieved">"Network connection is now available"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sync articles</string> |     <string name="pref_switch_periodic_refresh">Sync articles</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> |     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> |     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> | ||||||
|     <string name="loading_notification_title">Loading ...</string> |     <string name="loading_notification_title">Loading …</string> | ||||||
|     <string name="loading_notification_text">Selfoss is syncing your articles</string> |     <string name="loading_notification_text">Selfoss is syncing your articles</string> | ||||||
|     <string name="notification_channel_sync">Sync notification</string> |     <string name="notification_channel_sync">Sync notification</string> | ||||||
|     <string name="new_items_channel_sync">New items notification</string> |     <string name="new_items_channel_sync">New items notification</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Reader for Selfoss"</string> |     <string name="app_name">"Reader for Selfoss"</string> | ||||||
|     <string name="title_activity_login">"Entrar"</string> |     <string name="title_activity_login">"Entrar"</string> | ||||||
|     <string name="prompt_password">"Senha"</string> |     <string name="prompt_password">"Senha"</string> | ||||||
|     <string name="prompt_http_password">"Senha HTTP"</string> |  | ||||||
|     <string name="action_sign_in">"Vamos lá"</string> |     <string name="action_sign_in">"Vamos lá"</string> | ||||||
|     <string name="error_invalid_password">"Senha muito pequena"</string> |     <string name="error_invalid_password">"Senha muito pequena"</string> | ||||||
|     <string name="error_field_required">"Campo obrigatório"</string> |     <string name="error_field_required">"Campo obrigatório"</string> | ||||||
|     <string name="prompt_url">"Url"</string> |     <string name="prompt_url">"Url"</string> | ||||||
|     <string name="withLoginSwitch">"É necessário o login ?"</string> |     <string name="withLoginSwitch">"É necessário o login ?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"É necessário o login HTTP ?"</string> |  | ||||||
|     <string name="login_url_problem">"Oops. Talvez você precise adicionar uma \"/\" no final da url."</string> |     <string name="login_url_problem">"Oops. Talvez você precise adicionar uma \"/\" no final da url."</string> | ||||||
|     <string name="prompt_login">"Usuário"</string> |     <string name="prompt_login">"Usuário"</string> | ||||||
|     <string name="prompt_http_login">"Usuário HTTP"</string> |  | ||||||
|     <string name="label_share">"Compartilhar"</string> |  | ||||||
|     <string name="readAll">"Ler todos"</string> |     <string name="readAll">"Ler todos"</string> | ||||||
|     <string name="action_disconnect">"Desconectar"</string> |     <string name="action_disconnect">"Desconectar"</string> | ||||||
|     <string name="title_activity_settings">"Configurações"</string> |     <string name="title_activity_settings">"Configurações"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Verifique os detalhes novamente."</string> |     <string name="wrong_infos">"Verifique os detalhes novamente."</string> | ||||||
|     <string name="all_posts_not_read">"Nenhum post foi lido"</string> |     <string name="all_posts_not_read">"Nenhum post foi lido"</string> | ||||||
|     <string name="all_posts_read">"Todos os posts foram lidos"</string> |     <string name="all_posts_read">"Todos os posts foram lidos"</string> | ||||||
|     <string name="cant_get_favs">"Não consigo obter os favoritos"</string> |  | ||||||
|     <string name="cant_get_new_elements">"Não consigo obter novos artigos"</string> |  | ||||||
|     <string name="cant_get_read">"Não consigo ler artigos"</string> |  | ||||||
|     <string name="nothing_here">"Nada aqui"</string> |     <string name="nothing_here">"Nada aqui"</string> | ||||||
|     <string name="tab_new">"Novo"</string> |     <string name="tab_new">"Novo"</string> | ||||||
|     <string name="tab_read">"Todos"</string> |     <string name="tab_read">"Todos"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"Informe um erro ou peça um novo recurso"</string> |     <string name="issue_tracker_summary">"Informe um erro ou peça um novo recurso"</string> | ||||||
|     <string name="warning_wrong_url">"ATENÇÃO"</string> |     <string name="warning_wrong_url">"ATENÇÃO"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Card View"</string> |     <string name="pref_switch_card_view_title">"Card View"</string> | ||||||
|     <string name="cant_mark_favortie">"Não é possível marcar o artigo como favorito"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"Não é possível remover o item do favorito"</string> |  | ||||||
|     <string name="share">"Compartilhar"</string> |     <string name="share">"Compartilhar"</string> | ||||||
|     <string name="rating_prompt_title">"Aproveitando o app ?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"Sim !"</string> |  | ||||||
|     <string name="rating_prompt_no">"Na verdade não …"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"Você pode nos dizer o porquê ?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"OK !"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Não agora."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Ótimo ! Você pode nos avaliar na loja ?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"Com certeza !"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Não agora."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Obrigado, seu comentário ajuda a melhorar o app !"</string> |  | ||||||
|     <string name="switch_unread_count">"Exibir a contagem de artigos não lidos como um badge na barra inferior."</string> |     <string name="switch_unread_count">"Exibir a contagem de artigos não lidos como um badge na barra inferior."</string> | ||||||
|     <string name="switch_unread_count_title">"Exibir contagem de artigos não lidos"</string> |     <string name="switch_unread_count_title">"Exibir contagem de artigos não lidos"</string> | ||||||
|     <string name="display_all_counts_title">"Exibir contagem de lidos e favoritos"</string> |     <string name="display_all_counts_title">"Exibir contagem de lidos e favoritos"</string> | ||||||
|     <string name="text_wrong_url">"Parece que você está tentando utilizar uma URL inválida. Certifique-se de que está correto, e se o problema persistir, entre em contato comigo (através do link de contato da loja). Por favor, note que o aplicativo precisa que você esteja usando o Selfoss. Você não pode acessar feeds RSS sem ele."</string> |     <string name="text_wrong_url">"Parece que você está tentando utilizar uma URL inválida. Certifique-se de que está correto, e se o problema persistir, entre em contato comigo (através do link de contato da loja). Por favor, note que o aplicativo precisa que você esteja usando o Selfoss. Você não pode acessar feeds RSS sem ele."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Abrir links dentro do aplicativo"</string> |     <string name="pref_article_viewer_title">"Abrir links dentro do aplicativo"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Os artigos serão abertos dentro do aplicativo"</string> |     <string name="pref_article_viewer_on">"Os artigos serão abertos dentro do aplicativo"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Os artigos serão abertos com seu navegador padrão"</string> |     <string name="pref_article_viewer_off">"Os artigos serão abertos com seu navegador padrão"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Use o visualizador de artigos"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Usará o visualizador de artigos em vez do navegador"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Utilizará o navegador em vez do visualizador de artigos"</string> |  | ||||||
|     <string name="pref_general_category_links">"Manipulação de links"</string> |     <string name="pref_general_category_links">"Manipulação de links"</string> | ||||||
|     <string name="pref_general_category_displaying">"Mostrando"</string> |     <string name="pref_general_category_displaying">"Mostrando"</string> | ||||||
|     <string name="pref_switch_card_view_on">"Os artigos serão exibidos no formato de cards"</string> |     <string name="pref_switch_card_view_on">"Os artigos serão exibidos no formato de cards"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">Cards com altura ajustáveis de acordo com o conteúdo</string> |     <string name="card_height_on">Cards com altura ajustáveis de acordo com o conteúdo</string> | ||||||
|     <string name="card_height_off">Cards com altura de tamanho fixo</string> |     <string name="card_height_off">Cards com altura de tamanho fixo</string> | ||||||
|     <string name="source_code">Código fonte</string> |     <string name="source_code">Código fonte</string> | ||||||
|     <string name="cant_mark_read">Não é possível marcar o artigo como lido</string> |     <string name="filter_item_tags">Tags</string> | ||||||
|     <string name="cant_mark_unread">Can\'t mark article as unread</string> |     <string name="filter_item_sources">Fontes</string> | ||||||
|     <string name="drawer_error_loading_tags">Erro ao carregar as tags…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Erro ao carregar as fontes…</string> |  | ||||||
|     <string name="drawer_item_filters">Filtros</string> |  | ||||||
|     <string name="drawer_action_clear">limpar</string> |  | ||||||
|     <string name="drawer_item_tags">Tags</string> |  | ||||||
|     <string name="drawer_item_sources">Fontes</string> |  | ||||||
|     <string name="drawer_action_edit">editar</string> |  | ||||||
|     <string name="no_tags_loaded">Nenhuma tag carregada</string> |  | ||||||
|     <string name="no_sources_loaded">Nenhuma fonte carregada</string> |  | ||||||
|     <string name="drawer_loading">Carregando …</string> |  | ||||||
|     <string name="menu_home_search">Procurar</string> |     <string name="menu_home_search">Procurar</string> | ||||||
|     <string name="can_delete_source">Não foi possível apagar a fonte…</string> |     <string name="can_delete_source">Não foi possível apagar a fonte…</string> | ||||||
|     <string name="base_url_error">Houve um problema ao tentar se comunicar com o seu Selfoss. Se o problema persistir, entre em contato comigo.</string> |     <string name="base_url_error">Houve um problema ao tentar se comunicar com o seu Selfoss. Se o problema persistir, entre em contato comigo.</string> | ||||||
|     <string name="pref_header_theme">Temas</string> |     <string name="pref_header_theme">Temas</string> | ||||||
|     <string name="default_theme">Padrão</string> |  | ||||||
|     <string name="default_dark_theme">Padrão/Escuro</string> |  | ||||||
|     <string name="pref_header_debug">Depurar</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Usando um certificado autônomo ?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Por motivos de segurança, certificados autônomos não são suportados por padrão. Ao ativar, não serei responsável por qualquer problema de segurança que você encontre.</string> |  | ||||||
|     <string name="pref_selfoss_category">Selfoss Api</string> |     <string name="pref_selfoss_category">Selfoss Api</string> | ||||||
|     <string name="pref_api_items_number_title">Quantidade de itens carregados</string> |     <string name="pref_api_items_number_title">Quantidade de itens carregados</string> | ||||||
|     <string name="pref_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="summary_debug_identifier">Identificador de depuração</string> |  | ||||||
|     <string name="unique_id_to_clipboard">Identificador copiado para a área de transferência</string> |  | ||||||
|     <string name="display_header_drawer_summary">Exibir um cabeçalho com o URL da instância do Selfoss na barra lateral.</string> |  | ||||||
|     <string name="display_header_drawer_title">Cabeçalho da conta</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Carregar mais artigos ao realizar o scroll</string> |     <string name="pref_general_infinite_loading_title">Carregar mais artigos ao realizar o scroll</string> | ||||||
|     <string name="translation">Traduções</string> |     <string name="translation">Traduções</string> | ||||||
|     <string name="cant_open_invalid_url">A url está inválida. Estou tentando resolver esse problema para que o aplicativo não encerre.</string> |     <string name="cant_open_invalid_url">A url está inválida. Estou tentando resolver esse problema para que o aplicativo não encerre.</string> | ||||||
|     <string name="drawer_report_bug">Reportar erro</string> |  | ||||||
|     <string name="items_number_should_be_number">O número dos itens deve ser um número inteiro.</string> |     <string name="items_number_should_be_number">O número dos itens deve ser um número inteiro.</string> | ||||||
|     <string name="reader_action_more">Leia mais</string> |  | ||||||
|     <string name="reader_action_open">Abrir no navegador</string> |     <string name="reader_action_open">Abrir no navegador</string> | ||||||
|     <string name="reader_action_share">Compartilhar</string> |     <string name="reader_action_share">Compartilhar</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Se esta configuração estiver ativada, os artigos serão marcados como lidos ao deslizar para a esquerda e para a direita no leitor do artigo.</string> |     <string name="pref_switch_actions_pager_scroll_on">Se esta configuração estiver ativada, os artigos serão marcados como lidos ao deslizar para a esquerda e para a direita no leitor do artigo.</string> | ||||||
|     <string name="add_to_favs_reader">Adicionar aos favoritos</string> |     <string name="add_to_favs_reader">Adicionar aos favoritos</string> | ||||||
|     <string name="remove_to_favs_reader">Remover dos favoritos</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Tamanho da fonte do conteúdo do leitor de artigos</string> |     <string name="pref_content_reader_font_size">Tamanho da fonte do conteúdo do leitor de artigos</string> | ||||||
|     <string name="pref_header_viewer">Visualizador de artigos</string> |     <string name="pref_header_viewer">Visualizador de artigos</string> | ||||||
|     <string name="refresh_dialog_message">Isso atualizará sua instância do Selfoss.</string> |     <string name="refresh_dialog_message">Isso atualizará sua instância do Selfoss.</string> | ||||||
|     <string name="markall_dialog_message">Isso marcará todos os itens como lidos.</string> |     <string name="markall_dialog_message">Isso marcará todos os itens como lidos.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Marcar Como Lida ao Abrir</string> |     <string name="pref_switch_actions_pager_scroll">Marcar Como Lida ao Abrir</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Não marca artigos como lido quando abrir.</string> |     <string name="pref_switch_actions_pager_scroll_off">Não marca artigos como lido quando abrir.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Envia relatórios de erros automaticamente</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Enviar relatórios de erro automaticamente</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Perguntar sempre, ao enviar relatórios de erro.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Relatório de erro</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Log de depuração (Serão enviados sem uma caixa de diálogo)</string> |  | ||||||
|     <string name="acra_login">Ativar registro de erros</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="unmark">Mark item as unread</string> |     <string name="unmark">Mark item as unread</string> | ||||||
|     <string name="pref_header_offline">Offline and cache</string> |     <string name="pref_header_offline">Offline and cache</string> | ||||||
|     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> |     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Save items for offline use</string> |     <string name="pref_switch_items_caching">Save items for offline use</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Not connected !</string> |  | ||||||
|     <string name="network_connectivity_lost">"Network connection lost"</string> |     <string name="network_connectivity_lost">"Network connection lost"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Network connection is now available"</string> |     <string name="network_connectivity_retrieved">"Network connection is now available"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sync articles</string> |     <string name="pref_switch_periodic_refresh">Sync articles</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> |     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> |     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> | ||||||
|     <string name="loading_notification_title">Loading ...</string> |     <string name="loading_notification_title">Loading …</string> | ||||||
|     <string name="loading_notification_text">Selfoss is syncing your articles</string> |     <string name="loading_notification_text">Selfoss is syncing your articles</string> | ||||||
|     <string name="notification_channel_sync">Sync notification</string> |     <string name="notification_channel_sync">Sync notification</string> | ||||||
|     <string name="new_items_channel_sync">New items notification</string> |     <string name="new_items_channel_sync">New items notification</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Leitor para Selfoss"</string> |     <string name="app_name">"Leitor para Selfoss"</string> | ||||||
|     <string name="title_activity_login">"Iniciar sessão"</string> |     <string name="title_activity_login">"Iniciar sessão"</string> | ||||||
|     <string name="prompt_password">"Palavra passe"</string> |     <string name="prompt_password">"Palavra passe"</string> | ||||||
|     <string name="prompt_http_password">"Senha HTTP"</string> |  | ||||||
|     <string name="action_sign_in">"Ir"</string> |     <string name="action_sign_in">"Ir"</string> | ||||||
|     <string name="error_invalid_password">"Senha não é longa o suficiente"</string> |     <string name="error_invalid_password">"Senha não é longa o suficiente"</string> | ||||||
|     <string name="error_field_required">"Campo obrigatório"</string> |     <string name="error_field_required">"Campo obrigatório"</string> | ||||||
|     <string name="prompt_url">"Url"</string> |     <string name="prompt_url">"Url"</string> | ||||||
|     <string name="withLoginSwitch">"É necessário fazer login?"</string> |     <string name="withLoginSwitch">"É necessário fazer login?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"É necessário fazer login on HTTP?"</string> |  | ||||||
|     <string name="login_url_problem">"Uups. Você pode precisar adicionar uma \"/\" no final da url."</string> |     <string name="login_url_problem">"Uups. Você pode precisar adicionar uma \"/\" no final da url."</string> | ||||||
|     <string name="prompt_login">"Nome do usuário"</string> |     <string name="prompt_login">"Nome do usuário"</string> | ||||||
|     <string name="prompt_http_login">"Nome de utilizador HTTP"</string> |  | ||||||
|     <string name="label_share">"Compartilhar"</string> |  | ||||||
|     <string name="readAll">"Ler tudo"</string> |     <string name="readAll">"Ler tudo"</string> | ||||||
|     <string name="action_disconnect">"Desligar"</string> |     <string name="action_disconnect">"Desligar"</string> | ||||||
|     <string name="title_activity_settings">"Configurações"</string> |     <string name="title_activity_settings">"Configurações"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Verifique seus dados novamente."</string> |     <string name="wrong_infos">"Verifique seus dados novamente."</string> | ||||||
|     <string name="all_posts_not_read">"Todas as postagens não foram lidas"</string> |     <string name="all_posts_not_read">"Todas as postagens não foram lidas"</string> | ||||||
|     <string name="all_posts_read">"Todas as postagens foram lidas"</string> |     <string name="all_posts_read">"Todas as postagens foram lidas"</string> | ||||||
|     <string name="cant_get_favs">"Não é possível obter favoritos"</string> |  | ||||||
|     <string name="cant_get_new_elements">"Não é possível obter novos artigos"</string> |  | ||||||
|     <string name="cant_get_read">"Não é possível ler artigos"</string> |  | ||||||
|     <string name="nothing_here">"Nada aqui"</string> |     <string name="nothing_here">"Nada aqui"</string> | ||||||
|     <string name="tab_new">"Novo"</string> |     <string name="tab_new">"Novo"</string> | ||||||
|     <string name="tab_read">"Tudo"</string> |     <string name="tab_read">"Tudo"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"Relatar um bug ou pedir um novo recurso"</string> |     <string name="issue_tracker_summary">"Relatar um bug ou pedir um novo recurso"</string> | ||||||
|     <string name="warning_wrong_url">"AVISO"</string> |     <string name="warning_wrong_url">"AVISO"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Vista de cartão"</string> |     <string name="pref_switch_card_view_title">"Vista de cartão"</string> | ||||||
|     <string name="cant_mark_favortie">"Não é possível marcar o artigo como favorito"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"Não pode remover o item do favorito"</string> |  | ||||||
|     <string name="share">"Compartilhar"</string> |     <string name="share">"Compartilhar"</string> | ||||||
|     <string name="rating_prompt_title">"Gosta da aplicação?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"Sim!"</string> |  | ||||||
|     <string name="rating_prompt_no">"Não realmente…"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"Pode nos dizer por que?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"Okey!"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Agora não."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Legal! Você pode classificar-na loja?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"Claro!"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Agora não."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Obrigado, seu feedback ajudar a realçar o app!"</string> |  | ||||||
|     <string name="switch_unread_count">"Exibir a contagem não lida como um emblema para a barra inferior."</string> |     <string name="switch_unread_count">"Exibir a contagem não lida como um emblema para a barra inferior."</string> | ||||||
|     <string name="switch_unread_count_title">"Exibir a contagem não lida"</string> |     <string name="switch_unread_count_title">"Exibir a contagem não lida"</string> | ||||||
|     <string name="display_all_counts_title">"Exibir a contagem para o favorito e leitura"</string> |     <string name="display_all_counts_title">"Exibir a contagem para o favorito e leitura"</string> | ||||||
|     <string name="text_wrong_url">"Você parece estar tentando usar um URL inválido. Certifique-se de que está correto, e se o problema persistir, entre em contato comigo (através do link de contato da loja). Por favor, note que o aplicativo precisa que você esteja usando o Selfoss. Você não pode acessar feeds RSS sem ele."</string> |     <string name="text_wrong_url">"Você parece estar tentando usar um URL inválido. Certifique-se de que está correto, e se o problema persistir, entre em contato comigo (através do link de contato da loja). Por favor, note que o aplicativo precisa que você esteja usando o Selfoss. Você não pode acessar feeds RSS sem ele."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Abrir links dentro do app"</string> |     <string name="pref_article_viewer_title">"Abrir links dentro do app"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Artigos serão aberto dentro do aplicativo"</string> |     <string name="pref_article_viewer_on">"Artigos serão aberto dentro do aplicativo"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Artigos serão aberto com o seu navegador padrão"</string> |     <string name="pref_article_viewer_off">"Artigos serão aberto com o seu navegador padrão"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Use o Visualizador de artigo"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Vai usar o Visualizador de artigo em vez do navegador interno"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Vai usar o navegador interno em vez do Visualizador de artigo"</string> |  | ||||||
|     <string name="pref_general_category_links">"Manipulação de ligações"</string> |     <string name="pref_general_category_links">"Manipulação de ligações"</string> | ||||||
|     <string name="pref_general_category_displaying">"Mostrando"</string> |     <string name="pref_general_category_displaying">"Mostrando"</string> | ||||||
|     <string name="pref_switch_card_view_on">"Os artigos serão exibidos como cartões"</string> |     <string name="pref_switch_card_view_on">"Os artigos serão exibidos como cartões"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">Altura de cartas irá ajustar ao seu conteúdo</string> |     <string name="card_height_on">Altura de cartas irá ajustar ao seu conteúdo</string> | ||||||
|     <string name="card_height_off">Altura do cartão será corrigida</string> |     <string name="card_height_off">Altura do cartão será corrigida</string> | ||||||
|     <string name="source_code">Código fonte</string> |     <string name="source_code">Código fonte</string> | ||||||
|     <string name="cant_mark_read">Não pode marcar o artigo como lido</string> |     <string name="filter_item_tags">Etiquetas</string> | ||||||
|     <string name="cant_mark_unread">Can\'t mark article as unread</string> |     <string name="filter_item_sources">Fontes</string> | ||||||
|     <string name="drawer_error_loading_tags">Erro ao carregar etiquetas…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Erro ao carregar fontes…</string> |  | ||||||
|     <string name="drawer_item_filters">Filtros</string> |  | ||||||
|     <string name="drawer_action_clear">limpar</string> |  | ||||||
|     <string name="drawer_item_tags">Etiquetas</string> |  | ||||||
|     <string name="drawer_item_sources">Fontes</string> |  | ||||||
|     <string name="drawer_action_edit">editar</string> |  | ||||||
|     <string name="no_tags_loaded">Não tags carregado</string> |  | ||||||
|     <string name="no_sources_loaded">Não há fontes carregadas</string> |  | ||||||
|     <string name="drawer_loading">A carregar…</string> |  | ||||||
|     <string name="menu_home_search">Buscar</string> |     <string name="menu_home_search">Buscar</string> | ||||||
|     <string name="can_delete_source">Não é possível excluir a fonte…</string> |     <string name="can_delete_source">Não é possível excluir a fonte…</string> | ||||||
|     <string name="base_url_error">Houve um problema ao tentar se comunicar com sua instância de Selfoss. Se o problema persistir, por favor entre em contato comigo.</string> |     <string name="base_url_error">Houve um problema ao tentar se comunicar com sua instância de Selfoss. Se o problema persistir, por favor entre em contato comigo.</string> | ||||||
|     <string name="pref_header_theme">Temas</string> |     <string name="pref_header_theme">Temas</string> | ||||||
|     <string name="default_theme">Predefinição</string> |  | ||||||
|     <string name="default_dark_theme">Padrão/escuro</string> |  | ||||||
|     <string name="pref_header_debug">Depurar</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Usando um certificado hospedado?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Devido a razões de segurança, auto certificados auto-assinados não são suportados por padrão. Ao activar isto, eu não vou ser responsável de qualquer problema de segurança que você encontrar.</string> |  | ||||||
|     <string name="pref_selfoss_category">Api de Selfoss</string> |     <string name="pref_selfoss_category">Api de Selfoss</string> | ||||||
|     <string name="pref_api_items_number_title">Número de itens carregados</string> |     <string name="pref_api_items_number_title">Número de itens carregados</string> | ||||||
|     <string name="pref_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="summary_debug_identifier">Depurar o identificador</string> |  | ||||||
|     <string name="unique_id_to_clipboard">Identificador de copiados para a área de transferência</string> |  | ||||||
|     <string name="display_header_drawer_summary">Exibir um cabeçalho com o url de instância de selfoss na gaveta lateral.</string> |  | ||||||
|     <string name="display_header_drawer_title">Cabeçalho de conta</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Carregar mais artigos no pergaminho</string> |     <string name="pref_general_infinite_loading_title">Carregar mais artigos no pergaminho</string> | ||||||
|     <string name="translation">Tradução</string> |     <string name="translation">Tradução</string> | ||||||
|     <string name="cant_open_invalid_url">A url do item é inválido. Eu estou olhando para resolver esta questão, para que o app não vai falhar.</string> |     <string name="cant_open_invalid_url">A url do item é inválido. Eu estou olhando para resolver esta questão, para que o app não vai falhar.</string> | ||||||
|     <string name="drawer_report_bug">Reportar falha</string> |  | ||||||
|     <string name="items_number_should_be_number">O número de itens deve ser um número inteiro.</string> |     <string name="items_number_should_be_number">O número de itens deve ser um número inteiro.</string> | ||||||
|     <string name="reader_action_more">Ler mais</string> |  | ||||||
|     <string name="reader_action_open">Abrir no browser</string> |     <string name="reader_action_open">Abrir no browser</string> | ||||||
|     <string name="reader_action_share">Compartilhar</string> |     <string name="reader_action_share">Compartilhar</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Artigos de marca como lida quando passar entre artigos.</string> |     <string name="pref_switch_actions_pager_scroll_on">Artigos de marca como lida quando passar entre artigos.</string> | ||||||
|     <string name="add_to_favs_reader">Add to favorites</string> |     <string name="add_to_favs_reader">Add to favorites</string> | ||||||
|     <string name="remove_to_favs_reader">Remove from favorites</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Article reader content font size</string> |     <string name="pref_content_reader_font_size">Article reader content font size</string> | ||||||
|     <string name="pref_header_viewer">Article viewer</string> |     <string name="pref_header_viewer">Article viewer</string> | ||||||
|     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> |     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> | ||||||
|     <string name="markall_dialog_message">This will mark all the items as read.</string> |     <string name="markall_dialog_message">This will mark all the items as read.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> |     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> |     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Automatically send crash reports</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Will send crash reports automatically</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Will ask everytime when sending crash reports.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Crash reports</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Debug logging (these will be sent without a dialog)</string> |  | ||||||
|     <string name="acra_login">Enable logging</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="unmark">Mark item as unread</string> |     <string name="unmark">Mark item as unread</string> | ||||||
|     <string name="pref_header_offline">Offline and cache</string> |     <string name="pref_header_offline">Offline and cache</string> | ||||||
|     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> |     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Save items for offline use</string> |     <string name="pref_switch_items_caching">Save items for offline use</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Not connected !</string> |  | ||||||
|     <string name="network_connectivity_lost">"Network connection lost"</string> |     <string name="network_connectivity_lost">"Network connection lost"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Network connection is now available"</string> |     <string name="network_connectivity_retrieved">"Network connection is now available"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sync articles</string> |     <string name="pref_switch_periodic_refresh">Sync articles</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> |     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> |     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> | ||||||
|     <string name="loading_notification_title">Loading ...</string> |     <string name="loading_notification_title">Loading …</string> | ||||||
|     <string name="loading_notification_text">Selfoss is syncing your articles</string> |     <string name="loading_notification_text">Selfoss is syncing your articles</string> | ||||||
|     <string name="notification_channel_sync">Sync notification</string> |     <string name="notification_channel_sync">Sync notification</string> | ||||||
|     <string name="new_items_channel_sync">New items notification</string> |     <string name="new_items_channel_sync">New items notification</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Reader for Selfoss"</string> |     <string name="app_name">"Reader for Selfoss"</string> | ||||||
|     <string name="title_activity_login">"පිවිසෙන්න"</string> |     <string name="title_activity_login">"පිවිසෙන්න"</string> | ||||||
|     <string name="prompt_password">"මුර පදය"</string> |     <string name="prompt_password">"මුර පදය"</string> | ||||||
|     <string name="prompt_http_password">"HTTP Password"</string> |  | ||||||
|     <string name="action_sign_in">"Go"</string> |     <string name="action_sign_in">"Go"</string> | ||||||
|     <string name="error_invalid_password">"Password not long enough"</string> |     <string name="error_invalid_password">"Password not long enough"</string> | ||||||
|     <string name="error_field_required">"Field required"</string> |     <string name="error_field_required">"Field required"</string> | ||||||
|     <string name="prompt_url">"Url"</string> |     <string name="prompt_url">"Url"</string> | ||||||
|     <string name="withLoginSwitch">"Login required ?"</string> |     <string name="withLoginSwitch">"Login required ?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"HTTP Login required ?"</string> |  | ||||||
|     <string name="login_url_problem">"Oops. You may need to add a \"/\" at the end of the url."</string> |     <string name="login_url_problem">"Oops. You may need to add a \"/\" at the end of the url."</string> | ||||||
|     <string name="prompt_login">"පරිශීලක නාමය"</string> |     <string name="prompt_login">"පරිශීලක නාමය"</string> | ||||||
|     <string name="prompt_http_login">"HTTP Username"</string> |  | ||||||
|     <string name="label_share">"Share"</string> |  | ||||||
|     <string name="readAll">"Read all"</string> |     <string name="readAll">"Read all"</string> | ||||||
|     <string name="action_disconnect">"Disconnect"</string> |     <string name="action_disconnect">"Disconnect"</string> | ||||||
|     <string name="title_activity_settings">"සැකසුම්"</string> |     <string name="title_activity_settings">"සැකසුම්"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Check your details again."</string> |     <string name="wrong_infos">"Check your details again."</string> | ||||||
|     <string name="all_posts_not_read">"All posts weren't read"</string> |     <string name="all_posts_not_read">"All posts weren't read"</string> | ||||||
|     <string name="all_posts_read">"All posts were read"</string> |     <string name="all_posts_read">"All posts were read"</string> | ||||||
|     <string name="cant_get_favs">"Can't get favorites"</string> |  | ||||||
|     <string name="cant_get_new_elements">"Can't get new articles"</string> |  | ||||||
|     <string name="cant_get_read">"Can't get read articles"</string> |  | ||||||
|     <string name="nothing_here">"Nothing here"</string> |     <string name="nothing_here">"Nothing here"</string> | ||||||
|     <string name="tab_new">"New"</string> |     <string name="tab_new">"New"</string> | ||||||
|     <string name="tab_read">"සියල්ල"</string> |     <string name="tab_read">"සියල්ල"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"Report a bug or ask for a new feature"</string> |     <string name="issue_tracker_summary">"Report a bug or ask for a new feature"</string> | ||||||
|     <string name="warning_wrong_url">"WARNING"</string> |     <string name="warning_wrong_url">"WARNING"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Card View"</string> |     <string name="pref_switch_card_view_title">"Card View"</string> | ||||||
|     <string name="cant_mark_favortie">"Can't mark article as favorite"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"Can't remove item from favorite"</string> |  | ||||||
|     <string name="share">"Share"</string> |     <string name="share">"Share"</string> | ||||||
|     <string name="rating_prompt_title">"Enjoying the app ?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"Yes !"</string> |  | ||||||
|     <string name="rating_prompt_no">"Not really …"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"Can you tell us why ?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"OK !"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Not now."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Great ! Can you rate us on the Store ?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"Sure !"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Not right now."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Thanks, your feedback help enhance the app !"</string> |  | ||||||
|     <string name="switch_unread_count">"Display the unread count as a badge for the bottom bar."</string> |     <string name="switch_unread_count">"Display the unread count as a badge for the bottom bar."</string> | ||||||
|     <string name="switch_unread_count_title">"Display unread count"</string> |     <string name="switch_unread_count_title">"Display unread count"</string> | ||||||
|     <string name="display_all_counts_title">"Display count for favorite and read"</string> |     <string name="display_all_counts_title">"Display count for favorite and read"</string> | ||||||
|     <string name="text_wrong_url">"You seem to be trying to use an invalid URL. Make sure it is correct, and if the problem persists, contact me (via the store contact link). Please note that the app needs you to be using Selfoss. You can't access RSS feeds without it."</string> |     <string name="text_wrong_url">"You seem to be trying to use an invalid URL. Make sure it is correct, and if the problem persists, contact me (via the store contact link). Please note that the app needs you to be using Selfoss. You can't access RSS feeds without it."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Open links inside the app"</string> |     <string name="pref_article_viewer_title">"Open links inside the app"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Articles will open inside the app"</string> |     <string name="pref_article_viewer_on">"Articles will open inside the app"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Articles will open with your default browser"</string> |     <string name="pref_article_viewer_off">"Articles will open with your default browser"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Use the article viewer"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Will use the article viewer instead of the internal browser"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Will use the internal browser instead of the article viewer"</string> |  | ||||||
|     <string name="pref_general_category_links">"Link handling"</string> |     <string name="pref_general_category_links">"Link handling"</string> | ||||||
|     <string name="pref_general_category_displaying">"Displaying"</string> |     <string name="pref_general_category_displaying">"Displaying"</string> | ||||||
|     <string name="pref_switch_card_view_on">"The articles will be displayed as cards"</string> |     <string name="pref_switch_card_view_on">"The articles will be displayed as cards"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">Cards height will adjust to its content</string> |     <string name="card_height_on">Cards height will adjust to its content</string> | ||||||
|     <string name="card_height_off">Card height will be fixed</string> |     <string name="card_height_off">Card height will be fixed</string> | ||||||
|     <string name="source_code">Source code</string> |     <string name="source_code">Source code</string> | ||||||
|     <string name="cant_mark_read">Can\'t mark article as read</string> |     <string name="filter_item_tags">Tags</string> | ||||||
|     <string name="cant_mark_unread">Can\'t mark article as unread</string> |     <string name="filter_item_sources">Sources</string> | ||||||
|     <string name="drawer_error_loading_tags">Error loading tags…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Error loading sources…</string> |  | ||||||
|     <string name="drawer_item_filters">Filters</string> |  | ||||||
|     <string name="drawer_action_clear">clear</string> |  | ||||||
|     <string name="drawer_item_tags">Tags</string> |  | ||||||
|     <string name="drawer_item_sources">Sources</string> |  | ||||||
|     <string name="drawer_action_edit">edit</string> |  | ||||||
|     <string name="no_tags_loaded">No tags loaded</string> |  | ||||||
|     <string name="no_sources_loaded">No sources loaded</string> |  | ||||||
|     <string name="drawer_loading">Loading …</string> |  | ||||||
|     <string name="menu_home_search">Search</string> |     <string name="menu_home_search">Search</string> | ||||||
|     <string name="can_delete_source">Can\'t delete the source…</string> |     <string name="can_delete_source">Can\'t delete the source…</string> | ||||||
|     <string name="base_url_error">There was an issue when trying to communicate with your Selfoss Instance. If the issue persists, please get in touch with me.</string> |     <string name="base_url_error">There was an issue when trying to communicate with your Selfoss Instance. If the issue persists, please get in touch with me.</string> | ||||||
|     <string name="pref_header_theme">Themes</string> |     <string name="pref_header_theme">Themes</string> | ||||||
|     <string name="default_theme">Default</string> |  | ||||||
|     <string name="default_dark_theme">Default/Dark</string> |  | ||||||
|     <string name="pref_header_debug">Debug</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Using a self hosted certificate ?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Due to security reasons, self signed certificates are not supported by default. By activating this, I\'ll not be responsible of any security problem you encounter.</string> |  | ||||||
|     <string name="pref_selfoss_category">Selfoss Api</string> |     <string name="pref_selfoss_category">Selfoss Api</string> | ||||||
|     <string name="pref_api_items_number_title">Loaded items number</string> |     <string name="pref_api_items_number_title">Loaded items number</string> | ||||||
|     <string name="pref_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="summary_debug_identifier">Debug identifier</string> |  | ||||||
|     <string name="unique_id_to_clipboard">Identifier copied to your clipboard</string> |  | ||||||
|     <string name="display_header_drawer_summary">Display a header with the selfoss instance url on the lateral drawer.</string> |  | ||||||
|     <string name="display_header_drawer_title">Account header</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Load more articles on scroll</string> |     <string name="pref_general_infinite_loading_title">Load more articles on scroll</string> | ||||||
|     <string name="translation">Translation</string> |     <string name="translation">Translation</string> | ||||||
|     <string name="cant_open_invalid_url">The item url is invalid. I\'m looking into solving this issue so the app won\'t crash.</string> |     <string name="cant_open_invalid_url">The item url is invalid. I\'m looking into solving this issue so the app won\'t crash.</string> | ||||||
|     <string name="drawer_report_bug">Report a bug</string> |  | ||||||
|     <string name="items_number_should_be_number">The items number should be an integer.</string> |     <string name="items_number_should_be_number">The items number should be an integer.</string> | ||||||
|     <string name="reader_action_more">Read more</string> |  | ||||||
|     <string name="reader_action_open">Open in browser</string> |     <string name="reader_action_open">Open in browser</string> | ||||||
|     <string name="reader_action_share">Share</string> |     <string name="reader_action_share">Share</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> |     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> | ||||||
|     <string name="add_to_favs_reader">Add to favorites</string> |     <string name="add_to_favs_reader">Add to favorites</string> | ||||||
|     <string name="remove_to_favs_reader">Remove from favorites</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Article reader content font size</string> |     <string name="pref_content_reader_font_size">Article reader content font size</string> | ||||||
|     <string name="pref_header_viewer">Article viewer</string> |     <string name="pref_header_viewer">Article viewer</string> | ||||||
|     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> |     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> | ||||||
|     <string name="markall_dialog_message">This will mark all the items as read.</string> |     <string name="markall_dialog_message">This will mark all the items as read.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> |     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> |     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Automatically send crash reports</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Will send crash reports automatically</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Will ask everytime when sending crash reports.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Crash reports</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Debug logging (these will be sent without a dialog)</string> |  | ||||||
|     <string name="acra_login">Enable logging</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="unmark">Mark item as unread</string> |     <string name="unmark">Mark item as unread</string> | ||||||
|     <string name="pref_header_offline">Offline and cache</string> |     <string name="pref_header_offline">Offline and cache</string> | ||||||
|     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> |     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Save items for offline use</string> |     <string name="pref_switch_items_caching">Save items for offline use</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Not connected !</string> |  | ||||||
|     <string name="network_connectivity_lost">"Network connection lost"</string> |     <string name="network_connectivity_lost">"Network connection lost"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Network connection is now available"</string> |     <string name="network_connectivity_retrieved">"Network connection is now available"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sync articles</string> |     <string name="pref_switch_periodic_refresh">Sync articles</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> |     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> |     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> | ||||||
|     <string name="loading_notification_title">Loading ...</string> |     <string name="loading_notification_title">Loading …</string> | ||||||
|     <string name="loading_notification_text">Selfoss is syncing your articles</string> |     <string name="loading_notification_text">Selfoss is syncing your articles</string> | ||||||
|     <string name="notification_channel_sync">Sync notification</string> |     <string name="notification_channel_sync">Sync notification</string> | ||||||
|     <string name="new_items_channel_sync">New items notification</string> |     <string name="new_items_channel_sync">New items notification</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Selfoss için okuyucu"</string> |     <string name="app_name">"Selfoss için okuyucu"</string> | ||||||
|     <string name="title_activity_login">"Giriş"</string> |     <string name="title_activity_login">"Giriş"</string> | ||||||
|     <string name="prompt_password">"Şifre"</string> |     <string name="prompt_password">"Şifre"</string> | ||||||
|     <string name="prompt_http_password">"HTTP şifresi"</string> |  | ||||||
|     <string name="action_sign_in">"Git"</string> |     <string name="action_sign_in">"Git"</string> | ||||||
|     <string name="error_invalid_password">"Parola yeterince uzun değil"</string> |     <string name="error_invalid_password">"Parola yeterince uzun değil"</string> | ||||||
|     <string name="error_field_required">"Alan gereklidir"</string> |     <string name="error_field_required">"Alan gereklidir"</string> | ||||||
|     <string name="prompt_url">"Url"</string> |     <string name="prompt_url">"Url"</string> | ||||||
|     <string name="withLoginSwitch">"Kullanıcı Girişi Gerekli?"</string> |     <string name="withLoginSwitch">"Kullanıcı Girişi Gerekli?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"HTTP üyelik gerekmektedir?"</string> |  | ||||||
|     <string name="login_url_problem">"Oops. Url'nin sonuna \"/\" eklemek gerekebilir."</string> |     <string name="login_url_problem">"Oops. Url'nin sonuna \"/\" eklemek gerekebilir."</string> | ||||||
|     <string name="prompt_login">"Kullanıcı adı"</string> |     <string name="prompt_login">"Kullanıcı adı"</string> | ||||||
|     <string name="prompt_http_login">"HTTP kullanıcı adı"</string> |  | ||||||
|     <string name="label_share">"Paylaş"</string> |  | ||||||
|     <string name="readAll">"Tümünü oku"</string> |     <string name="readAll">"Tümünü oku"</string> | ||||||
|     <string name="action_disconnect">"Bağlantıyı kes"</string> |     <string name="action_disconnect">"Bağlantıyı kes"</string> | ||||||
|     <string name="title_activity_settings">"Ayarlar"</string> |     <string name="title_activity_settings">"Ayarlar"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"Detaylarınızı tekrar kontrol edin."</string> |     <string name="wrong_infos">"Detaylarınızı tekrar kontrol edin."</string> | ||||||
|     <string name="all_posts_not_read">"Tüm mesajlar okunmadı"</string> |     <string name="all_posts_not_read">"Tüm mesajlar okunmadı"</string> | ||||||
|     <string name="all_posts_read">"Tüm mesajlar okundu"</string> |     <string name="all_posts_read">"Tüm mesajlar okundu"</string> | ||||||
|     <string name="cant_get_favs">"Sık ullanılanlara ulaşılamıyor"</string> |  | ||||||
|     <string name="cant_get_new_elements">"Yeni makalelere ulaşılamıyor"</string> |  | ||||||
|     <string name="cant_get_read">"Yeni makaleler okunamıyor"</string> |  | ||||||
|     <string name="nothing_here">"Burada hiçbir şey yok"</string> |     <string name="nothing_here">"Burada hiçbir şey yok"</string> | ||||||
|     <string name="tab_new">"Yeni"</string> |     <string name="tab_new">"Yeni"</string> | ||||||
|     <string name="tab_read">"Tüm"</string> |     <string name="tab_read">"Tüm"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"Bir hatayı bildir veya yeni bir özellik iste"</string> |     <string name="issue_tracker_summary">"Bir hatayı bildir veya yeni bir özellik iste"</string> | ||||||
|     <string name="warning_wrong_url">"UYARI"</string> |     <string name="warning_wrong_url">"UYARI"</string> | ||||||
|     <string name="pref_switch_card_view_title">"Kart görünümü"</string> |     <string name="pref_switch_card_view_title">"Kart görünümü"</string> | ||||||
|     <string name="cant_mark_favortie">"Makale favori olarak işaretlenemez"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"Nesne favorilerden kaldırılamıyor"</string> |  | ||||||
|     <string name="share">"Paylaş"</string> |     <string name="share">"Paylaş"</string> | ||||||
|     <string name="rating_prompt_title">"Uygulamayı sevdiniz mi?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"Evet!"</string> |  | ||||||
|     <string name="rating_prompt_no">"Aslında değil…"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"Nedenini bize söyleyebilir misiniz?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"Tamam!"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"Henüz değil."</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"Harika ! Bizi mağzada oylayabilir misin?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"Tabii ki!"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"Şimdi değil."</string> |  | ||||||
|     <string name="rating_prompt_thanks">"Teşekkürler, geri dönüşünü uygulamayı geliştirmede yardımcı olur!"</string> |  | ||||||
|     <string name="switch_unread_count">"Okunmamış sayıyı, alt çubuk için bir rozet olarak görüntüleyin."</string> |     <string name="switch_unread_count">"Okunmamış sayıyı, alt çubuk için bir rozet olarak görüntüleyin."</string> | ||||||
|     <string name="switch_unread_count_title">"Okunmamış sayıyı görüntüle"</string> |     <string name="switch_unread_count_title">"Okunmamış sayıyı görüntüle"</string> | ||||||
|     <string name="display_all_counts_title">"Favori ve okunan sayıları göster"</string> |     <string name="display_all_counts_title">"Favori ve okunan sayıları göster"</string> | ||||||
|     <string name="text_wrong_url">"Geçersiz bir URL kullanmaya çalışıyormuş gibi görünüyorsunuz. Doğru olduğundan emin olun ve sorun devam ederse, bana ulaşın (mağaza iletişim bağlantısıyla). Uygulamanın, Selfoss'u kullanmanız gerektiğini lütfen unutmayın. RSS özet akışlarına olmadan erişemezsiniz."</string> |     <string name="text_wrong_url">"Geçersiz bir URL kullanmaya çalışıyormuş gibi görünüyorsunuz. Doğru olduğundan emin olun ve sorun devam ederse, bana ulaşın (mağaza iletişim bağlantısıyla). Uygulamanın, Selfoss'u kullanmanız gerektiğini lütfen unutmayın. RSS özet akışlarına olmadan erişemezsiniz."</string> | ||||||
|     <string name="pref_general_internal_browser_title">"Uygulamadaki bağlantıları açın"</string> |     <string name="pref_article_viewer_title">"Uygulamadaki bağlantıları açın"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"Makale, uygulama içinde açılacaktır"</string> |     <string name="pref_article_viewer_on">"Makale, uygulama içinde açılacaktır"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"Makaleler varsayılan tarayıcınızla açılır"</string> |     <string name="pref_article_viewer_off">"Makaleler varsayılan tarayıcınızla açılır"</string> | ||||||
|     <string name="prefer_article_viewer_title">"Makale görüntüleyiciyi kullanın"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"Dahili tarayıcı yerine makale görüntüleyicisini kullanacak"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"Makale görüntüleyicisi yerine dahili tarayıcıyı kullanacak"</string> |  | ||||||
|     <string name="pref_general_category_links">"Bağlantı açma şekli"</string> |     <string name="pref_general_category_links">"Bağlantı açma şekli"</string> | ||||||
|     <string name="pref_general_category_displaying">"Gösteriliyor"</string> |     <string name="pref_general_category_displaying">"Gösteriliyor"</string> | ||||||
|     <string name="pref_switch_card_view_on">"Makaleler kart olarak gösterilecek"</string> |     <string name="pref_switch_card_view_on">"Makaleler kart olarak gösterilecek"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">Kartların yüksekliği içeriğine göre ayarlanır</string> |     <string name="card_height_on">Kartların yüksekliği içeriğine göre ayarlanır</string> | ||||||
|     <string name="card_height_off">Kart yüksekliği sabit olacak</string> |     <string name="card_height_off">Kart yüksekliği sabit olacak</string> | ||||||
|     <string name="source_code">Kaynak kodu</string> |     <string name="source_code">Kaynak kodu</string> | ||||||
|     <string name="cant_mark_read">Makale favori olarak işaretlenemez</string> |     <string name="filter_item_tags">Etiketler</string> | ||||||
|     <string name="cant_mark_unread">Can\'t mark article as unread</string> |     <string name="filter_item_sources">Kaynaklar</string> | ||||||
|     <string name="drawer_error_loading_tags">Etiketler yükleme hatası…</string> |  | ||||||
|     <string name="drawer_error_loading_sources">Kaynaklar yüklenirken hata oluştu…</string> |  | ||||||
|     <string name="drawer_item_filters">Filtreler</string> |  | ||||||
|     <string name="drawer_action_clear">temizle</string> |  | ||||||
|     <string name="drawer_item_tags">Etiketler</string> |  | ||||||
|     <string name="drawer_item_sources">Kaynaklar</string> |  | ||||||
|     <string name="drawer_action_edit">düzenle</string> |  | ||||||
|     <string name="no_tags_loaded">Yüklenen görüntü yok</string> |  | ||||||
|     <string name="no_sources_loaded">Yüklenen kaynak yok</string> |  | ||||||
|     <string name="drawer_loading">Yükleniyor…</string> |  | ||||||
|     <string name="menu_home_search">Ara</string> |     <string name="menu_home_search">Ara</string> | ||||||
|     <string name="can_delete_source">Kaynak silinemiyor…</string> |     <string name="can_delete_source">Kaynak silinemiyor…</string> | ||||||
|     <string name="base_url_error">Selfoss Örneğinizle iletişim kurmaya çalışırken bir sorun oluştu. Sorun devam ederse, lütfen benimle iletişime geçin.</string> |     <string name="base_url_error">Selfoss Örneğinizle iletişim kurmaya çalışırken bir sorun oluştu. Sorun devam ederse, lütfen benimle iletişime geçin.</string> | ||||||
|     <string name="pref_header_theme">Temalar</string> |     <string name="pref_header_theme">Temalar</string> | ||||||
|     <string name="default_theme">Varsayılan</string> |  | ||||||
|     <string name="default_dark_theme">Varsayılan/koyu</string> |  | ||||||
|     <string name="pref_header_debug">Hata ayıklama</string> |  | ||||||
|     <string name="self_hosted_cert_switch">Kendi kendine barındırılan bir sertifika mı kullanıyorsunuz?</string> |  | ||||||
|     <string name="self_signed_cert_warning">Güvenlik nedeniyle, kendinden imzalı sertifikalar varsayılan olarak desteklenmez. Bunu etkinleştirerek karşılaştığınız herhangi bir güvenlik sorununun sorumluluğunu almayacağım.</string> |  | ||||||
|     <string name="pref_selfoss_category">Selfoss Uygulaması</string> |     <string name="pref_selfoss_category">Selfoss Uygulaması</string> | ||||||
|     <string name="pref_api_items_number_title">Yüklenen öğe numarası</string> |     <string name="pref_api_items_number_title">Yüklenen öğe numarası</string> | ||||||
|     <string name="pref_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="summary_debug_identifier">Hata ayıklama tanıtıcısı</string> |  | ||||||
|     <string name="unique_id_to_clipboard">Tanımlayıcı panonuza kopyalanır</string> |  | ||||||
|     <string name="display_header_drawer_summary">Selfoss örneği url\'li bir üstbilgi, yan çekmece üzerine gösterin.</string> |  | ||||||
|     <string name="display_header_drawer_title">Hesap başlığı</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">Kaydırma üzerine daha fazla makale yükleyin</string> |     <string name="pref_general_infinite_loading_title">Kaydırma üzerine daha fazla makale yükleyin</string> | ||||||
|     <string name="translation">Çeviri</string> |     <string name="translation">Çeviri</string> | ||||||
|     <string name="cant_open_invalid_url">Öğe url geçersiz. Uygulama çökmeyeceği için bu sorunu çözmeye çalışıyorum.</string> |     <string name="cant_open_invalid_url">Öğe url geçersiz. Uygulama çökmeyeceği için bu sorunu çözmeye çalışıyorum.</string> | ||||||
|     <string name="drawer_report_bug">Hata bildir</string> |  | ||||||
|     <string name="items_number_should_be_number">Öğe sayısı bir tamsayı olmalıdır.</string> |     <string name="items_number_should_be_number">Öğe sayısı bir tamsayı olmalıdır.</string> | ||||||
|     <string name="reader_action_more">Daha fazlasını görüntüle</string> |  | ||||||
|     <string name="reader_action_open">Tarayıcıda aç</string> |     <string name="reader_action_open">Tarayıcıda aç</string> | ||||||
|     <string name="reader_action_share">Paylaş</string> |     <string name="reader_action_share">Paylaş</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> |     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> | ||||||
|     <string name="add_to_favs_reader">Add to favorites</string> |     <string name="add_to_favs_reader">Add to favorites</string> | ||||||
|     <string name="remove_to_favs_reader">Remove from favorites</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Article reader content font size</string> |     <string name="pref_content_reader_font_size">Article reader content font size</string> | ||||||
|     <string name="pref_header_viewer">Article viewer</string> |     <string name="pref_header_viewer">Article viewer</string> | ||||||
|     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> |     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> | ||||||
|     <string name="markall_dialog_message">This will mark all the items as read.</string> |     <string name="markall_dialog_message">This will mark all the items as read.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> |     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> |     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Automatically send crash reports</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Will send crash reports automatically</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Will ask everytime when sending crash reports.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Crash reports</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Debug logging (these will be sent without a dialog)</string> |  | ||||||
|     <string name="acra_login">Enable logging</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="unmark">Mark item as unread</string> |     <string name="unmark">Mark item as unread</string> | ||||||
|     <string name="pref_header_offline">Offline and cache</string> |     <string name="pref_header_offline">Offline and cache</string> | ||||||
|     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> |     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Save items for offline use</string> |     <string name="pref_switch_items_caching">Save items for offline use</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Not connected !</string> |  | ||||||
|     <string name="network_connectivity_lost">"Network connection lost"</string> |     <string name="network_connectivity_lost">"Network connection lost"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Network connection is now available"</string> |     <string name="network_connectivity_retrieved">"Network connection is now available"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sync articles</string> |     <string name="pref_switch_periodic_refresh">Sync articles</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> |     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> |     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> | ||||||
|     <string name="loading_notification_title">Loading ...</string> |     <string name="loading_notification_title">Loading …</string> | ||||||
|     <string name="loading_notification_text">Selfoss is syncing your articles</string> |     <string name="loading_notification_text">Selfoss is syncing your articles</string> | ||||||
|     <string name="notification_channel_sync">Sync notification</string> |     <string name="notification_channel_sync">Sync notification</string> | ||||||
|     <string name="new_items_channel_sync">New items notification</string> |     <string name="new_items_channel_sync">New items notification</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Selfoss 阅读器"</string> |     <string name="app_name">"Selfoss 阅读器"</string> | ||||||
|     <string name="title_activity_login">"登录"</string> |     <string name="title_activity_login">"登录"</string> | ||||||
|     <string name="prompt_password">"密码"</string> |     <string name="prompt_password">"密码"</string> | ||||||
|     <string name="prompt_http_password">"HTTP 密码"</string> |  | ||||||
|     <string name="action_sign_in">"转至"</string> |     <string name="action_sign_in">"转至"</string> | ||||||
|     <string name="error_invalid_password">"密码不够长"</string> |     <string name="error_invalid_password">"密码不够长"</string> | ||||||
|     <string name="error_field_required">"必填字段"</string> |     <string name="error_field_required">"必填字段"</string> | ||||||
|     <string name="prompt_url">"网址"</string> |     <string name="prompt_url">"网址"</string> | ||||||
|     <string name="withLoginSwitch">"需要登录?"</string> |     <string name="withLoginSwitch">"需要登录?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"请先登录网站"</string> |  | ||||||
|     <string name="login_url_problem">"哎呀。您可能需要在网址的末尾添加一个 \"/\"。"</string> |     <string name="login_url_problem">"哎呀。您可能需要在网址的末尾添加一个 \"/\"。"</string> | ||||||
|     <string name="prompt_login">"用户名"</string> |     <string name="prompt_login">"用户名"</string> | ||||||
|     <string name="prompt_http_login">"HTTP 用户名"</string> |  | ||||||
|     <string name="label_share">"分享"</string> |  | ||||||
|     <string name="readAll">"全部阅读"</string> |     <string name="readAll">"全部阅读"</string> | ||||||
|     <string name="action_disconnect">"断开连接"</string> |     <string name="action_disconnect">"断开连接"</string> | ||||||
|     <string name="title_activity_settings">"设置"</string> |     <string name="title_activity_settings">"设置"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"再次检查您的详细信息。"</string> |     <string name="wrong_infos">"再次检查您的详细信息。"</string> | ||||||
|     <string name="all_posts_not_read">"所有帖子都未读"</string> |     <string name="all_posts_not_read">"所有帖子都未读"</string> | ||||||
|     <string name="all_posts_read">"所有帖子已读"</string> |     <string name="all_posts_read">"所有帖子已读"</string> | ||||||
|     <string name="cant_get_favs">"无法获取收藏文件"</string> |  | ||||||
|     <string name="cant_get_new_elements">"无法获取新文章"</string> |  | ||||||
|     <string name="cant_get_read">"无法获取已读文章"</string> |  | ||||||
|     <string name="nothing_here">"暂无内容!"</string> |     <string name="nothing_here">"暂无内容!"</string> | ||||||
|     <string name="tab_new">"新建"</string> |     <string name="tab_new">"新建"</string> | ||||||
|     <string name="tab_read">"所有"</string> |     <string name="tab_read">"所有"</string> | ||||||
| @@ -40,37 +33,22 @@ | |||||||
|     <string name="addStringNoUrl">"登录以添加数据源。"</string> |     <string name="addStringNoUrl">"登录以添加数据源。"</string> | ||||||
|     <string name="cant_get_sources">"无法获取数据列表。"</string> |     <string name="cant_get_sources">"无法获取数据列表。"</string> | ||||||
|     <string name="cant_create_source">"无法创建源数据。"</string> |     <string name="cant_create_source">"无法创建源数据。"</string> | ||||||
|     <string name="cant_get_spouts_no_network">"Can't get spouts list because of a network issue."</string> |     <string name="cant_get_spouts_no_network">"由于网络问题,无法获取 spouts 列表。"</string> | ||||||
|     <string name="cant_get_spouts">"Can't get spouts list. There may ben an api issue."</string> |     <string name="cant_get_spouts">"无法获取 spouts 列表。可能有一个 api 问题。"</string> | ||||||
|     <string name="form_not_complete">"窗体未完成"</string> |     <string name="form_not_complete">"窗体未完成"</string> | ||||||
|     <string name="pref_header_links">"链接"</string> |     <string name="pref_header_links">"链接"</string> | ||||||
|     <string name="issue_tracker_link">"问题追踪器"</string> |     <string name="issue_tracker_link">"问题追踪器"</string> | ||||||
|     <string name="issue_tracker_summary">"报告错误或请求新功能"</string> |     <string name="issue_tracker_summary">"报告错误或请求新功能"</string> | ||||||
|     <string name="warning_wrong_url">"警告"</string> |     <string name="warning_wrong_url">"警告"</string> | ||||||
|     <string name="pref_switch_card_view_title">"卡片视图"</string> |     <string name="pref_switch_card_view_title">"卡片视图"</string> | ||||||
|     <string name="cant_mark_favortie">"不能将文章标记为收藏"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"无法从收藏中删除项目"</string> |  | ||||||
|     <string name="share">"共享"</string> |     <string name="share">"共享"</string> | ||||||
|     <string name="rating_prompt_title">"喜欢这个应用吗?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"是的!"</string> |  | ||||||
|     <string name="rating_prompt_no">"不大喜欢…"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"能告诉我们为什么吗?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"好的!"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"以后再说。"</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"太好了!你能在应用商店给我们打分吗?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"当然!"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"现在不行。"</string> |  | ||||||
|     <string name="rating_prompt_thanks">"谢谢,您的反馈有助于改进应用程序!"</string> |  | ||||||
|     <string name="switch_unread_count">"将未读数在底部显示为一个徽标。"</string> |     <string name="switch_unread_count">"将未读数在底部显示为一个徽标。"</string> | ||||||
|     <string name="switch_unread_count_title">"显示未读数"</string> |     <string name="switch_unread_count_title">"显示未读数"</string> | ||||||
|     <string name="display_all_counts_title">"显示收藏和已读的计数"</string> |     <string name="display_all_counts_title">"显示收藏和已读的计数"</string> | ||||||
|     <string name="text_wrong_url">"您似乎试图使用无效的 URL。确保它是正确的,如果问题仍然存在,请与我联系 (通过商店的联系链接)。请注意,该应用程序需要您使用 Selfoss。没有它,您无法访问 RSS 源。"</string> |     <string name="text_wrong_url">"您似乎试图使用无效的 URL。确保它是正确的,如果问题仍然存在,请与我联系 (通过商店的联系链接)。请注意,该应用程序需要您使用 Selfoss。没有它,您无法访问 RSS 源。"</string> | ||||||
|     <string name="pref_general_internal_browser_title">"打开应用程序中的链接"</string> |     <string name="pref_article_viewer_title">"在应用内打开链接"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"文章将在应用程序内打开"</string> |     <string name="pref_article_viewer_on">"文章将在应用程序内打开"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"文章将使用默认浏览器打开"</string> |     <string name="pref_article_viewer_off">"文章将使用默认浏览器打开"</string> | ||||||
|     <string name="prefer_article_viewer_title">"使用文章查看器"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"将使用文章查看器而不是内部浏览器"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"将使用内部浏览器而不是文章查看器"</string> |  | ||||||
|     <string name="pref_general_category_links">"链接处理"</string> |     <string name="pref_general_category_links">"链接处理"</string> | ||||||
|     <string name="pref_general_category_displaying">"显示"</string> |     <string name="pref_general_category_displaying">"显示"</string> | ||||||
|     <string name="pref_switch_card_view_on">"这些文章将以卡片形式显示"</string> |     <string name="pref_switch_card_view_on">"这些文章将以卡片形式显示"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">卡片高度将根据内容调整</string> |     <string name="card_height_on">卡片高度将根据内容调整</string> | ||||||
|     <string name="card_height_off">卡片高度将被固定</string> |     <string name="card_height_off">卡片高度将被固定</string> | ||||||
|     <string name="source_code">源代码</string> |     <string name="source_code">源代码</string> | ||||||
|     <string name="cant_mark_read">无法将文章标记为已读</string> |     <string name="filter_item_tags">标签</string> | ||||||
|     <string name="cant_mark_unread">无法将文章标记为未读</string> |     <string name="filter_item_sources">来源</string> | ||||||
|     <string name="drawer_error_loading_tags">加载标记时出错..。</string> |  | ||||||
|     <string name="drawer_error_loading_sources">加载源时出错..。</string> |  | ||||||
|     <string name="drawer_item_filters">搜索条件</string> |  | ||||||
|     <string name="drawer_action_clear">清空</string> |  | ||||||
|     <string name="drawer_item_tags">标签</string> |  | ||||||
|     <string name="drawer_item_sources">来源</string> |  | ||||||
|     <string name="drawer_action_edit">编辑</string> |  | ||||||
|     <string name="no_tags_loaded">未加载标签</string> |  | ||||||
|     <string name="no_sources_loaded">未加载数据源</string> |  | ||||||
|     <string name="drawer_loading">正在载入…</string> |  | ||||||
|     <string name="menu_home_search">搜索</string> |     <string name="menu_home_search">搜索</string> | ||||||
|     <string name="can_delete_source">无法删除数据源…</string> |     <string name="can_delete_source">无法删除数据源…</string> | ||||||
|     <string name="base_url_error">与您的 Selfoss 通信时出现问题。如果问题一直存在,请与我联系。</string> |     <string name="base_url_error">与您的 Selfoss 通信时出现问题。如果问题一直存在,请与我联系。</string> | ||||||
|     <string name="pref_header_theme">主题</string> |     <string name="pref_header_theme">主题</string> | ||||||
|     <string name="default_theme">默认</string> |  | ||||||
|     <string name="default_dark_theme">默认值/暗</string> |  | ||||||
|     <string name="pref_header_debug">调试</string> |  | ||||||
|     <string name="self_hosted_cert_switch">使用自托管证书?</string> |  | ||||||
|     <string name="self_signed_cert_warning">出于安全考虑, 默认情况下不支持自签名证书。如果激活此项, 您遇到的任何安全问题我将概不负责。</string> |  | ||||||
|     <string name="pref_selfoss_category">塞尔福斯 Api</string> |     <string name="pref_selfoss_category">塞尔福斯 Api</string> | ||||||
|     <string name="pref_api_items_number_title">已加载项目编号</string> |     <string name="pref_api_items_number_title">已加载项目编号</string> | ||||||
|     <string name="pref_hidden_tags">隐藏标签</string> |  | ||||||
|     <string name="summary_debug_identifier">除错标识符</string> |  | ||||||
|     <string name="unique_id_to_clipboard">复制到你的剪贴板的标识符</string> |  | ||||||
|     <string name="display_header_drawer_summary">在侧边栏中显示带有 Selfoss 链接地址的页眉。</string> |  | ||||||
|     <string name="display_header_drawer_title">帐户页眉</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">翻页时载入更多文章</string> |     <string name="pref_general_infinite_loading_title">翻页时载入更多文章</string> | ||||||
|     <string name="translation">翻译</string> |     <string name="translation">翻译</string> | ||||||
|     <string name="cant_open_invalid_url">项目链接地址无效。我正在设法解决这个问题,以避免应用程序崩溃。</string> |     <string name="cant_open_invalid_url">项目链接地址无效。我正在设法解决这个问题,以避免应用程序崩溃。</string> | ||||||
|     <string name="drawer_report_bug">报告错误</string> |  | ||||||
|     <string name="items_number_should_be_number">项目数应为整数。</string> |     <string name="items_number_should_be_number">项目数应为整数。</string> | ||||||
|     <string name="reader_action_more">阅读更多</string> |  | ||||||
|     <string name="reader_action_open">在浏览器中打开</string> |     <string name="reader_action_open">在浏览器中打开</string> | ||||||
|     <string name="reader_action_share">分享</string> |     <string name="reader_action_share">分享</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">切换文章时将文章标记为已读。</string> |     <string name="pref_switch_actions_pager_scroll_on">切换文章时将文章标记为已读。</string> | ||||||
|     <string name="add_to_favs_reader">添加到收藏</string> |     <string name="add_to_favs_reader">添加到收藏</string> | ||||||
|     <string name="remove_to_favs_reader">从收藏中移除</string> |  | ||||||
|     <string name="pref_content_reader_font_size">文章阅读器内容字体大小</string> |     <string name="pref_content_reader_font_size">文章阅读器内容字体大小</string> | ||||||
|     <string name="pref_header_viewer">文章查看器</string> |     <string name="pref_header_viewer">文章查看器</string> | ||||||
|     <string name="refresh_dialog_message">这将刷新您的 Selfoss 实例。</string> |     <string name="refresh_dialog_message">这将刷新您的 Selfoss 实例。</string> | ||||||
|     <string name="markall_dialog_message">这将标记所有项目为已读。</string> |     <string name="markall_dialog_message">这将标记所有项目为已读。</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">滑动时标为已读</string> |     <string name="pref_switch_actions_pager_scroll">滑动时标为已读</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">滑动时不标记文章为已读</string> |     <string name="pref_switch_actions_pager_scroll_off">滑动时不标记文章为已读</string> | ||||||
|     <string name="pref_acra_alwaysaccept">自动发送崩溃报告</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">允许自动发送故障报告</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">每次发送崩溃报告时都会询问。</string> |  | ||||||
|     <string name="pref_debug_crash_reports">崩溃报告</string> |  | ||||||
|     <string name="pref_debug_debug_logs">调试日志(这些日志将在没有对话框的情况下发送)</string> |  | ||||||
|     <string name="acra_login">启用日志记录</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">隐藏标签</string> |  | ||||||
|     <string name="unmark">标记条目为未读</string> |     <string name="unmark">标记条目为未读</string> | ||||||
|     <string name="pref_header_offline">离线和缓存</string> |     <string name="pref_header_offline">离线和缓存</string> | ||||||
|     <string name="pref_switch_items_caching_off">文章不会被保存到设备内存,应用程序在离线时将无法阅读它们</string> |     <string name="pref_switch_items_caching_off">文章不会被保存到设备内存,应用程序在离线时将无法阅读它们</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">保存项目以便离线使用</string> |     <string name="pref_switch_items_caching">保存项目以便离线使用</string> | ||||||
|     <string name="pref_switch_update_sources">检查新来源和标签</string> |     <string name="pref_switch_update_sources">检查新来源和标签</string> | ||||||
|     <string name="pref_switch_update_sources_summary">如果你的服务器接收过多的数据库查询,请禁用此功能。</string> |     <string name="pref_switch_update_sources_summary">如果你的服务器接收过多的数据库查询,请禁用此功能。</string> | ||||||
|     <string name="no_network_connectivity">未连接!</string> |  | ||||||
|     <string name="network_connectivity_lost">"网络连接丢失"</string> |     <string name="network_connectivity_lost">"网络连接丢失"</string> | ||||||
|     <string name="network_connectivity_retrieved">"网络连接现在可用"</string> |     <string name="network_connectivity_retrieved">"网络连接现在可用"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">同步文章</string> |     <string name="pref_switch_periodic_refresh">同步文章</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">将定期同步文章</string> |     <string name="pref_switch_periodic_refresh_on">将定期同步文章</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[同步间隔 (>= 15分钟)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[同步间隔 (>= 15分钟)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">仅在手机充电时刷新</string> |     <string name="pref_switch_refresh_when_charging">仅在手机充电时刷新</string> | ||||||
|     <string name="loading_notification_title">加载中...</string> |     <string name="loading_notification_title">加载中…</string> | ||||||
|     <string name="loading_notification_text">Selfoss 正在同步您的文章</string> |     <string name="loading_notification_text">Selfoss 正在同步您的文章</string> | ||||||
|     <string name="notification_channel_sync">同步通知</string> |     <string name="notification_channel_sync">同步通知</string> | ||||||
|     <string name="new_items_channel_sync">新条目通知</string> |     <string name="new_items_channel_sync">新条目通知</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">底部栏将始终显示</string> |     <string name="reader_static_bar_on">底部栏将始终显示</string> | ||||||
|     <string name="reader_static_bar_off">底部栏可以通过浮动按钮显示</string> |     <string name="reader_static_bar_off">底部栏可以通过浮动按钮显示</string> | ||||||
|     <string name="remove_source">删除源</string> |     <string name="remove_source">删除源</string> | ||||||
|  |     <string name="pref_theme_title">浅色/深色模式</string> | ||||||
|  |     <string name="mode_dark">深色模式</string> | ||||||
|  |     <string name="mode_system">遵循系统设置</string> | ||||||
|  |     <string name="mode_light">浅色模式</string> | ||||||
|  |     <string name="gdpr_dialog_title">该应用不分享任何关于您的个人数据。</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[崩溃报告发送现已启用。 可以从设置页面禁用它。 请记住,崩溃报告对于应用程序开发是必需的。]]></string> | ||||||
|  |     <string name="crash_toast_text">发生崩溃。请将细节发送给开发人员。</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"禁用自动错误报告 "</string> | ||||||
|  |     <string name="menu_home_filter">筛选器</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -3,17 +3,13 @@ | |||||||
|     <string name="app_name">"Selfoss 阅读器"</string> |     <string name="app_name">"Selfoss 阅读器"</string> | ||||||
|     <string name="title_activity_login">"登录"</string> |     <string name="title_activity_login">"登录"</string> | ||||||
|     <string name="prompt_password">"密码"</string> |     <string name="prompt_password">"密码"</string> | ||||||
|     <string name="prompt_http_password">"HTTP 密碼"</string> |  | ||||||
|     <string name="action_sign_in">"转至"</string> |     <string name="action_sign_in">"转至"</string> | ||||||
|     <string name="error_invalid_password">"密码不够长"</string> |     <string name="error_invalid_password">"密码不够长"</string> | ||||||
|     <string name="error_field_required">"欄位必填"</string> |     <string name="error_field_required">"欄位必填"</string> | ||||||
|     <string name="prompt_url">"网址"</string> |     <string name="prompt_url">"网址"</string> | ||||||
|     <string name="withLoginSwitch">"需要登入?"</string> |     <string name="withLoginSwitch">"需要登入?"</string> | ||||||
|     <string name="withHttpLoginSwitch">"请先登录网站"</string> |  | ||||||
|     <string name="login_url_problem">"哎呀。您可能需要在网址的末尾添加一个 \"/\"。"</string> |     <string name="login_url_problem">"哎呀。您可能需要在网址的末尾添加一个 \"/\"。"</string> | ||||||
|     <string name="prompt_login">"使用者名稱"</string> |     <string name="prompt_login">"使用者名稱"</string> | ||||||
|     <string name="prompt_http_login">"HTTP 用户名"</string> |  | ||||||
|     <string name="label_share">"分享"</string> |  | ||||||
|     <string name="readAll">"全部阅读"</string> |     <string name="readAll">"全部阅读"</string> | ||||||
|     <string name="action_disconnect">"断开连接"</string> |     <string name="action_disconnect">"断开连接"</string> | ||||||
|     <string name="title_activity_settings">"设置"</string> |     <string name="title_activity_settings">"设置"</string> | ||||||
| @@ -26,9 +22,6 @@ | |||||||
|     <string name="wrong_infos">"再次检查您的详细信息。"</string> |     <string name="wrong_infos">"再次检查您的详细信息。"</string> | ||||||
|     <string name="all_posts_not_read">"所有帖子都未读"</string> |     <string name="all_posts_not_read">"所有帖子都未读"</string> | ||||||
|     <string name="all_posts_read">"所有帖子已读"</string> |     <string name="all_posts_read">"所有帖子已读"</string> | ||||||
|     <string name="cant_get_favs">"无法获取收藏文件"</string> |  | ||||||
|     <string name="cant_get_new_elements">"无法获取新文章"</string> |  | ||||||
|     <string name="cant_get_read">"无法获取已读文章"</string> |  | ||||||
|     <string name="nothing_here">"暂无内容!"</string> |     <string name="nothing_here">"暂无内容!"</string> | ||||||
|     <string name="tab_new">"新建"</string> |     <string name="tab_new">"新建"</string> | ||||||
|     <string name="tab_read">"所有"</string> |     <string name="tab_read">"所有"</string> | ||||||
| @@ -48,29 +41,14 @@ | |||||||
|     <string name="issue_tracker_summary">"报告错误或请求新功能"</string> |     <string name="issue_tracker_summary">"报告错误或请求新功能"</string> | ||||||
|     <string name="warning_wrong_url">"警告"</string> |     <string name="warning_wrong_url">"警告"</string> | ||||||
|     <string name="pref_switch_card_view_title">"卡片视图"</string> |     <string name="pref_switch_card_view_title">"卡片视图"</string> | ||||||
|     <string name="cant_mark_favortie">"不能将文章标记为收藏"</string> |  | ||||||
|     <string name="cant_unmark_favortie">"无法从收藏中删除项目"</string> |  | ||||||
|     <string name="share">"共享"</string> |     <string name="share">"共享"</string> | ||||||
|     <string name="rating_prompt_title">"喜欢这个应用吗?"</string> |  | ||||||
|     <string name="rating_prompt_yes">"是的!"</string> |  | ||||||
|     <string name="rating_prompt_no">"不大喜欢…"</string> |  | ||||||
|     <string name="rating_prompt_feedback_title">"能告诉我们为什么吗?"</string> |  | ||||||
|     <string name="rating_prompt_feedback_yes">"好的!"</string> |  | ||||||
|     <string name="rating_prompt_feedback_no">"以后再说。"</string> |  | ||||||
|     <string name="rating_prompt_rating_title">"太好了!你能在应用商店给我们打分吗?"</string> |  | ||||||
|     <string name="rating_prompt_rating_yes">"当然!"</string> |  | ||||||
|     <string name="rating_prompt_rating_no">"现在不行。"</string> |  | ||||||
|     <string name="rating_prompt_thanks">"谢谢,您的反馈有助于改进应用程序!"</string> |  | ||||||
|     <string name="switch_unread_count">"将未读数在底部显示为一个徽标。"</string> |     <string name="switch_unread_count">"将未读数在底部显示为一个徽标。"</string> | ||||||
|     <string name="switch_unread_count_title">"显示未读数"</string> |     <string name="switch_unread_count_title">"显示未读数"</string> | ||||||
|     <string name="display_all_counts_title">"显示收藏和已读的计数"</string> |     <string name="display_all_counts_title">"显示收藏和已读的计数"</string> | ||||||
|     <string name="text_wrong_url">"您似乎试图使用无效的 URL。确保它是正确的,如果问题仍然存在,请与我联系 (通过商店的联系链接)。请注意,该应用程序需要您使用 Selfoss。没有它,您无法访问 RSS 源。"</string> |     <string name="text_wrong_url">"您似乎试图使用无效的 URL。确保它是正确的,如果问题仍然存在,请与我联系 (通过商店的联系链接)。请注意,该应用程序需要您使用 Selfoss。没有它,您无法访问 RSS 源。"</string> | ||||||
|     <string name="pref_general_internal_browser_title">"打开应用程序中的链接"</string> |     <string name="pref_article_viewer_title">"打开应用程序中的链接"</string> | ||||||
|     <string name="pref_general_internal_browser_on">"文章将在应用程序内打开"</string> |     <string name="pref_article_viewer_on">"文章将在应用程序内打开"</string> | ||||||
|     <string name="pref_general_internal_browser_off">"文章将使用默认浏览器打开"</string> |     <string name="pref_article_viewer_off">"文章将使用默认浏览器打开"</string> | ||||||
|     <string name="prefer_article_viewer_title">"使用文章查看器"</string> |  | ||||||
|     <string name="prefer_article_viewer_on">"将使用文章查看器而不是内部浏览器"</string> |  | ||||||
|     <string name="prefer_article_viewer_off">"将使用内部浏览器而不是文章查看器"</string> |  | ||||||
|     <string name="pref_general_category_links">"链接处理"</string> |     <string name="pref_general_category_links">"链接处理"</string> | ||||||
|     <string name="pref_general_category_displaying">"显示"</string> |     <string name="pref_general_category_displaying">"显示"</string> | ||||||
|     <string name="pref_switch_card_view_on">"这些文章将以卡片形式显示"</string> |     <string name="pref_switch_card_view_on">"这些文章将以卡片形式显示"</string> | ||||||
| @@ -83,58 +61,28 @@ | |||||||
|     <string name="card_height_on">卡片高度将根据内容调整</string> |     <string name="card_height_on">卡片高度将根据内容调整</string> | ||||||
|     <string name="card_height_off">卡片高度将被固定</string> |     <string name="card_height_off">卡片高度将被固定</string> | ||||||
|     <string name="source_code">源代码</string> |     <string name="source_code">源代码</string> | ||||||
|     <string name="cant_mark_read">无法将文章标记为已读</string> |     <string name="filter_item_tags">标签</string> | ||||||
|     <string name="cant_mark_unread">Can\'t mark article as unread</string> |     <string name="filter_item_sources">来源</string> | ||||||
|     <string name="drawer_error_loading_tags">加载标记时出错..。</string> |  | ||||||
|     <string name="drawer_error_loading_sources">加载源时出错..。</string> |  | ||||||
|     <string name="drawer_item_filters">搜索条件</string> |  | ||||||
|     <string name="drawer_action_clear">清空</string> |  | ||||||
|     <string name="drawer_item_tags">标签</string> |  | ||||||
|     <string name="drawer_item_sources">来源</string> |  | ||||||
|     <string name="drawer_action_edit">编辑</string> |  | ||||||
|     <string name="no_tags_loaded">未加载标签</string> |  | ||||||
|     <string name="no_sources_loaded">未加载数据源</string> |  | ||||||
|     <string name="drawer_loading">正在载入…</string> |  | ||||||
|     <string name="menu_home_search">搜索</string> |     <string name="menu_home_search">搜索</string> | ||||||
|     <string name="can_delete_source">无法删除数据源…</string> |     <string name="can_delete_source">无法删除数据源…</string> | ||||||
|     <string name="base_url_error">与您的 Selfoss 通信时出现问题。如果问题一直存在,请与我联系。</string> |     <string name="base_url_error">与您的 Selfoss 通信时出现问题。如果问题一直存在,请与我联系。</string> | ||||||
|     <string name="pref_header_theme">主题</string> |     <string name="pref_header_theme">主题</string> | ||||||
|     <string name="default_theme">默认</string> |  | ||||||
|     <string name="default_dark_theme">默认值/暗</string> |  | ||||||
|     <string name="pref_header_debug">调试</string> |  | ||||||
|     <string name="self_hosted_cert_switch">使用自托管证书?</string> |  | ||||||
|     <string name="self_signed_cert_warning">出于安全考虑, 默认情况下不支持自签名证书。如果激活此项, 您遇到的任何安全问题我将概不负责。</string> |  | ||||||
|     <string name="pref_selfoss_category">塞尔福斯 Api</string> |     <string name="pref_selfoss_category">塞尔福斯 Api</string> | ||||||
|     <string name="pref_api_items_number_title">已加载项目编号</string> |     <string name="pref_api_items_number_title">已加载项目编号</string> | ||||||
|     <string name="pref_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="summary_debug_identifier">除错标识符</string> |  | ||||||
|     <string name="unique_id_to_clipboard">复制到你的剪贴板的标识符</string> |  | ||||||
|     <string name="display_header_drawer_summary">在侧边栏中显示带有 Selfoss 链接地址的页眉。</string> |  | ||||||
|     <string name="display_header_drawer_title">帐户页眉</string> |  | ||||||
|     <string name="pref_general_infinite_loading_title">翻页时载入更多文章</string> |     <string name="pref_general_infinite_loading_title">翻页时载入更多文章</string> | ||||||
|     <string name="translation">翻译</string> |     <string name="translation">翻译</string> | ||||||
|     <string name="cant_open_invalid_url">项目链接地址无效。我正在设法解决这个问题,以避免应用程序崩溃。</string> |     <string name="cant_open_invalid_url">项目链接地址无效。我正在设法解决这个问题,以避免应用程序崩溃。</string> | ||||||
|     <string name="drawer_report_bug">报告错误</string> |  | ||||||
|     <string name="items_number_should_be_number">项目数应为整数。</string> |     <string name="items_number_should_be_number">项目数应为整数。</string> | ||||||
|     <string name="reader_action_more">阅读更多</string> |  | ||||||
|     <string name="reader_action_open">在浏览器中打开</string> |     <string name="reader_action_open">在浏览器中打开</string> | ||||||
|     <string name="reader_action_share">分享</string> |     <string name="reader_action_share">分享</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> |     <string name="pref_switch_actions_pager_scroll_on">Mark articles as read when swiping between articles.</string> | ||||||
|     <string name="add_to_favs_reader">Add to favorites</string> |     <string name="add_to_favs_reader">Add to favorites</string> | ||||||
|     <string name="remove_to_favs_reader">Remove from favorites</string> |  | ||||||
|     <string name="pref_content_reader_font_size">Article reader content font size</string> |     <string name="pref_content_reader_font_size">Article reader content font size</string> | ||||||
|     <string name="pref_header_viewer">Article viewer</string> |     <string name="pref_header_viewer">Article viewer</string> | ||||||
|     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> |     <string name="refresh_dialog_message">This will refresh your Selfoss instance.</string> | ||||||
|     <string name="markall_dialog_message">This will mark all the items as read.</string> |     <string name="markall_dialog_message">This will mark all the items as read.</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> |     <string name="pref_switch_actions_pager_scroll">Mark as read on swipe</string> | ||||||
|     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> |     <string name="pref_switch_actions_pager_scroll_off">Don\'t mark articles as read when swiping.</string> | ||||||
|     <string name="pref_acra_alwaysaccept">Automatically send crash reports</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_enabled">Will send crash reports automatically</string> |  | ||||||
|     <string name="pref_acra_alwaysaccept_disabled">Will ask everytime when sending crash reports.</string> |  | ||||||
|     <string name="pref_debug_crash_reports">Crash reports</string> |  | ||||||
|     <string name="pref_debug_debug_logs">Debug logging (these will be sent without a dialog)</string> |  | ||||||
|     <string name="acra_login">Enable logging</string> |  | ||||||
|     <string name="drawer_item_hidden_tags">Hidden Tags</string> |  | ||||||
|     <string name="unmark">Mark item as unread</string> |     <string name="unmark">Mark item as unread</string> | ||||||
|     <string name="pref_header_offline">Offline and cache</string> |     <string name="pref_header_offline">Offline and cache</string> | ||||||
|     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> |     <string name="pref_switch_items_caching_off">Articles won\'t be saved to the device memory, and the app won\'t be usable offline.</string> | ||||||
| @@ -142,7 +90,6 @@ | |||||||
|     <string name="pref_switch_items_caching">Save items for offline use</string> |     <string name="pref_switch_items_caching">Save items for offline use</string> | ||||||
|     <string name="pref_switch_update_sources">Check for new sources and tags</string> |     <string name="pref_switch_update_sources">Check for new sources and tags</string> | ||||||
|     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> |     <string name="pref_switch_update_sources_summary">Disable this if your server is receiving excessive amounts of database queries.</string> | ||||||
|     <string name="no_network_connectivity">Not connected !</string> |  | ||||||
|     <string name="network_connectivity_lost">"Network connection lost"</string> |     <string name="network_connectivity_lost">"Network connection lost"</string> | ||||||
|     <string name="network_connectivity_retrieved">"Network connection is now available"</string> |     <string name="network_connectivity_retrieved">"Network connection is now available"</string> | ||||||
|     <string name="pref_switch_periodic_refresh">Sync articles</string> |     <string name="pref_switch_periodic_refresh">Sync articles</string> | ||||||
| @@ -150,7 +97,7 @@ | |||||||
|     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> |     <string name="pref_switch_periodic_refresh_on">Articles will periodically be synced</string> | ||||||
|     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> |     <string name="pref_periodic_refresh_minutes_title"><![CDATA[Sync interval ( >= 15 minutes)]]></string> | ||||||
|     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> |     <string name="pref_switch_refresh_when_charging">Only refresh when phone is charging</string> | ||||||
|     <string name="loading_notification_title">Loading ...</string> |     <string name="loading_notification_title">Loading …</string> | ||||||
|     <string name="loading_notification_text">Selfoss is syncing your articles</string> |     <string name="loading_notification_text">Selfoss is syncing your articles</string> | ||||||
|     <string name="notification_channel_sync">Sync notification</string> |     <string name="notification_channel_sync">Sync notification</string> | ||||||
|     <string name="new_items_channel_sync">New items notification</string> |     <string name="new_items_channel_sync">New items notification</string> | ||||||
| @@ -169,4 +116,16 @@ | |||||||
|     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> |     <string name="reader_static_bar_on">The bottom bar will always be displayed</string> | ||||||
|     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> |     <string name="reader_static_bar_off">The bottom bar can be shown through the floating button</string> | ||||||
|     <string name="remove_source">Remove source</string> |     <string name="remove_source">Remove source</string> | ||||||
|  |     <string name="pref_theme_title">Light/Dark mode</string> | ||||||
|  |     <string name="mode_dark">Dark mode</string> | ||||||
|  |     <string name="mode_system">Follow the system setting</string> | ||||||
|  |     <string name="mode_light">Light mode</string> | ||||||
|  |     <string name="gdpr_dialog_title">The app does not share any personal data about you.</string> | ||||||
|  |     <string name="gdpr_dialog_message"><![CDATA[Crash reports sending is now enabled. It can be disabled from the settings page. Keep in mind that crash reports are essential for the app development.]]></string> | ||||||
|  |     <string name="crash_toast_text">A crash occured. Sending the details to the developper.</string> | ||||||
|  |     <string name="pref_switch_disable_acra">"Disable automatic bug reporting. "</string> | ||||||
|  |     <string name="menu_home_filter">Filters</string> | ||||||
|  |     <string name="application_selfoss_only">This app only works with a Selfoss instance, and no other RSS feed.</string> | ||||||
|  |     <string name="menu_home_sources">Sources</string> | ||||||
|  |     <string name="update_source">Update source</string> | ||||||
| </resources> | </resources> | ||||||
|   | |||||||
| @@ -2,5 +2,8 @@ | |||||||
| <resources> | <resources> | ||||||
|     <declare-styleable name="Theme"> |     <declare-styleable name="Theme"> | ||||||
|         <attr name="colorAccentDark" format="reference|color" /> |         <attr name="colorAccentDark" format="reference|color" /> | ||||||
|  |         <attr name="bottomBarBackground" format="reference|color" /> | ||||||
|  |         <attr name="toolbarPopupTheme" format="reference|color" /> | ||||||
|  |         <attr name="webviewBackground" format="reference|color" /> | ||||||
|     </declare-styleable> |     </declare-styleable> | ||||||
| </resources> | </resources> | ||||||
Some files were not shown because too many files have changed in this diff Show More
		Reference in New Issue
	
	Block a user